diff --git a/gcc/mpc/INSTALL b/gcc/mpc/INSTALL
index 5a2bcaf650..8865734f81 100644
--- a/gcc/mpc/INSTALL
+++ b/gcc/mpc/INSTALL
@@ -1,101 +1,368 @@
-Copyright (C) INRIA 2003, 2005, 2007, 2008, 2009, 2010, 2011, 2012
+Installation Instructions
+*************************
-Copying and distribution of this file, with or without modification,
+ Copyright (C) 1994-1996, 1999-2002, 2004-2016 Free Software
+Foundation, Inc.
+
+ Copying and distribution of this file, with or without modification,
are permitted in any medium without royalty provided the copyright
-notice and this notice are preserved. This file is offered as-is,
-without any warranty.
+notice and this notice are preserved. This file is offered as-is,
+without warranty of any kind.
+Basic Installation
+==================
- Installing GNU MPC
- ==================
+ Briefly, the shell command './configure && make && make install'
+should configure, build, and install this package. The following
+more-detailed instructions are generic; see the 'README' file for
+instructions specific to this package. Some packages provide this
+'INSTALL' file but do not implement all of the features documented
+below. The lack of an optional feature in a given package is not
+necessarily a bug. More recommendations for GNU packages can be found
+in *note Makefile Conventions: (standards)Makefile Conventions.
-This is for the impatient, for deeper explanations see the chapter
-"Installing GNU MPC" in the Texinfo documentation (type 'info mpc.info').
+ The 'configure' shell script attempts to guess correct values for
+various system-dependent variables used during compilation. It uses
+those values to create a 'Makefile' in each directory of the package.
+It may also create one or more '.h' files containing system-dependent
+definitions. Finally, it creates a shell script 'config.status' that
+you can run in the future to recreate the current configuration, and a
+file 'config.log' containing compiler output (useful mainly for
+debugging 'configure').
-0. You first need to install GMP, the GNU Multiprecision Arithmetic Library,
- see , and GNU MPFR, see .
- GNU MPC requires GMP version 5.0.0 or later
- and GNU MPFR version 3.0.0 or later.
+ It can also use an optional file (typically called 'config.cache' and
+enabled with '--cache-file=config.cache' or simply '-C') that saves the
+results of its tests to speed up reconfiguring. Caching is disabled by
+default to prevent problems with accidental use of stale cache files.
-1. In the directory of the GNU MPC archive, type
+ If you need to do unusual things to compile the package, please try
+to figure out how 'configure' could check whether to do them, and mail
+diffs or instructions to the address given in the 'README' so they can
+be considered for the next release. If you are using the cache, and at
+some point 'config.cache' contains results you don't want to keep, you
+may remove or edit it.
- tar xzf mpc-1.1.0.tar.gz
- cd mpc-1.1.0
- ./configure
- make
+ The file 'configure.ac' (or 'configure.in') is used to create
+'configure' by a program called 'autoconf'. You need 'configure.ac' if
+you want to change it or regenerate 'configure' using a newer version of
+'autoconf'.
- This assumes that GMP and GNU MPFR are installed in a directory searched
- by default by the compiler. Otherwise, use --with-gmp=DIR or
- --with-mpfr=DIR with ./configure (see the Texinfo documentation).
+ The simplest way to compile this package is:
-2. You should run the test suite, type
+ 1. 'cd' to the directory containing the package's source code and type
+ './configure' to configure the package for your system.
- make check
+ Running 'configure' might take a while. While running, it prints
+ some messages telling which features it is checking for.
- If any error occurs, please report it on the mailing list
- , or file a bug at the bug tracker
- .
+ 2. Type 'make' to compile the package.
-3. To install the GNU MPC library, type
+ 3. Optionally, type 'make check' to run any self-tests that come with
+ the package, generally using the just-built uninstalled binaries.
- make install
+ 4. Type 'make install' to install the programs and any data files and
+ documentation. When installing into a prefix owned by root, it is
+ recommended that the package be configured and built as a regular
+ user, and only the 'make install' phase executed with root
+ privileges.
- By default, the files are copied into subdirectories of /usr/local.
- You need write permissions on these directories, or pass an alternative
- installation directory using the --prefix option to ./configure.
+ 5. Optionally, type 'make installcheck' to repeat any self-tests, but
+ this time using the binaries in their final installed location.
+ This target does not install anything. Running this target as a
+ regular user, particularly if the prior 'make install' required
+ root privileges, verifies that the installation completed
+ correctly.
-4. You can optionally create documentation, type
+ 6. You can remove the program binaries and object files from the
+ source code directory by typing 'make clean'. To also remove the
+ files that 'configure' created (so you can compile the package for
+ a different kind of computer), type 'make distclean'. There is
+ also a 'make maintainer-clean' target, but that is intended mainly
+ for the package's developers. If you use it, you may have to get
+ all sorts of other programs in order to regenerate files that came
+ with the distribution.
- make dvi
+ 7. Often, you can also type 'make uninstall' to remove the installed
+ files again. In practice, not all packages have tested that
+ uninstallation works correctly, even though it is required by the
+ GNU Coding Standards.
- or
+ 8. Some packages, particularly those that use Automake, provide 'make
+ distcheck', which can by used by developers to test that all other
+ targets like 'make install' and 'make uninstall' work correctly.
+ This target is generally not run by end users.
- make ps
+Compilers and Options
+=====================
- This requires the Texinfo package (version 4.2 at least).
+ Some systems require unusual options for compilation or linking that
+the 'configure' script does not know about. Run './configure --help'
+for details on some of the pertinent environment variables.
-In case of difficulties, please send a description of the problem to
-.
+ You can give 'configure' initial values for configuration parameters
+by setting variables in the command line or in the environment. Here is
+an example:
-##############################################################################
+ ./configure CC=c99 CFLAGS=-g LIBS=-lposix
-Note for AIX users:
-===================
+ *Note Defining Variables::, for more details.
-If GMP was built with the 64-bit ABI, before building and testing GNU MPC,
-it might be necessary to set the OBJECT_MODE environment variable to 64
-by, e.g.,
- export OBJECT_MODE=64
-This has been tested with the C compiler IBM XL C/C++ Enterprise Edition
-V8.0 for AIX, version: 08.00.0000.0021, GMP 4.2.4 and GNU MPFR 2.4.1.
+Compiling For Multiple Architectures
+====================================
-##############################################################################
+ You can compile the package for more than one kind of computer at the
+same time, by placing the object files for each architecture in their
+own directory. To do this, you can use GNU 'make'. 'cd' to the
+directory where you want the object files and executables to go and run
+the 'configure' script. 'configure' automatically checks for the source
+code in the directory that 'configure' is in and in '..'. This is known
+as a "VPATH" build.
-Note for Windows users:
-=======================
+ With a non-GNU 'make', it is safer to compile the package for one
+architecture at a time in the source code directory. After you have
+installed the package for one architecture, use 'make distclean' before
+reconfiguring for another architecture.
-There is a special file Makefile.vc for Windows, contributed by Mickaël
-Gastineau. This file works both for the Windows Server 2003 R2 Platform SDK,
-and for the Windows SDK of Vista. To use it, simply replace "make" by
-"nmake /f makefile.vc" in the above instructions:
+ On MacOS X 10.5 and later systems, you can create libraries and
+executables that work on multiple system types--known as "fat" or
+"universal" binaries--by specifying multiple '-arch' options to the
+compiler but only a single '-arch' option to the preprocessor. Like
+this:
-compilation :
-nmake /f makefile.vc GMP= MPFR=
+ ./configure CC="gcc -arch i386 -arch x86_64 -arch ppc -arch ppc64" \
+ CXX="g++ -arch i386 -arch x86_64 -arch ppc -arch ppc64" \
+ CPP="gcc -E" CXXCPP="g++ -E"
-clean :
-nmake /f makefile.vc GMP= MPFR= clean
+ This is not guaranteed to produce working output in all cases, you
+may have to build one architecture at a time and combine the results
+using the 'lipo' tool if you have problems.
-check :
-nmake /f makefile.vc GMP= MPFR= check
+Installation Names
+==================
-If you want to compile mpc with mingw in the msys shell, you might need to
-add the following to the configure command (or in your environment):
+ By default, 'make install' installs the package's commands under
+'/usr/local/bin', include files under '/usr/local/include', etc. You
+can specify an installation prefix other than '/usr/local' by giving
+'configure' the option '--prefix=PREFIX', where PREFIX must be an
+absolute file name.
-LDFLAGS=-L/usr/local/lib CPPFLAGS=-I/usr/local/include
+ You can specify separate installation prefixes for
+architecture-specific files and architecture-independent files. If you
+pass the option '--exec-prefix=PREFIX' to 'configure', the package uses
+PREFIX as the prefix for installing programs and libraries.
+Documentation and other data files still use the regular prefix.
-In addition, you might need to give the following additional argument to
-configure (reported for mpc-0.9):
+ In addition, if you use an unusual directory layout you can give
+options like '--bindir=DIR' to specify different values for particular
+kinds of files. Run 'configure --help' for a list of the directories
+you can set and what kinds of files go in them. In general, the default
+for these options is expressed in terms of '${prefix}', so that
+specifying just '--prefix' will affect all of the other directory
+specifications that were not explicitly provided.
-CPP="x86_64-w64-mingw32-gcc -E"
+ The most portable way to affect installation locations is to pass the
+correct locations to 'configure'; however, many packages provide one or
+both of the following shortcuts of passing variable assignments to the
+'make install' command line to change installation locations without
+having to reconfigure or recompile.
-(reported by Sisyphus)
+ The first method involves providing an override variable for each
+affected directory. For example, 'make install
+prefix=/alternate/directory' will choose an alternate location for all
+directory configuration variables that were expressed in terms of
+'${prefix}'. Any directories that were specified during 'configure',
+but not in terms of '${prefix}', must each be overridden at install time
+for the entire installation to be relocated. The approach of makefile
+variable overrides for each directory variable is required by the GNU
+Coding Standards, and ideally causes no recompilation. However, some
+platforms have known limitations with the semantics of shared libraries
+that end up requiring recompilation when using this method, particularly
+noticeable in packages that use GNU Libtool.
+
+ The second method involves providing the 'DESTDIR' variable. For
+example, 'make install DESTDIR=/alternate/directory' will prepend
+'/alternate/directory' before all installation names. The approach of
+'DESTDIR' overrides is not required by the GNU Coding Standards, and
+does not work on platforms that have drive letters. On the other hand,
+it does better at avoiding recompilation issues, and works well even
+when some directory options were not specified in terms of '${prefix}'
+at 'configure' time.
+
+Optional Features
+=================
+
+ If the package supports it, you can cause programs to be installed
+with an extra prefix or suffix on their names by giving 'configure' the
+option '--program-prefix=PREFIX' or '--program-suffix=SUFFIX'.
+
+ Some packages pay attention to '--enable-FEATURE' options to
+'configure', where FEATURE indicates an optional part of the package.
+They may also pay attention to '--with-PACKAGE' options, where PACKAGE
+is something like 'gnu-as' or 'x' (for the X Window System). The
+'README' should mention any '--enable-' and '--with-' options that the
+package recognizes.
+
+ For packages that use the X Window System, 'configure' can usually
+find the X include and library files automatically, but if it doesn't,
+you can use the 'configure' options '--x-includes=DIR' and
+'--x-libraries=DIR' to specify their locations.
+
+ Some packages offer the ability to configure how verbose the
+execution of 'make' will be. For these packages, running './configure
+--enable-silent-rules' sets the default to minimal output, which can be
+overridden with 'make V=1'; while running './configure
+--disable-silent-rules' sets the default to verbose, which can be
+overridden with 'make V=0'.
+
+Particular systems
+==================
+
+ On HP-UX, the default C compiler is not ANSI C compatible. If GNU CC
+is not installed, it is recommended to use the following options in
+order to use an ANSI C compiler:
+
+ ./configure CC="cc -Ae -D_XOPEN_SOURCE=500"
+
+and if that doesn't work, install pre-built binaries of GCC for HP-UX.
+
+ HP-UX 'make' updates targets which have the same time stamps as their
+prerequisites, which makes it generally unusable when shipped generated
+files such as 'configure' are involved. Use GNU 'make' instead.
+
+ On OSF/1 a.k.a. Tru64, some versions of the default C compiler cannot
+parse its '' header file. The option '-nodtk' can be used as a
+workaround. If GNU CC is not installed, it is therefore recommended to
+try
+
+ ./configure CC="cc"
+
+and if that doesn't work, try
+
+ ./configure CC="cc -nodtk"
+
+ On Solaris, don't put '/usr/ucb' early in your 'PATH'. This
+directory contains several dysfunctional programs; working variants of
+these programs are available in '/usr/bin'. So, if you need '/usr/ucb'
+in your 'PATH', put it _after_ '/usr/bin'.
+
+ On Haiku, software installed for all users goes in '/boot/common',
+not '/usr/local'. It is recommended to use the following options:
+
+ ./configure --prefix=/boot/common
+
+Specifying the System Type
+==========================
+
+ There may be some features 'configure' cannot figure out
+automatically, but needs to determine by the type of machine the package
+will run on. Usually, assuming the package is built to be run on the
+_same_ architectures, 'configure' can figure that out, but if it prints
+a message saying it cannot guess the machine type, give it the
+'--build=TYPE' option. TYPE can either be a short name for the system
+type, such as 'sun4', or a canonical name which has the form:
+
+ CPU-COMPANY-SYSTEM
+
+where SYSTEM can have one of these forms:
+
+ OS
+ KERNEL-OS
+
+ See the file 'config.sub' for the possible values of each field. If
+'config.sub' isn't included in this package, then this package doesn't
+need to know the machine type.
+
+ If you are _building_ compiler tools for cross-compiling, you should
+use the option '--target=TYPE' to select the type of system they will
+produce code for.
+
+ If you want to _use_ a cross compiler, that generates code for a
+platform different from the build platform, you should specify the
+"host" platform (i.e., that on which the generated programs will
+eventually be run) with '--host=TYPE'.
+
+Sharing Defaults
+================
+
+ If you want to set default values for 'configure' scripts to share,
+you can create a site shell script called 'config.site' that gives
+default values for variables like 'CC', 'cache_file', and 'prefix'.
+'configure' looks for 'PREFIX/share/config.site' if it exists, then
+'PREFIX/etc/config.site' if it exists. Or, you can set the
+'CONFIG_SITE' environment variable to the location of the site script.
+A warning: not all 'configure' scripts look for a site script.
+
+Defining Variables
+==================
+
+ Variables not defined in a site shell script can be set in the
+environment passed to 'configure'. However, some packages may run
+configure again during the build, and the customized values of these
+variables may be lost. In order to avoid this problem, you should set
+them in the 'configure' command line, using 'VAR=value'. For example:
+
+ ./configure CC=/usr/local2/bin/gcc
+
+causes the specified 'gcc' to be used as the C compiler (unless it is
+overridden in the site shell script).
+
+Unfortunately, this technique does not work for 'CONFIG_SHELL' due to an
+Autoconf limitation. Until the limitation is lifted, you can use this
+workaround:
+
+ CONFIG_SHELL=/bin/bash ./configure CONFIG_SHELL=/bin/bash
+
+'configure' Invocation
+======================
+
+ 'configure' recognizes the following options to control how it
+operates.
+
+'--help'
+'-h'
+ Print a summary of all of the options to 'configure', and exit.
+
+'--help=short'
+'--help=recursive'
+ Print a summary of the options unique to this package's
+ 'configure', and exit. The 'short' variant lists options used only
+ in the top level, while the 'recursive' variant lists options also
+ present in any nested packages.
+
+'--version'
+'-V'
+ Print the version of Autoconf used to generate the 'configure'
+ script, and exit.
+
+'--cache-file=FILE'
+ Enable the cache: use and save the results of the tests in FILE,
+ traditionally 'config.cache'. FILE defaults to '/dev/null' to
+ disable caching.
+
+'--config-cache'
+'-C'
+ Alias for '--cache-file=config.cache'.
+
+'--quiet'
+'--silent'
+'-q'
+ Do not print messages saying which checks are being made. To
+ suppress all normal output, redirect it to '/dev/null' (any error
+ messages will still be shown).
+
+'--srcdir=DIR'
+ Look for the package's source code in directory DIR. Usually
+ 'configure' can determine that directory automatically.
+
+'--prefix=DIR'
+ Use DIR as the installation prefix. *note Installation Names:: for
+ more details, including other options available for fine-tuning the
+ installation locations.
+
+'--no-create'
+'-n'
+ Run the configure checks, but stop before creating any output
+ files.
+
+'configure' also accepts some other, not widely useful, options. Run
+'configure --help' for more details.
diff --git a/gcc/mpc/Makefile.am b/gcc/mpc/Makefile.am
index a286ce7ba0..be2ade6bf3 100644
--- a/gcc/mpc/Makefile.am
+++ b/gcc/mpc/Makefile.am
@@ -1,6 +1,6 @@
## Makefile.am -- Process this file with automake to produce Makefile.in
##
-## Copyright (C) 2008, 2010, 2011, 2012, 2013, 2014 INRIA
+## Copyright (C) 2008, 2010, 2011, 2012, 2013, 2014, 2020 INRIA
##
## This file is part of GNU MPC.
##
@@ -32,3 +32,6 @@ EXTRA_DIST = doc/fdl-1.3.texi src/mpc-log.h Makefile.vc
bench :
cd tools/bench && $(MAKE) $(AM_MAKEFLAGS) bench
+mpcheck :
+ cd tools/mpcheck && $(MAKE) $(AM_MAKEFLAGS) mpcheck
+
diff --git a/gcc/mpc/Makefile.in b/gcc/mpc/Makefile.in
index 1499176e60..e883e029fc 100644
--- a/gcc/mpc/Makefile.in
+++ b/gcc/mpc/Makefile.in
@@ -1,7 +1,7 @@
-# Makefile.in generated by automake 1.15.1 from Makefile.am.
+# Makefile.in generated by automake 1.16.2 from Makefile.am.
# @configure_input@
-# Copyright (C) 1994-2017 Free Software Foundation, Inc.
+# Copyright (C) 1994-2020 Free Software Foundation, Inc.
# This Makefile.in is free software; the Free Software Foundation
# gives unlimited permission to copy and/or distribute it,
@@ -170,9 +170,9 @@ am__recursive_targets = \
$(RECURSIVE_CLEAN_TARGETS) \
$(am__extra_recursive_targets)
AM_RECURSIVE_TARGETS = $(am__recursive_targets:-recursive=) TAGS CTAGS \
- cscope distdir dist dist-all distcheck
-am__tagged_files = $(HEADERS) $(SOURCES) $(TAGS_FILES) \
- $(LISP)config.h.in
+ cscope distdir distdir-am dist dist-all distcheck
+am__tagged_files = $(HEADERS) $(SOURCES) $(TAGS_FILES) $(LISP) \
+ config.h.in
# Read a list of newline-separated strings from the standard input,
# and print each of them once, without duplicates. Input order is
# *not* preserved.
@@ -193,10 +193,17 @@ ETAGS = etags
CTAGS = ctags
CSCOPE = cscope
DIST_SUBDIRS = $(SUBDIRS)
-am__DIST_COMMON = $(srcdir)/Makefile.in $(srcdir)/config.h.in AUTHORS \
- COPYING.LESSER ChangeLog INSTALL NEWS README TODO ar-lib \
- compile config.guess config.sub depcomp install-sh ltmain.sh \
- missing
+am__DIST_COMMON = $(srcdir)/Makefile.in $(srcdir)/config.h.in \
+ $(top_srcdir)/build-aux/ar-lib $(top_srcdir)/build-aux/compile \
+ $(top_srcdir)/build-aux/config.guess \
+ $(top_srcdir)/build-aux/config.sub \
+ $(top_srcdir)/build-aux/install-sh \
+ $(top_srcdir)/build-aux/ltmain.sh \
+ $(top_srcdir)/build-aux/missing AUTHORS COPYING.LESSER \
+ ChangeLog INSTALL NEWS README TODO build-aux/ar-lib \
+ build-aux/compile build-aux/config.guess build-aux/config.sub \
+ build-aux/install-sh build-aux/ltmain.sh build-aux/mdate-sh \
+ build-aux/missing build-aux/texinfo.tex
DISTFILES = $(DIST_COMMON) $(DIST_SOURCES) $(TEXINFOS) $(EXTRA_DIST)
distdir = $(PACKAGE)-$(VERSION)
top_distdir = $(distdir)
@@ -396,8 +403,8 @@ Makefile: $(srcdir)/Makefile.in $(top_builddir)/config.status
echo ' $(SHELL) ./config.status'; \
$(SHELL) ./config.status;; \
*) \
- echo ' cd $(top_builddir) && $(SHELL) ./config.status $@ $(am__depfiles_maybe)'; \
- cd $(top_builddir) && $(SHELL) ./config.status $@ $(am__depfiles_maybe);; \
+ echo ' cd $(top_builddir) && $(SHELL) ./config.status $@ $(am__maybe_remake_depfiles)'; \
+ cd $(top_builddir) && $(SHELL) ./config.status $@ $(am__maybe_remake_depfiles);; \
esac;
$(top_builddir)/config.status: $(top_srcdir)/configure $(CONFIG_STATUS_DEPENDENCIES)
@@ -560,7 +567,10 @@ distclean-tags:
-rm -f TAGS ID GTAGS GRTAGS GSYMS GPATH tags
-rm -f cscope.out cscope.in.out cscope.po.out cscope.files
-distdir: $(DISTFILES)
+distdir: $(BUILT_SOURCES)
+ $(MAKE) $(AM_MAKEFLAGS) distdir-am
+
+distdir-am: $(DISTFILES)
$(am__remove_distdir)
test -d "$(distdir)" || mkdir "$(distdir)"
@srcdirstrip=`echo "$(srcdir)" | sed 's/[].[^$$\\*]/\\\\&/g'`; \
@@ -640,6 +650,10 @@ dist-xz: distdir
tardir=$(distdir) && $(am__tar) | XZ_OPT=$${XZ_OPT--e} xz -c >$(distdir).tar.xz
$(am__post_remove_distdir)
+dist-zstd: distdir
+ tardir=$(distdir) && $(am__tar) | zstd -c $${ZSTD_CLEVEL-$${ZSTD_OPT--19}} >$(distdir).tar.zst
+ $(am__post_remove_distdir)
+
dist-tarZ: distdir
@echo WARNING: "Support for distribution archives compressed with" \
"legacy program 'compress' is deprecated." >&2
@@ -682,6 +696,8 @@ distcheck: dist
eval GZIP= gzip $(GZIP_ENV) -dc $(distdir).shar.gz | unshar ;;\
*.zip*) \
unzip $(distdir).zip ;;\
+ *.tar.zst*) \
+ zstd -dc $(distdir).tar.zst | $(am__untar) ;;\
esac
chmod -R a-w $(distdir)
chmod u+w $(distdir)
@@ -862,18 +878,19 @@ uninstall-am: uninstall-includeHEADERS
am--refresh check check-am clean clean-cscope clean-generic \
clean-libtool cscope cscopelist-am ctags ctags-am dist \
dist-all dist-bzip2 dist-gzip dist-lzip dist-shar dist-tarZ \
- dist-xz dist-zip distcheck distclean distclean-generic \
- distclean-hdr distclean-libtool distclean-tags distcleancheck \
- distdir distuninstallcheck dvi dvi-am html html-am info \
- info-am install install-am install-data install-data-am \
- install-dvi install-dvi-am install-exec install-exec-am \
- install-html install-html-am install-includeHEADERS \
- install-info install-info-am install-man install-pdf \
- install-pdf-am install-ps install-ps-am install-strip \
- installcheck installcheck-am installdirs installdirs-am \
- maintainer-clean maintainer-clean-generic mostlyclean \
- mostlyclean-generic mostlyclean-libtool pdf pdf-am ps ps-am \
- tags tags-am uninstall uninstall-am uninstall-includeHEADERS
+ dist-xz dist-zip dist-zstd distcheck distclean \
+ distclean-generic distclean-hdr distclean-libtool \
+ distclean-tags distcleancheck distdir distuninstallcheck dvi \
+ dvi-am html html-am info info-am install install-am \
+ install-data install-data-am install-dvi install-dvi-am \
+ install-exec install-exec-am install-html install-html-am \
+ install-includeHEADERS install-info install-info-am \
+ install-man install-pdf install-pdf-am install-ps \
+ install-ps-am install-strip installcheck installcheck-am \
+ installdirs installdirs-am maintainer-clean \
+ maintainer-clean-generic mostlyclean mostlyclean-generic \
+ mostlyclean-libtool pdf pdf-am ps ps-am tags tags-am uninstall \
+ uninstall-am uninstall-includeHEADERS
.PRECIOUS: Makefile
@@ -881,6 +898,9 @@ uninstall-am: uninstall-includeHEADERS
bench :
cd tools/bench && $(MAKE) $(AM_MAKEFLAGS) bench
+mpcheck :
+ cd tools/mpcheck && $(MAKE) $(AM_MAKEFLAGS) mpcheck
+
# Tell versions [3.59,3.63) of GNU make to not export all variables.
# Otherwise a system limit (for SysV at least) may be exceeded.
.NOEXPORT:
diff --git a/gcc/mpc/Makefile.vc b/gcc/mpc/Makefile.vc
index 7c76ab804f..ddf1665993 100644
--- a/gcc/mpc/Makefile.vc
+++ b/gcc/mpc/Makefile.vc
@@ -1,6 +1,6 @@
# Makefile for the MPC library (Windows version).
#
-# Copyright (C) INRIA - CNRS, 2002, 2004, 2005, 2007, 2008, 2009, 2010, 2011, 2012, 2013, 2016, 2017
+# Copyright (C) INRIA - CNRS, 2002, 2004, 2005, 2007, 2008, 2009, 2010, 2011, 2012, 2013, 2016, 2017, 2018, 2020
#
# This file is part of the MPC Library.
#
@@ -50,7 +50,7 @@ CPP = cl.exe
CC = cl.exe
CDEFAULTFLAGS=/O2 /GR- /MD /nologo /EHs
-VERSION=1.1.0
+VERSION=1.2.0
######################## do not edit below this line ##########################
diff --git a/gcc/mpc/NEWS b/gcc/mpc/NEWS
index 2fa0ad9b3e..0107c8510f 100644
--- a/gcc/mpc/NEWS
+++ b/gcc/mpc/NEWS
@@ -1,3 +1,10 @@
+Changes in version 1.2.0:
+ - Minimally required library version: MPFR 4.1.0
+ - New functions: mpc_sum, mpc_dot
+ - Several functions are more robust with a reduced exponent range
+ (for example corresponding to IEEE 754 binary formats)
+ - New tool mpcheck.
+
Changes in version 1.1.0:
- Minimally required library versions: GMP 5.0.0 and MPFR 3.0.0
- Fixed issues with MPFR 4.0.0
diff --git a/gcc/mpc/README b/gcc/mpc/README
index 55369dbd0f..f850ef7efb 100644
--- a/gcc/mpc/README
+++ b/gcc/mpc/README
@@ -1,4 +1,4 @@
-Copyright (C) INRIA 2003, 2005, 2008, 2009, 2011
+Copyright (C) INRIA 2003, 2005, 2007, 2008, 2009, 2010, 2011, 2012, 2014, 2015, 2018, 2020
Copying and distribution of this file, with or without modification,
are permitted in any medium without royalty provided the copyright
@@ -9,3 +9,107 @@ without any warranty.
GNU MPC is a complex floating-point library with exact rounding.
It is based on the GNU MPFR floating-point library (http://www.mpfr.org/),
which is itself based on the GNU MP library (http://gmplib.org/).
+
+
+ Installing GNU MPC
+ ==================
+
+This is for the impatient, for deeper explanations see the chapter
+"Installing GNU MPC" in the Texinfo documentation (type 'info mpc.info').
+
+0. You first need to install GMP, the GNU Multiprecision Arithmetic Library,
+ see , and GNU MPFR, see .
+ GNU MPC requires GMP version 5.0.0 or later
+ and GNU MPFR version 4.1.0 or later.
+
+1. In the directory of the GNU MPC archive, type
+
+ tar xzf mpc-1.2.0.tar.gz
+ cd mpc-1.2.0
+ ./configure
+ make
+
+ This assumes that GMP and GNU MPFR are installed in a directory searched
+ by default by the compiler. Otherwise, use --with-gmp=DIR or
+ --with-mpfr=DIR with ./configure (see the Texinfo documentation).
+
+2. You should run the test suite, type
+
+ make check
+
+ If any error occurs, please report it on the mailing list
+ , or file a bug at the bug tracker
+ .
+
+3. To install the GNU MPC library, type
+
+ make install
+
+ By default, the files are copied into subdirectories of /usr/local.
+ You need write permissions on these directories, or pass an alternative
+ installation directory using the --prefix option to ./configure.
+
+4. You can optionally create documentation, type
+
+ make dvi
+
+ or
+
+ make ps
+
+ This requires the Texinfo package (version 4.2 at least).
+
+In case of difficulties, please send a description of the problem to
+.
+
+##############################################################################
+
+Known problems:
+===============
+
+When LD_LIBRARY_PATH is set to various paths, it might confuse the configure
+script, even with --with-gmp and --with-mpfr options. Then try to unset
+LD_LIBRARY_PATH.
+
+##############################################################################
+
+Note for AIX users:
+===================
+
+If GMP was built with the 64-bit ABI, before building and testing GNU MPC,
+it might be necessary to set the OBJECT_MODE environment variable to 64
+by, e.g.,
+ export OBJECT_MODE=64
+This has been tested with the C compiler IBM XL C/C++ Enterprise Edition
+V8.0 for AIX, version: 08.00.0000.0021, GMP 4.2.4 and GNU MPFR 2.4.1.
+
+##############################################################################
+
+Note for Windows users:
+=======================
+
+There is a special file Makefile.vc for Windows, contributed by Mickaël
+Gastineau. This file works both for the Windows Server 2003 R2 Platform SDK,
+and for the Windows SDK of Vista. To use it, simply replace "make" by
+"nmake /f makefile.vc" in the above instructions:
+
+compilation :
+nmake /f makefile.vc GMP= MPFR=
+
+clean :
+nmake /f makefile.vc GMP= MPFR= clean
+
+check :
+nmake /f makefile.vc GMP= MPFR= check
+
+If you want to compile mpc with mingw in the msys shell, you might need to
+add the following to the configure command (or in your environment):
+
+LDFLAGS=-L/usr/local/lib CPPFLAGS=-I/usr/local/include
+
+In addition, you might need to give the following additional argument to
+configure (reported for mpc-0.9):
+
+CPP="x86_64-w64-mingw32-gcc -E"
+
+(reported by Sisyphus)
diff --git a/gcc/mpc/TODO b/gcc/mpc/TODO
index 26248932ec..6ce93a668c 100644
--- a/gcc/mpc/TODO
+++ b/gcc/mpc/TODO
@@ -25,9 +25,6 @@ implement mul_karatsuba with three multiplications at precision around p,
instead of two at precision 2*p and one at precision p
requires analysis of error propagation
-From Andreas Enge 05 July 2012:
-Add support for rounding mode MPFR_RNDA.
-
From Andreas Enge and Paul Zimmermann 6 July 2012:
Improve speed of Im (atan) for x+i*y with small y, for instance by using
the Taylor series directly. See also the discussion
@@ -74,13 +71,12 @@ New functions to implement:
- from Joseph S. Myers 19 Mar 2012: mpc_erf,
mpc_erfc, mpc_exp2, mpc_expm1, mpc_log1p, mpc_log2, mpc_lgamma, mpc_tgamma
http://lists.gforge.inria.fr/pipermail/mpc-discuss/2012-March/001090.html
+ See the article by Pascal Molin (hal.archives-ouvertes.fr/hal-00580855).
- from Andreas Enge and Philippe Théveny 17 July 2008
agm (and complex logarithm with agm ?). For the error analysis, one can
start from Theorem 1 of http://www.lix.polytechnique.fr/Labo/Regis.Dupont/preprints/Dupont_FastEvalMod.ps.gz, and probably the best is to compute AGM(a,b)
as a*AGM(1,b/a) with |b/a| <= 1. In such a way, after one step all values
are in the same quadrant, and no cancellation occurs any more.
-- from Andreas Enge 25 June 2009:
- correctly rounded roots of unity zeta_n^i
- implement a root-finding algorithm using the Durand-Kerner method
(cf http://en.wikipedia.org/wiki/Durand%E2%80%93Kerner_method).
See also the CEVAL algorithm from Yap and Sagraloff:
diff --git a/gcc/mpc/aclocal.m4 b/gcc/mpc/aclocal.m4
index b3e368d047..03ada2621e 100644
--- a/gcc/mpc/aclocal.m4
+++ b/gcc/mpc/aclocal.m4
@@ -1,6 +1,6 @@
-# generated automatically by aclocal 1.15.1 -*- Autoconf -*-
+# generated automatically by aclocal 1.16.2 -*- Autoconf -*-
-# Copyright (C) 1996-2017 Free Software Foundation, Inc.
+# Copyright (C) 1996-2020 Free Software Foundation, Inc.
# This file is free software; the Free Software Foundation
# gives unlimited permission to copy and/or distribute it,
@@ -20,7 +20,7 @@ You have another version of autoconf. It may work, but is not guaranteed to.
If you have problems, you may need to regenerate the build system entirely.
To do so, use the procedure documented by the package, typically 'autoreconf'.])])
-# Copyright (C) 2002-2017 Free Software Foundation, Inc.
+# Copyright (C) 2002-2020 Free Software Foundation, Inc.
#
# This file is free software; the Free Software Foundation
# gives unlimited permission to copy and/or distribute it,
@@ -32,10 +32,10 @@ To do so, use the procedure documented by the package, typically 'autoreconf'.])
# generated from the m4 files accompanying Automake X.Y.
# (This private macro should not be called outside this file.)
AC_DEFUN([AM_AUTOMAKE_VERSION],
-[am__api_version='1.15'
+[am__api_version='1.16'
dnl Some users find AM_AUTOMAKE_VERSION and mistake it for a way to
dnl require some minimum version. Point them to the right macro.
-m4_if([$1], [1.15.1], [],
+m4_if([$1], [1.16.2], [],
[AC_FATAL([Do not call $0, use AM_INIT_AUTOMAKE([$1]).])])dnl
])
@@ -51,12 +51,12 @@ m4_define([_AM_AUTOCONF_VERSION], [])
# Call AM_AUTOMAKE_VERSION and AM_AUTOMAKE_VERSION so they can be traced.
# This function is AC_REQUIREd by AM_INIT_AUTOMAKE.
AC_DEFUN([AM_SET_CURRENT_AUTOMAKE_VERSION],
-[AM_AUTOMAKE_VERSION([1.15.1])dnl
+[AM_AUTOMAKE_VERSION([1.16.2])dnl
m4_ifndef([AC_AUTOCONF_VERSION],
[m4_copy([m4_PACKAGE_VERSION], [AC_AUTOCONF_VERSION])])dnl
_AM_AUTOCONF_VERSION(m4_defn([AC_AUTOCONF_VERSION]))])
-# Copyright (C) 2011-2017 Free Software Foundation, Inc.
+# Copyright (C) 2011-2020 Free Software Foundation, Inc.
#
# This file is free software; the Free Software Foundation
# gives unlimited permission to copy and/or distribute it,
@@ -118,7 +118,7 @@ AC_SUBST([AR])dnl
# AM_AUX_DIR_EXPAND -*- Autoconf -*-
-# Copyright (C) 2001-2017 Free Software Foundation, Inc.
+# Copyright (C) 2001-2020 Free Software Foundation, Inc.
#
# This file is free software; the Free Software Foundation
# gives unlimited permission to copy and/or distribute it,
@@ -170,7 +170,7 @@ am_aux_dir=`cd "$ac_aux_dir" && pwd`
# AM_CONDITIONAL -*- Autoconf -*-
-# Copyright (C) 1997-2017 Free Software Foundation, Inc.
+# Copyright (C) 1997-2020 Free Software Foundation, Inc.
#
# This file is free software; the Free Software Foundation
# gives unlimited permission to copy and/or distribute it,
@@ -201,7 +201,7 @@ AC_CONFIG_COMMANDS_PRE(
Usually this means the macro was only invoked conditionally.]])
fi])])
-# Copyright (C) 1999-2017 Free Software Foundation, Inc.
+# Copyright (C) 1999-2020 Free Software Foundation, Inc.
#
# This file is free software; the Free Software Foundation
# gives unlimited permission to copy and/or distribute it,
@@ -392,13 +392,12 @@ _AM_SUBST_NOTMAKE([am__nodep])dnl
# Generate code to set up dependency tracking. -*- Autoconf -*-
-# Copyright (C) 1999-2017 Free Software Foundation, Inc.
+# Copyright (C) 1999-2020 Free Software Foundation, Inc.
#
# This file is free software; the Free Software Foundation
# gives unlimited permission to copy and/or distribute it,
# with or without modifications, as long as this notice is preserved.
-
# _AM_OUTPUT_DEPENDENCY_COMMANDS
# ------------------------------
AC_DEFUN([_AM_OUTPUT_DEPENDENCY_COMMANDS],
@@ -406,49 +405,43 @@ AC_DEFUN([_AM_OUTPUT_DEPENDENCY_COMMANDS],
# Older Autoconf quotes --file arguments for eval, but not when files
# are listed without --file. Let's play safe and only enable the eval
# if we detect the quoting.
- case $CONFIG_FILES in
- *\'*) eval set x "$CONFIG_FILES" ;;
- *) set x $CONFIG_FILES ;;
- esac
+ # TODO: see whether this extra hack can be removed once we start
+ # requiring Autoconf 2.70 or later.
+ AS_CASE([$CONFIG_FILES],
+ [*\'*], [eval set x "$CONFIG_FILES"],
+ [*], [set x $CONFIG_FILES])
shift
- for mf
+ # Used to flag and report bootstrapping failures.
+ am_rc=0
+ for am_mf
do
# Strip MF so we end up with the name of the file.
- mf=`echo "$mf" | sed -e 's/:.*$//'`
- # Check whether this is an Automake generated Makefile or not.
- # We used to match only the files named 'Makefile.in', but
- # some people rename them; so instead we look at the file content.
- # Grep'ing the first line is not enough: some people post-process
- # each Makefile.in and add a new line on top of each file to say so.
- # Grep'ing the whole file is not good either: AIX grep has a line
+ am_mf=`AS_ECHO(["$am_mf"]) | sed -e 's/:.*$//'`
+ # Check whether this is an Automake generated Makefile which includes
+ # dependency-tracking related rules and includes.
+ # Grep'ing the whole file directly is not great: AIX grep has a line
# limit of 2048, but all sed's we know have understand at least 4000.
- if sed -n 's,^#.*generated by automake.*,X,p' "$mf" | grep X >/dev/null 2>&1; then
- dirpart=`AS_DIRNAME("$mf")`
- else
- continue
- fi
- # Extract the definition of DEPDIR, am__include, and am__quote
- # from the Makefile without running 'make'.
- DEPDIR=`sed -n 's/^DEPDIR = //p' < "$mf"`
- test -z "$DEPDIR" && continue
- am__include=`sed -n 's/^am__include = //p' < "$mf"`
- test -z "$am__include" && continue
- am__quote=`sed -n 's/^am__quote = //p' < "$mf"`
- # Find all dependency output files, they are included files with
- # $(DEPDIR) in their names. We invoke sed twice because it is the
- # simplest approach to changing $(DEPDIR) to its actual value in the
- # expansion.
- for file in `sed -n "
- s/^$am__include $am__quote\(.*(DEPDIR).*\)$am__quote"'$/\1/p' <"$mf" | \
- sed -e 's/\$(DEPDIR)/'"$DEPDIR"'/g'`; do
- # Make sure the directory exists.
- test -f "$dirpart/$file" && continue
- fdir=`AS_DIRNAME(["$file"])`
- AS_MKDIR_P([$dirpart/$fdir])
- # echo "creating $dirpart/$file"
- echo '# dummy' > "$dirpart/$file"
- done
+ sed -n 's,^am--depfiles:.*,X,p' "$am_mf" | grep X >/dev/null 2>&1 \
+ || continue
+ am_dirpart=`AS_DIRNAME(["$am_mf"])`
+ am_filepart=`AS_BASENAME(["$am_mf"])`
+ AM_RUN_LOG([cd "$am_dirpart" \
+ && sed -e '/# am--include-marker/d' "$am_filepart" \
+ | $MAKE -f - am--depfiles]) || am_rc=$?
done
+ if test $am_rc -ne 0; then
+ AC_MSG_FAILURE([Something went wrong bootstrapping makefile fragments
+ for automatic dependency tracking. If GNU make was not used, consider
+ re-running the configure script with MAKE="gmake" (or whatever is
+ necessary). You can also try re-running configure with the
+ '--disable-dependency-tracking' option to at least be able to build
+ the package (albeit without support for automatic dependency tracking).])
+ fi
+ AS_UNSET([am_dirpart])
+ AS_UNSET([am_filepart])
+ AS_UNSET([am_mf])
+ AS_UNSET([am_rc])
+ rm -f conftest-deps.mk
}
])# _AM_OUTPUT_DEPENDENCY_COMMANDS
@@ -457,18 +450,17 @@ AC_DEFUN([_AM_OUTPUT_DEPENDENCY_COMMANDS],
# -----------------------------
# This macro should only be invoked once -- use via AC_REQUIRE.
#
-# This code is only required when automatic dependency tracking
-# is enabled. FIXME. This creates each '.P' file that we will
-# need in order to bootstrap the dependency handling code.
+# This code is only required when automatic dependency tracking is enabled.
+# This creates each '.Po' and '.Plo' makefile fragment that we'll need in
+# order to bootstrap the dependency handling code.
AC_DEFUN([AM_OUTPUT_DEPENDENCY_COMMANDS],
[AC_CONFIG_COMMANDS([depfiles],
[test x"$AMDEP_TRUE" != x"" || _AM_OUTPUT_DEPENDENCY_COMMANDS],
- [AMDEP_TRUE="$AMDEP_TRUE" ac_aux_dir="$ac_aux_dir"])
-])
+ [AMDEP_TRUE="$AMDEP_TRUE" MAKE="${MAKE-make}"])])
# Do all the work for Automake. -*- Autoconf -*-
-# Copyright (C) 1996-2017 Free Software Foundation, Inc.
+# Copyright (C) 1996-2020 Free Software Foundation, Inc.
#
# This file is free software; the Free Software Foundation
# gives unlimited permission to copy and/or distribute it,
@@ -555,8 +547,8 @@ AC_REQUIRE([AM_PROG_INSTALL_STRIP])dnl
AC_REQUIRE([AC_PROG_MKDIR_P])dnl
# For better backward compatibility. To be removed once Automake 1.9.x
# dies out for good. For more background, see:
-#
-#
+#
+#
AC_SUBST([mkdir_p], ['$(MKDIR_P)'])
# We need awk for the "check" target (and possibly the TAP driver). The
# system "awk" is bad on some platforms.
@@ -623,7 +615,7 @@ END
Aborting the configuration process, to ensure you take notice of the issue.
You can download and install GNU coreutils to get an 'rm' implementation
-that behaves properly: .
+that behaves properly: .
If you want to complete the configuration process using your problematic
'rm' anyway, export the environment variable ACCEPT_INFERIOR_RM_PROGRAM
@@ -665,7 +657,7 @@ for _am_header in $config_headers :; do
done
echo "timestamp for $_am_arg" >`AS_DIRNAME(["$_am_arg"])`/stamp-h[]$_am_stamp_count])
-# Copyright (C) 2001-2017 Free Software Foundation, Inc.
+# Copyright (C) 2001-2020 Free Software Foundation, Inc.
#
# This file is free software; the Free Software Foundation
# gives unlimited permission to copy and/or distribute it,
@@ -686,7 +678,7 @@ if test x"${install_sh+set}" != xset; then
fi
AC_SUBST([install_sh])])
-# Copyright (C) 2003-2017 Free Software Foundation, Inc.
+# Copyright (C) 2003-2020 Free Software Foundation, Inc.
#
# This file is free software; the Free Software Foundation
# gives unlimited permission to copy and/or distribute it,
@@ -708,7 +700,7 @@ AC_SUBST([am__leading_dot])])
# Add --enable-maintainer-mode option to configure. -*- Autoconf -*-
# From Jim Meyering
-# Copyright (C) 1996-2017 Free Software Foundation, Inc.
+# Copyright (C) 1996-2020 Free Software Foundation, Inc.
#
# This file is free software; the Free Software Foundation
# gives unlimited permission to copy and/or distribute it,
@@ -743,7 +735,7 @@ AC_MSG_CHECKING([whether to enable maintainer-specific portions of Makefiles])
# Check to see how 'make' treats includes. -*- Autoconf -*-
-# Copyright (C) 2001-2017 Free Software Foundation, Inc.
+# Copyright (C) 2001-2020 Free Software Foundation, Inc.
#
# This file is free software; the Free Software Foundation
# gives unlimited permission to copy and/or distribute it,
@@ -751,49 +743,42 @@ AC_MSG_CHECKING([whether to enable maintainer-specific portions of Makefiles])
# AM_MAKE_INCLUDE()
# -----------------
-# Check to see how make treats includes.
+# Check whether make has an 'include' directive that can support all
+# the idioms we need for our automatic dependency tracking code.
AC_DEFUN([AM_MAKE_INCLUDE],
-[am_make=${MAKE-make}
-cat > confinc << 'END'
+[AC_MSG_CHECKING([whether ${MAKE-make} supports the include directive])
+cat > confinc.mk << 'END'
am__doit:
- @echo this is the am__doit target
+ @echo this is the am__doit target >confinc.out
.PHONY: am__doit
END
-# If we don't find an include directive, just comment out the code.
-AC_MSG_CHECKING([for style of include used by $am_make])
am__include="#"
am__quote=
-_am_result=none
-# First try GNU make style include.
-echo "include confinc" > confmf
-# Ignore all kinds of additional output from 'make'.
-case `$am_make -s -f confmf 2> /dev/null` in #(
-*the\ am__doit\ target*)
- am__include=include
- am__quote=
- _am_result=GNU
- ;;
-esac
-# Now try BSD make style include.
-if test "$am__include" = "#"; then
- echo '.include "confinc"' > confmf
- case `$am_make -s -f confmf 2> /dev/null` in #(
- *the\ am__doit\ target*)
- am__include=.include
- am__quote="\""
- _am_result=BSD
- ;;
- esac
-fi
-AC_SUBST([am__include])
-AC_SUBST([am__quote])
-AC_MSG_RESULT([$_am_result])
-rm -f confinc confmf
-])
+# BSD make does it like this.
+echo '.include "confinc.mk" # ignored' > confmf.BSD
+# Other make implementations (GNU, Solaris 10, AIX) do it like this.
+echo 'include confinc.mk # ignored' > confmf.GNU
+_am_result=no
+for s in GNU BSD; do
+ AM_RUN_LOG([${MAKE-make} -f confmf.$s && cat confinc.out])
+ AS_CASE([$?:`cat confinc.out 2>/dev/null`],
+ ['0:this is the am__doit target'],
+ [AS_CASE([$s],
+ [BSD], [am__include='.include' am__quote='"'],
+ [am__include='include' am__quote=''])])
+ if test "$am__include" != "#"; then
+ _am_result="yes ($s style)"
+ break
+ fi
+done
+rm -f confinc.* confmf.*
+AC_MSG_RESULT([${_am_result}])
+AC_SUBST([am__include])])
+AC_SUBST([am__quote])])
# Fake the existence of programs that GNU maintainers use. -*- Autoconf -*-
-# Copyright (C) 1997-2017 Free Software Foundation, Inc.
+# Copyright (C) 1997-2020 Free Software Foundation, Inc.
#
# This file is free software; the Free Software Foundation
# gives unlimited permission to copy and/or distribute it,
@@ -832,7 +817,7 @@ fi
# Helper functions for option handling. -*- Autoconf -*-
-# Copyright (C) 2001-2017 Free Software Foundation, Inc.
+# Copyright (C) 2001-2020 Free Software Foundation, Inc.
#
# This file is free software; the Free Software Foundation
# gives unlimited permission to copy and/or distribute it,
@@ -861,7 +846,7 @@ AC_DEFUN([_AM_SET_OPTIONS],
AC_DEFUN([_AM_IF_OPTION],
[m4_ifset(_AM_MANGLE_OPTION([$1]), [$2], [$3])])
-# Copyright (C) 1999-2017 Free Software Foundation, Inc.
+# Copyright (C) 1999-2020 Free Software Foundation, Inc.
#
# This file is free software; the Free Software Foundation
# gives unlimited permission to copy and/or distribute it,
@@ -908,7 +893,7 @@ AC_LANG_POP([C])])
# For backward compatibility.
AC_DEFUN_ONCE([AM_PROG_CC_C_O], [AC_REQUIRE([AC_PROG_CC])])
-# Copyright (C) 2001-2017 Free Software Foundation, Inc.
+# Copyright (C) 2001-2020 Free Software Foundation, Inc.
#
# This file is free software; the Free Software Foundation
# gives unlimited permission to copy and/or distribute it,
@@ -927,7 +912,7 @@ AC_DEFUN([AM_RUN_LOG],
# Check to make sure that the build environment is sane. -*- Autoconf -*-
-# Copyright (C) 1996-2017 Free Software Foundation, Inc.
+# Copyright (C) 1996-2020 Free Software Foundation, Inc.
#
# This file is free software; the Free Software Foundation
# gives unlimited permission to copy and/or distribute it,
@@ -1008,7 +993,7 @@ AC_CONFIG_COMMANDS_PRE(
rm -f conftest.file
])
-# Copyright (C) 2009-2017 Free Software Foundation, Inc.
+# Copyright (C) 2009-2020 Free Software Foundation, Inc.
#
# This file is free software; the Free Software Foundation
# gives unlimited permission to copy and/or distribute it,
@@ -1068,7 +1053,7 @@ AC_SUBST([AM_BACKSLASH])dnl
_AM_SUBST_NOTMAKE([AM_BACKSLASH])dnl
])
-# Copyright (C) 2001-2017 Free Software Foundation, Inc.
+# Copyright (C) 2001-2020 Free Software Foundation, Inc.
#
# This file is free software; the Free Software Foundation
# gives unlimited permission to copy and/or distribute it,
@@ -1096,7 +1081,7 @@ fi
INSTALL_STRIP_PROGRAM="\$(install_sh) -c -s"
AC_SUBST([INSTALL_STRIP_PROGRAM])])
-# Copyright (C) 2006-2017 Free Software Foundation, Inc.
+# Copyright (C) 2006-2020 Free Software Foundation, Inc.
#
# This file is free software; the Free Software Foundation
# gives unlimited permission to copy and/or distribute it,
@@ -1115,7 +1100,7 @@ AC_DEFUN([AM_SUBST_NOTMAKE], [_AM_SUBST_NOTMAKE($@)])
# Check how to create a tarball. -*- Autoconf -*-
-# Copyright (C) 2004-2017 Free Software Foundation, Inc.
+# Copyright (C) 2004-2020 Free Software Foundation, Inc.
#
# This file is free software; the Free Software Foundation
# gives unlimited permission to copy and/or distribute it,
diff --git a/gcc/mpc/ar-lib b/gcc/mpc/build-aux/ar-lib
similarity index 93%
rename from gcc/mpc/ar-lib
rename to gcc/mpc/build-aux/ar-lib
index 13d5723ff6..3181b374d0 100755
--- a/gcc/mpc/ar-lib
+++ b/gcc/mpc/build-aux/ar-lib
@@ -2,9 +2,9 @@
# Wrapper for Microsoft lib.exe
me=ar-lib
-scriptversion=2012-03-01.08; # UTC
+scriptversion=2019-07-04.01; # UTC
-# Copyright (C) 2010-2014 Free Software Foundation, Inc.
+# Copyright (C) 2010-2020 Free Software Foundation, Inc.
# Written by Peter Rosin .
#
# This program is free software; you can redistribute it and/or modify
@@ -18,7 +18,7 @@ scriptversion=2012-03-01.08; # UTC
# GNU General Public License for more details.
#
# You should have received a copy of the GNU General Public License
-# along with this program. If not, see .
+# along with this program. If not, see .
# As a special exception to the GNU General Public License, if you
# distribute this file as part of a program that contains a
@@ -53,7 +53,7 @@ func_file_conv ()
MINGW*)
file_conv=mingw
;;
- CYGWIN*)
+ CYGWIN* | MSYS*)
file_conv=cygwin
;;
*)
@@ -65,7 +65,7 @@ func_file_conv ()
mingw)
file=`cmd //C echo "$file " | sed -e 's/"\(.*\) " *$/\1/'`
;;
- cygwin)
+ cygwin | msys)
file=`cygpath -m "$file" || echo "$file"`
;;
wine)
@@ -224,10 +224,11 @@ elif test -n "$extract"; then
esac
done
else
- $AR -NOLOGO -LIST "$archive" | sed -e 's/\\/\\\\/g' | while read member
- do
- $AR -NOLOGO -EXTRACT:"$member" "$archive" || exit $?
- done
+ $AR -NOLOGO -LIST "$archive" | tr -d '\r' | sed -e 's/\\/\\\\/g' \
+ | while read member
+ do
+ $AR -NOLOGO -EXTRACT:"$member" "$archive" || exit $?
+ done
fi
elif test -n "$quick$replace"; then
diff --git a/gcc/mpc/compile b/gcc/mpc/build-aux/compile
similarity index 94%
rename from gcc/mpc/compile
rename to gcc/mpc/build-aux/compile
index 4be2a80b03..b7d43b99c7 100755
--- a/gcc/mpc/compile
+++ b/gcc/mpc/build-aux/compile
@@ -1,9 +1,9 @@
#!/bin/sh
# Wrapper for compilers which do not understand '-c -o'.
-scriptversion=2012-10-14.11; # UTC
+scriptversion=2018-03-07.03; # UTC
-# Copyright (C) 1999-2014 Free Software Foundation, Inc.
+# Copyright (C) 1999-2020 Free Software Foundation, Inc.
# Written by Tom Tromey .
#
# This program is free software; you can redistribute it and/or modify
@@ -17,7 +17,7 @@ scriptversion=2012-10-14.11; # UTC
# GNU General Public License for more details.
#
# You should have received a copy of the GNU General Public License
-# along with this program. If not, see .
+# along with this program. If not, see .
# As a special exception to the GNU General Public License, if you
# distribute this file as part of a program that contains a
@@ -53,7 +53,7 @@ func_file_conv ()
MINGW*)
file_conv=mingw
;;
- CYGWIN*)
+ CYGWIN* | MSYS*)
file_conv=cygwin
;;
*)
@@ -67,7 +67,7 @@ func_file_conv ()
mingw/*)
file=`cmd //C echo "$file " | sed -e 's/"\(.*\) " *$/\1/'`
;;
- cygwin/*)
+ cygwin/* | msys/*)
file=`cygpath -m "$file" || echo "$file"`
;;
wine/*)
@@ -255,7 +255,8 @@ EOF
echo "compile $scriptversion"
exit $?
;;
- cl | *[/\\]cl | cl.exe | *[/\\]cl.exe )
+ cl | *[/\\]cl | cl.exe | *[/\\]cl.exe | \
+ icl | *[/\\]icl | icl.exe | *[/\\]icl.exe )
func_cl_wrapper "$@" # Doesn't return...
;;
esac
@@ -339,9 +340,9 @@ exit $ret
# Local Variables:
# mode: shell-script
# sh-indentation: 2
-# eval: (add-hook 'write-file-hooks 'time-stamp)
+# eval: (add-hook 'before-save-hook 'time-stamp)
# time-stamp-start: "scriptversion="
# time-stamp-format: "%:y-%02m-%02d.%02H"
-# time-stamp-time-zone: "UTC"
+# time-stamp-time-zone: "UTC0"
# time-stamp-end: "; # UTC"
# End:
diff --git a/gcc/mpc/config.guess b/gcc/mpc/build-aux/config.guess
similarity index 55%
rename from gcc/mpc/config.guess
rename to gcc/mpc/build-aux/config.guess
index baad2942da..2a02660bb7 100755
--- a/gcc/mpc/config.guess
+++ b/gcc/mpc/build-aux/config.guess
@@ -1,8 +1,8 @@
#!/bin/sh
# Attempt to guess a canonical system name.
-# Copyright 1992-2014 Free Software Foundation, Inc.
+# Copyright 1992-2020 Free Software Foundation, Inc.
-timestamp='2014-11-04'
+timestamp='2020-01-01'
# This file is free software; you can redistribute it and/or modify it
# under the terms of the GNU General Public License as published by
@@ -15,7 +15,7 @@ timestamp='2014-11-04'
# General Public License for more details.
#
# You should have received a copy of the GNU General Public License
-# along with this program; if not, see .
+# along with this program; if not, see .
#
# As a special exception to the GNU General Public License, if you
# distribute this file as part of a program that contains a
@@ -27,7 +27,7 @@ timestamp='2014-11-04'
# Originally written by Per Bothner; maintained since 2000 by Ben Elliston.
#
# You can get the latest version of this script from:
-# http://git.savannah.gnu.org/gitweb/?p=config.git;a=blob_plain;f=config.guess;hb=HEAD
+# https://git.savannah.gnu.org/gitweb/?p=config.git;a=blob_plain;f=config.guess
#
# Please send patches to .
@@ -39,7 +39,7 @@ Usage: $0 [OPTION]
Output the configuration name of the system \`$me' is run on.
-Operation modes:
+Options:
-h, --help print this help, then exit
-t, --time-stamp print date of last modification, then exit
-v, --version print version number, then exit
@@ -50,7 +50,7 @@ version="\
GNU config.guess ($timestamp)
Originally written by Per Bothner.
-Copyright 1992-2014 Free Software Foundation, Inc.
+Copyright 1992-2020 Free Software Foundation, Inc.
This is free software; see the source for copying conditions. There is NO
warranty; not even for MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE."
@@ -84,8 +84,6 @@ if test $# != 0; then
exit 1
fi
-trap 'exit 1' 1 2 15
-
# CC_FOR_BUILD -- compiler used by this script. Note that the use of a
# compiler to aid in system detection is discouraged as it requires
# temporary files to be created and, as you can see below, it is a
@@ -96,34 +94,40 @@ trap 'exit 1' 1 2 15
# Portable tmp directory creation inspired by the Autoconf team.
-set_cc_for_build='
-trap "exitcode=\$?; (rm -f \$tmpfiles 2>/dev/null; rmdir \$tmp 2>/dev/null) && exit \$exitcode" 0 ;
-trap "rm -f \$tmpfiles 2>/dev/null; rmdir \$tmp 2>/dev/null; exit 1" 1 2 13 15 ;
-: ${TMPDIR=/tmp} ;
- { tmp=`(umask 077 && mktemp -d "$TMPDIR/cgXXXXXX") 2>/dev/null` && test -n "$tmp" && test -d "$tmp" ; } ||
- { test -n "$RANDOM" && tmp=$TMPDIR/cg$$-$RANDOM && (umask 077 && mkdir $tmp) ; } ||
- { tmp=$TMPDIR/cg-$$ && (umask 077 && mkdir $tmp) && echo "Warning: creating insecure temp directory" >&2 ; } ||
- { echo "$me: cannot create a temporary directory in $TMPDIR" >&2 ; exit 1 ; } ;
-dummy=$tmp/dummy ;
-tmpfiles="$dummy.c $dummy.o $dummy.rel $dummy" ;
-case $CC_FOR_BUILD,$HOST_CC,$CC in
- ,,) echo "int x;" > $dummy.c ;
- for c in cc gcc c89 c99 ; do
- if ($c -c -o $dummy.o $dummy.c) >/dev/null 2>&1 ; then
- CC_FOR_BUILD="$c"; break ;
- fi ;
- done ;
- if test x"$CC_FOR_BUILD" = x ; then
- CC_FOR_BUILD=no_compiler_found ;
- fi
- ;;
- ,,*) CC_FOR_BUILD=$CC ;;
- ,*,*) CC_FOR_BUILD=$HOST_CC ;;
-esac ; set_cc_for_build= ;'
+tmp=
+# shellcheck disable=SC2172
+trap 'test -z "$tmp" || rm -fr "$tmp"' 0 1 2 13 15
+
+set_cc_for_build() {
+ # prevent multiple calls if $tmp is already set
+ test "$tmp" && return 0
+ : "${TMPDIR=/tmp}"
+ # shellcheck disable=SC2039
+ { tmp=`(umask 077 && mktemp -d "$TMPDIR/cgXXXXXX") 2>/dev/null` && test -n "$tmp" && test -d "$tmp" ; } ||
+ { test -n "$RANDOM" && tmp=$TMPDIR/cg$$-$RANDOM && (umask 077 && mkdir "$tmp" 2>/dev/null) ; } ||
+ { tmp=$TMPDIR/cg-$$ && (umask 077 && mkdir "$tmp" 2>/dev/null) && echo "Warning: creating insecure temp directory" >&2 ; } ||
+ { echo "$me: cannot create a temporary directory in $TMPDIR" >&2 ; exit 1 ; }
+ dummy=$tmp/dummy
+ case ${CC_FOR_BUILD-},${HOST_CC-},${CC-} in
+ ,,) echo "int x;" > "$dummy.c"
+ for driver in cc gcc c89 c99 ; do
+ if ($driver -c -o "$dummy.o" "$dummy.c") >/dev/null 2>&1 ; then
+ CC_FOR_BUILD="$driver"
+ break
+ fi
+ done
+ if test x"$CC_FOR_BUILD" = x ; then
+ CC_FOR_BUILD=no_compiler_found
+ fi
+ ;;
+ ,,*) CC_FOR_BUILD=$CC ;;
+ ,*,*) CC_FOR_BUILD=$HOST_CC ;;
+ esac
+}
# This is needed to find uname on a Pyramid OSx when run in the BSD universe.
# (ghazi@noc.rutgers.edu 1994-08-24)
-if (test -f /.attbin/uname) >/dev/null 2>&1 ; then
+if test -f /.attbin/uname ; then
PATH=$PATH:/.attbin ; export PATH
fi
@@ -132,14 +136,14 @@ UNAME_RELEASE=`(uname -r) 2>/dev/null` || UNAME_RELEASE=unknown
UNAME_SYSTEM=`(uname -s) 2>/dev/null` || UNAME_SYSTEM=unknown
UNAME_VERSION=`(uname -v) 2>/dev/null` || UNAME_VERSION=unknown
-case "${UNAME_SYSTEM}" in
+case "$UNAME_SYSTEM" in
Linux|GNU|GNU/*)
# If the system lacks a compiler, then just pick glibc.
# We could probably try harder.
LIBC=gnu
- eval $set_cc_for_build
- cat <<-EOF > $dummy.c
+ set_cc_for_build
+ cat <<-EOF > "$dummy.c"
#include
#if defined(__UCLIBC__)
LIBC=uclibc
@@ -149,13 +153,20 @@ Linux|GNU|GNU/*)
LIBC=gnu
#endif
EOF
- eval `$CC_FOR_BUILD -E $dummy.c 2>/dev/null | grep '^LIBC' | sed 's, ,,g'`
+ eval "`$CC_FOR_BUILD -E "$dummy.c" 2>/dev/null | grep '^LIBC' | sed 's, ,,g'`"
+
+ # If ldd exists, use it to detect musl libc.
+ if command -v ldd >/dev/null && \
+ ldd --version 2>&1 | grep -q ^musl
+ then
+ LIBC=musl
+ fi
;;
esac
# Note: order is significant - the case branches are not exclusive.
-case "${UNAME_MACHINE}:${UNAME_SYSTEM}:${UNAME_RELEASE}:${UNAME_VERSION}" in
+case "$UNAME_MACHINE:$UNAME_SYSTEM:$UNAME_RELEASE:$UNAME_VERSION" in
*:NetBSD:*:*)
# NetBSD (nbsd) targets should (where applicable) match one or
# more of the tuples: *-*-netbsdelf*, *-*-netbsdaout*,
@@ -168,21 +179,31 @@ case "${UNAME_MACHINE}:${UNAME_SYSTEM}:${UNAME_RELEASE}:${UNAME_VERSION}" in
# Note: NetBSD doesn't particularly care about the vendor
# portion of the name. We always set it to "unknown".
sysctl="sysctl -n hw.machine_arch"
- UNAME_MACHINE_ARCH=`(/sbin/$sysctl 2>/dev/null || \
- /usr/sbin/$sysctl 2>/dev/null || echo unknown)`
- case "${UNAME_MACHINE_ARCH}" in
+ UNAME_MACHINE_ARCH=`(uname -p 2>/dev/null || \
+ "/sbin/$sysctl" 2>/dev/null || \
+ "/usr/sbin/$sysctl" 2>/dev/null || \
+ echo unknown)`
+ case "$UNAME_MACHINE_ARCH" in
armeb) machine=armeb-unknown ;;
arm*) machine=arm-unknown ;;
sh3el) machine=shl-unknown ;;
sh3eb) machine=sh-unknown ;;
sh5el) machine=sh5le-unknown ;;
- *) machine=${UNAME_MACHINE_ARCH}-unknown ;;
+ earmv*)
+ arch=`echo "$UNAME_MACHINE_ARCH" | sed -e 's,^e\(armv[0-9]\).*$,\1,'`
+ endian=`echo "$UNAME_MACHINE_ARCH" | sed -ne 's,^.*\(eb\)$,\1,p'`
+ machine="${arch}${endian}"-unknown
+ ;;
+ *) machine="$UNAME_MACHINE_ARCH"-unknown ;;
esac
# The Operating System including object format, if it has switched
- # to ELF recently, or will in the future.
- case "${UNAME_MACHINE_ARCH}" in
+ # to ELF recently (or will in the future) and ABI.
+ case "$UNAME_MACHINE_ARCH" in
+ earm*)
+ os=netbsdelf
+ ;;
arm*|i386|m68k|ns32k|sh3*|sparc|vax)
- eval $set_cc_for_build
+ set_cc_for_build
if echo __ELF__ | $CC_FOR_BUILD -E - 2>/dev/null \
| grep -q __ELF__
then
@@ -197,43 +218,72 @@ case "${UNAME_MACHINE}:${UNAME_SYSTEM}:${UNAME_RELEASE}:${UNAME_VERSION}" in
os=netbsd
;;
esac
+ # Determine ABI tags.
+ case "$UNAME_MACHINE_ARCH" in
+ earm*)
+ expr='s/^earmv[0-9]/-eabi/;s/eb$//'
+ abi=`echo "$UNAME_MACHINE_ARCH" | sed -e "$expr"`
+ ;;
+ esac
# The OS release
# Debian GNU/NetBSD machines have a different userland, and
# thus, need a distinct triplet. However, they do not need
# kernel version information, so it can be replaced with a
# suitable tag, in the style of linux-gnu.
- case "${UNAME_VERSION}" in
+ case "$UNAME_VERSION" in
Debian*)
release='-gnu'
;;
*)
- release=`echo ${UNAME_RELEASE}|sed -e 's/[-_].*/\./'`
+ release=`echo "$UNAME_RELEASE" | sed -e 's/[-_].*//' | cut -d. -f1,2`
;;
esac
# Since CPU_TYPE-MANUFACTURER-KERNEL-OPERATING_SYSTEM:
# contains redundant information, the shorter form:
# CPU_TYPE-MANUFACTURER-OPERATING_SYSTEM is used.
- echo "${machine}-${os}${release}"
+ echo "$machine-${os}${release}${abi-}"
exit ;;
*:Bitrig:*:*)
UNAME_MACHINE_ARCH=`arch | sed 's/Bitrig.//'`
- echo ${UNAME_MACHINE_ARCH}-unknown-bitrig${UNAME_RELEASE}
+ echo "$UNAME_MACHINE_ARCH"-unknown-bitrig"$UNAME_RELEASE"
exit ;;
*:OpenBSD:*:*)
UNAME_MACHINE_ARCH=`arch | sed 's/OpenBSD.//'`
- echo ${UNAME_MACHINE_ARCH}-unknown-openbsd${UNAME_RELEASE}
+ echo "$UNAME_MACHINE_ARCH"-unknown-openbsd"$UNAME_RELEASE"
+ exit ;;
+ *:LibertyBSD:*:*)
+ UNAME_MACHINE_ARCH=`arch | sed 's/^.*BSD\.//'`
+ echo "$UNAME_MACHINE_ARCH"-unknown-libertybsd"$UNAME_RELEASE"
+ exit ;;
+ *:MidnightBSD:*:*)
+ echo "$UNAME_MACHINE"-unknown-midnightbsd"$UNAME_RELEASE"
exit ;;
*:ekkoBSD:*:*)
- echo ${UNAME_MACHINE}-unknown-ekkobsd${UNAME_RELEASE}
+ echo "$UNAME_MACHINE"-unknown-ekkobsd"$UNAME_RELEASE"
exit ;;
*:SolidBSD:*:*)
- echo ${UNAME_MACHINE}-unknown-solidbsd${UNAME_RELEASE}
+ echo "$UNAME_MACHINE"-unknown-solidbsd"$UNAME_RELEASE"
+ exit ;;
+ *:OS108:*:*)
+ echo "$UNAME_MACHINE"-unknown-os108_"$UNAME_RELEASE"
exit ;;
macppc:MirBSD:*:*)
- echo powerpc-unknown-mirbsd${UNAME_RELEASE}
+ echo powerpc-unknown-mirbsd"$UNAME_RELEASE"
exit ;;
*:MirBSD:*:*)
- echo ${UNAME_MACHINE}-unknown-mirbsd${UNAME_RELEASE}
+ echo "$UNAME_MACHINE"-unknown-mirbsd"$UNAME_RELEASE"
+ exit ;;
+ *:Sortix:*:*)
+ echo "$UNAME_MACHINE"-unknown-sortix
+ exit ;;
+ *:Twizzler:*:*)
+ echo "$UNAME_MACHINE"-unknown-twizzler
+ exit ;;
+ *:Redox:*:*)
+ echo "$UNAME_MACHINE"-unknown-redox
+ exit ;;
+ mips:OSF1:*.*)
+ echo mips-dec-osf1
exit ;;
alpha:OSF1:*:*)
case $UNAME_RELEASE in
@@ -251,63 +301,54 @@ case "${UNAME_MACHINE}:${UNAME_SYSTEM}:${UNAME_RELEASE}:${UNAME_VERSION}" in
ALPHA_CPU_TYPE=`/usr/sbin/psrinfo -v | sed -n -e 's/^ The alpha \(.*\) processor.*$/\1/p' | head -n 1`
case "$ALPHA_CPU_TYPE" in
"EV4 (21064)")
- UNAME_MACHINE="alpha" ;;
+ UNAME_MACHINE=alpha ;;
"EV4.5 (21064)")
- UNAME_MACHINE="alpha" ;;
+ UNAME_MACHINE=alpha ;;
"LCA4 (21066/21068)")
- UNAME_MACHINE="alpha" ;;
+ UNAME_MACHINE=alpha ;;
"EV5 (21164)")
- UNAME_MACHINE="alphaev5" ;;
+ UNAME_MACHINE=alphaev5 ;;
"EV5.6 (21164A)")
- UNAME_MACHINE="alphaev56" ;;
+ UNAME_MACHINE=alphaev56 ;;
"EV5.6 (21164PC)")
- UNAME_MACHINE="alphapca56" ;;
+ UNAME_MACHINE=alphapca56 ;;
"EV5.7 (21164PC)")
- UNAME_MACHINE="alphapca57" ;;
+ UNAME_MACHINE=alphapca57 ;;
"EV6 (21264)")
- UNAME_MACHINE="alphaev6" ;;
+ UNAME_MACHINE=alphaev6 ;;
"EV6.7 (21264A)")
- UNAME_MACHINE="alphaev67" ;;
+ UNAME_MACHINE=alphaev67 ;;
"EV6.8CB (21264C)")
- UNAME_MACHINE="alphaev68" ;;
+ UNAME_MACHINE=alphaev68 ;;
"EV6.8AL (21264B)")
- UNAME_MACHINE="alphaev68" ;;
+ UNAME_MACHINE=alphaev68 ;;
"EV6.8CX (21264D)")
- UNAME_MACHINE="alphaev68" ;;
+ UNAME_MACHINE=alphaev68 ;;
"EV6.9A (21264/EV69A)")
- UNAME_MACHINE="alphaev69" ;;
+ UNAME_MACHINE=alphaev69 ;;
"EV7 (21364)")
- UNAME_MACHINE="alphaev7" ;;
+ UNAME_MACHINE=alphaev7 ;;
"EV7.9 (21364A)")
- UNAME_MACHINE="alphaev79" ;;
+ UNAME_MACHINE=alphaev79 ;;
esac
# A Pn.n version is a patched version.
# A Vn.n version is a released version.
# A Tn.n version is a released field test version.
# A Xn.n version is an unreleased experimental baselevel.
# 1.2 uses "1.2" for uname -r.
- echo ${UNAME_MACHINE}-dec-osf`echo ${UNAME_RELEASE} | sed -e 's/^[PVTX]//' | tr 'ABCDEFGHIJKLMNOPQRSTUVWXYZ' 'abcdefghijklmnopqrstuvwxyz'`
+ echo "$UNAME_MACHINE"-dec-osf"`echo "$UNAME_RELEASE" | sed -e 's/^[PVTX]//' | tr ABCDEFGHIJKLMNOPQRSTUVWXYZ abcdefghijklmnopqrstuvwxyz`"
# Reset EXIT trap before exiting to avoid spurious non-zero exit code.
exitcode=$?
trap '' 0
exit $exitcode ;;
- Alpha\ *:Windows_NT*:*)
- # How do we know it's Interix rather than the generic POSIX subsystem?
- # Should we change UNAME_MACHINE based on the output of uname instead
- # of the specific Alpha model?
- echo alpha-pc-interix
- exit ;;
- 21064:Windows_NT:50:3)
- echo alpha-dec-winnt3.5
- exit ;;
Amiga*:UNIX_System_V:4.0:*)
echo m68k-unknown-sysv4
exit ;;
*:[Aa]miga[Oo][Ss]:*:*)
- echo ${UNAME_MACHINE}-unknown-amigaos
+ echo "$UNAME_MACHINE"-unknown-amigaos
exit ;;
*:[Mm]orph[Oo][Ss]:*:*)
- echo ${UNAME_MACHINE}-unknown-morphos
+ echo "$UNAME_MACHINE"-unknown-morphos
exit ;;
*:OS/390:*:*)
echo i370-ibm-openedition
@@ -319,7 +360,7 @@ case "${UNAME_MACHINE}:${UNAME_SYSTEM}:${UNAME_RELEASE}:${UNAME_VERSION}" in
echo powerpc-ibm-os400
exit ;;
arm:RISC*:1.[012]*:*|arm:riscix:1.[012]*:*)
- echo arm-acorn-riscix${UNAME_RELEASE}
+ echo arm-acorn-riscix"$UNAME_RELEASE"
exit ;;
arm*:riscos:*:*|arm*:RISCOS:*:*)
echo arm-unknown-riscos
@@ -346,38 +387,38 @@ case "${UNAME_MACHINE}:${UNAME_SYSTEM}:${UNAME_RELEASE}:${UNAME_VERSION}" in
sparc) echo sparc-icl-nx7; exit ;;
esac ;;
s390x:SunOS:*:*)
- echo ${UNAME_MACHINE}-ibm-solaris2`echo ${UNAME_RELEASE}|sed -e 's/[^.]*//'`
+ echo "$UNAME_MACHINE"-ibm-solaris2"`echo "$UNAME_RELEASE" | sed -e 's/[^.]*//'`"
exit ;;
sun4H:SunOS:5.*:*)
- echo sparc-hal-solaris2`echo ${UNAME_RELEASE}|sed -e 's/[^.]*//'`
+ echo sparc-hal-solaris2"`echo "$UNAME_RELEASE"|sed -e 's/[^.]*//'`"
exit ;;
sun4*:SunOS:5.*:* | tadpole*:SunOS:5.*:*)
- echo sparc-sun-solaris2`echo ${UNAME_RELEASE}|sed -e 's/[^.]*//'`
+ echo sparc-sun-solaris2"`echo "$UNAME_RELEASE" | sed -e 's/[^.]*//'`"
exit ;;
i86pc:AuroraUX:5.*:* | i86xen:AuroraUX:5.*:*)
- echo i386-pc-auroraux${UNAME_RELEASE}
+ echo i386-pc-auroraux"$UNAME_RELEASE"
exit ;;
i86pc:SunOS:5.*:* | i86xen:SunOS:5.*:*)
- eval $set_cc_for_build
- SUN_ARCH="i386"
+ set_cc_for_build
+ SUN_ARCH=i386
# If there is a compiler, see if it is configured for 64-bit objects.
# Note that the Sun cc does not turn __LP64__ into 1 like gcc does.
# This test works for both compilers.
- if [ "$CC_FOR_BUILD" != 'no_compiler_found' ]; then
+ if [ "$CC_FOR_BUILD" != no_compiler_found ]; then
if (echo '#ifdef __amd64'; echo IS_64BIT_ARCH; echo '#endif') | \
- (CCOPTS= $CC_FOR_BUILD -E - 2>/dev/null) | \
+ (CCOPTS="" $CC_FOR_BUILD -E - 2>/dev/null) | \
grep IS_64BIT_ARCH >/dev/null
then
- SUN_ARCH="x86_64"
+ SUN_ARCH=x86_64
fi
fi
- echo ${SUN_ARCH}-pc-solaris2`echo ${UNAME_RELEASE}|sed -e 's/[^.]*//'`
+ echo "$SUN_ARCH"-pc-solaris2"`echo "$UNAME_RELEASE"|sed -e 's/[^.]*//'`"
exit ;;
sun4*:SunOS:6*:*)
# According to config.sub, this is the proper way to canonicalize
# SunOS6. Hard to guess exactly what SunOS6 will be like, but
# it's likely to be more like Solaris than SunOS4.
- echo sparc-sun-solaris3`echo ${UNAME_RELEASE}|sed -e 's/[^.]*//'`
+ echo sparc-sun-solaris3"`echo "$UNAME_RELEASE"|sed -e 's/[^.]*//'`"
exit ;;
sun4*:SunOS:*:*)
case "`/usr/bin/arch -k`" in
@@ -386,25 +427,25 @@ case "${UNAME_MACHINE}:${UNAME_SYSTEM}:${UNAME_RELEASE}:${UNAME_VERSION}" in
;;
esac
# Japanese Language versions have a version number like `4.1.3-JL'.
- echo sparc-sun-sunos`echo ${UNAME_RELEASE}|sed -e 's/-/_/'`
+ echo sparc-sun-sunos"`echo "$UNAME_RELEASE"|sed -e 's/-/_/'`"
exit ;;
sun3*:SunOS:*:*)
- echo m68k-sun-sunos${UNAME_RELEASE}
+ echo m68k-sun-sunos"$UNAME_RELEASE"
exit ;;
sun*:*:4.2BSD:*)
UNAME_RELEASE=`(sed 1q /etc/motd | awk '{print substr($5,1,3)}') 2>/dev/null`
- test "x${UNAME_RELEASE}" = "x" && UNAME_RELEASE=3
+ test "x$UNAME_RELEASE" = x && UNAME_RELEASE=3
case "`/bin/arch`" in
sun3)
- echo m68k-sun-sunos${UNAME_RELEASE}
+ echo m68k-sun-sunos"$UNAME_RELEASE"
;;
sun4)
- echo sparc-sun-sunos${UNAME_RELEASE}
+ echo sparc-sun-sunos"$UNAME_RELEASE"
;;
esac
exit ;;
aushp:SunOS:*:*)
- echo sparc-auspex-sunos${UNAME_RELEASE}
+ echo sparc-auspex-sunos"$UNAME_RELEASE"
exit ;;
# The situation for MiNT is a little confusing. The machine name
# can be virtually everything (everything which is not
@@ -415,44 +456,44 @@ case "${UNAME_MACHINE}:${UNAME_SYSTEM}:${UNAME_RELEASE}:${UNAME_VERSION}" in
# MiNT. But MiNT is downward compatible to TOS, so this should
# be no problem.
atarist[e]:*MiNT:*:* | atarist[e]:*mint:*:* | atarist[e]:*TOS:*:*)
- echo m68k-atari-mint${UNAME_RELEASE}
+ echo m68k-atari-mint"$UNAME_RELEASE"
exit ;;
atari*:*MiNT:*:* | atari*:*mint:*:* | atarist[e]:*TOS:*:*)
- echo m68k-atari-mint${UNAME_RELEASE}
+ echo m68k-atari-mint"$UNAME_RELEASE"
exit ;;
*falcon*:*MiNT:*:* | *falcon*:*mint:*:* | *falcon*:*TOS:*:*)
- echo m68k-atari-mint${UNAME_RELEASE}
+ echo m68k-atari-mint"$UNAME_RELEASE"
exit ;;
milan*:*MiNT:*:* | milan*:*mint:*:* | *milan*:*TOS:*:*)
- echo m68k-milan-mint${UNAME_RELEASE}
+ echo m68k-milan-mint"$UNAME_RELEASE"
exit ;;
hades*:*MiNT:*:* | hades*:*mint:*:* | *hades*:*TOS:*:*)
- echo m68k-hades-mint${UNAME_RELEASE}
+ echo m68k-hades-mint"$UNAME_RELEASE"
exit ;;
*:*MiNT:*:* | *:*mint:*:* | *:*TOS:*:*)
- echo m68k-unknown-mint${UNAME_RELEASE}
+ echo m68k-unknown-mint"$UNAME_RELEASE"
exit ;;
m68k:machten:*:*)
- echo m68k-apple-machten${UNAME_RELEASE}
+ echo m68k-apple-machten"$UNAME_RELEASE"
exit ;;
powerpc:machten:*:*)
- echo powerpc-apple-machten${UNAME_RELEASE}
+ echo powerpc-apple-machten"$UNAME_RELEASE"
exit ;;
RISC*:Mach:*:*)
echo mips-dec-mach_bsd4.3
exit ;;
RISC*:ULTRIX:*:*)
- echo mips-dec-ultrix${UNAME_RELEASE}
+ echo mips-dec-ultrix"$UNAME_RELEASE"
exit ;;
VAX*:ULTRIX*:*:*)
- echo vax-dec-ultrix${UNAME_RELEASE}
+ echo vax-dec-ultrix"$UNAME_RELEASE"
exit ;;
2020:CLIX:*:* | 2430:CLIX:*:*)
- echo clipper-intergraph-clix${UNAME_RELEASE}
+ echo clipper-intergraph-clix"$UNAME_RELEASE"
exit ;;
mips:*:*:UMIPS | mips:*:*:RISCos)
- eval $set_cc_for_build
- sed 's/^ //' << EOF >$dummy.c
+ set_cc_for_build
+ sed 's/^ //' << EOF > "$dummy.c"
#ifdef __cplusplus
#include /* for printf() prototype */
int main (int argc, char *argv[]) {
@@ -461,23 +502,23 @@ case "${UNAME_MACHINE}:${UNAME_SYSTEM}:${UNAME_RELEASE}:${UNAME_VERSION}" in
#endif
#if defined (host_mips) && defined (MIPSEB)
#if defined (SYSTYPE_SYSV)
- printf ("mips-mips-riscos%ssysv\n", argv[1]); exit (0);
+ printf ("mips-mips-riscos%ssysv\\n", argv[1]); exit (0);
#endif
#if defined (SYSTYPE_SVR4)
- printf ("mips-mips-riscos%ssvr4\n", argv[1]); exit (0);
+ printf ("mips-mips-riscos%ssvr4\\n", argv[1]); exit (0);
#endif
#if defined (SYSTYPE_BSD43) || defined(SYSTYPE_BSD)
- printf ("mips-mips-riscos%sbsd\n", argv[1]); exit (0);
+ printf ("mips-mips-riscos%sbsd\\n", argv[1]); exit (0);
#endif
#endif
exit (-1);
}
EOF
- $CC_FOR_BUILD -o $dummy $dummy.c &&
- dummyarg=`echo "${UNAME_RELEASE}" | sed -n 's/\([0-9]*\).*/\1/p'` &&
- SYSTEM_NAME=`$dummy $dummyarg` &&
+ $CC_FOR_BUILD -o "$dummy" "$dummy.c" &&
+ dummyarg=`echo "$UNAME_RELEASE" | sed -n 's/\([0-9]*\).*/\1/p'` &&
+ SYSTEM_NAME=`"$dummy" "$dummyarg"` &&
{ echo "$SYSTEM_NAME"; exit; }
- echo mips-mips-riscos${UNAME_RELEASE}
+ echo mips-mips-riscos"$UNAME_RELEASE"
exit ;;
Motorola:PowerMAX_OS:*:*)
echo powerpc-motorola-powermax
@@ -503,17 +544,17 @@ EOF
AViiON:dgux:*:*)
# DG/UX returns AViiON for all architectures
UNAME_PROCESSOR=`/usr/bin/uname -p`
- if [ $UNAME_PROCESSOR = mc88100 ] || [ $UNAME_PROCESSOR = mc88110 ]
+ if [ "$UNAME_PROCESSOR" = mc88100 ] || [ "$UNAME_PROCESSOR" = mc88110 ]
then
- if [ ${TARGET_BINARY_INTERFACE}x = m88kdguxelfx ] || \
- [ ${TARGET_BINARY_INTERFACE}x = x ]
+ if [ "$TARGET_BINARY_INTERFACE"x = m88kdguxelfx ] || \
+ [ "$TARGET_BINARY_INTERFACE"x = x ]
then
- echo m88k-dg-dgux${UNAME_RELEASE}
+ echo m88k-dg-dgux"$UNAME_RELEASE"
else
- echo m88k-dg-dguxbcs${UNAME_RELEASE}
+ echo m88k-dg-dguxbcs"$UNAME_RELEASE"
fi
else
- echo i586-dg-dgux${UNAME_RELEASE}
+ echo i586-dg-dgux"$UNAME_RELEASE"
fi
exit ;;
M88*:DolphinOS:*:*) # DolphinOS (SVR3)
@@ -530,7 +571,7 @@ EOF
echo m68k-tektronix-bsd
exit ;;
*:IRIX*:*:*)
- echo mips-sgi-irix`echo ${UNAME_RELEASE}|sed -e 's/-/_/g'`
+ echo mips-sgi-irix"`echo "$UNAME_RELEASE"|sed -e 's/-/_/g'`"
exit ;;
????????:AIX?:[12].1:2) # AIX 2.2.1 or AIX 2.1.1 is RT/PC AIX.
echo romp-ibm-aix # uname -m gives an 8 hex-code CPU id
@@ -542,14 +583,14 @@ EOF
if [ -x /usr/bin/oslevel ] ; then
IBM_REV=`/usr/bin/oslevel`
else
- IBM_REV=${UNAME_VERSION}.${UNAME_RELEASE}
+ IBM_REV="$UNAME_VERSION.$UNAME_RELEASE"
fi
- echo ${UNAME_MACHINE}-ibm-aix${IBM_REV}
+ echo "$UNAME_MACHINE"-ibm-aix"$IBM_REV"
exit ;;
*:AIX:2:3)
if grep bos325 /usr/include/stdio.h >/dev/null 2>&1; then
- eval $set_cc_for_build
- sed 's/^ //' << EOF >$dummy.c
+ set_cc_for_build
+ sed 's/^ //' << EOF > "$dummy.c"
#include
main()
@@ -560,7 +601,7 @@ EOF
exit(0);
}
EOF
- if $CC_FOR_BUILD -o $dummy $dummy.c && SYSTEM_NAME=`$dummy`
+ if $CC_FOR_BUILD -o "$dummy" "$dummy.c" && SYSTEM_NAME=`"$dummy"`
then
echo "$SYSTEM_NAME"
else
@@ -574,7 +615,7 @@ EOF
exit ;;
*:AIX:*:[4567])
IBM_CPU_ID=`/usr/sbin/lsdev -C -c processor -S available | sed 1q | awk '{ print $1 }'`
- if /usr/sbin/lsattr -El ${IBM_CPU_ID} | grep ' POWER' >/dev/null 2>&1; then
+ if /usr/sbin/lsattr -El "$IBM_CPU_ID" | grep ' POWER' >/dev/null 2>&1; then
IBM_ARCH=rs6000
else
IBM_ARCH=powerpc
@@ -583,18 +624,18 @@ EOF
IBM_REV=`/usr/bin/lslpp -Lqc bos.rte.libc |
awk -F: '{ print $3 }' | sed s/[0-9]*$/0/`
else
- IBM_REV=${UNAME_VERSION}.${UNAME_RELEASE}
+ IBM_REV="$UNAME_VERSION.$UNAME_RELEASE"
fi
- echo ${IBM_ARCH}-ibm-aix${IBM_REV}
+ echo "$IBM_ARCH"-ibm-aix"$IBM_REV"
exit ;;
*:AIX:*:*)
echo rs6000-ibm-aix
exit ;;
- ibmrt:4.4BSD:*|romp-ibm:BSD:*)
+ ibmrt:4.4BSD:*|romp-ibm:4.4BSD:*)
echo romp-ibm-bsd4.4
exit ;;
ibmrt:*BSD:*|romp-ibm:BSD:*) # covers RT/PC BSD and
- echo romp-ibm-bsd${UNAME_RELEASE} # 4.3 with uname added to
+ echo romp-ibm-bsd"$UNAME_RELEASE" # 4.3 with uname added to
exit ;; # report: romp-ibm BSD 4.3
*:BOSX:*:*)
echo rs6000-bull-bosx
@@ -609,28 +650,28 @@ EOF
echo m68k-hp-bsd4.4
exit ;;
9000/[34678]??:HP-UX:*:*)
- HPUX_REV=`echo ${UNAME_RELEASE}|sed -e 's/[^.]*.[0B]*//'`
- case "${UNAME_MACHINE}" in
- 9000/31? ) HP_ARCH=m68000 ;;
- 9000/[34]?? ) HP_ARCH=m68k ;;
+ HPUX_REV=`echo "$UNAME_RELEASE"|sed -e 's/[^.]*.[0B]*//'`
+ case "$UNAME_MACHINE" in
+ 9000/31?) HP_ARCH=m68000 ;;
+ 9000/[34]??) HP_ARCH=m68k ;;
9000/[678][0-9][0-9])
if [ -x /usr/bin/getconf ]; then
sc_cpu_version=`/usr/bin/getconf SC_CPU_VERSION 2>/dev/null`
sc_kernel_bits=`/usr/bin/getconf SC_KERNEL_BITS 2>/dev/null`
- case "${sc_cpu_version}" in
- 523) HP_ARCH="hppa1.0" ;; # CPU_PA_RISC1_0
- 528) HP_ARCH="hppa1.1" ;; # CPU_PA_RISC1_1
+ case "$sc_cpu_version" in
+ 523) HP_ARCH=hppa1.0 ;; # CPU_PA_RISC1_0
+ 528) HP_ARCH=hppa1.1 ;; # CPU_PA_RISC1_1
532) # CPU_PA_RISC2_0
- case "${sc_kernel_bits}" in
- 32) HP_ARCH="hppa2.0n" ;;
- 64) HP_ARCH="hppa2.0w" ;;
- '') HP_ARCH="hppa2.0" ;; # HP-UX 10.20
+ case "$sc_kernel_bits" in
+ 32) HP_ARCH=hppa2.0n ;;
+ 64) HP_ARCH=hppa2.0w ;;
+ '') HP_ARCH=hppa2.0 ;; # HP-UX 10.20
esac ;;
esac
fi
- if [ "${HP_ARCH}" = "" ]; then
- eval $set_cc_for_build
- sed 's/^ //' << EOF >$dummy.c
+ if [ "$HP_ARCH" = "" ]; then
+ set_cc_for_build
+ sed 's/^ //' << EOF > "$dummy.c"
#define _HPUX_SOURCE
#include
@@ -663,13 +704,13 @@ EOF
exit (0);
}
EOF
- (CCOPTS= $CC_FOR_BUILD -o $dummy $dummy.c 2>/dev/null) && HP_ARCH=`$dummy`
+ (CCOPTS="" $CC_FOR_BUILD -o "$dummy" "$dummy.c" 2>/dev/null) && HP_ARCH=`"$dummy"`
test -z "$HP_ARCH" && HP_ARCH=hppa
fi ;;
esac
- if [ ${HP_ARCH} = "hppa2.0w" ]
+ if [ "$HP_ARCH" = hppa2.0w ]
then
- eval $set_cc_for_build
+ set_cc_for_build
# hppa2.0w-hp-hpux* has a 64-bit kernel and a compiler generating
# 32-bit code. hppa64-hp-hpux* has the same kernel and a compiler
@@ -680,23 +721,23 @@ EOF
# $ CC_FOR_BUILD="cc +DA2.0w" ./config.guess
# => hppa64-hp-hpux11.23
- if echo __LP64__ | (CCOPTS= $CC_FOR_BUILD -E - 2>/dev/null) |
+ if echo __LP64__ | (CCOPTS="" $CC_FOR_BUILD -E - 2>/dev/null) |
grep -q __LP64__
then
- HP_ARCH="hppa2.0w"
+ HP_ARCH=hppa2.0w
else
- HP_ARCH="hppa64"
+ HP_ARCH=hppa64
fi
fi
- echo ${HP_ARCH}-hp-hpux${HPUX_REV}
+ echo "$HP_ARCH"-hp-hpux"$HPUX_REV"
exit ;;
ia64:HP-UX:*:*)
- HPUX_REV=`echo ${UNAME_RELEASE}|sed -e 's/[^.]*.[0B]*//'`
- echo ia64-hp-hpux${HPUX_REV}
+ HPUX_REV=`echo "$UNAME_RELEASE"|sed -e 's/[^.]*.[0B]*//'`
+ echo ia64-hp-hpux"$HPUX_REV"
exit ;;
3050*:HI-UX:*:*)
- eval $set_cc_for_build
- sed 's/^ //' << EOF >$dummy.c
+ set_cc_for_build
+ sed 's/^ //' << EOF > "$dummy.c"
#include
int
main ()
@@ -721,11 +762,11 @@ EOF
exit (0);
}
EOF
- $CC_FOR_BUILD -o $dummy $dummy.c && SYSTEM_NAME=`$dummy` &&
+ $CC_FOR_BUILD -o "$dummy" "$dummy.c" && SYSTEM_NAME=`"$dummy"` &&
{ echo "$SYSTEM_NAME"; exit; }
echo unknown-hitachi-hiuxwe2
exit ;;
- 9000/7??:4.3bsd:*:* | 9000/8?[79]:4.3bsd:*:* )
+ 9000/7??:4.3bsd:*:* | 9000/8?[79]:4.3bsd:*:*)
echo hppa1.1-hp-bsd
exit ;;
9000/8??:4.3bsd:*:*)
@@ -734,7 +775,7 @@ EOF
*9??*:MPE/iX:*:* | *3000*:MPE/iX:*:*)
echo hppa1.0-hp-mpeix
exit ;;
- hp7??:OSF1:*:* | hp8?[79]:OSF1:*:* )
+ hp7??:OSF1:*:* | hp8?[79]:OSF1:*:*)
echo hppa1.1-hp-osf
exit ;;
hp8??:OSF1:*:*)
@@ -742,9 +783,9 @@ EOF
exit ;;
i*86:OSF1:*:*)
if [ -x /usr/sbin/sysversion ] ; then
- echo ${UNAME_MACHINE}-unknown-osf1mk
+ echo "$UNAME_MACHINE"-unknown-osf1mk
else
- echo ${UNAME_MACHINE}-unknown-osf1
+ echo "$UNAME_MACHINE"-unknown-osf1
fi
exit ;;
parisc*:Lites*:*:*)
@@ -769,130 +810,123 @@ EOF
echo c4-convex-bsd
exit ;;
CRAY*Y-MP:*:*:*)
- echo ymp-cray-unicos${UNAME_RELEASE} | sed -e 's/\.[^.]*$/.X/'
+ echo ymp-cray-unicos"$UNAME_RELEASE" | sed -e 's/\.[^.]*$/.X/'
exit ;;
CRAY*[A-Z]90:*:*:*)
- echo ${UNAME_MACHINE}-cray-unicos${UNAME_RELEASE} \
+ echo "$UNAME_MACHINE"-cray-unicos"$UNAME_RELEASE" \
| sed -e 's/CRAY.*\([A-Z]90\)/\1/' \
-e y/ABCDEFGHIJKLMNOPQRSTUVWXYZ/abcdefghijklmnopqrstuvwxyz/ \
-e 's/\.[^.]*$/.X/'
exit ;;
CRAY*TS:*:*:*)
- echo t90-cray-unicos${UNAME_RELEASE} | sed -e 's/\.[^.]*$/.X/'
+ echo t90-cray-unicos"$UNAME_RELEASE" | sed -e 's/\.[^.]*$/.X/'
exit ;;
CRAY*T3E:*:*:*)
- echo alphaev5-cray-unicosmk${UNAME_RELEASE} | sed -e 's/\.[^.]*$/.X/'
+ echo alphaev5-cray-unicosmk"$UNAME_RELEASE" | sed -e 's/\.[^.]*$/.X/'
exit ;;
CRAY*SV1:*:*:*)
- echo sv1-cray-unicos${UNAME_RELEASE} | sed -e 's/\.[^.]*$/.X/'
+ echo sv1-cray-unicos"$UNAME_RELEASE" | sed -e 's/\.[^.]*$/.X/'
exit ;;
*:UNICOS/mp:*:*)
- echo craynv-cray-unicosmp${UNAME_RELEASE} | sed -e 's/\.[^.]*$/.X/'
+ echo craynv-cray-unicosmp"$UNAME_RELEASE" | sed -e 's/\.[^.]*$/.X/'
exit ;;
F30[01]:UNIX_System_V:*:* | F700:UNIX_System_V:*:*)
- FUJITSU_PROC=`uname -m | tr 'ABCDEFGHIJKLMNOPQRSTUVWXYZ' 'abcdefghijklmnopqrstuvwxyz'`
- FUJITSU_SYS=`uname -p | tr 'ABCDEFGHIJKLMNOPQRSTUVWXYZ' 'abcdefghijklmnopqrstuvwxyz' | sed -e 's/\///'`
- FUJITSU_REL=`echo ${UNAME_RELEASE} | sed -e 's/ /_/'`
+ FUJITSU_PROC=`uname -m | tr ABCDEFGHIJKLMNOPQRSTUVWXYZ abcdefghijklmnopqrstuvwxyz`
+ FUJITSU_SYS=`uname -p | tr ABCDEFGHIJKLMNOPQRSTUVWXYZ abcdefghijklmnopqrstuvwxyz | sed -e 's/\///'`
+ FUJITSU_REL=`echo "$UNAME_RELEASE" | sed -e 's/ /_/'`
echo "${FUJITSU_PROC}-fujitsu-${FUJITSU_SYS}${FUJITSU_REL}"
exit ;;
5000:UNIX_System_V:4.*:*)
- FUJITSU_SYS=`uname -p | tr 'ABCDEFGHIJKLMNOPQRSTUVWXYZ' 'abcdefghijklmnopqrstuvwxyz' | sed -e 's/\///'`
- FUJITSU_REL=`echo ${UNAME_RELEASE} | tr 'ABCDEFGHIJKLMNOPQRSTUVWXYZ' 'abcdefghijklmnopqrstuvwxyz' | sed -e 's/ /_/'`
+ FUJITSU_SYS=`uname -p | tr ABCDEFGHIJKLMNOPQRSTUVWXYZ abcdefghijklmnopqrstuvwxyz | sed -e 's/\///'`
+ FUJITSU_REL=`echo "$UNAME_RELEASE" | tr ABCDEFGHIJKLMNOPQRSTUVWXYZ abcdefghijklmnopqrstuvwxyz | sed -e 's/ /_/'`
echo "sparc-fujitsu-${FUJITSU_SYS}${FUJITSU_REL}"
exit ;;
i*86:BSD/386:*:* | i*86:BSD/OS:*:* | *:Ascend\ Embedded/OS:*:*)
- echo ${UNAME_MACHINE}-pc-bsdi${UNAME_RELEASE}
+ echo "$UNAME_MACHINE"-pc-bsdi"$UNAME_RELEASE"
exit ;;
sparc*:BSD/OS:*:*)
- echo sparc-unknown-bsdi${UNAME_RELEASE}
+ echo sparc-unknown-bsdi"$UNAME_RELEASE"
exit ;;
*:BSD/OS:*:*)
- echo ${UNAME_MACHINE}-unknown-bsdi${UNAME_RELEASE}
+ echo "$UNAME_MACHINE"-unknown-bsdi"$UNAME_RELEASE"
+ exit ;;
+ arm:FreeBSD:*:*)
+ UNAME_PROCESSOR=`uname -p`
+ set_cc_for_build
+ if echo __ARM_PCS_VFP | $CC_FOR_BUILD -E - 2>/dev/null \
+ | grep -q __ARM_PCS_VFP
+ then
+ echo "${UNAME_PROCESSOR}"-unknown-freebsd"`echo ${UNAME_RELEASE}|sed -e 's/[-(].*//'`"-gnueabi
+ else
+ echo "${UNAME_PROCESSOR}"-unknown-freebsd"`echo ${UNAME_RELEASE}|sed -e 's/[-(].*//'`"-gnueabihf
+ fi
exit ;;
*:FreeBSD:*:*)
UNAME_PROCESSOR=`/usr/bin/uname -p`
- case ${UNAME_PROCESSOR} in
+ case "$UNAME_PROCESSOR" in
amd64)
- echo x86_64-unknown-freebsd`echo ${UNAME_RELEASE}|sed -e 's/[-(].*//'` ;;
- *)
- echo ${UNAME_PROCESSOR}-unknown-freebsd`echo ${UNAME_RELEASE}|sed -e 's/[-(].*//'` ;;
+ UNAME_PROCESSOR=x86_64 ;;
+ i386)
+ UNAME_PROCESSOR=i586 ;;
esac
+ echo "$UNAME_PROCESSOR"-unknown-freebsd"`echo "$UNAME_RELEASE"|sed -e 's/[-(].*//'`"
exit ;;
i*:CYGWIN*:*)
- echo ${UNAME_MACHINE}-pc-cygwin
+ echo "$UNAME_MACHINE"-pc-cygwin
exit ;;
*:MINGW64*:*)
- echo ${UNAME_MACHINE}-pc-mingw64
+ echo "$UNAME_MACHINE"-pc-mingw64
exit ;;
*:MINGW*:*)
- echo ${UNAME_MACHINE}-pc-mingw32
+ echo "$UNAME_MACHINE"-pc-mingw32
exit ;;
*:MSYS*:*)
- echo ${UNAME_MACHINE}-pc-msys
- exit ;;
- i*:windows32*:*)
- # uname -m includes "-pc" on this system.
- echo ${UNAME_MACHINE}-mingw32
+ echo "$UNAME_MACHINE"-pc-msys
exit ;;
i*:PW*:*)
- echo ${UNAME_MACHINE}-pc-pw32
+ echo "$UNAME_MACHINE"-pc-pw32
exit ;;
*:Interix*:*)
- case ${UNAME_MACHINE} in
+ case "$UNAME_MACHINE" in
x86)
- echo i586-pc-interix${UNAME_RELEASE}
+ echo i586-pc-interix"$UNAME_RELEASE"
exit ;;
authenticamd | genuineintel | EM64T)
- echo x86_64-unknown-interix${UNAME_RELEASE}
+ echo x86_64-unknown-interix"$UNAME_RELEASE"
exit ;;
IA64)
- echo ia64-unknown-interix${UNAME_RELEASE}
+ echo ia64-unknown-interix"$UNAME_RELEASE"
exit ;;
esac ;;
- [345]86:Windows_95:* | [345]86:Windows_98:* | [345]86:Windows_NT:*)
- echo i${UNAME_MACHINE}-pc-mks
- exit ;;
- 8664:Windows_NT:*)
- echo x86_64-pc-mks
- exit ;;
- i*:Windows_NT*:* | Pentium*:Windows_NT*:*)
- # How do we know it's Interix rather than the generic POSIX subsystem?
- # It also conflicts with pre-2.0 versions of AT&T UWIN. Should we
- # UNAME_MACHINE based on the output of uname instead of i386?
- echo i586-pc-interix
- exit ;;
i*:UWIN*:*)
- echo ${UNAME_MACHINE}-pc-uwin
+ echo "$UNAME_MACHINE"-pc-uwin
exit ;;
amd64:CYGWIN*:*:* | x86_64:CYGWIN*:*:*)
- echo x86_64-unknown-cygwin
- exit ;;
- p*:CYGWIN*:*)
- echo powerpcle-unknown-cygwin
+ echo x86_64-pc-cygwin
exit ;;
prep*:SunOS:5.*:*)
- echo powerpcle-unknown-solaris2`echo ${UNAME_RELEASE}|sed -e 's/[^.]*//'`
+ echo powerpcle-unknown-solaris2"`echo "$UNAME_RELEASE"|sed -e 's/[^.]*//'`"
exit ;;
*:GNU:*:*)
# the GNU system
- echo `echo ${UNAME_MACHINE}|sed -e 's,[-/].*$,,'`-unknown-${LIBC}`echo ${UNAME_RELEASE}|sed -e 's,/.*$,,'`
+ echo "`echo "$UNAME_MACHINE"|sed -e 's,[-/].*$,,'`-unknown-$LIBC`echo "$UNAME_RELEASE"|sed -e 's,/.*$,,'`"
exit ;;
*:GNU/*:*:*)
# other systems with GNU libc and userland
- echo ${UNAME_MACHINE}-unknown-`echo ${UNAME_SYSTEM} | sed 's,^[^/]*/,,' | tr '[A-Z]' '[a-z]'``echo ${UNAME_RELEASE}|sed -e 's/[-(].*//'`-${LIBC}
+ echo "$UNAME_MACHINE-unknown-`echo "$UNAME_SYSTEM" | sed 's,^[^/]*/,,' | tr "[:upper:]" "[:lower:]"``echo "$UNAME_RELEASE"|sed -e 's/[-(].*//'`-$LIBC"
exit ;;
- i*86:Minix:*:*)
- echo ${UNAME_MACHINE}-pc-minix
+ *:Minix:*:*)
+ echo "$UNAME_MACHINE"-unknown-minix
exit ;;
aarch64:Linux:*:*)
- echo ${UNAME_MACHINE}-unknown-linux-${LIBC}
+ echo "$UNAME_MACHINE"-unknown-linux-"$LIBC"
exit ;;
aarch64_be:Linux:*:*)
UNAME_MACHINE=aarch64_be
- echo ${UNAME_MACHINE}-unknown-linux-${LIBC}
+ echo "$UNAME_MACHINE"-unknown-linux-"$LIBC"
exit ;;
alpha:Linux:*:*)
- case `sed -n '/^cpu model/s/^.*: \(.*\)/\1/p' < /proc/cpuinfo` in
+ case `sed -n '/^cpu model/s/^.*: \(.*\)/\1/p' /proc/cpuinfo 2>/dev/null` in
EV5) UNAME_MACHINE=alphaev5 ;;
EV56) UNAME_MACHINE=alphaev56 ;;
PCA56) UNAME_MACHINE=alphapca56 ;;
@@ -902,129 +936,169 @@ EOF
EV68*) UNAME_MACHINE=alphaev68 ;;
esac
objdump --private-headers /bin/sh | grep -q ld.so.1
- if test "$?" = 0 ; then LIBC="gnulibc1" ; fi
- echo ${UNAME_MACHINE}-unknown-linux-${LIBC}
+ if test "$?" = 0 ; then LIBC=gnulibc1 ; fi
+ echo "$UNAME_MACHINE"-unknown-linux-"$LIBC"
exit ;;
arc:Linux:*:* | arceb:Linux:*:*)
- echo ${UNAME_MACHINE}-unknown-linux-${LIBC}
+ echo "$UNAME_MACHINE"-unknown-linux-"$LIBC"
exit ;;
arm*:Linux:*:*)
- eval $set_cc_for_build
+ set_cc_for_build
if echo __ARM_EABI__ | $CC_FOR_BUILD -E - 2>/dev/null \
| grep -q __ARM_EABI__
then
- echo ${UNAME_MACHINE}-unknown-linux-${LIBC}
+ echo "$UNAME_MACHINE"-unknown-linux-"$LIBC"
else
if echo __ARM_PCS_VFP | $CC_FOR_BUILD -E - 2>/dev/null \
| grep -q __ARM_PCS_VFP
then
- echo ${UNAME_MACHINE}-unknown-linux-${LIBC}eabi
+ echo "$UNAME_MACHINE"-unknown-linux-"$LIBC"eabi
else
- echo ${UNAME_MACHINE}-unknown-linux-${LIBC}eabihf
+ echo "$UNAME_MACHINE"-unknown-linux-"$LIBC"eabihf
fi
fi
exit ;;
avr32*:Linux:*:*)
- echo ${UNAME_MACHINE}-unknown-linux-${LIBC}
+ echo "$UNAME_MACHINE"-unknown-linux-"$LIBC"
exit ;;
cris:Linux:*:*)
- echo ${UNAME_MACHINE}-axis-linux-${LIBC}
+ echo "$UNAME_MACHINE"-axis-linux-"$LIBC"
exit ;;
crisv32:Linux:*:*)
- echo ${UNAME_MACHINE}-axis-linux-${LIBC}
+ echo "$UNAME_MACHINE"-axis-linux-"$LIBC"
+ exit ;;
+ e2k:Linux:*:*)
+ echo "$UNAME_MACHINE"-unknown-linux-"$LIBC"
exit ;;
frv:Linux:*:*)
- echo ${UNAME_MACHINE}-unknown-linux-${LIBC}
+ echo "$UNAME_MACHINE"-unknown-linux-"$LIBC"
exit ;;
hexagon:Linux:*:*)
- echo ${UNAME_MACHINE}-unknown-linux-${LIBC}
+ echo "$UNAME_MACHINE"-unknown-linux-"$LIBC"
exit ;;
i*86:Linux:*:*)
- echo ${UNAME_MACHINE}-pc-linux-${LIBC}
+ echo "$UNAME_MACHINE"-pc-linux-"$LIBC"
exit ;;
ia64:Linux:*:*)
- echo ${UNAME_MACHINE}-unknown-linux-${LIBC}
+ echo "$UNAME_MACHINE"-unknown-linux-"$LIBC"
+ exit ;;
+ k1om:Linux:*:*)
+ echo "$UNAME_MACHINE"-unknown-linux-"$LIBC"
exit ;;
m32r*:Linux:*:*)
- echo ${UNAME_MACHINE}-unknown-linux-${LIBC}
+ echo "$UNAME_MACHINE"-unknown-linux-"$LIBC"
exit ;;
m68*:Linux:*:*)
- echo ${UNAME_MACHINE}-unknown-linux-${LIBC}
+ echo "$UNAME_MACHINE"-unknown-linux-"$LIBC"
exit ;;
mips:Linux:*:* | mips64:Linux:*:*)
- eval $set_cc_for_build
- sed 's/^ //' << EOF >$dummy.c
+ set_cc_for_build
+ IS_GLIBC=0
+ test x"${LIBC}" = xgnu && IS_GLIBC=1
+ sed 's/^ //' << EOF > "$dummy.c"
#undef CPU
- #undef ${UNAME_MACHINE}
- #undef ${UNAME_MACHINE}el
+ #undef mips
+ #undef mipsel
+ #undef mips64
+ #undef mips64el
+ #if ${IS_GLIBC} && defined(_ABI64)
+ LIBCABI=gnuabi64
+ #else
+ #if ${IS_GLIBC} && defined(_ABIN32)
+ LIBCABI=gnuabin32
+ #else
+ LIBCABI=${LIBC}
+ #endif
+ #endif
+
+ #if ${IS_GLIBC} && defined(__mips64) && defined(__mips_isa_rev) && __mips_isa_rev>=6
+ CPU=mipsisa64r6
+ #else
+ #if ${IS_GLIBC} && !defined(__mips64) && defined(__mips_isa_rev) && __mips_isa_rev>=6
+ CPU=mipsisa32r6
+ #else
+ #if defined(__mips64)
+ CPU=mips64
+ #else
+ CPU=mips
+ #endif
+ #endif
+ #endif
+
#if defined(__MIPSEL__) || defined(__MIPSEL) || defined(_MIPSEL) || defined(MIPSEL)
- CPU=${UNAME_MACHINE}el
+ MIPS_ENDIAN=el
#else
#if defined(__MIPSEB__) || defined(__MIPSEB) || defined(_MIPSEB) || defined(MIPSEB)
- CPU=${UNAME_MACHINE}
+ MIPS_ENDIAN=
#else
- CPU=
+ MIPS_ENDIAN=
#endif
#endif
EOF
- eval `$CC_FOR_BUILD -E $dummy.c 2>/dev/null | grep '^CPU'`
- test x"${CPU}" != x && { echo "${CPU}-unknown-linux-${LIBC}"; exit; }
+ eval "`$CC_FOR_BUILD -E "$dummy.c" 2>/dev/null | grep '^CPU\|^MIPS_ENDIAN\|^LIBCABI'`"
+ test "x$CPU" != x && { echo "$CPU${MIPS_ENDIAN}-unknown-linux-$LIBCABI"; exit; }
;;
+ mips64el:Linux:*:*)
+ echo "$UNAME_MACHINE"-unknown-linux-"$LIBC"
+ exit ;;
openrisc*:Linux:*:*)
- echo or1k-unknown-linux-${LIBC}
+ echo or1k-unknown-linux-"$LIBC"
exit ;;
or32:Linux:*:* | or1k*:Linux:*:*)
- echo ${UNAME_MACHINE}-unknown-linux-${LIBC}
+ echo "$UNAME_MACHINE"-unknown-linux-"$LIBC"
exit ;;
padre:Linux:*:*)
- echo sparc-unknown-linux-${LIBC}
+ echo sparc-unknown-linux-"$LIBC"
exit ;;
parisc64:Linux:*:* | hppa64:Linux:*:*)
- echo hppa64-unknown-linux-${LIBC}
+ echo hppa64-unknown-linux-"$LIBC"
exit ;;
parisc:Linux:*:* | hppa:Linux:*:*)
# Look for CPU level
case `grep '^cpu[^a-z]*:' /proc/cpuinfo 2>/dev/null | cut -d' ' -f2` in
- PA7*) echo hppa1.1-unknown-linux-${LIBC} ;;
- PA8*) echo hppa2.0-unknown-linux-${LIBC} ;;
- *) echo hppa-unknown-linux-${LIBC} ;;
+ PA7*) echo hppa1.1-unknown-linux-"$LIBC" ;;
+ PA8*) echo hppa2.0-unknown-linux-"$LIBC" ;;
+ *) echo hppa-unknown-linux-"$LIBC" ;;
esac
exit ;;
ppc64:Linux:*:*)
- echo powerpc64-unknown-linux-${LIBC}
+ echo powerpc64-unknown-linux-"$LIBC"
exit ;;
ppc:Linux:*:*)
- echo powerpc-unknown-linux-${LIBC}
+ echo powerpc-unknown-linux-"$LIBC"
exit ;;
ppc64le:Linux:*:*)
- echo powerpc64le-unknown-linux-${LIBC}
+ echo powerpc64le-unknown-linux-"$LIBC"
exit ;;
ppcle:Linux:*:*)
- echo powerpcle-unknown-linux-${LIBC}
+ echo powerpcle-unknown-linux-"$LIBC"
+ exit ;;
+ riscv32:Linux:*:* | riscv64:Linux:*:*)
+ echo "$UNAME_MACHINE"-unknown-linux-"$LIBC"
exit ;;
s390:Linux:*:* | s390x:Linux:*:*)
- echo ${UNAME_MACHINE}-ibm-linux-${LIBC}
+ echo "$UNAME_MACHINE"-ibm-linux-"$LIBC"
exit ;;
sh64*:Linux:*:*)
- echo ${UNAME_MACHINE}-unknown-linux-${LIBC}
+ echo "$UNAME_MACHINE"-unknown-linux-"$LIBC"
exit ;;
sh*:Linux:*:*)
- echo ${UNAME_MACHINE}-unknown-linux-${LIBC}
+ echo "$UNAME_MACHINE"-unknown-linux-"$LIBC"
exit ;;
sparc:Linux:*:* | sparc64:Linux:*:*)
- echo ${UNAME_MACHINE}-unknown-linux-${LIBC}
+ echo "$UNAME_MACHINE"-unknown-linux-"$LIBC"
exit ;;
tile*:Linux:*:*)
- echo ${UNAME_MACHINE}-unknown-linux-${LIBC}
+ echo "$UNAME_MACHINE"-unknown-linux-"$LIBC"
exit ;;
vax:Linux:*:*)
- echo ${UNAME_MACHINE}-dec-linux-${LIBC}
+ echo "$UNAME_MACHINE"-dec-linux-"$LIBC"
exit ;;
x86_64:Linux:*:*)
- echo ${UNAME_MACHINE}-unknown-linux-${LIBC}
+ echo "$UNAME_MACHINE"-pc-linux-"$LIBC"
exit ;;
xtensa*:Linux:*:*)
- echo ${UNAME_MACHINE}-unknown-linux-${LIBC}
+ echo "$UNAME_MACHINE"-unknown-linux-"$LIBC"
exit ;;
i*86:DYNIX/ptx:4*:*)
# ptx 4.0 does uname -s correctly, with DYNIX/ptx in there.
@@ -1038,34 +1112,34 @@ EOF
# I am not positive that other SVR4 systems won't match this,
# I just have to hope. -- rms.
# Use sysv4.2uw... so that sysv4* matches it.
- echo ${UNAME_MACHINE}-pc-sysv4.2uw${UNAME_VERSION}
+ echo "$UNAME_MACHINE"-pc-sysv4.2uw"$UNAME_VERSION"
exit ;;
i*86:OS/2:*:*)
# If we were able to find `uname', then EMX Unix compatibility
# is probably installed.
- echo ${UNAME_MACHINE}-pc-os2-emx
+ echo "$UNAME_MACHINE"-pc-os2-emx
exit ;;
i*86:XTS-300:*:STOP)
- echo ${UNAME_MACHINE}-unknown-stop
+ echo "$UNAME_MACHINE"-unknown-stop
exit ;;
i*86:atheos:*:*)
- echo ${UNAME_MACHINE}-unknown-atheos
+ echo "$UNAME_MACHINE"-unknown-atheos
exit ;;
i*86:syllable:*:*)
- echo ${UNAME_MACHINE}-pc-syllable
+ echo "$UNAME_MACHINE"-pc-syllable
exit ;;
i*86:LynxOS:2.*:* | i*86:LynxOS:3.[01]*:* | i*86:LynxOS:4.[02]*:*)
- echo i386-unknown-lynxos${UNAME_RELEASE}
+ echo i386-unknown-lynxos"$UNAME_RELEASE"
exit ;;
i*86:*DOS:*:*)
- echo ${UNAME_MACHINE}-pc-msdosdjgpp
+ echo "$UNAME_MACHINE"-pc-msdosdjgpp
exit ;;
- i*86:*:4.*:* | i*86:SYSTEM_V:4.*:*)
- UNAME_REL=`echo ${UNAME_RELEASE} | sed 's/\/MP$//'`
+ i*86:*:4.*:*)
+ UNAME_REL=`echo "$UNAME_RELEASE" | sed 's/\/MP$//'`
if grep Novell /usr/include/link.h >/dev/null 2>/dev/null; then
- echo ${UNAME_MACHINE}-univel-sysv${UNAME_REL}
+ echo "$UNAME_MACHINE"-univel-sysv"$UNAME_REL"
else
- echo ${UNAME_MACHINE}-pc-sysv${UNAME_REL}
+ echo "$UNAME_MACHINE"-pc-sysv"$UNAME_REL"
fi
exit ;;
i*86:*:5:[678]*)
@@ -1075,12 +1149,12 @@ EOF
*Pentium) UNAME_MACHINE=i586 ;;
*Pent*|*Celeron) UNAME_MACHINE=i686 ;;
esac
- echo ${UNAME_MACHINE}-unknown-sysv${UNAME_RELEASE}${UNAME_SYSTEM}${UNAME_VERSION}
+ echo "$UNAME_MACHINE-unknown-sysv${UNAME_RELEASE}${UNAME_SYSTEM}${UNAME_VERSION}"
exit ;;
i*86:*:3.2:*)
if test -f /usr/options/cb.name; then
UNAME_REL=`sed -n 's/.*Version //p' /dev/null >/dev/null ; then
UNAME_REL=`(/bin/uname -X|grep Release|sed -e 's/.*= //')`
(/bin/uname -X|grep i80486 >/dev/null) && UNAME_MACHINE=i486
@@ -1090,9 +1164,9 @@ EOF
&& UNAME_MACHINE=i686
(/bin/uname -X|grep '^Machine.*Pentium Pro' >/dev/null) \
&& UNAME_MACHINE=i686
- echo ${UNAME_MACHINE}-pc-sco$UNAME_REL
+ echo "$UNAME_MACHINE"-pc-sco"$UNAME_REL"
else
- echo ${UNAME_MACHINE}-pc-sysv32
+ echo "$UNAME_MACHINE"-pc-sysv32
fi
exit ;;
pc:*:*:*)
@@ -1100,7 +1174,7 @@ EOF
# uname -m prints for DJGPP always 'pc', but it prints nothing about
# the processor, so we play safe by assuming i586.
# Note: whatever this is, it MUST be the same as what config.sub
- # prints for the "djgpp" host, or else GDB configury will decide that
+ # prints for the "djgpp" host, or else GDB configure will decide that
# this is a cross-build.
echo i586-pc-msdosdjgpp
exit ;;
@@ -1112,9 +1186,9 @@ EOF
exit ;;
i860:*:4.*:*) # i860-SVR4
if grep Stardent /usr/include/sys/uadmin.h >/dev/null 2>&1 ; then
- echo i860-stardent-sysv${UNAME_RELEASE} # Stardent Vistra i860-SVR4
+ echo i860-stardent-sysv"$UNAME_RELEASE" # Stardent Vistra i860-SVR4
else # Add other i860-SVR4 vendors below as they are discovered.
- echo i860-unknown-sysv${UNAME_RELEASE} # Unknown i860-SVR4
+ echo i860-unknown-sysv"$UNAME_RELEASE" # Unknown i860-SVR4
fi
exit ;;
mini*:CTIX:SYS*5:*)
@@ -1134,9 +1208,9 @@ EOF
test -r /etc/.relid \
&& OS_REL=.`sed -n 's/[^ ]* [^ ]* \([0-9][0-9]\).*/\1/p' < /etc/.relid`
/bin/uname -p 2>/dev/null | grep 86 >/dev/null \
- && { echo i486-ncr-sysv4.3${OS_REL}; exit; }
+ && { echo i486-ncr-sysv4.3"$OS_REL"; exit; }
/bin/uname -p 2>/dev/null | /bin/grep entium >/dev/null \
- && { echo i586-ncr-sysv4.3${OS_REL}; exit; } ;;
+ && { echo i586-ncr-sysv4.3"$OS_REL"; exit; } ;;
3[34]??:*:4.0:* | 3[34]??,*:*:4.0:*)
/bin/uname -p 2>/dev/null | grep 86 >/dev/null \
&& { echo i486-ncr-sysv4; exit; } ;;
@@ -1145,28 +1219,28 @@ EOF
test -r /etc/.relid \
&& OS_REL=.`sed -n 's/[^ ]* [^ ]* \([0-9][0-9]\).*/\1/p' < /etc/.relid`
/bin/uname -p 2>/dev/null | grep 86 >/dev/null \
- && { echo i486-ncr-sysv4.3${OS_REL}; exit; }
+ && { echo i486-ncr-sysv4.3"$OS_REL"; exit; }
/bin/uname -p 2>/dev/null | /bin/grep entium >/dev/null \
- && { echo i586-ncr-sysv4.3${OS_REL}; exit; }
+ && { echo i586-ncr-sysv4.3"$OS_REL"; exit; }
/bin/uname -p 2>/dev/null | /bin/grep pteron >/dev/null \
- && { echo i586-ncr-sysv4.3${OS_REL}; exit; } ;;
+ && { echo i586-ncr-sysv4.3"$OS_REL"; exit; } ;;
m68*:LynxOS:2.*:* | m68*:LynxOS:3.0*:*)
- echo m68k-unknown-lynxos${UNAME_RELEASE}
+ echo m68k-unknown-lynxos"$UNAME_RELEASE"
exit ;;
mc68030:UNIX_System_V:4.*:*)
echo m68k-atari-sysv4
exit ;;
TSUNAMI:LynxOS:2.*:*)
- echo sparc-unknown-lynxos${UNAME_RELEASE}
+ echo sparc-unknown-lynxos"$UNAME_RELEASE"
exit ;;
rs6000:LynxOS:2.*:*)
- echo rs6000-unknown-lynxos${UNAME_RELEASE}
+ echo rs6000-unknown-lynxos"$UNAME_RELEASE"
exit ;;
PowerPC:LynxOS:2.*:* | PowerPC:LynxOS:3.[01]*:* | PowerPC:LynxOS:4.[02]*:*)
- echo powerpc-unknown-lynxos${UNAME_RELEASE}
+ echo powerpc-unknown-lynxos"$UNAME_RELEASE"
exit ;;
SM[BE]S:UNIX_SV:*:*)
- echo mips-dde-sysv${UNAME_RELEASE}
+ echo mips-dde-sysv"$UNAME_RELEASE"
exit ;;
RM*:ReliantUNIX-*:*:*)
echo mips-sni-sysv4
@@ -1177,7 +1251,7 @@ EOF
*:SINIX-*:*:*)
if uname -p 2>/dev/null >/dev/null ; then
UNAME_MACHINE=`(uname -p) 2>/dev/null`
- echo ${UNAME_MACHINE}-sni-sysv4
+ echo "$UNAME_MACHINE"-sni-sysv4
else
echo ns32k-sni-sysv
fi
@@ -1197,23 +1271,23 @@ EOF
exit ;;
i*86:VOS:*:*)
# From Paul.Green@stratus.com.
- echo ${UNAME_MACHINE}-stratus-vos
+ echo "$UNAME_MACHINE"-stratus-vos
exit ;;
*:VOS:*:*)
# From Paul.Green@stratus.com.
echo hppa1.1-stratus-vos
exit ;;
mc68*:A/UX:*:*)
- echo m68k-apple-aux${UNAME_RELEASE}
+ echo m68k-apple-aux"$UNAME_RELEASE"
exit ;;
news*:NEWS-OS:6*:*)
echo mips-sony-newsos6
exit ;;
R[34]000:*System_V*:*:* | R4000:UNIX_SYSV:*:* | R*000:UNIX_SV:*:*)
if [ -d /usr/nec ]; then
- echo mips-nec-sysv${UNAME_RELEASE}
+ echo mips-nec-sysv"$UNAME_RELEASE"
else
- echo mips-unknown-sysv${UNAME_RELEASE}
+ echo mips-unknown-sysv"$UNAME_RELEASE"
fi
exit ;;
BeBox:BeOS:*:*) # BeOS running on hardware made by Be, PPC only.
@@ -1232,77 +1306,94 @@ EOF
echo x86_64-unknown-haiku
exit ;;
SX-4:SUPER-UX:*:*)
- echo sx4-nec-superux${UNAME_RELEASE}
+ echo sx4-nec-superux"$UNAME_RELEASE"
exit ;;
SX-5:SUPER-UX:*:*)
- echo sx5-nec-superux${UNAME_RELEASE}
+ echo sx5-nec-superux"$UNAME_RELEASE"
exit ;;
SX-6:SUPER-UX:*:*)
- echo sx6-nec-superux${UNAME_RELEASE}
+ echo sx6-nec-superux"$UNAME_RELEASE"
exit ;;
SX-7:SUPER-UX:*:*)
- echo sx7-nec-superux${UNAME_RELEASE}
+ echo sx7-nec-superux"$UNAME_RELEASE"
exit ;;
SX-8:SUPER-UX:*:*)
- echo sx8-nec-superux${UNAME_RELEASE}
+ echo sx8-nec-superux"$UNAME_RELEASE"
exit ;;
SX-8R:SUPER-UX:*:*)
- echo sx8r-nec-superux${UNAME_RELEASE}
+ echo sx8r-nec-superux"$UNAME_RELEASE"
+ exit ;;
+ SX-ACE:SUPER-UX:*:*)
+ echo sxace-nec-superux"$UNAME_RELEASE"
exit ;;
Power*:Rhapsody:*:*)
- echo powerpc-apple-rhapsody${UNAME_RELEASE}
+ echo powerpc-apple-rhapsody"$UNAME_RELEASE"
exit ;;
*:Rhapsody:*:*)
- echo ${UNAME_MACHINE}-apple-rhapsody${UNAME_RELEASE}
+ echo "$UNAME_MACHINE"-apple-rhapsody"$UNAME_RELEASE"
exit ;;
*:Darwin:*:*)
- UNAME_PROCESSOR=`uname -p` || UNAME_PROCESSOR=unknown
- eval $set_cc_for_build
- if test "$UNAME_PROCESSOR" = unknown ; then
- UNAME_PROCESSOR=powerpc
+ UNAME_PROCESSOR=`uname -p`
+ case $UNAME_PROCESSOR in
+ unknown) UNAME_PROCESSOR=powerpc ;;
+ esac
+ if command -v xcode-select > /dev/null 2> /dev/null && \
+ ! xcode-select --print-path > /dev/null 2> /dev/null ; then
+ # Avoid executing cc if there is no toolchain installed as
+ # cc will be a stub that puts up a graphical alert
+ # prompting the user to install developer tools.
+ CC_FOR_BUILD=no_compiler_found
+ else
+ set_cc_for_build
fi
- if test `echo "$UNAME_RELEASE" | sed -e 's/\..*//'` -le 10 ; then
- if [ "$CC_FOR_BUILD" != 'no_compiler_found' ]; then
- if (echo '#ifdef __LP64__'; echo IS_64BIT_ARCH; echo '#endif') | \
- (CCOPTS= $CC_FOR_BUILD -E - 2>/dev/null) | \
- grep IS_64BIT_ARCH >/dev/null
- then
- case $UNAME_PROCESSOR in
- i386) UNAME_PROCESSOR=x86_64 ;;
- powerpc) UNAME_PROCESSOR=powerpc64 ;;
- esac
- fi
+ if [ "$CC_FOR_BUILD" != no_compiler_found ]; then
+ if (echo '#ifdef __LP64__'; echo IS_64BIT_ARCH; echo '#endif') | \
+ (CCOPTS="" $CC_FOR_BUILD -E - 2>/dev/null) | \
+ grep IS_64BIT_ARCH >/dev/null
+ then
+ case $UNAME_PROCESSOR in
+ i386) UNAME_PROCESSOR=x86_64 ;;
+ powerpc) UNAME_PROCESSOR=powerpc64 ;;
+ esac
+ fi
+ # On 10.4-10.6 one might compile for PowerPC via gcc -arch ppc
+ if (echo '#ifdef __POWERPC__'; echo IS_PPC; echo '#endif') | \
+ (CCOPTS="" $CC_FOR_BUILD -E - 2>/dev/null) | \
+ grep IS_PPC >/dev/null
+ then
+ UNAME_PROCESSOR=powerpc
fi
elif test "$UNAME_PROCESSOR" = i386 ; then
- # Avoid executing cc on OS X 10.9, as it ships with a stub
- # that puts up a graphical alert prompting to install
- # developer tools. Any system running Mac OS X 10.7 or
- # later (Darwin 11 and later) is required to have a 64-bit
- # processor. This is not true of the ARM version of Darwin
- # that Apple uses in portable devices.
- UNAME_PROCESSOR=x86_64
+ # uname -m returns i386 or x86_64
+ UNAME_PROCESSOR=$UNAME_MACHINE
fi
- echo ${UNAME_PROCESSOR}-apple-darwin${UNAME_RELEASE}
+ echo "$UNAME_PROCESSOR"-apple-darwin"$UNAME_RELEASE"
exit ;;
*:procnto*:*:* | *:QNX:[0123456789]*:*)
UNAME_PROCESSOR=`uname -p`
- if test "$UNAME_PROCESSOR" = "x86"; then
+ if test "$UNAME_PROCESSOR" = x86; then
UNAME_PROCESSOR=i386
UNAME_MACHINE=pc
fi
- echo ${UNAME_PROCESSOR}-${UNAME_MACHINE}-nto-qnx${UNAME_RELEASE}
+ echo "$UNAME_PROCESSOR"-"$UNAME_MACHINE"-nto-qnx"$UNAME_RELEASE"
exit ;;
*:QNX:*:4*)
echo i386-pc-qnx
exit ;;
- NEO-?:NONSTOP_KERNEL:*:*)
- echo neo-tandem-nsk${UNAME_RELEASE}
+ NEO-*:NONSTOP_KERNEL:*:*)
+ echo neo-tandem-nsk"$UNAME_RELEASE"
exit ;;
NSE-*:NONSTOP_KERNEL:*:*)
- echo nse-tandem-nsk${UNAME_RELEASE}
+ echo nse-tandem-nsk"$UNAME_RELEASE"
exit ;;
- NSR-?:NONSTOP_KERNEL:*:*)
- echo nsr-tandem-nsk${UNAME_RELEASE}
+ NSR-*:NONSTOP_KERNEL:*:*)
+ echo nsr-tandem-nsk"$UNAME_RELEASE"
+ exit ;;
+ NSV-*:NONSTOP_KERNEL:*:*)
+ echo nsv-tandem-nsk"$UNAME_RELEASE"
+ exit ;;
+ NSX-*:NONSTOP_KERNEL:*:*)
+ echo nsx-tandem-nsk"$UNAME_RELEASE"
exit ;;
*:NonStop-UX:*:*)
echo mips-compaq-nonstopux
@@ -1311,18 +1402,19 @@ EOF
echo bs2000-siemens-sysv
exit ;;
DS/*:UNIX_System_V:*:*)
- echo ${UNAME_MACHINE}-${UNAME_SYSTEM}-${UNAME_RELEASE}
+ echo "$UNAME_MACHINE"-"$UNAME_SYSTEM"-"$UNAME_RELEASE"
exit ;;
*:Plan9:*:*)
# "uname -m" is not consistent, so use $cputype instead. 386
# is converted to i386 for consistency with other x86
# operating systems.
- if test "$cputype" = "386"; then
+ # shellcheck disable=SC2154
+ if test "$cputype" = 386; then
UNAME_MACHINE=i386
else
UNAME_MACHINE="$cputype"
fi
- echo ${UNAME_MACHINE}-unknown-plan9
+ echo "$UNAME_MACHINE"-unknown-plan9
exit ;;
*:TOPS-10:*:*)
echo pdp10-unknown-tops10
@@ -1343,14 +1435,14 @@ EOF
echo pdp10-unknown-its
exit ;;
SEI:*:*:SEIUX)
- echo mips-sei-seiux${UNAME_RELEASE}
+ echo mips-sei-seiux"$UNAME_RELEASE"
exit ;;
*:DragonFly:*:*)
- echo ${UNAME_MACHINE}-unknown-dragonfly`echo ${UNAME_RELEASE}|sed -e 's/[-(].*//'`
+ echo "$UNAME_MACHINE"-unknown-dragonfly"`echo "$UNAME_RELEASE"|sed -e 's/[-(].*//'`"
exit ;;
*:*VMS:*:*)
UNAME_MACHINE=`(uname -p) 2>/dev/null`
- case "${UNAME_MACHINE}" in
+ case "$UNAME_MACHINE" in
A*) echo alpha-dec-vms ; exit ;;
I*) echo ia64-dec-vms ; exit ;;
V*) echo vax-dec-vms ; exit ;;
@@ -1359,34 +1451,188 @@ EOF
echo i386-pc-xenix
exit ;;
i*86:skyos:*:*)
- echo ${UNAME_MACHINE}-pc-skyos`echo ${UNAME_RELEASE}` | sed -e 's/ .*$//'
+ echo "$UNAME_MACHINE"-pc-skyos"`echo "$UNAME_RELEASE" | sed -e 's/ .*$//'`"
exit ;;
i*86:rdos:*:*)
- echo ${UNAME_MACHINE}-pc-rdos
+ echo "$UNAME_MACHINE"-pc-rdos
exit ;;
i*86:AROS:*:*)
- echo ${UNAME_MACHINE}-pc-aros
+ echo "$UNAME_MACHINE"-pc-aros
exit ;;
x86_64:VMkernel:*:*)
- echo ${UNAME_MACHINE}-unknown-esx
+ echo "$UNAME_MACHINE"-unknown-esx
+ exit ;;
+ amd64:Isilon\ OneFS:*:*)
+ echo x86_64-unknown-onefs
+ exit ;;
+ *:Unleashed:*:*)
+ echo "$UNAME_MACHINE"-unknown-unleashed"$UNAME_RELEASE"
exit ;;
esac
+# No uname command or uname output not recognized.
+set_cc_for_build
+cat > "$dummy.c" <
+#include
+#endif
+#if defined(ultrix) || defined(_ultrix) || defined(__ultrix) || defined(__ultrix__)
+#if defined (vax) || defined (__vax) || defined (__vax__) || defined(mips) || defined(__mips) || defined(__mips__) || defined(MIPS) || defined(__MIPS__)
+#include
+#if defined(_SIZE_T_) || defined(SIGLOST)
+#include
+#endif
+#endif
+#endif
+main ()
+{
+#if defined (sony)
+#if defined (MIPSEB)
+ /* BFD wants "bsd" instead of "newsos". Perhaps BFD should be changed,
+ I don't know.... */
+ printf ("mips-sony-bsd\n"); exit (0);
+#else
+#include
+ printf ("m68k-sony-newsos%s\n",
+#ifdef NEWSOS4
+ "4"
+#else
+ ""
+#endif
+ ); exit (0);
+#endif
+#endif
+
+#if defined (NeXT)
+#if !defined (__ARCHITECTURE__)
+#define __ARCHITECTURE__ "m68k"
+#endif
+ int version;
+ version=`(hostinfo | sed -n 's/.*NeXT Mach \([0-9]*\).*/\1/p') 2>/dev/null`;
+ if (version < 4)
+ printf ("%s-next-nextstep%d\n", __ARCHITECTURE__, version);
+ else
+ printf ("%s-next-openstep%d\n", __ARCHITECTURE__, version);
+ exit (0);
+#endif
+
+#if defined (MULTIMAX) || defined (n16)
+#if defined (UMAXV)
+ printf ("ns32k-encore-sysv\n"); exit (0);
+#else
+#if defined (CMU)
+ printf ("ns32k-encore-mach\n"); exit (0);
+#else
+ printf ("ns32k-encore-bsd\n"); exit (0);
+#endif
+#endif
+#endif
+
+#if defined (__386BSD__)
+ printf ("i386-pc-bsd\n"); exit (0);
+#endif
+
+#if defined (sequent)
+#if defined (i386)
+ printf ("i386-sequent-dynix\n"); exit (0);
+#endif
+#if defined (ns32000)
+ printf ("ns32k-sequent-dynix\n"); exit (0);
+#endif
+#endif
+
+#if defined (_SEQUENT_)
+ struct utsname un;
+
+ uname(&un);
+ if (strncmp(un.version, "V2", 2) == 0) {
+ printf ("i386-sequent-ptx2\n"); exit (0);
+ }
+ if (strncmp(un.version, "V1", 2) == 0) { /* XXX is V1 correct? */
+ printf ("i386-sequent-ptx1\n"); exit (0);
+ }
+ printf ("i386-sequent-ptx\n"); exit (0);
+#endif
+
+#if defined (vax)
+#if !defined (ultrix)
+#include
+#if defined (BSD)
+#if BSD == 43
+ printf ("vax-dec-bsd4.3\n"); exit (0);
+#else
+#if BSD == 199006
+ printf ("vax-dec-bsd4.3reno\n"); exit (0);
+#else
+ printf ("vax-dec-bsd\n"); exit (0);
+#endif
+#endif
+#else
+ printf ("vax-dec-bsd\n"); exit (0);
+#endif
+#else
+#if defined(_SIZE_T_) || defined(SIGLOST)
+ struct utsname un;
+ uname (&un);
+ printf ("vax-dec-ultrix%s\n", un.release); exit (0);
+#else
+ printf ("vax-dec-ultrix\n"); exit (0);
+#endif
+#endif
+#endif
+#if defined(ultrix) || defined(_ultrix) || defined(__ultrix) || defined(__ultrix__)
+#if defined(mips) || defined(__mips) || defined(__mips__) || defined(MIPS) || defined(__MIPS__)
+#if defined(_SIZE_T_) || defined(SIGLOST)
+ struct utsname *un;
+ uname (&un);
+ printf ("mips-dec-ultrix%s\n", un.release); exit (0);
+#else
+ printf ("mips-dec-ultrix\n"); exit (0);
+#endif
+#endif
+#endif
+
+#if defined (alliant) && defined (i860)
+ printf ("i860-alliant-bsd\n"); exit (0);
+#endif
+
+ exit (1);
+}
+EOF
+
+$CC_FOR_BUILD -o "$dummy" "$dummy.c" 2>/dev/null && SYSTEM_NAME=`$dummy` &&
+ { echo "$SYSTEM_NAME"; exit; }
+
+# Apollos put the system type in the environment.
+test -d /usr/apollo && { echo "$ISP-apollo-$SYSTYPE"; exit; }
+
+echo "$0: unable to guess system type" >&2
+
+case "$UNAME_MACHINE:$UNAME_SYSTEM" in
+ mips:Linux | mips64:Linux)
+ # If we got here on MIPS GNU/Linux, output extra information.
+ cat >&2 <&2 < in order to provide the needed
-information to handle your system.
+If $0 has already been updated, send the following data and any
+information you think might be pertinent to config-patches@gnu.org to
+provide the necessary information to handle your system.
config.guess timestamp = $timestamp
@@ -1405,16 +1651,16 @@ hostinfo = `(hostinfo) 2>/dev/null`
/usr/bin/oslevel = `(/usr/bin/oslevel) 2>/dev/null`
/usr/convex/getsysinfo = `(/usr/convex/getsysinfo) 2>/dev/null`
-UNAME_MACHINE = ${UNAME_MACHINE}
-UNAME_RELEASE = ${UNAME_RELEASE}
-UNAME_SYSTEM = ${UNAME_SYSTEM}
-UNAME_VERSION = ${UNAME_VERSION}
+UNAME_MACHINE = "$UNAME_MACHINE"
+UNAME_RELEASE = "$UNAME_RELEASE"
+UNAME_SYSTEM = "$UNAME_SYSTEM"
+UNAME_VERSION = "$UNAME_VERSION"
EOF
exit 1
# Local variables:
-# eval: (add-hook 'write-file-hooks 'time-stamp)
+# eval: (add-hook 'before-save-hook 'time-stamp)
# time-stamp-start: "timestamp='"
# time-stamp-format: "%:y-%02m-%02d"
# time-stamp-end: "'"
diff --git a/gcc/mpc/build-aux/config.sub b/gcc/mpc/build-aux/config.sub
new file mode 100755
index 0000000000..a3f11f8f32
--- /dev/null
+++ b/gcc/mpc/build-aux/config.sub
@@ -0,0 +1,1793 @@
+#!/bin/sh
+# Configuration validation subroutine script.
+# Copyright 1992-2020 Free Software Foundation, Inc.
+
+timestamp='2020-01-01'
+
+# This file is free software; you can redistribute it and/or modify it
+# under the terms of the GNU General Public License as published by
+# the Free Software Foundation; either version 3 of the License, or
+# (at your option) any later version.
+#
+# This program is distributed in the hope that it will be useful, but
+# WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
+# General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License
+# along with this program; if not, see .
+#
+# As a special exception to the GNU General Public License, if you
+# distribute this file as part of a program that contains a
+# configuration script generated by Autoconf, you may include it under
+# the same distribution terms that you use for the rest of that
+# program. This Exception is an additional permission under section 7
+# of the GNU General Public License, version 3 ("GPLv3").
+
+
+# Please send patches to .
+#
+# Configuration subroutine to validate and canonicalize a configuration type.
+# Supply the specified configuration type as an argument.
+# If it is invalid, we print an error message on stderr and exit with code 1.
+# Otherwise, we print the canonical config type on stdout and succeed.
+
+# You can get the latest version of this script from:
+# https://git.savannah.gnu.org/gitweb/?p=config.git;a=blob_plain;f=config.sub
+
+# This file is supposed to be the same for all GNU packages
+# and recognize all the CPU types, system types and aliases
+# that are meaningful with *any* GNU software.
+# Each package is responsible for reporting which valid configurations
+# it does not support. The user should be able to distinguish
+# a failure to support a valid configuration from a meaningless
+# configuration.
+
+# The goal of this file is to map all the various variations of a given
+# machine specification into a single specification in the form:
+# CPU_TYPE-MANUFACTURER-OPERATING_SYSTEM
+# or in some cases, the newer four-part form:
+# CPU_TYPE-MANUFACTURER-KERNEL-OPERATING_SYSTEM
+# It is wrong to echo any other type of specification.
+
+me=`echo "$0" | sed -e 's,.*/,,'`
+
+usage="\
+Usage: $0 [OPTION] CPU-MFR-OPSYS or ALIAS
+
+Canonicalize a configuration name.
+
+Options:
+ -h, --help print this help, then exit
+ -t, --time-stamp print date of last modification, then exit
+ -v, --version print version number, then exit
+
+Report bugs and patches to ."
+
+version="\
+GNU config.sub ($timestamp)
+
+Copyright 1992-2020 Free Software Foundation, Inc.
+
+This is free software; see the source for copying conditions. There is NO
+warranty; not even for MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE."
+
+help="
+Try \`$me --help' for more information."
+
+# Parse command line
+while test $# -gt 0 ; do
+ case $1 in
+ --time-stamp | --time* | -t )
+ echo "$timestamp" ; exit ;;
+ --version | -v )
+ echo "$version" ; exit ;;
+ --help | --h* | -h )
+ echo "$usage"; exit ;;
+ -- ) # Stop option processing
+ shift; break ;;
+ - ) # Use stdin as input.
+ break ;;
+ -* )
+ echo "$me: invalid option $1$help" >&2
+ exit 1 ;;
+
+ *local*)
+ # First pass through any local machine types.
+ echo "$1"
+ exit ;;
+
+ * )
+ break ;;
+ esac
+done
+
+case $# in
+ 0) echo "$me: missing argument$help" >&2
+ exit 1;;
+ 1) ;;
+ *) echo "$me: too many arguments$help" >&2
+ exit 1;;
+esac
+
+# Split fields of configuration type
+# shellcheck disable=SC2162
+IFS="-" read field1 field2 field3 field4 <&2
+ exit 1
+ ;;
+ *-*-*-*)
+ basic_machine=$field1-$field2
+ os=$field3-$field4
+ ;;
+ *-*-*)
+ # Ambiguous whether COMPANY is present, or skipped and KERNEL-OS is two
+ # parts
+ maybe_os=$field2-$field3
+ case $maybe_os in
+ nto-qnx* | linux-gnu* | linux-android* | linux-dietlibc \
+ | linux-newlib* | linux-musl* | linux-uclibc* | uclinux-uclibc* \
+ | uclinux-gnu* | kfreebsd*-gnu* | knetbsd*-gnu* | netbsd*-gnu* \
+ | netbsd*-eabi* | kopensolaris*-gnu* | cloudabi*-eabi* \
+ | storm-chaos* | os2-emx* | rtmk-nova*)
+ basic_machine=$field1
+ os=$maybe_os
+ ;;
+ android-linux)
+ basic_machine=$field1-unknown
+ os=linux-android
+ ;;
+ *)
+ basic_machine=$field1-$field2
+ os=$field3
+ ;;
+ esac
+ ;;
+ *-*)
+ # A lone config we happen to match not fitting any pattern
+ case $field1-$field2 in
+ decstation-3100)
+ basic_machine=mips-dec
+ os=
+ ;;
+ *-*)
+ # Second component is usually, but not always the OS
+ case $field2 in
+ # Prevent following clause from handling this valid os
+ sun*os*)
+ basic_machine=$field1
+ os=$field2
+ ;;
+ # Manufacturers
+ dec* | mips* | sequent* | encore* | pc533* | sgi* | sony* \
+ | att* | 7300* | 3300* | delta* | motorola* | sun[234]* \
+ | unicom* | ibm* | next | hp | isi* | apollo | altos* \
+ | convergent* | ncr* | news | 32* | 3600* | 3100* \
+ | hitachi* | c[123]* | convex* | sun | crds | omron* | dg \
+ | ultra | tti* | harris | dolphin | highlevel | gould \
+ | cbm | ns | masscomp | apple | axis | knuth | cray \
+ | microblaze* | sim | cisco \
+ | oki | wec | wrs | winbond)
+ basic_machine=$field1-$field2
+ os=
+ ;;
+ *)
+ basic_machine=$field1
+ os=$field2
+ ;;
+ esac
+ ;;
+ esac
+ ;;
+ *)
+ # Convert single-component short-hands not valid as part of
+ # multi-component configurations.
+ case $field1 in
+ 386bsd)
+ basic_machine=i386-pc
+ os=bsd
+ ;;
+ a29khif)
+ basic_machine=a29k-amd
+ os=udi
+ ;;
+ adobe68k)
+ basic_machine=m68010-adobe
+ os=scout
+ ;;
+ alliant)
+ basic_machine=fx80-alliant
+ os=
+ ;;
+ altos | altos3068)
+ basic_machine=m68k-altos
+ os=
+ ;;
+ am29k)
+ basic_machine=a29k-none
+ os=bsd
+ ;;
+ amdahl)
+ basic_machine=580-amdahl
+ os=sysv
+ ;;
+ amiga)
+ basic_machine=m68k-unknown
+ os=
+ ;;
+ amigaos | amigados)
+ basic_machine=m68k-unknown
+ os=amigaos
+ ;;
+ amigaunix | amix)
+ basic_machine=m68k-unknown
+ os=sysv4
+ ;;
+ apollo68)
+ basic_machine=m68k-apollo
+ os=sysv
+ ;;
+ apollo68bsd)
+ basic_machine=m68k-apollo
+ os=bsd
+ ;;
+ aros)
+ basic_machine=i386-pc
+ os=aros
+ ;;
+ aux)
+ basic_machine=m68k-apple
+ os=aux
+ ;;
+ balance)
+ basic_machine=ns32k-sequent
+ os=dynix
+ ;;
+ blackfin)
+ basic_machine=bfin-unknown
+ os=linux
+ ;;
+ cegcc)
+ basic_machine=arm-unknown
+ os=cegcc
+ ;;
+ convex-c1)
+ basic_machine=c1-convex
+ os=bsd
+ ;;
+ convex-c2)
+ basic_machine=c2-convex
+ os=bsd
+ ;;
+ convex-c32)
+ basic_machine=c32-convex
+ os=bsd
+ ;;
+ convex-c34)
+ basic_machine=c34-convex
+ os=bsd
+ ;;
+ convex-c38)
+ basic_machine=c38-convex
+ os=bsd
+ ;;
+ cray)
+ basic_machine=j90-cray
+ os=unicos
+ ;;
+ crds | unos)
+ basic_machine=m68k-crds
+ os=
+ ;;
+ da30)
+ basic_machine=m68k-da30
+ os=
+ ;;
+ decstation | pmax | pmin | dec3100 | decstatn)
+ basic_machine=mips-dec
+ os=
+ ;;
+ delta88)
+ basic_machine=m88k-motorola
+ os=sysv3
+ ;;
+ dicos)
+ basic_machine=i686-pc
+ os=dicos
+ ;;
+ djgpp)
+ basic_machine=i586-pc
+ os=msdosdjgpp
+ ;;
+ ebmon29k)
+ basic_machine=a29k-amd
+ os=ebmon
+ ;;
+ es1800 | OSE68k | ose68k | ose | OSE)
+ basic_machine=m68k-ericsson
+ os=ose
+ ;;
+ gmicro)
+ basic_machine=tron-gmicro
+ os=sysv
+ ;;
+ go32)
+ basic_machine=i386-pc
+ os=go32
+ ;;
+ h8300hms)
+ basic_machine=h8300-hitachi
+ os=hms
+ ;;
+ h8300xray)
+ basic_machine=h8300-hitachi
+ os=xray
+ ;;
+ h8500hms)
+ basic_machine=h8500-hitachi
+ os=hms
+ ;;
+ harris)
+ basic_machine=m88k-harris
+ os=sysv3
+ ;;
+ hp300 | hp300hpux)
+ basic_machine=m68k-hp
+ os=hpux
+ ;;
+ hp300bsd)
+ basic_machine=m68k-hp
+ os=bsd
+ ;;
+ hppaosf)
+ basic_machine=hppa1.1-hp
+ os=osf
+ ;;
+ hppro)
+ basic_machine=hppa1.1-hp
+ os=proelf
+ ;;
+ i386mach)
+ basic_machine=i386-mach
+ os=mach
+ ;;
+ isi68 | isi)
+ basic_machine=m68k-isi
+ os=sysv
+ ;;
+ m68knommu)
+ basic_machine=m68k-unknown
+ os=linux
+ ;;
+ magnum | m3230)
+ basic_machine=mips-mips
+ os=sysv
+ ;;
+ merlin)
+ basic_machine=ns32k-utek
+ os=sysv
+ ;;
+ mingw64)
+ basic_machine=x86_64-pc
+ os=mingw64
+ ;;
+ mingw32)
+ basic_machine=i686-pc
+ os=mingw32
+ ;;
+ mingw32ce)
+ basic_machine=arm-unknown
+ os=mingw32ce
+ ;;
+ monitor)
+ basic_machine=m68k-rom68k
+ os=coff
+ ;;
+ morphos)
+ basic_machine=powerpc-unknown
+ os=morphos
+ ;;
+ moxiebox)
+ basic_machine=moxie-unknown
+ os=moxiebox
+ ;;
+ msdos)
+ basic_machine=i386-pc
+ os=msdos
+ ;;
+ msys)
+ basic_machine=i686-pc
+ os=msys
+ ;;
+ mvs)
+ basic_machine=i370-ibm
+ os=mvs
+ ;;
+ nacl)
+ basic_machine=le32-unknown
+ os=nacl
+ ;;
+ ncr3000)
+ basic_machine=i486-ncr
+ os=sysv4
+ ;;
+ netbsd386)
+ basic_machine=i386-pc
+ os=netbsd
+ ;;
+ netwinder)
+ basic_machine=armv4l-rebel
+ os=linux
+ ;;
+ news | news700 | news800 | news900)
+ basic_machine=m68k-sony
+ os=newsos
+ ;;
+ news1000)
+ basic_machine=m68030-sony
+ os=newsos
+ ;;
+ necv70)
+ basic_machine=v70-nec
+ os=sysv
+ ;;
+ nh3000)
+ basic_machine=m68k-harris
+ os=cxux
+ ;;
+ nh[45]000)
+ basic_machine=m88k-harris
+ os=cxux
+ ;;
+ nindy960)
+ basic_machine=i960-intel
+ os=nindy
+ ;;
+ mon960)
+ basic_machine=i960-intel
+ os=mon960
+ ;;
+ nonstopux)
+ basic_machine=mips-compaq
+ os=nonstopux
+ ;;
+ os400)
+ basic_machine=powerpc-ibm
+ os=os400
+ ;;
+ OSE68000 | ose68000)
+ basic_machine=m68000-ericsson
+ os=ose
+ ;;
+ os68k)
+ basic_machine=m68k-none
+ os=os68k
+ ;;
+ paragon)
+ basic_machine=i860-intel
+ os=osf
+ ;;
+ parisc)
+ basic_machine=hppa-unknown
+ os=linux
+ ;;
+ pw32)
+ basic_machine=i586-unknown
+ os=pw32
+ ;;
+ rdos | rdos64)
+ basic_machine=x86_64-pc
+ os=rdos
+ ;;
+ rdos32)
+ basic_machine=i386-pc
+ os=rdos
+ ;;
+ rom68k)
+ basic_machine=m68k-rom68k
+ os=coff
+ ;;
+ sa29200)
+ basic_machine=a29k-amd
+ os=udi
+ ;;
+ sei)
+ basic_machine=mips-sei
+ os=seiux
+ ;;
+ sequent)
+ basic_machine=i386-sequent
+ os=
+ ;;
+ sps7)
+ basic_machine=m68k-bull
+ os=sysv2
+ ;;
+ st2000)
+ basic_machine=m68k-tandem
+ os=
+ ;;
+ stratus)
+ basic_machine=i860-stratus
+ os=sysv4
+ ;;
+ sun2)
+ basic_machine=m68000-sun
+ os=
+ ;;
+ sun2os3)
+ basic_machine=m68000-sun
+ os=sunos3
+ ;;
+ sun2os4)
+ basic_machine=m68000-sun
+ os=sunos4
+ ;;
+ sun3)
+ basic_machine=m68k-sun
+ os=
+ ;;
+ sun3os3)
+ basic_machine=m68k-sun
+ os=sunos3
+ ;;
+ sun3os4)
+ basic_machine=m68k-sun
+ os=sunos4
+ ;;
+ sun4)
+ basic_machine=sparc-sun
+ os=
+ ;;
+ sun4os3)
+ basic_machine=sparc-sun
+ os=sunos3
+ ;;
+ sun4os4)
+ basic_machine=sparc-sun
+ os=sunos4
+ ;;
+ sun4sol2)
+ basic_machine=sparc-sun
+ os=solaris2
+ ;;
+ sun386 | sun386i | roadrunner)
+ basic_machine=i386-sun
+ os=
+ ;;
+ sv1)
+ basic_machine=sv1-cray
+ os=unicos
+ ;;
+ symmetry)
+ basic_machine=i386-sequent
+ os=dynix
+ ;;
+ t3e)
+ basic_machine=alphaev5-cray
+ os=unicos
+ ;;
+ t90)
+ basic_machine=t90-cray
+ os=unicos
+ ;;
+ toad1)
+ basic_machine=pdp10-xkl
+ os=tops20
+ ;;
+ tpf)
+ basic_machine=s390x-ibm
+ os=tpf
+ ;;
+ udi29k)
+ basic_machine=a29k-amd
+ os=udi
+ ;;
+ ultra3)
+ basic_machine=a29k-nyu
+ os=sym1
+ ;;
+ v810 | necv810)
+ basic_machine=v810-nec
+ os=none
+ ;;
+ vaxv)
+ basic_machine=vax-dec
+ os=sysv
+ ;;
+ vms)
+ basic_machine=vax-dec
+ os=vms
+ ;;
+ vsta)
+ basic_machine=i386-pc
+ os=vsta
+ ;;
+ vxworks960)
+ basic_machine=i960-wrs
+ os=vxworks
+ ;;
+ vxworks68)
+ basic_machine=m68k-wrs
+ os=vxworks
+ ;;
+ vxworks29k)
+ basic_machine=a29k-wrs
+ os=vxworks
+ ;;
+ xbox)
+ basic_machine=i686-pc
+ os=mingw32
+ ;;
+ ymp)
+ basic_machine=ymp-cray
+ os=unicos
+ ;;
+ *)
+ basic_machine=$1
+ os=
+ ;;
+ esac
+ ;;
+esac
+
+# Decode 1-component or ad-hoc basic machines
+case $basic_machine in
+ # Here we handle the default manufacturer of certain CPU types. It is in
+ # some cases the only manufacturer, in others, it is the most popular.
+ w89k)
+ cpu=hppa1.1
+ vendor=winbond
+ ;;
+ op50n)
+ cpu=hppa1.1
+ vendor=oki
+ ;;
+ op60c)
+ cpu=hppa1.1
+ vendor=oki
+ ;;
+ ibm*)
+ cpu=i370
+ vendor=ibm
+ ;;
+ orion105)
+ cpu=clipper
+ vendor=highlevel
+ ;;
+ mac | mpw | mac-mpw)
+ cpu=m68k
+ vendor=apple
+ ;;
+ pmac | pmac-mpw)
+ cpu=powerpc
+ vendor=apple
+ ;;
+
+ # Recognize the various machine names and aliases which stand
+ # for a CPU type and a company and sometimes even an OS.
+ 3b1 | 7300 | 7300-att | att-7300 | pc7300 | safari | unixpc)
+ cpu=m68000
+ vendor=att
+ ;;
+ 3b*)
+ cpu=we32k
+ vendor=att
+ ;;
+ bluegene*)
+ cpu=powerpc
+ vendor=ibm
+ os=cnk
+ ;;
+ decsystem10* | dec10*)
+ cpu=pdp10
+ vendor=dec
+ os=tops10
+ ;;
+ decsystem20* | dec20*)
+ cpu=pdp10
+ vendor=dec
+ os=tops20
+ ;;
+ delta | 3300 | motorola-3300 | motorola-delta \
+ | 3300-motorola | delta-motorola)
+ cpu=m68k
+ vendor=motorola
+ ;;
+ dpx2*)
+ cpu=m68k
+ vendor=bull
+ os=sysv3
+ ;;
+ encore | umax | mmax)
+ cpu=ns32k
+ vendor=encore
+ ;;
+ elxsi)
+ cpu=elxsi
+ vendor=elxsi
+ os=${os:-bsd}
+ ;;
+ fx2800)
+ cpu=i860
+ vendor=alliant
+ ;;
+ genix)
+ cpu=ns32k
+ vendor=ns
+ ;;
+ h3050r* | hiux*)
+ cpu=hppa1.1
+ vendor=hitachi
+ os=hiuxwe2
+ ;;
+ hp3k9[0-9][0-9] | hp9[0-9][0-9])
+ cpu=hppa1.0
+ vendor=hp
+ ;;
+ hp9k2[0-9][0-9] | hp9k31[0-9])
+ cpu=m68000
+ vendor=hp
+ ;;
+ hp9k3[2-9][0-9])
+ cpu=m68k
+ vendor=hp
+ ;;
+ hp9k6[0-9][0-9] | hp6[0-9][0-9])
+ cpu=hppa1.0
+ vendor=hp
+ ;;
+ hp9k7[0-79][0-9] | hp7[0-79][0-9])
+ cpu=hppa1.1
+ vendor=hp
+ ;;
+ hp9k78[0-9] | hp78[0-9])
+ # FIXME: really hppa2.0-hp
+ cpu=hppa1.1
+ vendor=hp
+ ;;
+ hp9k8[67]1 | hp8[67]1 | hp9k80[24] | hp80[24] | hp9k8[78]9 | hp8[78]9 | hp9k893 | hp893)
+ # FIXME: really hppa2.0-hp
+ cpu=hppa1.1
+ vendor=hp
+ ;;
+ hp9k8[0-9][13679] | hp8[0-9][13679])
+ cpu=hppa1.1
+ vendor=hp
+ ;;
+ hp9k8[0-9][0-9] | hp8[0-9][0-9])
+ cpu=hppa1.0
+ vendor=hp
+ ;;
+ i*86v32)
+ cpu=`echo "$1" | sed -e 's/86.*/86/'`
+ vendor=pc
+ os=sysv32
+ ;;
+ i*86v4*)
+ cpu=`echo "$1" | sed -e 's/86.*/86/'`
+ vendor=pc
+ os=sysv4
+ ;;
+ i*86v)
+ cpu=`echo "$1" | sed -e 's/86.*/86/'`
+ vendor=pc
+ os=sysv
+ ;;
+ i*86sol2)
+ cpu=`echo "$1" | sed -e 's/86.*/86/'`
+ vendor=pc
+ os=solaris2
+ ;;
+ j90 | j90-cray)
+ cpu=j90
+ vendor=cray
+ os=${os:-unicos}
+ ;;
+ iris | iris4d)
+ cpu=mips
+ vendor=sgi
+ case $os in
+ irix*)
+ ;;
+ *)
+ os=irix4
+ ;;
+ esac
+ ;;
+ miniframe)
+ cpu=m68000
+ vendor=convergent
+ ;;
+ *mint | mint[0-9]* | *MiNT | *MiNT[0-9]*)
+ cpu=m68k
+ vendor=atari
+ os=mint
+ ;;
+ news-3600 | risc-news)
+ cpu=mips
+ vendor=sony
+ os=newsos
+ ;;
+ next | m*-next)
+ cpu=m68k
+ vendor=next
+ case $os in
+ openstep*)
+ ;;
+ nextstep*)
+ ;;
+ ns2*)
+ os=nextstep2
+ ;;
+ *)
+ os=nextstep3
+ ;;
+ esac
+ ;;
+ np1)
+ cpu=np1
+ vendor=gould
+ ;;
+ op50n-* | op60c-*)
+ cpu=hppa1.1
+ vendor=oki
+ os=proelf
+ ;;
+ pa-hitachi)
+ cpu=hppa1.1
+ vendor=hitachi
+ os=hiuxwe2
+ ;;
+ pbd)
+ cpu=sparc
+ vendor=tti
+ ;;
+ pbb)
+ cpu=m68k
+ vendor=tti
+ ;;
+ pc532)
+ cpu=ns32k
+ vendor=pc532
+ ;;
+ pn)
+ cpu=pn
+ vendor=gould
+ ;;
+ power)
+ cpu=power
+ vendor=ibm
+ ;;
+ ps2)
+ cpu=i386
+ vendor=ibm
+ ;;
+ rm[46]00)
+ cpu=mips
+ vendor=siemens
+ ;;
+ rtpc | rtpc-*)
+ cpu=romp
+ vendor=ibm
+ ;;
+ sde)
+ cpu=mipsisa32
+ vendor=sde
+ os=${os:-elf}
+ ;;
+ simso-wrs)
+ cpu=sparclite
+ vendor=wrs
+ os=vxworks
+ ;;
+ tower | tower-32)
+ cpu=m68k
+ vendor=ncr
+ ;;
+ vpp*|vx|vx-*)
+ cpu=f301
+ vendor=fujitsu
+ ;;
+ w65)
+ cpu=w65
+ vendor=wdc
+ ;;
+ w89k-*)
+ cpu=hppa1.1
+ vendor=winbond
+ os=proelf
+ ;;
+ none)
+ cpu=none
+ vendor=none
+ ;;
+ leon|leon[3-9])
+ cpu=sparc
+ vendor=$basic_machine
+ ;;
+ leon-*|leon[3-9]-*)
+ cpu=sparc
+ vendor=`echo "$basic_machine" | sed 's/-.*//'`
+ ;;
+
+ *-*)
+ # shellcheck disable=SC2162
+ IFS="-" read cpu vendor <&2
+ exit 1
+ ;;
+ esac
+ ;;
+esac
+
+# Here we canonicalize certain aliases for manufacturers.
+case $vendor in
+ digital*)
+ vendor=dec
+ ;;
+ commodore*)
+ vendor=cbm
+ ;;
+ *)
+ ;;
+esac
+
+# Decode manufacturer-specific aliases for certain operating systems.
+
+if [ x$os != x ]
+then
+case $os in
+ # First match some system type aliases that might get confused
+ # with valid system types.
+ # solaris* is a basic system type, with this one exception.
+ auroraux)
+ os=auroraux
+ ;;
+ bluegene*)
+ os=cnk
+ ;;
+ solaris1 | solaris1.*)
+ os=`echo $os | sed -e 's|solaris1|sunos4|'`
+ ;;
+ solaris)
+ os=solaris2
+ ;;
+ unixware*)
+ os=sysv4.2uw
+ ;;
+ gnu/linux*)
+ os=`echo $os | sed -e 's|gnu/linux|linux-gnu|'`
+ ;;
+ # es1800 is here to avoid being matched by es* (a different OS)
+ es1800*)
+ os=ose
+ ;;
+ # Some version numbers need modification
+ chorusos*)
+ os=chorusos
+ ;;
+ isc)
+ os=isc2.2
+ ;;
+ sco6)
+ os=sco5v6
+ ;;
+ sco5)
+ os=sco3.2v5
+ ;;
+ sco4)
+ os=sco3.2v4
+ ;;
+ sco3.2.[4-9]*)
+ os=`echo $os | sed -e 's/sco3.2./sco3.2v/'`
+ ;;
+ sco3.2v[4-9]* | sco5v6*)
+ # Don't forget version if it is 3.2v4 or newer.
+ ;;
+ scout)
+ # Don't match below
+ ;;
+ sco*)
+ os=sco3.2v2
+ ;;
+ psos*)
+ os=psos
+ ;;
+ # Now accept the basic system types.
+ # The portable systems comes first.
+ # Each alternative MUST end in a * to match a version number.
+ # sysv* is not here because it comes later, after sysvr4.
+ gnu* | bsd* | mach* | minix* | genix* | ultrix* | irix* \
+ | *vms* | esix* | aix* | cnk* | sunos | sunos[34]*\
+ | hpux* | unos* | osf* | luna* | dgux* | auroraux* | solaris* \
+ | sym* | kopensolaris* | plan9* \
+ | amigaos* | amigados* | msdos* | newsos* | unicos* | aof* \
+ | aos* | aros* | cloudabi* | sortix* | twizzler* \
+ | nindy* | vxsim* | vxworks* | ebmon* | hms* | mvs* \
+ | clix* | riscos* | uniplus* | iris* | isc* | rtu* | xenix* \
+ | knetbsd* | mirbsd* | netbsd* \
+ | bitrig* | openbsd* | solidbsd* | libertybsd* | os108* \
+ | ekkobsd* | kfreebsd* | freebsd* | riscix* | lynxos* \
+ | bosx* | nextstep* | cxux* | aout* | elf* | oabi* \
+ | ptx* | coff* | ecoff* | winnt* | domain* | vsta* \
+ | udi* | eabi* | lites* | ieee* | go32* | aux* | hcos* \
+ | chorusrdb* | cegcc* | glidix* \
+ | cygwin* | msys* | pe* | moss* | proelf* | rtems* \
+ | midipix* | mingw32* | mingw64* | linux-gnu* | linux-android* \
+ | linux-newlib* | linux-musl* | linux-uclibc* \
+ | uxpv* | beos* | mpeix* | udk* | moxiebox* \
+ | interix* | uwin* | mks* | rhapsody* | darwin* \
+ | openstep* | oskit* | conix* | pw32* | nonstopux* \
+ | storm-chaos* | tops10* | tenex* | tops20* | its* \
+ | os2* | vos* | palmos* | uclinux* | nucleus* \
+ | morphos* | superux* | rtmk* | windiss* \
+ | powermax* | dnix* | nx6 | nx7 | sei* | dragonfly* \
+ | skyos* | haiku* | rdos* | toppers* | drops* | es* \
+ | onefs* | tirtos* | phoenix* | fuchsia* | redox* | bme* \
+ | midnightbsd* | amdhsa* | unleashed* | emscripten* | wasi* \
+ | nsk* | powerunix)
+ # Remember, each alternative MUST END IN *, to match a version number.
+ ;;
+ qnx*)
+ case $cpu in
+ x86 | i*86)
+ ;;
+ *)
+ os=nto-$os
+ ;;
+ esac
+ ;;
+ hiux*)
+ os=hiuxwe2
+ ;;
+ nto-qnx*)
+ ;;
+ nto*)
+ os=`echo $os | sed -e 's|nto|nto-qnx|'`
+ ;;
+ sim | xray | os68k* | v88r* \
+ | windows* | osx | abug | netware* | os9* \
+ | macos* | mpw* | magic* | mmixware* | mon960* | lnews*)
+ ;;
+ linux-dietlibc)
+ os=linux-dietlibc
+ ;;
+ linux*)
+ os=`echo $os | sed -e 's|linux|linux-gnu|'`
+ ;;
+ lynx*178)
+ os=lynxos178
+ ;;
+ lynx*5)
+ os=lynxos5
+ ;;
+ lynx*)
+ os=lynxos
+ ;;
+ mac*)
+ os=`echo "$os" | sed -e 's|mac|macos|'`
+ ;;
+ opened*)
+ os=openedition
+ ;;
+ os400*)
+ os=os400
+ ;;
+ sunos5*)
+ os=`echo "$os" | sed -e 's|sunos5|solaris2|'`
+ ;;
+ sunos6*)
+ os=`echo "$os" | sed -e 's|sunos6|solaris3|'`
+ ;;
+ wince*)
+ os=wince
+ ;;
+ utek*)
+ os=bsd
+ ;;
+ dynix*)
+ os=bsd
+ ;;
+ acis*)
+ os=aos
+ ;;
+ atheos*)
+ os=atheos
+ ;;
+ syllable*)
+ os=syllable
+ ;;
+ 386bsd)
+ os=bsd
+ ;;
+ ctix* | uts*)
+ os=sysv
+ ;;
+ nova*)
+ os=rtmk-nova
+ ;;
+ ns2)
+ os=nextstep2
+ ;;
+ # Preserve the version number of sinix5.
+ sinix5.*)
+ os=`echo $os | sed -e 's|sinix|sysv|'`
+ ;;
+ sinix*)
+ os=sysv4
+ ;;
+ tpf*)
+ os=tpf
+ ;;
+ triton*)
+ os=sysv3
+ ;;
+ oss*)
+ os=sysv3
+ ;;
+ svr4*)
+ os=sysv4
+ ;;
+ svr3)
+ os=sysv3
+ ;;
+ sysvr4)
+ os=sysv4
+ ;;
+ # This must come after sysvr4.
+ sysv*)
+ ;;
+ ose*)
+ os=ose
+ ;;
+ *mint | mint[0-9]* | *MiNT | MiNT[0-9]*)
+ os=mint
+ ;;
+ zvmoe)
+ os=zvmoe
+ ;;
+ dicos*)
+ os=dicos
+ ;;
+ pikeos*)
+ # Until real need of OS specific support for
+ # particular features comes up, bare metal
+ # configurations are quite functional.
+ case $cpu in
+ arm*)
+ os=eabi
+ ;;
+ *)
+ os=elf
+ ;;
+ esac
+ ;;
+ nacl*)
+ ;;
+ ios)
+ ;;
+ none)
+ ;;
+ *-eabi)
+ ;;
+ *)
+ echo Invalid configuration \`"$1"\': system \`"$os"\' not recognized 1>&2
+ exit 1
+ ;;
+esac
+else
+
+# Here we handle the default operating systems that come with various machines.
+# The value should be what the vendor currently ships out the door with their
+# machine or put another way, the most popular os provided with the machine.
+
+# Note that if you're going to try to match "-MANUFACTURER" here (say,
+# "-sun"), then you have to tell the case statement up towards the top
+# that MANUFACTURER isn't an operating system. Otherwise, code above
+# will signal an error saying that MANUFACTURER isn't an operating
+# system, and we'll never get to this point.
+
+case $cpu-$vendor in
+ score-*)
+ os=elf
+ ;;
+ spu-*)
+ os=elf
+ ;;
+ *-acorn)
+ os=riscix1.2
+ ;;
+ arm*-rebel)
+ os=linux
+ ;;
+ arm*-semi)
+ os=aout
+ ;;
+ c4x-* | tic4x-*)
+ os=coff
+ ;;
+ c8051-*)
+ os=elf
+ ;;
+ clipper-intergraph)
+ os=clix
+ ;;
+ hexagon-*)
+ os=elf
+ ;;
+ tic54x-*)
+ os=coff
+ ;;
+ tic55x-*)
+ os=coff
+ ;;
+ tic6x-*)
+ os=coff
+ ;;
+ # This must come before the *-dec entry.
+ pdp10-*)
+ os=tops20
+ ;;
+ pdp11-*)
+ os=none
+ ;;
+ *-dec | vax-*)
+ os=ultrix4.2
+ ;;
+ m68*-apollo)
+ os=domain
+ ;;
+ i386-sun)
+ os=sunos4.0.2
+ ;;
+ m68000-sun)
+ os=sunos3
+ ;;
+ m68*-cisco)
+ os=aout
+ ;;
+ mep-*)
+ os=elf
+ ;;
+ mips*-cisco)
+ os=elf
+ ;;
+ mips*-*)
+ os=elf
+ ;;
+ or32-*)
+ os=coff
+ ;;
+ *-tti) # must be before sparc entry or we get the wrong os.
+ os=sysv3
+ ;;
+ sparc-* | *-sun)
+ os=sunos4.1.1
+ ;;
+ pru-*)
+ os=elf
+ ;;
+ *-be)
+ os=beos
+ ;;
+ *-ibm)
+ os=aix
+ ;;
+ *-knuth)
+ os=mmixware
+ ;;
+ *-wec)
+ os=proelf
+ ;;
+ *-winbond)
+ os=proelf
+ ;;
+ *-oki)
+ os=proelf
+ ;;
+ *-hp)
+ os=hpux
+ ;;
+ *-hitachi)
+ os=hiux
+ ;;
+ i860-* | *-att | *-ncr | *-altos | *-motorola | *-convergent)
+ os=sysv
+ ;;
+ *-cbm)
+ os=amigaos
+ ;;
+ *-dg)
+ os=dgux
+ ;;
+ *-dolphin)
+ os=sysv3
+ ;;
+ m68k-ccur)
+ os=rtu
+ ;;
+ m88k-omron*)
+ os=luna
+ ;;
+ *-next)
+ os=nextstep
+ ;;
+ *-sequent)
+ os=ptx
+ ;;
+ *-crds)
+ os=unos
+ ;;
+ *-ns)
+ os=genix
+ ;;
+ i370-*)
+ os=mvs
+ ;;
+ *-gould)
+ os=sysv
+ ;;
+ *-highlevel)
+ os=bsd
+ ;;
+ *-encore)
+ os=bsd
+ ;;
+ *-sgi)
+ os=irix
+ ;;
+ *-siemens)
+ os=sysv4
+ ;;
+ *-masscomp)
+ os=rtu
+ ;;
+ f30[01]-fujitsu | f700-fujitsu)
+ os=uxpv
+ ;;
+ *-rom68k)
+ os=coff
+ ;;
+ *-*bug)
+ os=coff
+ ;;
+ *-apple)
+ os=macos
+ ;;
+ *-atari*)
+ os=mint
+ ;;
+ *-wrs)
+ os=vxworks
+ ;;
+ *)
+ os=none
+ ;;
+esac
+fi
+
+# Here we handle the case where we know the os, and the CPU type, but not the
+# manufacturer. We pick the logical manufacturer.
+case $vendor in
+ unknown)
+ case $os in
+ riscix*)
+ vendor=acorn
+ ;;
+ sunos*)
+ vendor=sun
+ ;;
+ cnk*|-aix*)
+ vendor=ibm
+ ;;
+ beos*)
+ vendor=be
+ ;;
+ hpux*)
+ vendor=hp
+ ;;
+ mpeix*)
+ vendor=hp
+ ;;
+ hiux*)
+ vendor=hitachi
+ ;;
+ unos*)
+ vendor=crds
+ ;;
+ dgux*)
+ vendor=dg
+ ;;
+ luna*)
+ vendor=omron
+ ;;
+ genix*)
+ vendor=ns
+ ;;
+ clix*)
+ vendor=intergraph
+ ;;
+ mvs* | opened*)
+ vendor=ibm
+ ;;
+ os400*)
+ vendor=ibm
+ ;;
+ ptx*)
+ vendor=sequent
+ ;;
+ tpf*)
+ vendor=ibm
+ ;;
+ vxsim* | vxworks* | windiss*)
+ vendor=wrs
+ ;;
+ aux*)
+ vendor=apple
+ ;;
+ hms*)
+ vendor=hitachi
+ ;;
+ mpw* | macos*)
+ vendor=apple
+ ;;
+ *mint | mint[0-9]* | *MiNT | MiNT[0-9]*)
+ vendor=atari
+ ;;
+ vos*)
+ vendor=stratus
+ ;;
+ esac
+ ;;
+esac
+
+echo "$cpu-$vendor-$os"
+exit
+
+# Local variables:
+# eval: (add-hook 'before-save-hook 'time-stamp)
+# time-stamp-start: "timestamp='"
+# time-stamp-format: "%:y-%02m-%02d"
+# time-stamp-end: "'"
+# End:
diff --git a/gcc/mpc/depcomp b/gcc/mpc/build-aux/depcomp
similarity index 98%
rename from gcc/mpc/depcomp
rename to gcc/mpc/build-aux/depcomp
index 23789fcfdb..be01859950 100755
--- a/gcc/mpc/depcomp
+++ b/gcc/mpc/build-aux/depcomp
@@ -1,9 +1,9 @@
#!/bin/sh
# depcomp - compile a program generating dependencies as side-effects
-scriptversion=2013-05-30.07; # UTC
+scriptversion=2018-03-07.03; # UTC
-# Copyright (C) 1999-2014 Free Software Foundation, Inc.
+# Copyright (C) 1999-2020 Free Software Foundation, Inc.
# This program is free software; you can redistribute it and/or modify
# it under the terms of the GNU General Public License as published by
@@ -16,7 +16,7 @@ scriptversion=2013-05-30.07; # UTC
# GNU General Public License for more details.
# You should have received a copy of the GNU General Public License
-# along with this program. If not, see .
+# along with this program. If not, see .
# As a special exception to the GNU General Public License, if you
# distribute this file as part of a program that contains a
@@ -783,9 +783,9 @@ exit 0
# Local Variables:
# mode: shell-script
# sh-indentation: 2
-# eval: (add-hook 'write-file-hooks 'time-stamp)
+# eval: (add-hook 'before-save-hook 'time-stamp)
# time-stamp-start: "scriptversion="
# time-stamp-format: "%:y-%02m-%02d.%02H"
-# time-stamp-time-zone: "UTC"
+# time-stamp-time-zone: "UTC0"
# time-stamp-end: "; # UTC"
# End:
diff --git a/gcc/mpc/install-sh b/gcc/mpc/build-aux/install-sh
similarity index 88%
rename from gcc/mpc/install-sh
rename to gcc/mpc/build-aux/install-sh
index 0b0fdcbba6..20d8b2eaea 100755
--- a/gcc/mpc/install-sh
+++ b/gcc/mpc/build-aux/install-sh
@@ -1,7 +1,7 @@
#!/bin/sh
# install - install a program, script, or datafile
-scriptversion=2013-12-25.23; # UTC
+scriptversion=2018-03-11.20; # UTC
# This originates from X11R5 (mit/util/scripts/install.sh), which was
# later released in X11R6 (xc/config/util/install.sh) with the
@@ -271,15 +271,18 @@ do
fi
dst=$dst_arg
- # If destination is a directory, append the input filename; won't work
- # if double slashes aren't ignored.
+ # If destination is a directory, append the input filename.
if test -d "$dst"; then
if test "$is_target_a_directory" = never; then
echo "$0: $dst_arg: Is a directory" >&2
exit 1
fi
dstdir=$dst
- dst=$dstdir/`basename "$src"`
+ dstbase=`basename "$src"`
+ case $dst in
+ */) dst=$dst$dstbase;;
+ *) dst=$dst/$dstbase;;
+ esac
dstdir_status=0
else
dstdir=`dirname "$dst"`
@@ -288,6 +291,11 @@ do
fi
fi
+ case $dstdir in
+ */) dstdirslash=$dstdir;;
+ *) dstdirslash=$dstdir/;;
+ esac
+
obsolete_mkdir_used=false
if test $dstdir_status != 0; then
@@ -324,34 +332,43 @@ do
# is incompatible with FreeBSD 'install' when (umask & 300) != 0.
;;
*)
+ # Note that $RANDOM variable is not portable (e.g. dash); Use it
+ # here however when possible just to lower collision chance.
tmpdir=${TMPDIR-/tmp}/ins$RANDOM-$$
- trap 'ret=$?; rmdir "$tmpdir/d" "$tmpdir" 2>/dev/null; exit $ret' 0
+ trap 'ret=$?; rmdir "$tmpdir/a/b" "$tmpdir/a" "$tmpdir" 2>/dev/null; exit $ret' 0
+
+ # Because "mkdir -p" follows existing symlinks and we likely work
+ # directly in world-writeable /tmp, make sure that the '$tmpdir'
+ # directory is successfully created first before we actually test
+ # 'mkdir -p' feature.
if (umask $mkdir_umask &&
- exec $mkdirprog $mkdir_mode -p -- "$tmpdir/d") >/dev/null 2>&1
+ $mkdirprog $mkdir_mode "$tmpdir" &&
+ exec $mkdirprog $mkdir_mode -p -- "$tmpdir/a/b") >/dev/null 2>&1
then
if test -z "$dir_arg" || {
# Check for POSIX incompatibilities with -m.
# HP-UX 11.23 and IRIX 6.5 mkdir -m -p sets group- or
# other-writable bit of parent directory when it shouldn't.
# FreeBSD 6.1 mkdir -m -p sets mode of existing directory.
- ls_ld_tmpdir=`ls -ld "$tmpdir"`
+ test_tmpdir="$tmpdir/a"
+ ls_ld_tmpdir=`ls -ld "$test_tmpdir"`
case $ls_ld_tmpdir in
d????-?r-*) different_mode=700;;
d????-?--*) different_mode=755;;
*) false;;
esac &&
- $mkdirprog -m$different_mode -p -- "$tmpdir" && {
- ls_ld_tmpdir_1=`ls -ld "$tmpdir"`
+ $mkdirprog -m$different_mode -p -- "$test_tmpdir" && {
+ ls_ld_tmpdir_1=`ls -ld "$test_tmpdir"`
test "$ls_ld_tmpdir" = "$ls_ld_tmpdir_1"
}
}
then posix_mkdir=:
fi
- rmdir "$tmpdir/d" "$tmpdir"
+ rmdir "$tmpdir/a/b" "$tmpdir/a" "$tmpdir"
else
# Remove any dirs left behind by ancient mkdir implementations.
- rmdir ./$mkdir_mode ./-p ./-- 2>/dev/null
+ rmdir ./$mkdir_mode ./-p ./-- "$tmpdir" 2>/dev/null
fi
trap '' 0;;
esac;;
@@ -427,14 +444,25 @@ do
else
# Make a couple of temp file names in the proper directory.
- dsttmp=$dstdir/_inst.$$_
- rmtmp=$dstdir/_rm.$$_
+ dsttmp=${dstdirslash}_inst.$$_
+ rmtmp=${dstdirslash}_rm.$$_
# Trap to clean up those temp files at exit.
trap 'ret=$?; rm -f "$dsttmp" "$rmtmp" && exit $ret' 0
# Copy the file name to the temp name.
- (umask $cp_umask && $doit_exec $cpprog "$src" "$dsttmp") &&
+ (umask $cp_umask &&
+ { test -z "$stripcmd" || {
+ # Create $dsttmp read-write so that cp doesn't create it read-only,
+ # which would cause strip to fail.
+ if test -z "$doit"; then
+ : >"$dsttmp" # No need to fork-exec 'touch'.
+ else
+ $doit touch "$dsttmp"
+ fi
+ }
+ } &&
+ $doit_exec $cpprog "$src" "$dsttmp") &&
# and set any options; do chmod last to preserve setuid bits.
#
@@ -493,9 +521,9 @@ do
done
# Local variables:
-# eval: (add-hook 'write-file-hooks 'time-stamp)
+# eval: (add-hook 'before-save-hook 'time-stamp)
# time-stamp-start: "scriptversion="
# time-stamp-format: "%:y-%02m-%02d.%02H"
-# time-stamp-time-zone: "UTC"
+# time-stamp-time-zone: "UTC0"
# time-stamp-end: "; # UTC"
# End:
diff --git a/gcc/mpc/ltmain.sh b/gcc/mpc/build-aux/ltmain.sh
old mode 100644
new mode 100755
similarity index 99%
rename from gcc/mpc/ltmain.sh
rename to gcc/mpc/build-aux/ltmain.sh
index b04f605908..95d356d375
--- a/gcc/mpc/ltmain.sh
+++ b/gcc/mpc/build-aux/ltmain.sh
@@ -1,4 +1,4 @@
-#!/gnu/store/311nvir0pz1mhf0mgsmfrw00qfj7yq0j-bash-4.3.39/bin/sh
+#!/bin/sh
## DO NOT EDIT - This file generated from ./build-aux/ltmain.in
## by inline-source v2014-01-03.01
@@ -1367,7 +1367,7 @@ func_lt_ver ()
# time-stamp-pattern: "10/scriptversion=%:y-%02m-%02d.%02H; # UTC"
# time-stamp-time-zone: "UTC"
# End:
-#! /bin/sh
+#!/bin/sh
# Set a version string for this script.
scriptversion=2014-01-07.03; # UTC
diff --git a/gcc/mpc/build-aux/mdate-sh b/gcc/mpc/build-aux/mdate-sh
new file mode 100755
index 0000000000..6a6a4bcf2b
--- /dev/null
+++ b/gcc/mpc/build-aux/mdate-sh
@@ -0,0 +1,228 @@
+#!/bin/sh
+# Get modification time of a file or directory and pretty-print it.
+
+scriptversion=2018-03-07.03; # UTC
+
+# Copyright (C) 1995-2020 Free Software Foundation, Inc.
+# written by Ulrich Drepper , June 1995
+#
+# This program is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License as published by
+# the Free Software Foundation; either version 2, or (at your option)
+# any later version.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License
+# along with this program. If not, see .
+
+# As a special exception to the GNU General Public License, if you
+# distribute this file as part of a program that contains a
+# configuration script generated by Autoconf, you may include it under
+# the same distribution terms that you use for the rest of that program.
+
+# This file is maintained in Automake, please report
+# bugs to or send patches to
+# .
+
+if test -n "${ZSH_VERSION+set}" && (emulate sh) >/dev/null 2>&1; then
+ emulate sh
+ NULLCMD=:
+ # Pre-4.2 versions of Zsh do word splitting on ${1+"$@"}, which
+ # is contrary to our usage. Disable this feature.
+ alias -g '${1+"$@"}'='"$@"'
+ setopt NO_GLOB_SUBST
+fi
+
+case $1 in
+ '')
+ echo "$0: No file. Try '$0 --help' for more information." 1>&2
+ exit 1;
+ ;;
+ -h | --h*)
+ cat <<\EOF
+Usage: mdate-sh [--help] [--version] FILE
+
+Pretty-print the modification day of FILE, in the format:
+1 January 1970
+
+Report bugs to .
+EOF
+ exit $?
+ ;;
+ -v | --v*)
+ echo "mdate-sh $scriptversion"
+ exit $?
+ ;;
+esac
+
+error ()
+{
+ echo "$0: $1" >&2
+ exit 1
+}
+
+
+# Prevent date giving response in another language.
+LANG=C
+export LANG
+LC_ALL=C
+export LC_ALL
+LC_TIME=C
+export LC_TIME
+
+# Use UTC to get reproducible result.
+TZ=UTC0
+export TZ
+
+# GNU ls changes its time format in response to the TIME_STYLE
+# variable. Since we cannot assume 'unset' works, revert this
+# variable to its documented default.
+if test "${TIME_STYLE+set}" = set; then
+ TIME_STYLE=posix-long-iso
+ export TIME_STYLE
+fi
+
+save_arg1=$1
+
+# Find out how to get the extended ls output of a file or directory.
+if ls -L /dev/null 1>/dev/null 2>&1; then
+ ls_command='ls -L -l -d'
+else
+ ls_command='ls -l -d'
+fi
+# Avoid user/group names that might have spaces, when possible.
+if ls -n /dev/null 1>/dev/null 2>&1; then
+ ls_command="$ls_command -n"
+fi
+
+# A 'ls -l' line looks as follows on OS/2.
+# drwxrwx--- 0 Aug 11 2001 foo
+# This differs from Unix, which adds ownership information.
+# drwxrwx--- 2 root root 4096 Aug 11 2001 foo
+#
+# To find the date, we split the line on spaces and iterate on words
+# until we find a month. This cannot work with files whose owner is a
+# user named "Jan", or "Feb", etc. However, it's unlikely that '/'
+# will be owned by a user whose name is a month. So we first look at
+# the extended ls output of the root directory to decide how many
+# words should be skipped to get the date.
+
+# On HPUX /bin/sh, "set" interprets "-rw-r--r--" as options, so the "x" below.
+set x`$ls_command /`
+
+# Find which argument is the month.
+month=
+command=
+until test $month
+do
+ test $# -gt 0 || error "failed parsing '$ls_command /' output"
+ shift
+ # Add another shift to the command.
+ command="$command shift;"
+ case $1 in
+ Jan) month=January; nummonth=1;;
+ Feb) month=February; nummonth=2;;
+ Mar) month=March; nummonth=3;;
+ Apr) month=April; nummonth=4;;
+ May) month=May; nummonth=5;;
+ Jun) month=June; nummonth=6;;
+ Jul) month=July; nummonth=7;;
+ Aug) month=August; nummonth=8;;
+ Sep) month=September; nummonth=9;;
+ Oct) month=October; nummonth=10;;
+ Nov) month=November; nummonth=11;;
+ Dec) month=December; nummonth=12;;
+ esac
+done
+
+test -n "$month" || error "failed parsing '$ls_command /' output"
+
+# Get the extended ls output of the file or directory.
+set dummy x`eval "$ls_command \"\\\$save_arg1\""`
+
+# Remove all preceding arguments
+eval $command
+
+# Because of the dummy argument above, month is in $2.
+#
+# On a POSIX system, we should have
+#
+# $# = 5
+# $1 = file size
+# $2 = month
+# $3 = day
+# $4 = year or time
+# $5 = filename
+#
+# On Darwin 7.7.0 and 7.6.0, we have
+#
+# $# = 4
+# $1 = day
+# $2 = month
+# $3 = year or time
+# $4 = filename
+
+# Get the month.
+case $2 in
+ Jan) month=January; nummonth=1;;
+ Feb) month=February; nummonth=2;;
+ Mar) month=March; nummonth=3;;
+ Apr) month=April; nummonth=4;;
+ May) month=May; nummonth=5;;
+ Jun) month=June; nummonth=6;;
+ Jul) month=July; nummonth=7;;
+ Aug) month=August; nummonth=8;;
+ Sep) month=September; nummonth=9;;
+ Oct) month=October; nummonth=10;;
+ Nov) month=November; nummonth=11;;
+ Dec) month=December; nummonth=12;;
+esac
+
+case $3 in
+ ???*) day=$1;;
+ *) day=$3; shift;;
+esac
+
+# Here we have to deal with the problem that the ls output gives either
+# the time of day or the year.
+case $3 in
+ *:*) set `date`; eval year=\$$#
+ case $2 in
+ Jan) nummonthtod=1;;
+ Feb) nummonthtod=2;;
+ Mar) nummonthtod=3;;
+ Apr) nummonthtod=4;;
+ May) nummonthtod=5;;
+ Jun) nummonthtod=6;;
+ Jul) nummonthtod=7;;
+ Aug) nummonthtod=8;;
+ Sep) nummonthtod=9;;
+ Oct) nummonthtod=10;;
+ Nov) nummonthtod=11;;
+ Dec) nummonthtod=12;;
+ esac
+ # For the first six month of the year the time notation can also
+ # be used for files modified in the last year.
+ if (expr $nummonth \> $nummonthtod) > /dev/null;
+ then
+ year=`expr $year - 1`
+ fi;;
+ *) year=$3;;
+esac
+
+# The result.
+echo $day $month $year
+
+# Local Variables:
+# mode: shell-script
+# sh-indentation: 2
+# eval: (add-hook 'before-save-hook 'time-stamp)
+# time-stamp-start: "scriptversion="
+# time-stamp-format: "%:y-%02m-%02d.%02H"
+# time-stamp-time-zone: "UTC0"
+# time-stamp-end: "; # UTC"
+# End:
diff --git a/gcc/mpc/missing b/gcc/mpc/build-aux/missing
similarity index 94%
rename from gcc/mpc/missing
rename to gcc/mpc/build-aux/missing
index ea801d290a..3d6cabfe78 100755
--- a/gcc/mpc/missing
+++ b/gcc/mpc/build-aux/missing
@@ -1,9 +1,9 @@
#!/bin/sh
# Common wrapper for a few potentially missing GNU programs.
-scriptversion=2013-10-28.13; # UTC
+scriptversion=2018-03-07.03; # UTC
-# Copyright (C) 1996-2014 Free Software Foundation, Inc.
+# Copyright (C) 1996-2020 Free Software Foundation, Inc.
# Originally written by Fran,cois Pinard , 1996.
# This program is free software; you can redistribute it and/or modify
@@ -17,7 +17,7 @@ scriptversion=2013-10-28.13; # UTC
# GNU General Public License for more details.
# You should have received a copy of the GNU General Public License
-# along with this program. If not, see .
+# along with this program. If not, see .
# As a special exception to the GNU General Public License, if you
# distribute this file as part of a program that contains a
@@ -101,9 +101,9 @@ else
exit $st
fi
-perl_URL=http://www.perl.org/
-flex_URL=http://flex.sourceforge.net/
-gnu_software_URL=http://www.gnu.org/software
+perl_URL=https://www.perl.org/
+flex_URL=https://github.com/westes/flex
+gnu_software_URL=https://www.gnu.org/software
program_details ()
{
@@ -207,9 +207,9 @@ give_advice "$1" | sed -e '1s/^/WARNING: /' \
exit $st
# Local variables:
-# eval: (add-hook 'write-file-hooks 'time-stamp)
+# eval: (add-hook 'before-save-hook 'time-stamp)
# time-stamp-start: "scriptversion="
# time-stamp-format: "%:y-%02m-%02d.%02H"
-# time-stamp-time-zone: "UTC"
+# time-stamp-time-zone: "UTC0"
# time-stamp-end: "; # UTC"
# End:
diff --git a/gcc/mpc/test-driver b/gcc/mpc/build-aux/test-driver
similarity index 94%
rename from gcc/mpc/test-driver
rename to gcc/mpc/build-aux/test-driver
index 30073f1ccc..0f089281c1 100755
--- a/gcc/mpc/test-driver
+++ b/gcc/mpc/build-aux/test-driver
@@ -1,9 +1,9 @@
#!/bin/sh
# test-driver - basic testsuite driver script.
-scriptversion=2013-07-13.22; # UTC
+scriptversion=2018-03-07.03; # UTC
-# Copyright (C) 2011-2014 Free Software Foundation, Inc.
+# Copyright (C) 2011-2020 Free Software Foundation, Inc.
#
# This program is free software; you can redistribute it and/or modify
# it under the terms of the GNU General Public License as published by
@@ -16,7 +16,7 @@ scriptversion=2013-07-13.22; # UTC
# GNU General Public License for more details.
#
# You should have received a copy of the GNU General Public License
-# along with this program. If not, see .
+# along with this program. If not, see .
# As a special exception to the GNU General Public License, if you
# distribute this file as part of a program that contains a
@@ -140,9 +140,9 @@ echo ":copy-in-global-log: $gcopy" >> $trs_file
# Local Variables:
# mode: shell-script
# sh-indentation: 2
-# eval: (add-hook 'write-file-hooks 'time-stamp)
+# eval: (add-hook 'before-save-hook 'time-stamp)
# time-stamp-start: "scriptversion="
# time-stamp-format: "%:y-%02m-%02d.%02H"
-# time-stamp-time-zone: "UTC"
+# time-stamp-time-zone: "UTC0"
# time-stamp-end: "; # UTC"
# End:
diff --git a/gcc/mpc/build-aux/texinfo.tex b/gcc/mpc/build-aux/texinfo.tex
new file mode 100644
index 0000000000..deca599187
--- /dev/null
+++ b/gcc/mpc/build-aux/texinfo.tex
@@ -0,0 +1,11614 @@
+% texinfo.tex -- TeX macros to handle Texinfo files.
+%
+% Load plain if necessary, i.e., if running under initex.
+\expandafter\ifx\csname fmtname\endcsname\relax\input plain\fi
+%
+\def\texinfoversion{2020-02-11.09}
+%
+% Copyright 1985, 1986, 1988, 1990-2019 Free Software Foundation, Inc.
+%
+% This texinfo.tex file is free software: you can redistribute it and/or
+% modify it under the terms of the GNU General Public License as
+% published by the Free Software Foundation, either version 3 of the
+% License, or (at your option) any later version.
+%
+% This texinfo.tex file is distributed in the hope that it will be
+% useful, but WITHOUT ANY WARRANTY; without even the implied warranty
+% of MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
+% General Public License for more details.
+%
+% You should have received a copy of the GNU General Public License
+% along with this program. If not, see .
+%
+% As a special exception, when this file is read by TeX when processing
+% a Texinfo source document, you may use the result without
+% restriction. This Exception is an additional permission under section 7
+% of the GNU General Public License, version 3 ("GPLv3").
+%
+% Please try the latest version of texinfo.tex before submitting bug
+% reports; you can get the latest version from:
+% https://ftp.gnu.org/gnu/texinfo/ (the Texinfo release area), or
+% https://ftpmirror.gnu.org/texinfo/ (same, via a mirror), or
+% https://www.gnu.org/software/texinfo/ (the Texinfo home page)
+% The texinfo.tex in any given distribution could well be out
+% of date, so if that's what you're using, please check.
+%
+% Send bug reports to bug-texinfo@gnu.org. Please include including a
+% complete document in each bug report with which we can reproduce the
+% problem. Patches are, of course, greatly appreciated.
+%
+% To process a Texinfo manual with TeX, it's most reliable to use the
+% texi2dvi shell script that comes with the distribution. For a simple
+% manual foo.texi, however, you can get away with this:
+% tex foo.texi
+% texindex foo.??
+% tex foo.texi
+% tex foo.texi
+% dvips foo.dvi -o # or whatever; this makes foo.ps.
+% The extra TeX runs get the cross-reference information correct.
+% Sometimes one run after texindex suffices, and sometimes you need more
+% than two; texi2dvi does it as many times as necessary.
+%
+% It is possible to adapt texinfo.tex for other languages, to some
+% extent. You can get the existing language-specific files from the
+% full Texinfo distribution.
+%
+% The GNU Texinfo home page is https://www.gnu.org/software/texinfo.
+
+
+\message{Loading texinfo [version \texinfoversion]:}
+
+% If in a .fmt file, print the version number
+% and turn on active characters that we couldn't do earlier because
+% they might have appeared in the input file name.
+\everyjob{\message{[Texinfo version \texinfoversion]}%
+ \catcode`+=\active \catcode`\_=\active}
+
+% LaTeX's \typeout. This ensures that the messages it is used for
+% are identical in format to the corresponding ones from latex/pdflatex.
+\def\typeout{\immediate\write17}%
+
+\chardef\other=12
+
+% We never want plain's \outer definition of \+ in Texinfo.
+% For @tex, we can use \tabalign.
+\let\+ = \relax
+
+% Save some plain tex macros whose names we will redefine.
+\let\ptexb=\b
+\let\ptexbullet=\bullet
+\let\ptexc=\c
+\let\ptexcomma=\,
+\let\ptexdot=\.
+\let\ptexdots=\dots
+\let\ptexend=\end
+\let\ptexequiv=\equiv
+\let\ptexexclam=\!
+\let\ptexfootnote=\footnote
+\let\ptexgtr=>
+\let\ptexhat=^
+\let\ptexi=\i
+\let\ptexindent=\indent
+\let\ptexinsert=\insert
+\let\ptexlbrace=\{
+\let\ptexless=<
+\let\ptexnewwrite\newwrite
+\let\ptexnoindent=\noindent
+\let\ptexplus=+
+\let\ptexraggedright=\raggedright
+\let\ptexrbrace=\}
+\let\ptexslash=\/
+\let\ptexsp=\sp
+\let\ptexstar=\*
+\let\ptexsup=\sup
+\let\ptext=\t
+\let\ptextop=\top
+{\catcode`\'=\active \global\let\ptexquoteright'}% active in plain's math mode
+
+% If this character appears in an error message or help string, it
+% starts a new line in the output.
+\newlinechar = `^^J
+
+% Use TeX 3.0's \inputlineno to get the line number, for better error
+% messages, but if we're using an old version of TeX, don't do anything.
+%
+\ifx\inputlineno\thisisundefined
+ \let\linenumber = \empty % Pre-3.0.
+\else
+ \def\linenumber{l.\the\inputlineno:\space}
+\fi
+
+% Set up fixed words for English if not already set.
+\ifx\putwordAppendix\undefined \gdef\putwordAppendix{Appendix}\fi
+\ifx\putwordChapter\undefined \gdef\putwordChapter{Chapter}\fi
+\ifx\putworderror\undefined \gdef\putworderror{error}\fi
+\ifx\putwordfile\undefined \gdef\putwordfile{file}\fi
+\ifx\putwordin\undefined \gdef\putwordin{in}\fi
+\ifx\putwordIndexIsEmpty\undefined \gdef\putwordIndexIsEmpty{(Index is empty)}\fi
+\ifx\putwordIndexNonexistent\undefined \gdef\putwordIndexNonexistent{(Index is nonexistent)}\fi
+\ifx\putwordInfo\undefined \gdef\putwordInfo{Info}\fi
+\ifx\putwordInstanceVariableof\undefined \gdef\putwordInstanceVariableof{Instance Variable of}\fi
+\ifx\putwordMethodon\undefined \gdef\putwordMethodon{Method on}\fi
+\ifx\putwordNoTitle\undefined \gdef\putwordNoTitle{No Title}\fi
+\ifx\putwordof\undefined \gdef\putwordof{of}\fi
+\ifx\putwordon\undefined \gdef\putwordon{on}\fi
+\ifx\putwordpage\undefined \gdef\putwordpage{page}\fi
+\ifx\putwordsection\undefined \gdef\putwordsection{section}\fi
+\ifx\putwordSection\undefined \gdef\putwordSection{Section}\fi
+\ifx\putwordsee\undefined \gdef\putwordsee{see}\fi
+\ifx\putwordSee\undefined \gdef\putwordSee{See}\fi
+\ifx\putwordShortTOC\undefined \gdef\putwordShortTOC{Short Contents}\fi
+\ifx\putwordTOC\undefined \gdef\putwordTOC{Table of Contents}\fi
+%
+\ifx\putwordMJan\undefined \gdef\putwordMJan{January}\fi
+\ifx\putwordMFeb\undefined \gdef\putwordMFeb{February}\fi
+\ifx\putwordMMar\undefined \gdef\putwordMMar{March}\fi
+\ifx\putwordMApr\undefined \gdef\putwordMApr{April}\fi
+\ifx\putwordMMay\undefined \gdef\putwordMMay{May}\fi
+\ifx\putwordMJun\undefined \gdef\putwordMJun{June}\fi
+\ifx\putwordMJul\undefined \gdef\putwordMJul{July}\fi
+\ifx\putwordMAug\undefined \gdef\putwordMAug{August}\fi
+\ifx\putwordMSep\undefined \gdef\putwordMSep{September}\fi
+\ifx\putwordMOct\undefined \gdef\putwordMOct{October}\fi
+\ifx\putwordMNov\undefined \gdef\putwordMNov{November}\fi
+\ifx\putwordMDec\undefined \gdef\putwordMDec{December}\fi
+%
+\ifx\putwordDefmac\undefined \gdef\putwordDefmac{Macro}\fi
+\ifx\putwordDefspec\undefined \gdef\putwordDefspec{Special Form}\fi
+\ifx\putwordDefvar\undefined \gdef\putwordDefvar{Variable}\fi
+\ifx\putwordDefopt\undefined \gdef\putwordDefopt{User Option}\fi
+\ifx\putwordDeffunc\undefined \gdef\putwordDeffunc{Function}\fi
+
+% Give the space character the catcode for a space.
+\def\spaceisspace{\catcode`\ =10\relax}
+
+% Likewise for ^^M, the end of line character.
+\def\endlineisspace{\catcode13=10\relax}
+
+\chardef\dashChar = `\-
+\chardef\slashChar = `\/
+\chardef\underChar = `\_
+
+% Ignore a token.
+%
+\def\gobble#1{}
+
+% The following is used inside several \edef's.
+\def\makecsname#1{\expandafter\noexpand\csname#1\endcsname}
+
+% Hyphenation fixes.
+\hyphenation{
+ Flor-i-da Ghost-script Ghost-view Mac-OS Post-Script
+ ap-pen-dix bit-map bit-maps
+ data-base data-bases eshell fall-ing half-way long-est man-u-script
+ man-u-scripts mini-buf-fer mini-buf-fers over-view par-a-digm
+ par-a-digms rath-er rec-tan-gu-lar ro-bot-ics se-vere-ly set-up spa-ces
+ spell-ing spell-ings
+ stand-alone strong-est time-stamp time-stamps which-ever white-space
+ wide-spread wrap-around
+}
+
+% Sometimes it is convenient to have everything in the transcript file
+% and nothing on the terminal. We don't just call \tracingall here,
+% since that produces some useless output on the terminal. We also make
+% some effort to order the tracing commands to reduce output in the log
+% file; cf. trace.sty in LaTeX.
+%
+\def\gloggingall{\begingroup \globaldefs = 1 \loggingall \endgroup}%
+\def\loggingall{%
+ \tracingstats2
+ \tracingpages1
+ \tracinglostchars2 % 2 gives us more in etex
+ \tracingparagraphs1
+ \tracingoutput1
+ \tracingmacros2
+ \tracingrestores1
+ \showboxbreadth\maxdimen \showboxdepth\maxdimen
+ \ifx\eTeXversion\thisisundefined\else % etex gives us more logging
+ \tracingscantokens1
+ \tracingifs1
+ \tracinggroups1
+ \tracingnesting2
+ \tracingassigns1
+ \fi
+ \tracingcommands3 % 3 gives us more in etex
+ \errorcontextlines16
+}%
+
+% @errormsg{MSG}. Do the index-like expansions on MSG, but if things
+% aren't perfect, it's not the end of the world, being an error message,
+% after all.
+%
+\def\errormsg{\begingroup \indexnofonts \doerrormsg}
+\def\doerrormsg#1{\errmessage{#1}}
+
+% add check for \lastpenalty to plain's definitions. If the last thing
+% we did was a \nobreak, we don't want to insert more space.
+%
+\def\smallbreak{\ifnum\lastpenalty<10000\par\ifdim\lastskip<\smallskipamount
+ \removelastskip\penalty-50\smallskip\fi\fi}
+\def\medbreak{\ifnum\lastpenalty<10000\par\ifdim\lastskip<\medskipamount
+ \removelastskip\penalty-100\medskip\fi\fi}
+\def\bigbreak{\ifnum\lastpenalty<10000\par\ifdim\lastskip<\bigskipamount
+ \removelastskip\penalty-200\bigskip\fi\fi}
+
+% Output routine
+%
+
+% For a final copy, take out the rectangles
+% that mark overfull boxes (in case you have decided
+% that the text looks ok even though it passes the margin).
+%
+\def\finalout{\overfullrule=0pt }
+
+\newdimen\outerhsize \newdimen\outervsize % set by the paper size routines
+\newdimen\topandbottommargin \topandbottommargin=.75in
+
+% Output a mark which sets \thischapter, \thissection and \thiscolor.
+% We dump everything together because we only have one kind of mark.
+% This works because we only use \botmark / \topmark, not \firstmark.
+%
+% A mark contains a subexpression of the \ifcase ... \fi construct.
+% \get*marks macros below extract the needed part using \ifcase.
+%
+% Another complication is to let the user choose whether \thischapter
+% (\thissection) refers to the chapter (section) in effect at the top
+% of a page, or that at the bottom of a page.
+
+% \domark is called twice inside \chapmacro, to add one
+% mark before the section break, and one after.
+% In the second call \prevchapterdefs is the same as \currentchapterdefs,
+% and \prevsectiondefs is the same as \currentsectiondefs.
+% Then if the page is not broken at the mark, some of the previous
+% section appears on the page, and we can get the name of this section
+% from \firstmark for @everyheadingmarks top.
+% @everyheadingmarks bottom uses \botmark.
+%
+% See page 260 of The TeXbook.
+\def\domark{%
+ \toks0=\expandafter{\currentchapterdefs}%
+ \toks2=\expandafter{\currentsectiondefs}%
+ \toks4=\expandafter{\prevchapterdefs}%
+ \toks6=\expandafter{\prevsectiondefs}%
+ \toks8=\expandafter{\currentcolordefs}%
+ \mark{%
+ \the\toks0 \the\toks2 % 0: marks for @everyheadingmarks top
+ \noexpand\or \the\toks4 \the\toks6 % 1: for @everyheadingmarks bottom
+ \noexpand\else \the\toks8 % 2: color marks
+ }%
+}
+
+% \gettopheadingmarks, \getbottomheadingmarks,
+% \getcolormarks - extract needed part of mark.
+%
+% \topmark doesn't work for the very first chapter (after the title
+% page or the contents), so we use \firstmark there -- this gets us
+% the mark with the chapter defs, unless the user sneaks in, e.g.,
+% @setcolor (or @url, or @link, etc.) between @contents and the very
+% first @chapter.
+\def\gettopheadingmarks{%
+ \ifcase0\the\savedtopmark\fi
+ \ifx\thischapter\empty \ifcase0\firstmark\fi \fi
+}
+\def\getbottomheadingmarks{\ifcase1\botmark\fi}
+\def\getcolormarks{\ifcase2\the\savedtopmark\fi}
+
+% Avoid "undefined control sequence" errors.
+\def\currentchapterdefs{}
+\def\currentsectiondefs{}
+\def\currentsection{}
+\def\prevchapterdefs{}
+\def\prevsectiondefs{}
+\def\currentcolordefs{}
+
+% Margin to add to right of even pages, to left of odd pages.
+\newdimen\bindingoffset
+\newdimen\normaloffset
+\newdimen\txipagewidth \newdimen\txipageheight
+
+% Main output routine.
+%
+\chardef\PAGE = 255
+\newtoks\defaultoutput
+\defaultoutput = {\savetopmark\onepageout{\pagecontents\PAGE}}
+\output=\expandafter{\the\defaultoutput}
+
+\newbox\headlinebox
+\newbox\footlinebox
+
+% When outputting the double column layout for indices, an output routine
+% is run several times, which hides the original value of \topmark. This
+% can lead to a page heading being output and duplicating the chapter heading
+% of the index. Hence, save the contents of \topmark at the beginning of
+% the output routine. The saved contents are valid until we actually
+% \shipout a page.
+%
+% (We used to run a short output routine to actually set \topmark and
+% \firstmark to the right values, but if this was called with an empty page
+% containing whatsits for writing index entries, the whatsits would be thrown
+% away and the index auxiliary file would remain empty.)
+%
+\newtoks\savedtopmark
+\newif\iftopmarksaved
+\topmarksavedtrue
+\def\savetopmark{%
+ \iftopmarksaved\else
+ \global\savedtopmark=\expandafter{\topmark}%
+ \global\topmarksavedtrue
+ \fi
+}
+
+% \onepageout takes a vbox as an argument.
+% \shipout a vbox for a single page, adding an optional header, footer
+% and footnote. This also causes index entries for this page to be written
+% to the auxiliary files.
+%
+\def\onepageout#1{%
+ \hoffset=\normaloffset
+ %
+ \ifodd\pageno \advance\hoffset by \bindingoffset
+ \else \advance\hoffset by -\bindingoffset\fi
+ %
+ % Retrieve the information for the headings from the marks in the page,
+ % and call Plain TeX's \makeheadline and \makefootline, which use the
+ % values in \headline and \footline.
+ %
+ % This is used to check if we are on the first page of a chapter.
+ \ifcase1\the\savedtopmark\fi
+ \let\prevchaptername\thischaptername
+ \ifcase0\firstmark\fi
+ \let\curchaptername\thischaptername
+ %
+ \ifodd\pageno \getoddheadingmarks \else \getevenheadingmarks \fi
+ %
+ \ifx\curchaptername\prevchaptername
+ \let\thischapterheading\thischapter
+ \else
+ % \thischapterheading is the same as \thischapter except it is blank
+ % for the first page of a chapter. This is to prevent the chapter name
+ % being shown twice.
+ \def\thischapterheading{}%
+ \fi
+ %
+ % Common context changes for both heading and footing.
+ % Do this outside of the \shipout so @code etc. will be expanded in
+ % the headline as they should be, not taken literally (outputting ''code).
+ \def\commonheadfootline{\let\hsize=\txipagewidth \texinfochars}
+ %
+ \global\setbox\headlinebox = \vbox{\commonheadfootline \makeheadline}%
+ %
+ \ifodd\pageno \getoddfootingmarks \else \getevenfootingmarks \fi
+ \global\setbox\footlinebox = \vbox{\commonheadfootline \makefootline}%
+ %
+ {%
+ % Set context for writing to auxiliary files like index files.
+ % Have to do this stuff outside the \shipout because we want it to
+ % take effect in \write's, yet the group defined by the \vbox ends
+ % before the \shipout runs.
+ %
+ \atdummies % don't expand commands in the output.
+ \turnoffactive
+ \shipout\vbox{%
+ % Do this early so pdf references go to the beginning of the page.
+ \ifpdfmakepagedest \pdfdest name{\the\pageno} xyz\fi
+ %
+ \unvbox\headlinebox
+ \pagebody{#1}%
+ \ifdim\ht\footlinebox > 0pt
+ % Only leave this space if the footline is nonempty.
+ % (We lessened \vsize for it in \oddfootingyyy.)
+ % The \baselineskip=24pt in plain's \makefootline has no effect.
+ \vskip 24pt
+ \unvbox\footlinebox
+ \fi
+ %
+ }%
+ }%
+ \global\topmarksavedfalse
+ \advancepageno
+ \ifnum\outputpenalty>-20000 \else\dosupereject\fi
+}
+
+\newinsert\margin \dimen\margin=\maxdimen
+
+% Main part of page, including any footnotes
+\def\pagebody#1{\vbox to\txipageheight{\boxmaxdepth=\maxdepth #1}}
+{\catcode`\@ =11
+\gdef\pagecontents#1{\ifvoid\topins\else\unvbox\topins\fi
+% marginal hacks, juha@viisa.uucp (Juha Takala)
+\ifvoid\margin\else % marginal info is present
+ \rlap{\kern\hsize\vbox to\z@{\kern1pt\box\margin \vss}}\fi
+\dimen@=\dp#1\relax \unvbox#1\relax
+\ifvoid\footins\else\vskip\skip\footins\footnoterule \unvbox\footins\fi
+\ifr@ggedbottom \kern-\dimen@ \vfil \fi}
+}
+
+
+% Argument parsing
+
+% Parse an argument, then pass it to #1. The argument is the rest of
+% the input line (except we remove a trailing comment). #1 should be a
+% macro which expects an ordinary undelimited TeX argument.
+% For example, \def\foo{\parsearg\fooxxx}.
+%
+\def\parsearg{\parseargusing{}}
+\def\parseargusing#1#2{%
+ \def\argtorun{#2}%
+ \begingroup
+ \obeylines
+ \spaceisspace
+ #1%
+ \parseargline\empty% Insert the \empty token, see \finishparsearg below.
+}
+
+{\obeylines %
+ \gdef\parseargline#1^^M{%
+ \endgroup % End of the group started in \parsearg.
+ \argremovecomment #1\comment\ArgTerm%
+ }%
+}
+
+% First remove any @comment, then any @c comment. Pass the result on to
+% \argcheckspaces.
+\def\argremovecomment#1\comment#2\ArgTerm{\argremovec #1\c\ArgTerm}
+\def\argremovec#1\c#2\ArgTerm{\argcheckspaces#1\^^M\ArgTerm}
+
+% Each occurrence of `\^^M' or `\^^M' is replaced by a single space.
+%
+% \argremovec might leave us with trailing space, e.g.,
+% @end itemize @c foo
+% This space token undergoes the same procedure and is eventually removed
+% by \finishparsearg.
+%
+\def\argcheckspaces#1\^^M{\argcheckspacesX#1\^^M \^^M}
+\def\argcheckspacesX#1 \^^M{\argcheckspacesY#1\^^M}
+\def\argcheckspacesY#1\^^M#2\^^M#3\ArgTerm{%
+ \def\temp{#3}%
+ \ifx\temp\empty
+ % Do not use \next, perhaps the caller of \parsearg uses it; reuse \temp:
+ \let\temp\finishparsearg
+ \else
+ \let\temp\argcheckspaces
+ \fi
+ % Put the space token in:
+ \temp#1 #3\ArgTerm
+}
+
+% If a _delimited_ argument is enclosed in braces, they get stripped; so
+% to get _exactly_ the rest of the line, we had to prevent such situation.
+% We prepended an \empty token at the very beginning and we expand it now,
+% just before passing the control to \argtorun.
+% (Similarly, we have to think about #3 of \argcheckspacesY above: it is
+% either the null string, or it ends with \^^M---thus there is no danger
+% that a pair of braces would be stripped.
+%
+% But first, we have to remove the trailing space token.
+%
+\def\finishparsearg#1 \ArgTerm{\expandafter\argtorun\expandafter{#1}}
+
+
+% \parseargdef - define a command taking an argument on the line
+%
+% \parseargdef\foo{...}
+% is roughly equivalent to
+% \def\foo{\parsearg\Xfoo}
+% \def\Xfoo#1{...}
+\def\parseargdef#1{%
+ \expandafter \doparseargdef \csname\string#1\endcsname #1%
+}
+\def\doparseargdef#1#2{%
+ \def#2{\parsearg#1}%
+ \def#1##1%
+}
+
+% Several utility definitions with active space:
+{
+ \obeyspaces
+ \gdef\obeyedspace{ }
+
+ % Make each space character in the input produce a normal interword
+ % space in the output. Don't allow a line break at this space, as this
+ % is used only in environments like @example, where each line of input
+ % should produce a line of output anyway.
+ %
+ \gdef\sepspaces{\obeyspaces\let =\tie}
+
+ % If an index command is used in an @example environment, any spaces
+ % therein should become regular spaces in the raw index file, not the
+ % expansion of \tie (\leavevmode \penalty \@M \ ).
+ \gdef\unsepspaces{\let =\space}
+}
+
+
+\def\flushcr{\ifx\par\lisppar \def\next##1{}\else \let\next=\relax \fi \next}
+
+% Define the framework for environments in texinfo.tex. It's used like this:
+%
+% \envdef\foo{...}
+% \def\Efoo{...}
+%
+% It's the responsibility of \envdef to insert \begingroup before the
+% actual body; @end closes the group after calling \Efoo. \envdef also
+% defines \thisenv, so the current environment is known; @end checks
+% whether the environment name matches. The \checkenv macro can also be
+% used to check whether the current environment is the one expected.
+%
+% Non-false conditionals (@iftex, @ifset) don't fit into this, so they
+% are not treated as environments; they don't open a group. (The
+% implementation of @end takes care not to call \endgroup in this
+% special case.)
+
+
+% At run-time, environments start with this:
+\def\startenvironment#1{\begingroup\def\thisenv{#1}}
+% initialize
+\let\thisenv\empty
+
+% ... but they get defined via ``\envdef\foo{...}'':
+\long\def\envdef#1#2{\def#1{\startenvironment#1#2}}
+\def\envparseargdef#1#2{\parseargdef#1{\startenvironment#1#2}}
+
+% Check whether we're in the right environment:
+\def\checkenv#1{%
+ \def\temp{#1}%
+ \ifx\thisenv\temp
+ \else
+ \badenverr
+ \fi
+}
+
+% Environment mismatch, #1 expected:
+\def\badenverr{%
+ \errhelp = \EMsimple
+ \errmessage{This command can appear only \inenvironment\temp,
+ not \inenvironment\thisenv}%
+}
+\def\inenvironment#1{%
+ \ifx#1\empty
+ outside of any environment%
+ \else
+ in environment \expandafter\string#1%
+ \fi
+}
+
+% @end foo executes the definition of \Efoo.
+% But first, it executes a specialized version of \checkenv
+%
+\parseargdef\end{%
+ \if 1\csname iscond.#1\endcsname
+ \else
+ % The general wording of \badenverr may not be ideal.
+ \expandafter\checkenv\csname#1\endcsname
+ \csname E#1\endcsname
+ \endgroup
+ \fi
+}
+
+\newhelp\EMsimple{Press RETURN to continue.}
+
+
+% Be sure we're in horizontal mode when doing a tie, since we make space
+% equivalent to this in @example-like environments. Otherwise, a space
+% at the beginning of a line will start with \penalty -- and
+% since \penalty is valid in vertical mode, we'd end up putting the
+% penalty on the vertical list instead of in the new paragraph.
+{\catcode`@ = 11
+ % Avoid using \@M directly, because that causes trouble
+ % if the definition is written into an index file.
+ \global\let\tiepenalty = \@M
+ \gdef\tie{\leavevmode\penalty\tiepenalty\ }
+}
+
+% @: forces normal size whitespace following.
+\def\:{\spacefactor=1000 }
+
+% @* forces a line break.
+\def\*{\unskip\hfil\break\hbox{}\ignorespaces}
+
+% @/ allows a line break.
+\let\/=\allowbreak
+
+% @. is an end-of-sentence period.
+\def\.{.\spacefactor=\endofsentencespacefactor\space}
+
+% @! is an end-of-sentence bang.
+\def\!{!\spacefactor=\endofsentencespacefactor\space}
+
+% @? is an end-of-sentence query.
+\def\?{?\spacefactor=\endofsentencespacefactor\space}
+
+% @frenchspacing on|off says whether to put extra space after punctuation.
+%
+\def\onword{on}
+\def\offword{off}
+%
+\parseargdef\frenchspacing{%
+ \def\temp{#1}%
+ \ifx\temp\onword \plainfrenchspacing
+ \else\ifx\temp\offword \plainnonfrenchspacing
+ \else
+ \errhelp = \EMsimple
+ \errmessage{Unknown @frenchspacing option `\temp', must be on|off}%
+ \fi\fi
+}
+
+% @w prevents a word break. Without the \leavevmode, @w at the
+% beginning of a paragraph, when TeX is still in vertical mode, would
+% produce a whole line of output instead of starting the paragraph.
+\def\w#1{\leavevmode\hbox{#1}}
+
+% @group ... @end group forces ... to be all on one page, by enclosing
+% it in a TeX vbox. We use \vtop instead of \vbox to construct the box
+% to keep its height that of a normal line. According to the rules for
+% \topskip (p.114 of the TeXbook), the glue inserted is
+% max (\topskip - \ht (first item), 0). If that height is large,
+% therefore, no glue is inserted, and the space between the headline and
+% the text is small, which looks bad.
+%
+% Another complication is that the group might be very large. This can
+% cause the glue on the previous page to be unduly stretched, because it
+% does not have much material. In this case, it's better to add an
+% explicit \vfill so that the extra space is at the bottom. The
+% threshold for doing this is if the group is more than \vfilllimit
+% percent of a page (\vfilllimit can be changed inside of @tex).
+%
+\newbox\groupbox
+\def\vfilllimit{0.7}
+%
+\envdef\group{%
+ \ifnum\catcode`\^^M=\active \else
+ \errhelp = \groupinvalidhelp
+ \errmessage{@group invalid in context where filling is enabled}%
+ \fi
+ \startsavinginserts
+ %
+ \setbox\groupbox = \vtop\bgroup
+ % Do @comment since we are called inside an environment such as
+ % @example, where each end-of-line in the input causes an
+ % end-of-line in the output. We don't want the end-of-line after
+ % the `@group' to put extra space in the output. Since @group
+ % should appear on a line by itself (according to the Texinfo
+ % manual), we don't worry about eating any user text.
+ \comment
+}
+%
+% The \vtop produces a box with normal height and large depth; thus, TeX puts
+% \baselineskip glue before it, and (when the next line of text is done)
+% \lineskip glue after it. Thus, space below is not quite equal to space
+% above. But it's pretty close.
+\def\Egroup{%
+ % To get correct interline space between the last line of the group
+ % and the first line afterwards, we have to propagate \prevdepth.
+ \endgraf % Not \par, as it may have been set to \lisppar.
+ \global\dimen1 = \prevdepth
+ \egroup % End the \vtop.
+ \addgroupbox
+ \prevdepth = \dimen1
+ \checkinserts
+}
+
+\def\addgroupbox{
+ % \dimen0 is the vertical size of the group's box.
+ \dimen0 = \ht\groupbox \advance\dimen0 by \dp\groupbox
+ % \dimen2 is how much space is left on the page (more or less).
+ \dimen2 = \txipageheight \advance\dimen2 by -\pagetotal
+ % if the group doesn't fit on the current page, and it's a big big
+ % group, force a page break.
+ \ifdim \dimen0 > \dimen2
+ \ifdim \pagetotal < \vfilllimit\txipageheight
+ \page
+ \fi
+ \fi
+ \box\groupbox
+}
+
+%
+% TeX puts in an \escapechar (i.e., `@') at the beginning of the help
+% message, so this ends up printing `@group can only ...'.
+%
+\newhelp\groupinvalidhelp{%
+group can only be used in environments such as @example,^^J%
+where each line of input produces a line of output.}
+
+% @need space-in-mils
+% forces a page break if there is not space-in-mils remaining.
+
+\newdimen\mil \mil=0.001in
+
+\parseargdef\need{%
+ % Ensure vertical mode, so we don't make a big box in the middle of a
+ % paragraph.
+ \par
+ %
+ % If the @need value is less than one line space, it's useless.
+ \dimen0 = #1\mil
+ \dimen2 = \ht\strutbox
+ \advance\dimen2 by \dp\strutbox
+ \ifdim\dimen0 > \dimen2
+ %
+ % Do a \strut just to make the height of this box be normal, so the
+ % normal leading is inserted relative to the preceding line.
+ % And a page break here is fine.
+ \vtop to #1\mil{\strut\vfil}%
+ %
+ % TeX does not even consider page breaks if a penalty added to the
+ % main vertical list is 10000 or more. But in order to see if the
+ % empty box we just added fits on the page, we must make it consider
+ % page breaks. On the other hand, we don't want to actually break the
+ % page after the empty box. So we use a penalty of 9999.
+ %
+ % There is an extremely small chance that TeX will actually break the
+ % page at this \penalty, if there are no other feasible breakpoints in
+ % sight. (If the user is using lots of big @group commands, which
+ % almost-but-not-quite fill up a page, TeX will have a hard time doing
+ % good page breaking, for example.) However, I could not construct an
+ % example where a page broke at this \penalty; if it happens in a real
+ % document, then we can reconsider our strategy.
+ \penalty9999
+ %
+ % Back up by the size of the box, whether we did a page break or not.
+ \kern -#1\mil
+ %
+ % Do not allow a page break right after this kern.
+ \nobreak
+ \fi
+}
+
+% @br forces paragraph break (and is undocumented).
+
+\let\br = \par
+
+% @page forces the start of a new page.
+%
+\def\page{\par\vfill\supereject}
+
+% @exdent text....
+% outputs text on separate line in roman font, starting at standard page margin
+
+% This records the amount of indent in the innermost environment.
+% That's how much \exdent should take out.
+\newskip\exdentamount
+
+% This defn is used inside fill environments such as @defun.
+\parseargdef\exdent{\hfil\break\hbox{\kern -\exdentamount{\rm#1}}\hfil\break}
+
+% This defn is used inside nofill environments such as @example.
+\parseargdef\nofillexdent{{\advance \leftskip by -\exdentamount
+ \leftline{\hskip\leftskip{\rm#1}}}}
+
+% @inmargin{WHICH}{TEXT} puts TEXT in the WHICH margin next to the current
+% paragraph. For more general purposes, use the \margin insertion
+% class. WHICH is `l' or `r'. Not documented, written for gawk manual.
+%
+\newskip\inmarginspacing \inmarginspacing=1cm
+\def\strutdepth{\dp\strutbox}
+%
+\def\doinmargin#1#2{\strut\vadjust{%
+ \nobreak
+ \kern-\strutdepth
+ \vtop to \strutdepth{%
+ \baselineskip=\strutdepth
+ \vss
+ % if you have multiple lines of stuff to put here, you'll need to
+ % make the vbox yourself of the appropriate size.
+ \ifx#1l%
+ \llap{\ignorespaces #2\hskip\inmarginspacing}%
+ \else
+ \rlap{\hskip\hsize \hskip\inmarginspacing \ignorespaces #2}%
+ \fi
+ \null
+ }%
+}}
+\def\inleftmargin{\doinmargin l}
+\def\inrightmargin{\doinmargin r}
+%
+% @inmargin{TEXT [, RIGHT-TEXT]}
+% (if RIGHT-TEXT is given, use TEXT for left page, RIGHT-TEXT for right;
+% else use TEXT for both).
+%
+\def\inmargin#1{\parseinmargin #1,,\finish}
+\def\parseinmargin#1,#2,#3\finish{% not perfect, but better than nothing.
+ \setbox0 = \hbox{\ignorespaces #2}%
+ \ifdim\wd0 > 0pt
+ \def\lefttext{#1}% have both texts
+ \def\righttext{#2}%
+ \else
+ \def\lefttext{#1}% have only one text
+ \def\righttext{#1}%
+ \fi
+ %
+ \ifodd\pageno
+ \def\temp{\inrightmargin\righttext}% odd page -> outside is right margin
+ \else
+ \def\temp{\inleftmargin\lefttext}%
+ \fi
+ \temp
+}
+
+% @include FILE -- \input text of FILE.
+%
+\def\include{\parseargusing\filenamecatcodes\includezzz}
+\def\includezzz#1{%
+ \pushthisfilestack
+ \def\thisfile{#1}%
+ {%
+ \makevalueexpandable % we want to expand any @value in FILE.
+ \turnoffactive % and allow special characters in the expansion
+ \indexnofonts % Allow `@@' and other weird things in file names.
+ \wlog{texinfo.tex: doing @include of #1^^J}%
+ \edef\temp{\noexpand\input #1 }%
+ %
+ % This trickery is to read FILE outside of a group, in case it makes
+ % definitions, etc.
+ \expandafter
+ }\temp
+ \popthisfilestack
+}
+\def\filenamecatcodes{%
+ \catcode`\\=\other
+ \catcode`~=\other
+ \catcode`^=\other
+ \catcode`_=\other
+ \catcode`|=\other
+ \catcode`<=\other
+ \catcode`>=\other
+ \catcode`+=\other
+ \catcode`-=\other
+ \catcode`\`=\other
+ \catcode`\'=\other
+}
+
+\def\pushthisfilestack{%
+ \expandafter\pushthisfilestackX\popthisfilestack\StackTerm
+}
+\def\pushthisfilestackX{%
+ \expandafter\pushthisfilestackY\thisfile\StackTerm
+}
+\def\pushthisfilestackY #1\StackTerm #2\StackTerm {%
+ \gdef\popthisfilestack{\gdef\thisfile{#1}\gdef\popthisfilestack{#2}}%
+}
+
+\def\popthisfilestack{\errthisfilestackempty}
+\def\errthisfilestackempty{\errmessage{Internal error:
+ the stack of filenames is empty.}}
+%
+\def\thisfile{}
+
+% @center line
+% outputs that line, centered.
+%
+\parseargdef\center{%
+ \ifhmode
+ \let\centersub\centerH
+ \else
+ \let\centersub\centerV
+ \fi
+ \centersub{\hfil \ignorespaces#1\unskip \hfil}%
+ \let\centersub\relax % don't let the definition persist, just in case
+}
+\def\centerH#1{{%
+ \hfil\break
+ \advance\hsize by -\leftskip
+ \advance\hsize by -\rightskip
+ \line{#1}%
+ \break
+}}
+%
+\newcount\centerpenalty
+\def\centerV#1{%
+ % The idea here is the same as in \startdefun, \cartouche, etc.: if
+ % @center is the first thing after a section heading, we need to wipe
+ % out the negative parskip inserted by \sectionheading, but still
+ % prevent a page break here.
+ \centerpenalty = \lastpenalty
+ \ifnum\centerpenalty>10000 \vskip\parskip \fi
+ \ifnum\centerpenalty>9999 \penalty\centerpenalty \fi
+ \line{\kern\leftskip #1\kern\rightskip}%
+}
+
+% @sp n outputs n lines of vertical space
+%
+\parseargdef\sp{\vskip #1\baselineskip}
+
+% @comment ...line which is ignored...
+% @c is the same as @comment
+% @ignore ... @end ignore is another way to write a comment
+
+
+\def\c{\begingroup \catcode`\^^M=\active%
+\catcode`\@=\other \catcode`\{=\other \catcode`\}=\other%
+\cxxx}
+{\catcode`\^^M=\active \gdef\cxxx#1^^M{\endgroup}}
+%
+\let\comment\c
+
+% @paragraphindent NCHARS
+% We'll use ems for NCHARS, close enough.
+% NCHARS can also be the word `asis' or `none'.
+% We cannot feasibly implement @paragraphindent asis, though.
+%
+\def\asisword{asis} % no translation, these are keywords
+\def\noneword{none}
+%
+\parseargdef\paragraphindent{%
+ \def\temp{#1}%
+ \ifx\temp\asisword
+ \else
+ \ifx\temp\noneword
+ \defaultparindent = 0pt
+ \else
+ \defaultparindent = #1em
+ \fi
+ \fi
+ \parindent = \defaultparindent
+}
+
+% @exampleindent NCHARS
+% We'll use ems for NCHARS like @paragraphindent.
+% It seems @exampleindent asis isn't necessary, but
+% I preserve it to make it similar to @paragraphindent.
+\parseargdef\exampleindent{%
+ \def\temp{#1}%
+ \ifx\temp\asisword
+ \else
+ \ifx\temp\noneword
+ \lispnarrowing = 0pt
+ \else
+ \lispnarrowing = #1em
+ \fi
+ \fi
+}
+
+% @firstparagraphindent WORD
+% If WORD is `none', then suppress indentation of the first paragraph
+% after a section heading. If WORD is `insert', then do indent at such
+% paragraphs.
+%
+% The paragraph indentation is suppressed or not by calling
+% \suppressfirstparagraphindent, which the sectioning commands do.
+% We switch the definition of this back and forth according to WORD.
+% By default, we suppress indentation.
+%
+\def\suppressfirstparagraphindent{\dosuppressfirstparagraphindent}
+\def\insertword{insert}
+%
+\parseargdef\firstparagraphindent{%
+ \def\temp{#1}%
+ \ifx\temp\noneword
+ \let\suppressfirstparagraphindent = \dosuppressfirstparagraphindent
+ \else\ifx\temp\insertword
+ \let\suppressfirstparagraphindent = \relax
+ \else
+ \errhelp = \EMsimple
+ \errmessage{Unknown @firstparagraphindent option `\temp'}%
+ \fi\fi
+}
+
+% Here is how we actually suppress indentation. Redefine \everypar to
+% \kern backwards by \parindent, and then reset itself to empty.
+%
+% We also make \indent itself not actually do anything until the next
+% paragraph.
+%
+\gdef\dosuppressfirstparagraphindent{%
+ \gdef\indent {\restorefirstparagraphindent \indent}%
+ \gdef\noindent{\restorefirstparagraphindent \noindent}%
+ \global\everypar = {\kern -\parindent \restorefirstparagraphindent}%
+}
+%
+\gdef\restorefirstparagraphindent{%
+ \global\let\indent = \ptexindent
+ \global\let\noindent = \ptexnoindent
+ \global\everypar = {}%
+}
+
+
+% @refill is a no-op.
+\let\refill=\relax
+
+% @setfilename INFO-FILENAME - ignored
+\let\setfilename=\comment
+
+% @bye.
+\outer\def\bye{\pagealignmacro\tracingstats=1\ptexend}
+
+
+\message{pdf,}
+% adobe `portable' document format
+\newcount\tempnum
+\newcount\lnkcount
+\newtoks\filename
+\newcount\filenamelength
+\newcount\pgn
+\newtoks\toksA
+\newtoks\toksB
+\newtoks\toksC
+\newtoks\toksD
+\newbox\boxA
+\newbox\boxB
+\newcount\countA
+\newif\ifpdf
+\newif\ifpdfmakepagedest
+
+%
+% For LuaTeX
+%
+
+\newif\iftxiuseunicodedestname
+\txiuseunicodedestnamefalse % For pdfTeX etc.
+
+\ifx\luatexversion\thisisundefined
+\else
+ % Use Unicode destination names
+ \txiuseunicodedestnametrue
+ % Escape PDF strings with converting UTF-16 from UTF-8
+ \begingroup
+ \catcode`\%=12
+ \directlua{
+ function UTF16oct(str)
+ tex.sprint(string.char(0x5c) .. '376' .. string.char(0x5c) .. '377')
+ for c in string.utfvalues(str) do
+ if c < 0x10000 then
+ tex.sprint(
+ string.format(string.char(0x5c) .. string.char(0x25) .. '03o' ..
+ string.char(0x5c) .. string.char(0x25) .. '03o',
+ math.floor(c / 256), math.floor(c % 256)))
+ else
+ c = c - 0x10000
+ local c_hi = c / 1024 + 0xd800
+ local c_lo = c % 1024 + 0xdc00
+ tex.sprint(
+ string.format(string.char(0x5c) .. string.char(0x25) .. '03o' ..
+ string.char(0x5c) .. string.char(0x25) .. '03o' ..
+ string.char(0x5c) .. string.char(0x25) .. '03o' ..
+ string.char(0x5c) .. string.char(0x25) .. '03o',
+ math.floor(c_hi / 256), math.floor(c_hi % 256),
+ math.floor(c_lo / 256), math.floor(c_lo % 256)))
+ end
+ end
+ end
+ }
+ \endgroup
+ \def\pdfescapestrutfsixteen#1{\directlua{UTF16oct('\luaescapestring{#1}')}}
+ % Escape PDF strings without converting
+ \begingroup
+ \directlua{
+ function PDFescstr(str)
+ for c in string.bytes(str) do
+ if c <= 0x20 or c >= 0x80 or c == 0x28 or c == 0x29 or c == 0x5c then
+ tex.sprint(-2,
+ string.format(string.char(0x5c) .. string.char(0x25) .. '03o',
+ c))
+ else
+ tex.sprint(-2, string.char(c))
+ end
+ end
+ end
+ }
+ % The -2 in the arguments here gives all the input to TeX catcode 12
+ % (other) or 10 (space), preventing undefined control sequence errors. See
+ % https://lists.gnu.org/archive/html/bug-texinfo/2019-08/msg00031.html
+ %
+ \endgroup
+ \def\pdfescapestring#1{\directlua{PDFescstr('\luaescapestring{#1}')}}
+ \ifnum\luatexversion>84
+ % For LuaTeX >= 0.85
+ \def\pdfdest{\pdfextension dest}
+ \let\pdfoutput\outputmode
+ \def\pdfliteral{\pdfextension literal}
+ \def\pdfcatalog{\pdfextension catalog}
+ \def\pdftexversion{\numexpr\pdffeedback version\relax}
+ \let\pdfximage\saveimageresource
+ \let\pdfrefximage\useimageresource
+ \let\pdflastximage\lastsavedimageresourceindex
+ \def\pdfendlink{\pdfextension endlink\relax}
+ \def\pdfoutline{\pdfextension outline}
+ \def\pdfstartlink{\pdfextension startlink}
+ \def\pdffontattr{\pdfextension fontattr}
+ \def\pdfobj{\pdfextension obj}
+ \def\pdflastobj{\numexpr\pdffeedback lastobj\relax}
+ \let\pdfpagewidth\pagewidth
+ \let\pdfpageheight\pageheight
+ \edef\pdfhorigin{\pdfvariable horigin}
+ \edef\pdfvorigin{\pdfvariable vorigin}
+ \fi
+\fi
+
+% when pdftex is run in dvi mode, \pdfoutput is defined (so \pdfoutput=1
+% can be set). So we test for \relax and 0 as well as being undefined.
+\ifx\pdfoutput\thisisundefined
+\else
+ \ifx\pdfoutput\relax
+ \else
+ \ifcase\pdfoutput
+ \else
+ \pdftrue
+ \fi
+ \fi
+\fi
+
+\newif\ifpdforxetex
+\pdforxetexfalse
+\ifpdf
+ \pdforxetextrue
+\fi
+\ifx\XeTeXrevision\thisisundefined\else
+ \pdforxetextrue
+\fi
+
+
+% PDF uses PostScript string constants for the names of xref targets,
+% for display in the outlines, and in other places. Thus, we have to
+% double any backslashes. Otherwise, a name like "\node" will be
+% interpreted as a newline (\n), followed by o, d, e. Not good.
+%
+% See http://www.ntg.nl/pipermail/ntg-pdftex/2004-July/000654.html and
+% related messages. The final outcome is that it is up to the TeX user
+% to double the backslashes and otherwise make the string valid, so
+% that's what we do. pdftex 1.30.0 (ca.2005) introduced a primitive to
+% do this reliably, so we use it.
+
+% #1 is a control sequence in which to do the replacements,
+% which we \xdef.
+\def\txiescapepdf#1{%
+ \ifx\pdfescapestring\thisisundefined
+ % No primitive available; should we give a warning or log?
+ % Many times it won't matter.
+ \xdef#1{#1}%
+ \else
+ % The expandable \pdfescapestring primitive escapes parentheses,
+ % backslashes, and other special chars.
+ \xdef#1{\pdfescapestring{#1}}%
+ \fi
+}
+\def\txiescapepdfutfsixteen#1{%
+ \ifx\pdfescapestrutfsixteen\thisisundefined
+ % No UTF-16 converting macro available.
+ \txiescapepdf{#1}%
+ \else
+ \xdef#1{\pdfescapestrutfsixteen{#1}}%
+ \fi
+}
+
+\newhelp\nopdfimagehelp{Texinfo supports .png, .jpg, .jpeg, and .pdf images
+with PDF output, and none of those formats could be found. (.eps cannot
+be supported due to the design of the PDF format; use regular TeX (DVI
+output) for that.)}
+
+\ifpdf
+ %
+ % Color manipulation macros using ideas from pdfcolor.tex,
+ % except using rgb instead of cmyk; the latter is said to render as a
+ % very dark gray on-screen and a very dark halftone in print, instead
+ % of actual black. The dark red here is dark enough to print on paper as
+ % nearly black, but still distinguishable for online viewing. We use
+ % black by default, though.
+ \def\rgbDarkRed{0.50 0.09 0.12}
+ \def\rgbBlack{0 0 0}
+ %
+ % rg sets the color for filling (usual text, etc.);
+ % RG sets the color for stroking (thin rules, e.g., normal _'s).
+ \def\pdfsetcolor#1{\pdfliteral{#1 rg #1 RG}}
+ %
+ % Set color, and create a mark which defines \thiscolor accordingly,
+ % so that \makeheadline knows which color to restore.
+ \def\setcolor#1{%
+ \xdef\currentcolordefs{\gdef\noexpand\thiscolor{#1}}%
+ \domark
+ \pdfsetcolor{#1}%
+ }
+ %
+ \def\maincolor{\rgbBlack}
+ \pdfsetcolor{\maincolor}
+ \edef\thiscolor{\maincolor}
+ \def\currentcolordefs{}
+ %
+ \def\makefootline{%
+ \baselineskip24pt
+ \line{\pdfsetcolor{\maincolor}\the\footline}%
+ }
+ %
+ \def\makeheadline{%
+ \vbox to 0pt{%
+ \vskip-22.5pt
+ \line{%
+ \vbox to8.5pt{}%
+ % Extract \thiscolor definition from the marks.
+ \getcolormarks
+ % Typeset the headline with \maincolor, then restore the color.
+ \pdfsetcolor{\maincolor}\the\headline\pdfsetcolor{\thiscolor}%
+ }%
+ \vss
+ }%
+ \nointerlineskip
+ }
+ %
+ %
+ \pdfcatalog{/PageMode /UseOutlines}
+ %
+ % #1 is image name, #2 width (might be empty/whitespace), #3 height (ditto).
+ \def\dopdfimage#1#2#3{%
+ \def\pdfimagewidth{#2}\setbox0 = \hbox{\ignorespaces #2}%
+ \def\pdfimageheight{#3}\setbox2 = \hbox{\ignorespaces #3}%
+ %
+ % pdftex (and the PDF format) support .pdf, .png, .jpg (among
+ % others). Let's try in that order, PDF first since if
+ % someone has a scalable image, presumably better to use that than a
+ % bitmap.
+ \let\pdfimgext=\empty
+ \begingroup
+ \openin 1 #1.pdf \ifeof 1
+ \openin 1 #1.PDF \ifeof 1
+ \openin 1 #1.png \ifeof 1
+ \openin 1 #1.jpg \ifeof 1
+ \openin 1 #1.jpeg \ifeof 1
+ \openin 1 #1.JPG \ifeof 1
+ \errhelp = \nopdfimagehelp
+ \errmessage{Could not find image file #1 for pdf}%
+ \else \gdef\pdfimgext{JPG}%
+ \fi
+ \else \gdef\pdfimgext{jpeg}%
+ \fi
+ \else \gdef\pdfimgext{jpg}%
+ \fi
+ \else \gdef\pdfimgext{png}%
+ \fi
+ \else \gdef\pdfimgext{PDF}%
+ \fi
+ \else \gdef\pdfimgext{pdf}%
+ \fi
+ \closein 1
+ \endgroup
+ %
+ % without \immediate, ancient pdftex seg faults when the same image is
+ % included twice. (Version 3.14159-pre-1.0-unofficial-20010704.)
+ \ifnum\pdftexversion < 14
+ \immediate\pdfimage
+ \else
+ \immediate\pdfximage
+ \fi
+ \ifdim \wd0 >0pt width \pdfimagewidth \fi
+ \ifdim \wd2 >0pt height \pdfimageheight \fi
+ \ifnum\pdftexversion<13
+ #1.\pdfimgext
+ \else
+ {#1.\pdfimgext}%
+ \fi
+ \ifnum\pdftexversion < 14 \else
+ \pdfrefximage \pdflastximage
+ \fi}
+ %
+ \def\setpdfdestname#1{{%
+ % We have to set dummies so commands such as @code, and characters
+ % such as \, aren't expanded when present in a section title.
+ \indexnofonts
+ \makevalueexpandable
+ \turnoffactive
+ \iftxiuseunicodedestname
+ \ifx \declaredencoding \latone
+ % Pass through Latin-1 characters.
+ % LuaTeX with byte wise I/O converts Latin-1 characters to Unicode.
+ \else
+ \ifx \declaredencoding \utfeight
+ % Pass through Unicode characters.
+ \else
+ % Use ASCII approximations in destination names.
+ \passthroughcharsfalse
+ \fi
+ \fi
+ \else
+ % Use ASCII approximations in destination names.
+ \passthroughcharsfalse
+ \fi
+ \def\pdfdestname{#1}%
+ \txiescapepdf\pdfdestname
+ }}
+ %
+ \def\setpdfoutlinetext#1{{%
+ \indexnofonts
+ \makevalueexpandable
+ \turnoffactive
+ \ifx \declaredencoding \latone
+ % The PDF format can use an extended form of Latin-1 in bookmark
+ % strings. See Appendix D of the PDF Reference, Sixth Edition, for
+ % the "PDFDocEncoding".
+ \passthroughcharstrue
+ % Pass through Latin-1 characters.
+ % LuaTeX: Convert to Unicode
+ % pdfTeX: Use Latin-1 as PDFDocEncoding
+ \def\pdfoutlinetext{#1}%
+ \else
+ \ifx \declaredencoding \utfeight
+ \ifx\luatexversion\thisisundefined
+ % For pdfTeX with UTF-8.
+ % TODO: the PDF format can use UTF-16 in bookmark strings,
+ % but the code for this isn't done yet.
+ % Use ASCII approximations.
+ \passthroughcharsfalse
+ \def\pdfoutlinetext{#1}%
+ \else
+ % For LuaTeX with UTF-8.
+ % Pass through Unicode characters for title texts.
+ \passthroughcharstrue
+ \def\pdfoutlinetext{#1}%
+ \fi
+ \else
+ % For non-Latin-1 or non-UTF-8 encodings.
+ % Use ASCII approximations.
+ \passthroughcharsfalse
+ \def\pdfoutlinetext{#1}%
+ \fi
+ \fi
+ % LuaTeX: Convert to UTF-16
+ % pdfTeX: Use Latin-1 as PDFDocEncoding
+ \txiescapepdfutfsixteen\pdfoutlinetext
+ }}
+ %
+ \def\pdfmkdest#1{%
+ \setpdfdestname{#1}%
+ \safewhatsit{\pdfdest name{\pdfdestname} xyz}%
+ }
+ %
+ % used to mark target names; must be expandable.
+ \def\pdfmkpgn#1{#1}
+ %
+ % by default, use black for everything.
+ \def\urlcolor{\rgbBlack}
+ \def\linkcolor{\rgbBlack}
+ \def\endlink{\setcolor{\maincolor}\pdfendlink}
+ %
+ % Adding outlines to PDF; macros for calculating structure of outlines
+ % come from Petr Olsak
+ \def\expnumber#1{\expandafter\ifx\csname#1\endcsname\relax 0%
+ \else \csname#1\endcsname \fi}
+ \def\advancenumber#1{\tempnum=\expnumber{#1}\relax
+ \advance\tempnum by 1
+ \expandafter\xdef\csname#1\endcsname{\the\tempnum}}
+ %
+ % #1 is the section text, which is what will be displayed in the
+ % outline by the pdf viewer. #2 is the pdf expression for the number
+ % of subentries (or empty, for subsubsections). #3 is the node text,
+ % which might be empty if this toc entry had no corresponding node.
+ % #4 is the page number
+ %
+ \def\dopdfoutline#1#2#3#4{%
+ % Generate a link to the node text if that exists; else, use the
+ % page number. We could generate a destination for the section
+ % text in the case where a section has no node, but it doesn't
+ % seem worth the trouble, since most documents are normally structured.
+ \setpdfoutlinetext{#1}
+ \setpdfdestname{#3}
+ \ifx\pdfdestname\empty
+ \def\pdfdestname{#4}%
+ \fi
+ %
+ \pdfoutline goto name{\pdfmkpgn{\pdfdestname}}#2{\pdfoutlinetext}%
+ }
+ %
+ \def\pdfmakeoutlines{%
+ \begingroup
+ % Read toc silently, to get counts of subentries for \pdfoutline.
+ \def\partentry##1##2##3##4{}% ignore parts in the outlines
+ \def\numchapentry##1##2##3##4{%
+ \def\thischapnum{##2}%
+ \def\thissecnum{0}%
+ \def\thissubsecnum{0}%
+ }%
+ \def\numsecentry##1##2##3##4{%
+ \advancenumber{chap\thischapnum}%
+ \def\thissecnum{##2}%
+ \def\thissubsecnum{0}%
+ }%
+ \def\numsubsecentry##1##2##3##4{%
+ \advancenumber{sec\thissecnum}%
+ \def\thissubsecnum{##2}%
+ }%
+ \def\numsubsubsecentry##1##2##3##4{%
+ \advancenumber{subsec\thissubsecnum}%
+ }%
+ \def\thischapnum{0}%
+ \def\thissecnum{0}%
+ \def\thissubsecnum{0}%
+ %
+ % use \def rather than \let here because we redefine \chapentry et
+ % al. a second time, below.
+ \def\appentry{\numchapentry}%
+ \def\appsecentry{\numsecentry}%
+ \def\appsubsecentry{\numsubsecentry}%
+ \def\appsubsubsecentry{\numsubsubsecentry}%
+ \def\unnchapentry{\numchapentry}%
+ \def\unnsecentry{\numsecentry}%
+ \def\unnsubsecentry{\numsubsecentry}%
+ \def\unnsubsubsecentry{\numsubsubsecentry}%
+ \readdatafile{toc}%
+ %
+ % Read toc second time, this time actually producing the outlines.
+ % The `-' means take the \expnumber as the absolute number of
+ % subentries, which we calculated on our first read of the .toc above.
+ %
+ % We use the node names as the destinations.
+ \def\numchapentry##1##2##3##4{%
+ \dopdfoutline{##1}{count-\expnumber{chap##2}}{##3}{##4}}%
+ \def\numsecentry##1##2##3##4{%
+ \dopdfoutline{##1}{count-\expnumber{sec##2}}{##3}{##4}}%
+ \def\numsubsecentry##1##2##3##4{%
+ \dopdfoutline{##1}{count-\expnumber{subsec##2}}{##3}{##4}}%
+ \def\numsubsubsecentry##1##2##3##4{% count is always zero
+ \dopdfoutline{##1}{}{##3}{##4}}%
+ %
+ % PDF outlines are displayed using system fonts, instead of
+ % document fonts. Therefore we cannot use special characters,
+ % since the encoding is unknown. For example, the eogonek from
+ % Latin 2 (0xea) gets translated to a | character. Info from
+ % Staszek Wawrykiewicz, 19 Jan 2004 04:09:24 +0100.
+ %
+ % TODO this right, we have to translate 8-bit characters to
+ % their "best" equivalent, based on the @documentencoding. Too
+ % much work for too little return. Just use the ASCII equivalents
+ % we use for the index sort strings.
+ %
+ \indexnofonts
+ \setupdatafile
+ % We can have normal brace characters in the PDF outlines, unlike
+ % Texinfo index files. So set that up.
+ \def\{{\lbracecharliteral}%
+ \def\}{\rbracecharliteral}%
+ \catcode`\\=\active \otherbackslash
+ \input \tocreadfilename
+ \endgroup
+ }
+ {\catcode`[=1 \catcode`]=2
+ \catcode`{=\other \catcode`}=\other
+ \gdef\lbracecharliteral[{]%
+ \gdef\rbracecharliteral[}]%
+ ]
+ %
+ \def\skipspaces#1{\def\PP{#1}\def\D{|}%
+ \ifx\PP\D\let\nextsp\relax
+ \else\let\nextsp\skipspaces
+ \addtokens{\filename}{\PP}%
+ \advance\filenamelength by 1
+ \fi
+ \nextsp}
+ \def\getfilename#1{%
+ \filenamelength=0
+ % If we don't expand the argument now, \skipspaces will get
+ % snagged on things like "@value{foo}".
+ \edef\temp{#1}%
+ \expandafter\skipspaces\temp|\relax
+ }
+ \ifnum\pdftexversion < 14
+ \let \startlink \pdfannotlink
+ \else
+ \let \startlink \pdfstartlink
+ \fi
+ % make a live url in pdf output.
+ \def\pdfurl#1{%
+ \begingroup
+ % it seems we really need yet another set of dummies; have not
+ % tried to figure out what each command should do in the context
+ % of @url. for now, just make @/ a no-op, that's the only one
+ % people have actually reported a problem with.
+ %
+ \normalturnoffactive
+ \def\@{@}%
+ \let\/=\empty
+ \makevalueexpandable
+ % do we want to go so far as to use \indexnofonts instead of just
+ % special-casing \var here?
+ \def\var##1{##1}%
+ %
+ \leavevmode\setcolor{\urlcolor}%
+ \startlink attr{/Border [0 0 0]}%
+ user{/Subtype /Link /A << /S /URI /URI (#1) >>}%
+ \endgroup}
+ % \pdfgettoks - Surround page numbers in #1 with @pdflink. #1 may
+ % be a simple number, or a list of numbers in the case of an index
+ % entry.
+ \def\pdfgettoks#1.{\setbox\boxA=\hbox{\toksA={#1.}\toksB={}\maketoks}}
+ \def\addtokens#1#2{\edef\addtoks{\noexpand#1={\the#1#2}}\addtoks}
+ \def\adn#1{\addtokens{\toksC}{#1}\global\countA=1\let\next=\maketoks}
+ \def\poptoks#1#2|ENDTOKS|{\let\first=#1\toksD={#1}\toksA={#2}}
+ \def\maketoks{%
+ \expandafter\poptoks\the\toksA|ENDTOKS|\relax
+ \ifx\first0\adn0
+ \else\ifx\first1\adn1 \else\ifx\first2\adn2 \else\ifx\first3\adn3
+ \else\ifx\first4\adn4 \else\ifx\first5\adn5 \else\ifx\first6\adn6
+ \else\ifx\first7\adn7 \else\ifx\first8\adn8 \else\ifx\first9\adn9
+ \else
+ \ifnum0=\countA\else\makelink\fi
+ \ifx\first.\let\next=\done\else
+ \let\next=\maketoks
+ \addtokens{\toksB}{\the\toksD}
+ \ifx\first,\addtokens{\toksB}{\space}\fi
+ \fi
+ \fi\fi\fi\fi\fi\fi\fi\fi\fi\fi
+ \next}
+ \def\makelink{\addtokens{\toksB}%
+ {\noexpand\pdflink{\the\toksC}}\toksC={}\global\countA=0}
+ \def\pdflink#1{%
+ \startlink attr{/Border [0 0 0]} goto name{\pdfmkpgn{#1}}
+ \setcolor{\linkcolor}#1\endlink}
+ \def\done{\edef\st{\global\noexpand\toksA={\the\toksB}}\st}
+\else
+ % non-pdf mode
+ \let\pdfmkdest = \gobble
+ \let\pdfurl = \gobble
+ \let\endlink = \relax
+ \let\setcolor = \gobble
+ \let\pdfsetcolor = \gobble
+ \let\pdfmakeoutlines = \relax
+\fi % \ifx\pdfoutput
+
+%
+% For XeTeX
+%
+\ifx\XeTeXrevision\thisisundefined
+\else
+ %
+ % XeTeX version check
+ %
+ \ifnum\strcmp{\the\XeTeXversion\XeTeXrevision}{0.99996}>-1
+ % TeX Live 2016 contains XeTeX 0.99996 and xdvipdfmx 20160307.
+ % It can use the `dvipdfmx:config' special (from TeX Live SVN r40941).
+ % For avoiding PDF destination name replacement, we use this special
+ % instead of xdvipdfmx's command line option `-C 0x0010'.
+ \special{dvipdfmx:config C 0x0010}
+ % XeTeX 0.99995+ comes with xdvipdfmx 20160307+.
+ % It can handle Unicode destination names for PDF.
+ \txiuseunicodedestnametrue
+ \else
+ % XeTeX < 0.99996 (TeX Live < 2016) cannot use the
+ % `dvipdfmx:config' special.
+ % So for avoiding PDF destination name replacement,
+ % xdvipdfmx's command line option `-C 0x0010' is necessary.
+ %
+ % XeTeX < 0.99995 can not handle Unicode destination names for PDF
+ % because xdvipdfmx 20150315 has a UTF-16 conversion issue.
+ % It is fixed by xdvipdfmx 20160106 (TeX Live SVN r39753).
+ \txiuseunicodedestnamefalse
+ \fi
+ %
+ % Color support
+ %
+ \def\rgbDarkRed{0.50 0.09 0.12}
+ \def\rgbBlack{0 0 0}
+ %
+ \def\pdfsetcolor#1{\special{pdf:scolor [#1]}}
+ %
+ % Set color, and create a mark which defines \thiscolor accordingly,
+ % so that \makeheadline knows which color to restore.
+ \def\setcolor#1{%
+ \xdef\currentcolordefs{\gdef\noexpand\thiscolor{#1}}%
+ \domark
+ \pdfsetcolor{#1}%
+ }
+ %
+ \def\maincolor{\rgbBlack}
+ \pdfsetcolor{\maincolor}
+ \edef\thiscolor{\maincolor}
+ \def\currentcolordefs{}
+ %
+ \def\makefootline{%
+ \baselineskip24pt
+ \line{\pdfsetcolor{\maincolor}\the\footline}%
+ }
+ %
+ \def\makeheadline{%
+ \vbox to 0pt{%
+ \vskip-22.5pt
+ \line{%
+ \vbox to8.5pt{}%
+ % Extract \thiscolor definition from the marks.
+ \getcolormarks
+ % Typeset the headline with \maincolor, then restore the color.
+ \pdfsetcolor{\maincolor}\the\headline\pdfsetcolor{\thiscolor}%
+ }%
+ \vss
+ }%
+ \nointerlineskip
+ }
+ %
+ % PDF outline support
+ %
+ % Emulate pdfTeX primitive
+ \def\pdfdest name#1 xyz{%
+ \special{pdf:dest (#1) [@thispage /XYZ @xpos @ypos null]}%
+ }
+ %
+ \def\setpdfdestname#1{{%
+ % We have to set dummies so commands such as @code, and characters
+ % such as \, aren't expanded when present in a section title.
+ \indexnofonts
+ \makevalueexpandable
+ \turnoffactive
+ \iftxiuseunicodedestname
+ % Pass through Unicode characters.
+ \else
+ % Use ASCII approximations in destination names.
+ \passthroughcharsfalse
+ \fi
+ \def\pdfdestname{#1}%
+ \txiescapepdf\pdfdestname
+ }}
+ %
+ \def\setpdfoutlinetext#1{{%
+ \turnoffactive
+ % Always use Unicode characters in title texts.
+ \def\pdfoutlinetext{#1}%
+ % For XeTeX, xdvipdfmx converts to UTF-16.
+ % So we do not convert.
+ \txiescapepdf\pdfoutlinetext
+ }}
+ %
+ \def\pdfmkdest#1{%
+ \setpdfdestname{#1}%
+ \safewhatsit{\pdfdest name{\pdfdestname} xyz}%
+ }
+ %
+ % by default, use black for everything.
+ \def\urlcolor{\rgbBlack}
+ \def\linkcolor{\rgbBlack}
+ \def\endlink{\setcolor{\maincolor}\pdfendlink}
+ %
+ \def\dopdfoutline#1#2#3#4{%
+ \setpdfoutlinetext{#1}
+ \setpdfdestname{#3}
+ \ifx\pdfdestname\empty
+ \def\pdfdestname{#4}%
+ \fi
+ %
+ \special{pdf:out [-] #2 << /Title (\pdfoutlinetext) /A
+ << /S /GoTo /D (\pdfdestname) >> >> }%
+ }
+ %
+ \def\pdfmakeoutlines{%
+ \begingroup
+ %
+ % For XeTeX, counts of subentries are not necessary.
+ % Therefore, we read toc only once.
+ %
+ % We use node names as destinations.
+ \def\partentry##1##2##3##4{}% ignore parts in the outlines
+ \def\numchapentry##1##2##3##4{%
+ \dopdfoutline{##1}{1}{##3}{##4}}%
+ \def\numsecentry##1##2##3##4{%
+ \dopdfoutline{##1}{2}{##3}{##4}}%
+ \def\numsubsecentry##1##2##3##4{%
+ \dopdfoutline{##1}{3}{##3}{##4}}%
+ \def\numsubsubsecentry##1##2##3##4{%
+ \dopdfoutline{##1}{4}{##3}{##4}}%
+ %
+ \let\appentry\numchapentry%
+ \let\appsecentry\numsecentry%
+ \let\appsubsecentry\numsubsecentry%
+ \let\appsubsubsecentry\numsubsubsecentry%
+ \let\unnchapentry\numchapentry%
+ \let\unnsecentry\numsecentry%
+ \let\unnsubsecentry\numsubsecentry%
+ \let\unnsubsubsecentry\numsubsubsecentry%
+ %
+ % For XeTeX, xdvipdfmx converts strings to UTF-16.
+ % Therefore, the encoding and the language may not be considered.
+ %
+ \indexnofonts
+ \setupdatafile
+ % We can have normal brace characters in the PDF outlines, unlike
+ % Texinfo index files. So set that up.
+ \def\{{\lbracecharliteral}%
+ \def\}{\rbracecharliteral}%
+ \catcode`\\=\active \otherbackslash
+ \input \tocreadfilename
+ \endgroup
+ }
+ {\catcode`[=1 \catcode`]=2
+ \catcode`{=\other \catcode`}=\other
+ \gdef\lbracecharliteral[{]%
+ \gdef\rbracecharliteral[}]%
+ ]
+
+ \special{pdf:docview << /PageMode /UseOutlines >> }
+ % ``\special{pdf:tounicode ...}'' is not necessary
+ % because xdvipdfmx converts strings from UTF-8 to UTF-16 without it.
+ % However, due to a UTF-16 conversion issue of xdvipdfmx 20150315,
+ % ``\special{pdf:dest ...}'' cannot handle non-ASCII strings.
+ % It is fixed by xdvipdfmx 20160106 (TeX Live SVN r39753).
+%
+ \def\skipspaces#1{\def\PP{#1}\def\D{|}%
+ \ifx\PP\D\let\nextsp\relax
+ \else\let\nextsp\skipspaces
+ \addtokens{\filename}{\PP}%
+ \advance\filenamelength by 1
+ \fi
+ \nextsp}
+ \def\getfilename#1{%
+ \filenamelength=0
+ % If we don't expand the argument now, \skipspaces will get
+ % snagged on things like "@value{foo}".
+ \edef\temp{#1}%
+ \expandafter\skipspaces\temp|\relax
+ }
+ % make a live url in pdf output.
+ \def\pdfurl#1{%
+ \begingroup
+ % it seems we really need yet another set of dummies; have not
+ % tried to figure out what each command should do in the context
+ % of @url. for now, just make @/ a no-op, that's the only one
+ % people have actually reported a problem with.
+ %
+ \normalturnoffactive
+ \def\@{@}%
+ \let\/=\empty
+ \makevalueexpandable
+ % do we want to go so far as to use \indexnofonts instead of just
+ % special-casing \var here?
+ \def\var##1{##1}%
+ %
+ \leavevmode\setcolor{\urlcolor}%
+ \special{pdf:bann << /Border [0 0 0]
+ /Subtype /Link /A << /S /URI /URI (#1) >> >>}%
+ \endgroup}
+ \def\endlink{\setcolor{\maincolor}\special{pdf:eann}}
+ \def\pdfgettoks#1.{\setbox\boxA=\hbox{\toksA={#1.}\toksB={}\maketoks}}
+ \def\addtokens#1#2{\edef\addtoks{\noexpand#1={\the#1#2}}\addtoks}
+ \def\adn#1{\addtokens{\toksC}{#1}\global\countA=1\let\next=\maketoks}
+ \def\poptoks#1#2|ENDTOKS|{\let\first=#1\toksD={#1}\toksA={#2}}
+ \def\maketoks{%
+ \expandafter\poptoks\the\toksA|ENDTOKS|\relax
+ \ifx\first0\adn0
+ \else\ifx\first1\adn1 \else\ifx\first2\adn2 \else\ifx\first3\adn3
+ \else\ifx\first4\adn4 \else\ifx\first5\adn5 \else\ifx\first6\adn6
+ \else\ifx\first7\adn7 \else\ifx\first8\adn8 \else\ifx\first9\adn9
+ \else
+ \ifnum0=\countA\else\makelink\fi
+ \ifx\first.\let\next=\done\else
+ \let\next=\maketoks
+ \addtokens{\toksB}{\the\toksD}
+ \ifx\first,\addtokens{\toksB}{\space}\fi
+ \fi
+ \fi\fi\fi\fi\fi\fi\fi\fi\fi\fi
+ \next}
+ \def\makelink{\addtokens{\toksB}%
+ {\noexpand\pdflink{\the\toksC}}\toksC={}\global\countA=0}
+ \def\pdflink#1{%
+ \special{pdf:bann << /Border [0 0 0]
+ /Type /Annot /Subtype /Link /A << /S /GoTo /D (#1) >> >>}%
+ \setcolor{\linkcolor}#1\endlink}
+ \def\done{\edef\st{\global\noexpand\toksA={\the\toksB}}\st}
+%
+ %
+ % @image support
+ %
+ % #1 is image name, #2 width (might be empty/whitespace), #3 height (ditto).
+ \def\doxeteximage#1#2#3{%
+ \def\xeteximagewidth{#2}\setbox0 = \hbox{\ignorespaces #2}%
+ \def\xeteximageheight{#3}\setbox2 = \hbox{\ignorespaces #3}%
+ %
+ % XeTeX (and the PDF format) supports .pdf, .png, .jpg (among
+ % others). Let's try in that order, PDF first since if
+ % someone has a scalable image, presumably better to use that than a
+ % bitmap.
+ \let\xeteximgext=\empty
+ \begingroup
+ \openin 1 #1.pdf \ifeof 1
+ \openin 1 #1.PDF \ifeof 1
+ \openin 1 #1.png \ifeof 1
+ \openin 1 #1.jpg \ifeof 1
+ \openin 1 #1.jpeg \ifeof 1
+ \openin 1 #1.JPG \ifeof 1
+ \errmessage{Could not find image file #1 for XeTeX}%
+ \else \gdef\xeteximgext{JPG}%
+ \fi
+ \else \gdef\xeteximgext{jpeg}%
+ \fi
+ \else \gdef\xeteximgext{jpg}%
+ \fi
+ \else \gdef\xeteximgext{png}%
+ \fi
+ \else \gdef\xeteximgext{PDF}%
+ \fi
+ \else \gdef\xeteximgext{pdf}%
+ \fi
+ \closein 1
+ \endgroup
+ %
+ \def\xetexpdfext{pdf}%
+ \ifx\xeteximgext\xetexpdfext
+ \XeTeXpdffile "#1".\xeteximgext ""
+ \else
+ \def\xetexpdfext{PDF}%
+ \ifx\xeteximgext\xetexpdfext
+ \XeTeXpdffile "#1".\xeteximgext ""
+ \else
+ \XeTeXpicfile "#1".\xeteximgext ""
+ \fi
+ \fi
+ \ifdim \wd0 >0pt width \xeteximagewidth \fi
+ \ifdim \wd2 >0pt height \xeteximageheight \fi \relax
+ }
+\fi
+
+
+%
+\message{fonts,}
+
+% Set the baselineskip to #1, and the lineskip and strut size
+% correspondingly. There is no deep meaning behind these magic numbers
+% used as factors; they just match (closely enough) what Knuth defined.
+%
+\def\lineskipfactor{.08333}
+\def\strutheightpercent{.70833}
+\def\strutdepthpercent {.29167}
+%
+% can get a sort of poor man's double spacing by redefining this.
+\def\baselinefactor{1}
+%
+\newdimen\textleading
+\def\setleading#1{%
+ \dimen0 = #1\relax
+ \normalbaselineskip = \baselinefactor\dimen0
+ \normallineskip = \lineskipfactor\normalbaselineskip
+ \normalbaselines
+ \setbox\strutbox =\hbox{%
+ \vrule width0pt height\strutheightpercent\baselineskip
+ depth \strutdepthpercent \baselineskip
+ }%
+}
+
+% PDF CMaps. See also LaTeX's t1.cmap.
+%
+% do nothing with this by default.
+\expandafter\let\csname cmapOT1\endcsname\gobble
+\expandafter\let\csname cmapOT1IT\endcsname\gobble
+\expandafter\let\csname cmapOT1TT\endcsname\gobble
+
+% if we are producing pdf, and we have \pdffontattr, then define cmaps.
+% (\pdffontattr was introduced many years ago, but people still run
+% older pdftex's; it's easy to conditionalize, so we do.)
+\ifpdf \ifx\pdffontattr\thisisundefined \else
+ \begingroup
+ \catcode`\^^M=\active \def^^M{^^J}% Output line endings as the ^^J char.
+ \catcode`\%=12 \immediate\pdfobj stream {%!PS-Adobe-3.0 Resource-CMap
+%%DocumentNeededResources: ProcSet (CIDInit)
+%%IncludeResource: ProcSet (CIDInit)
+%%BeginResource: CMap (TeX-OT1-0)
+%%Title: (TeX-OT1-0 TeX OT1 0)
+%%Version: 1.000
+%%EndComments
+/CIDInit /ProcSet findresource begin
+12 dict begin
+begincmap
+/CIDSystemInfo
+<< /Registry (TeX)
+/Ordering (OT1)
+/Supplement 0
+>> def
+/CMapName /TeX-OT1-0 def
+/CMapType 2 def
+1 begincodespacerange
+<00> <7F>
+endcodespacerange
+8 beginbfrange
+<00> <01> <0393>
+<09> <0A> <03A8>
+<23> <26> <0023>
+<28> <3B> <0028>
+<3F> <5B> <003F>
+<5D> <5E> <005D>
+<61> <7A> <0061>
+<7B> <7C> <2013>
+endbfrange
+40 beginbfchar
+<02> <0398>
+<03> <039B>
+<04> <039E>
+<05> <03A0>
+<06> <03A3>
+<07> <03D2>
+<08> <03A6>
+<0B> <00660066>
+<0C> <00660069>
+<0D> <0066006C>
+<0E> <006600660069>
+<0F> <00660066006C>
+<10> <0131>
+<11> <0237>
+<12> <0060>
+<13> <00B4>
+<14> <02C7>
+<15> <02D8>
+<16> <00AF>
+<17> <02DA>
+<18> <00B8>
+<19> <00DF>
+<1A> <00E6>
+<1B> <0153>
+<1C> <00F8>
+<1D> <00C6>
+<1E> <0152>
+<1F> <00D8>
+<21> <0021>
+<22> <201D>
+<27> <2019>
+<3C> <00A1>
+<3D> <003D>
+<3E> <00BF>
+<5C> <201C>
+<5F> <02D9>
+<60> <2018>
+<7D> <02DD>
+<7E> <007E>
+<7F> <00A8>
+endbfchar
+endcmap
+CMapName currentdict /CMap defineresource pop
+end
+end
+%%EndResource
+%%EOF
+ }\endgroup
+ \expandafter\edef\csname cmapOT1\endcsname#1{%
+ \pdffontattr#1{/ToUnicode \the\pdflastobj\space 0 R}%
+ }%
+%
+% \cmapOT1IT
+ \begingroup
+ \catcode`\^^M=\active \def^^M{^^J}% Output line endings as the ^^J char.
+ \catcode`\%=12 \immediate\pdfobj stream {%!PS-Adobe-3.0 Resource-CMap
+%%DocumentNeededResources: ProcSet (CIDInit)
+%%IncludeResource: ProcSet (CIDInit)
+%%BeginResource: CMap (TeX-OT1IT-0)
+%%Title: (TeX-OT1IT-0 TeX OT1IT 0)
+%%Version: 1.000
+%%EndComments
+/CIDInit /ProcSet findresource begin
+12 dict begin
+begincmap
+/CIDSystemInfo
+<< /Registry (TeX)
+/Ordering (OT1IT)
+/Supplement 0
+>> def
+/CMapName /TeX-OT1IT-0 def
+/CMapType 2 def
+1 begincodespacerange
+<00> <7F>
+endcodespacerange
+8 beginbfrange
+<00> <01> <0393>
+<09> <0A> <03A8>
+<25> <26> <0025>
+<28> <3B> <0028>
+<3F> <5B> <003F>
+<5D> <5E> <005D>
+<61> <7A> <0061>
+<7B> <7C> <2013>
+endbfrange
+42 beginbfchar
+<02> <0398>
+<03> <039B>
+<04> <039E>
+<05> <03A0>
+<06> <03A3>
+<07> <03D2>
+<08> <03A6>
+<0B> <00660066>
+<0C> <00660069>
+<0D> <0066006C>
+<0E> <006600660069>
+<0F> <00660066006C>
+<10> <0131>
+<11> <0237>
+<12> <0060>
+<13> <00B4>
+<14> <02C7>
+<15> <02D8>
+<16> <00AF>
+<17> <02DA>
+<18> <00B8>
+<19> <00DF>
+<1A> <00E6>
+<1B> <0153>
+<1C> <00F8>
+<1D> <00C6>
+<1E> <0152>
+<1F> <00D8>
+<21> <0021>
+<22> <201D>
+<23> <0023>
+<24> <00A3>
+<27> <2019>
+<3C> <00A1>
+<3D> <003D>
+<3E> <00BF>
+<5C> <201C>
+<5F> <02D9>
+<60> <2018>
+<7D> <02DD>
+<7E> <007E>
+<7F> <00A8>
+endbfchar
+endcmap
+CMapName currentdict /CMap defineresource pop
+end
+end
+%%EndResource
+%%EOF
+ }\endgroup
+ \expandafter\edef\csname cmapOT1IT\endcsname#1{%
+ \pdffontattr#1{/ToUnicode \the\pdflastobj\space 0 R}%
+ }%
+%
+% \cmapOT1TT
+ \begingroup
+ \catcode`\^^M=\active \def^^M{^^J}% Output line endings as the ^^J char.
+ \catcode`\%=12 \immediate\pdfobj stream {%!PS-Adobe-3.0 Resource-CMap
+%%DocumentNeededResources: ProcSet (CIDInit)
+%%IncludeResource: ProcSet (CIDInit)
+%%BeginResource: CMap (TeX-OT1TT-0)
+%%Title: (TeX-OT1TT-0 TeX OT1TT 0)
+%%Version: 1.000
+%%EndComments
+/CIDInit /ProcSet findresource begin
+12 dict begin
+begincmap
+/CIDSystemInfo
+<< /Registry (TeX)
+/Ordering (OT1TT)
+/Supplement 0
+>> def
+/CMapName /TeX-OT1TT-0 def
+/CMapType 2 def
+1 begincodespacerange
+<00> <7F>
+endcodespacerange
+5 beginbfrange
+<00> <01> <0393>
+<09> <0A> <03A8>
+<21> <26> <0021>
+<28> <5F> <0028>
+<61> <7E> <0061>
+endbfrange
+32 beginbfchar
+<02> <0398>
+<03> <039B>
+<04> <039E>
+<05> <03A0>
+<06> <03A3>
+<07> <03D2>
+<08> <03A6>
+<0B> <2191>
+<0C> <2193>
+<0D> <0027>
+<0E> <00A1>
+<0F> <00BF>
+<10> <0131>
+<11> <0237>
+<12> <0060>
+<13> <00B4>
+<14> <02C7>
+<15> <02D8>
+<16> <00AF>
+<17> <02DA>
+<18> <00B8>
+<19> <00DF>
+<1A> <00E6>
+<1B> <0153>
+<1C> <00F8>
+<1D> <00C6>
+<1E> <0152>
+<1F> <00D8>
+<20> <2423>
+<27> <2019>
+<60> <2018>
+<7F> <00A8>
+endbfchar
+endcmap
+CMapName currentdict /CMap defineresource pop
+end
+end
+%%EndResource
+%%EOF
+ }\endgroup
+ \expandafter\edef\csname cmapOT1TT\endcsname#1{%
+ \pdffontattr#1{/ToUnicode \the\pdflastobj\space 0 R}%
+ }%
+\fi\fi
+
+
+% Set the font macro #1 to the font named \fontprefix#2.
+% #3 is the font's design size, #4 is a scale factor, #5 is the CMap
+% encoding (only OT1, OT1IT and OT1TT are allowed, or empty to omit).
+% Example:
+% #1 = \textrm
+% #2 = \rmshape
+% #3 = 10
+% #4 = \mainmagstep
+% #5 = OT1
+%
+\def\setfont#1#2#3#4#5{%
+ \font#1=\fontprefix#2#3 scaled #4
+ \csname cmap#5\endcsname#1%
+}
+% This is what gets called when #5 of \setfont is empty.
+\let\cmap\gobble
+%
+% (end of cmaps)
+
+% Use cm as the default font prefix.
+% To specify the font prefix, you must define \fontprefix
+% before you read in texinfo.tex.
+\ifx\fontprefix\thisisundefined
+\def\fontprefix{cm}
+\fi
+% Support font families that don't use the same naming scheme as CM.
+\def\rmshape{r}
+\def\rmbshape{bx} % where the normal face is bold
+\def\bfshape{b}
+\def\bxshape{bx}
+\def\ttshape{tt}
+\def\ttbshape{tt}
+\def\ttslshape{sltt}
+\def\itshape{ti}
+\def\itbshape{bxti}
+\def\slshape{sl}
+\def\slbshape{bxsl}
+\def\sfshape{ss}
+\def\sfbshape{ss}
+\def\scshape{csc}
+\def\scbshape{csc}
+
+% Definitions for a main text size of 11pt. (The default in Texinfo.)
+%
+\def\definetextfontsizexi{%
+% Text fonts (11.2pt, magstep1).
+\def\textnominalsize{11pt}
+\edef\mainmagstep{\magstephalf}
+\setfont\textrm\rmshape{10}{\mainmagstep}{OT1}
+\setfont\texttt\ttshape{10}{\mainmagstep}{OT1TT}
+\setfont\textbf\bfshape{10}{\mainmagstep}{OT1}
+\setfont\textit\itshape{10}{\mainmagstep}{OT1IT}
+\setfont\textsl\slshape{10}{\mainmagstep}{OT1}
+\setfont\textsf\sfshape{10}{\mainmagstep}{OT1}
+\setfont\textsc\scshape{10}{\mainmagstep}{OT1}
+\setfont\textttsl\ttslshape{10}{\mainmagstep}{OT1TT}
+\font\texti=cmmi10 scaled \mainmagstep
+\font\textsy=cmsy10 scaled \mainmagstep
+\def\textecsize{1095}
+
+% A few fonts for @defun names and args.
+\setfont\defbf\bfshape{10}{\magstep1}{OT1}
+\setfont\deftt\ttshape{10}{\magstep1}{OT1TT}
+\setfont\defsl\slshape{10}{\magstep1}{OT1}
+\setfont\defttsl\ttslshape{10}{\magstep1}{OT1TT}
+\def\df{\let\ttfont=\deftt \let\bffont = \defbf
+\let\ttslfont=\defttsl \let\slfont=\defsl \bf}
+
+% Fonts for indices, footnotes, small examples (9pt).
+\def\smallnominalsize{9pt}
+\setfont\smallrm\rmshape{9}{1000}{OT1}
+\setfont\smalltt\ttshape{9}{1000}{OT1TT}
+\setfont\smallbf\bfshape{10}{900}{OT1}
+\setfont\smallit\itshape{9}{1000}{OT1IT}
+\setfont\smallsl\slshape{9}{1000}{OT1}
+\setfont\smallsf\sfshape{9}{1000}{OT1}
+\setfont\smallsc\scshape{10}{900}{OT1}
+\setfont\smallttsl\ttslshape{10}{900}{OT1TT}
+\font\smalli=cmmi9
+\font\smallsy=cmsy9
+\def\smallecsize{0900}
+
+% Fonts for small examples (8pt).
+\def\smallernominalsize{8pt}
+\setfont\smallerrm\rmshape{8}{1000}{OT1}
+\setfont\smallertt\ttshape{8}{1000}{OT1TT}
+\setfont\smallerbf\bfshape{10}{800}{OT1}
+\setfont\smallerit\itshape{8}{1000}{OT1IT}
+\setfont\smallersl\slshape{8}{1000}{OT1}
+\setfont\smallersf\sfshape{8}{1000}{OT1}
+\setfont\smallersc\scshape{10}{800}{OT1}
+\setfont\smallerttsl\ttslshape{10}{800}{OT1TT}
+\font\smalleri=cmmi8
+\font\smallersy=cmsy8
+\def\smallerecsize{0800}
+
+% Fonts for math mode superscripts (7pt).
+\def\sevennominalsize{7pt}
+\setfont\sevenrm\rmshape{7}{1000}{OT1}
+\setfont\seventt\ttshape{10}{700}{OT1TT}
+\setfont\sevenbf\bfshape{10}{700}{OT1}
+\setfont\sevenit\itshape{7}{1000}{OT1IT}
+\setfont\sevensl\slshape{10}{700}{OT1}
+\setfont\sevensf\sfshape{10}{700}{OT1}
+\setfont\sevensc\scshape{10}{700}{OT1}
+\setfont\seventtsl\ttslshape{10}{700}{OT1TT}
+\font\seveni=cmmi7
+\font\sevensy=cmsy7
+\def\sevenecsize{0700}
+
+% Fonts for title page (20.4pt):
+\def\titlenominalsize{20pt}
+\setfont\titlerm\rmbshape{12}{\magstep3}{OT1}
+\setfont\titleit\itbshape{10}{\magstep4}{OT1IT}
+\setfont\titlesl\slbshape{10}{\magstep4}{OT1}
+\setfont\titlett\ttbshape{12}{\magstep3}{OT1TT}
+\setfont\titlettsl\ttslshape{10}{\magstep4}{OT1TT}
+\setfont\titlesf\sfbshape{17}{\magstep1}{OT1}
+\let\titlebf=\titlerm
+\setfont\titlesc\scbshape{10}{\magstep4}{OT1}
+\font\titlei=cmmi12 scaled \magstep3
+\font\titlesy=cmsy10 scaled \magstep4
+\def\titleecsize{2074}
+
+% Chapter (and unnumbered) fonts (17.28pt).
+\def\chapnominalsize{17pt}
+\setfont\chaprm\rmbshape{12}{\magstep2}{OT1}
+\setfont\chapit\itbshape{10}{\magstep3}{OT1IT}
+\setfont\chapsl\slbshape{10}{\magstep3}{OT1}
+\setfont\chaptt\ttbshape{12}{\magstep2}{OT1TT}
+\setfont\chapttsl\ttslshape{10}{\magstep3}{OT1TT}
+\setfont\chapsf\sfbshape{17}{1000}{OT1}
+\let\chapbf=\chaprm
+\setfont\chapsc\scbshape{10}{\magstep3}{OT1}
+\font\chapi=cmmi12 scaled \magstep2
+\font\chapsy=cmsy10 scaled \magstep3
+\def\chapecsize{1728}
+
+% Section fonts (14.4pt).
+\def\secnominalsize{14pt}
+\setfont\secrm\rmbshape{12}{\magstep1}{OT1}
+\setfont\secrmnotbold\rmshape{12}{\magstep1}{OT1}
+\setfont\secit\itbshape{10}{\magstep2}{OT1IT}
+\setfont\secsl\slbshape{10}{\magstep2}{OT1}
+\setfont\sectt\ttbshape{12}{\magstep1}{OT1TT}
+\setfont\secttsl\ttslshape{10}{\magstep2}{OT1TT}
+\setfont\secsf\sfbshape{12}{\magstep1}{OT1}
+\let\secbf\secrm
+\setfont\secsc\scbshape{10}{\magstep2}{OT1}
+\font\seci=cmmi12 scaled \magstep1
+\font\secsy=cmsy10 scaled \magstep2
+\def\sececsize{1440}
+
+% Subsection fonts (13.15pt).
+\def\ssecnominalsize{13pt}
+\setfont\ssecrm\rmbshape{12}{\magstephalf}{OT1}
+\setfont\ssecit\itbshape{10}{1315}{OT1IT}
+\setfont\ssecsl\slbshape{10}{1315}{OT1}
+\setfont\ssectt\ttbshape{12}{\magstephalf}{OT1TT}
+\setfont\ssecttsl\ttslshape{10}{1315}{OT1TT}
+\setfont\ssecsf\sfbshape{12}{\magstephalf}{OT1}
+\let\ssecbf\ssecrm
+\setfont\ssecsc\scbshape{10}{1315}{OT1}
+\font\sseci=cmmi12 scaled \magstephalf
+\font\ssecsy=cmsy10 scaled 1315
+\def\ssececsize{1200}
+
+% Reduced fonts for @acronym in text (10pt).
+\def\reducednominalsize{10pt}
+\setfont\reducedrm\rmshape{10}{1000}{OT1}
+\setfont\reducedtt\ttshape{10}{1000}{OT1TT}
+\setfont\reducedbf\bfshape{10}{1000}{OT1}
+\setfont\reducedit\itshape{10}{1000}{OT1IT}
+\setfont\reducedsl\slshape{10}{1000}{OT1}
+\setfont\reducedsf\sfshape{10}{1000}{OT1}
+\setfont\reducedsc\scshape{10}{1000}{OT1}
+\setfont\reducedttsl\ttslshape{10}{1000}{OT1TT}
+\font\reducedi=cmmi10
+\font\reducedsy=cmsy10
+\def\reducedecsize{1000}
+
+\textleading = 13.2pt % line spacing for 11pt CM
+\textfonts % reset the current fonts
+\rm
+} % end of 11pt text font size definitions, \definetextfontsizexi
+
+
+% Definitions to make the main text be 10pt Computer Modern, with
+% section, chapter, etc., sizes following suit. This is for the GNU
+% Press printing of the Emacs 22 manual. Maybe other manuals in the
+% future. Used with @smallbook, which sets the leading to 12pt.
+%
+\def\definetextfontsizex{%
+% Text fonts (10pt).
+\def\textnominalsize{10pt}
+\edef\mainmagstep{1000}
+\setfont\textrm\rmshape{10}{\mainmagstep}{OT1}
+\setfont\texttt\ttshape{10}{\mainmagstep}{OT1TT}
+\setfont\textbf\bfshape{10}{\mainmagstep}{OT1}
+\setfont\textit\itshape{10}{\mainmagstep}{OT1IT}
+\setfont\textsl\slshape{10}{\mainmagstep}{OT1}
+\setfont\textsf\sfshape{10}{\mainmagstep}{OT1}
+\setfont\textsc\scshape{10}{\mainmagstep}{OT1}
+\setfont\textttsl\ttslshape{10}{\mainmagstep}{OT1TT}
+\font\texti=cmmi10 scaled \mainmagstep
+\font\textsy=cmsy10 scaled \mainmagstep
+\def\textecsize{1000}
+
+% A few fonts for @defun names and args.
+\setfont\defbf\bfshape{10}{\magstephalf}{OT1}
+\setfont\deftt\ttshape{10}{\magstephalf}{OT1TT}
+\setfont\defsl\slshape{10}{\magstephalf}{OT1}
+\setfont\defttsl\ttslshape{10}{\magstephalf}{OT1TT}
+\def\df{\let\ttfont=\deftt \let\bffont = \defbf
+\let\slfont=\defsl \let\ttslfont=\defttsl \bf}
+
+% Fonts for indices, footnotes, small examples (9pt).
+\def\smallnominalsize{9pt}
+\setfont\smallrm\rmshape{9}{1000}{OT1}
+\setfont\smalltt\ttshape{9}{1000}{OT1TT}
+\setfont\smallbf\bfshape{10}{900}{OT1}
+\setfont\smallit\itshape{9}{1000}{OT1IT}
+\setfont\smallsl\slshape{9}{1000}{OT1}
+\setfont\smallsf\sfshape{9}{1000}{OT1}
+\setfont\smallsc\scshape{10}{900}{OT1}
+\setfont\smallttsl\ttslshape{10}{900}{OT1TT}
+\font\smalli=cmmi9
+\font\smallsy=cmsy9
+\def\smallecsize{0900}
+
+% Fonts for small examples (8pt).
+\def\smallernominalsize{8pt}
+\setfont\smallerrm\rmshape{8}{1000}{OT1}
+\setfont\smallertt\ttshape{8}{1000}{OT1TT}
+\setfont\smallerbf\bfshape{10}{800}{OT1}
+\setfont\smallerit\itshape{8}{1000}{OT1IT}
+\setfont\smallersl\slshape{8}{1000}{OT1}
+\setfont\smallersf\sfshape{8}{1000}{OT1}
+\setfont\smallersc\scshape{10}{800}{OT1}
+\setfont\smallerttsl\ttslshape{10}{800}{OT1TT}
+\font\smalleri=cmmi8
+\font\smallersy=cmsy8
+\def\smallerecsize{0800}
+
+% Fonts for math mode superscripts (7pt).
+\def\sevennominalsize{7pt}
+\setfont\sevenrm\rmshape{7}{1000}{OT1}
+\setfont\seventt\ttshape{10}{700}{OT1TT}
+\setfont\sevenbf\bfshape{10}{700}{OT1}
+\setfont\sevenit\itshape{7}{1000}{OT1IT}
+\setfont\sevensl\slshape{10}{700}{OT1}
+\setfont\sevensf\sfshape{10}{700}{OT1}
+\setfont\sevensc\scshape{10}{700}{OT1}
+\setfont\seventtsl\ttslshape{10}{700}{OT1TT}
+\font\seveni=cmmi7
+\font\sevensy=cmsy7
+\def\sevenecsize{0700}
+
+% Fonts for title page (20.4pt):
+\def\titlenominalsize{20pt}
+\setfont\titlerm\rmbshape{12}{\magstep3}{OT1}
+\setfont\titleit\itbshape{10}{\magstep4}{OT1IT}
+\setfont\titlesl\slbshape{10}{\magstep4}{OT1}
+\setfont\titlett\ttbshape{12}{\magstep3}{OT1TT}
+\setfont\titlettsl\ttslshape{10}{\magstep4}{OT1TT}
+\setfont\titlesf\sfbshape{17}{\magstep1}{OT1}
+\let\titlebf=\titlerm
+\setfont\titlesc\scbshape{10}{\magstep4}{OT1}
+\font\titlei=cmmi12 scaled \magstep3
+\font\titlesy=cmsy10 scaled \magstep4
+\def\titleecsize{2074}
+
+% Chapter fonts (14.4pt).
+\def\chapnominalsize{14pt}
+\setfont\chaprm\rmbshape{12}{\magstep1}{OT1}
+\setfont\chapit\itbshape{10}{\magstep2}{OT1IT}
+\setfont\chapsl\slbshape{10}{\magstep2}{OT1}
+\setfont\chaptt\ttbshape{12}{\magstep1}{OT1TT}
+\setfont\chapttsl\ttslshape{10}{\magstep2}{OT1TT}
+\setfont\chapsf\sfbshape{12}{\magstep1}{OT1}
+\let\chapbf\chaprm
+\setfont\chapsc\scbshape{10}{\magstep2}{OT1}
+\font\chapi=cmmi12 scaled \magstep1
+\font\chapsy=cmsy10 scaled \magstep2
+\def\chapecsize{1440}
+
+% Section fonts (12pt).
+\def\secnominalsize{12pt}
+\setfont\secrm\rmbshape{12}{1000}{OT1}
+\setfont\secit\itbshape{10}{\magstep1}{OT1IT}
+\setfont\secsl\slbshape{10}{\magstep1}{OT1}
+\setfont\sectt\ttbshape{12}{1000}{OT1TT}
+\setfont\secttsl\ttslshape{10}{\magstep1}{OT1TT}
+\setfont\secsf\sfbshape{12}{1000}{OT1}
+\let\secbf\secrm
+\setfont\secsc\scbshape{10}{\magstep1}{OT1}
+\font\seci=cmmi12
+\font\secsy=cmsy10 scaled \magstep1
+\def\sececsize{1200}
+
+% Subsection fonts (10pt).
+\def\ssecnominalsize{10pt}
+\setfont\ssecrm\rmbshape{10}{1000}{OT1}
+\setfont\ssecit\itbshape{10}{1000}{OT1IT}
+\setfont\ssecsl\slbshape{10}{1000}{OT1}
+\setfont\ssectt\ttbshape{10}{1000}{OT1TT}
+\setfont\ssecttsl\ttslshape{10}{1000}{OT1TT}
+\setfont\ssecsf\sfbshape{10}{1000}{OT1}
+\let\ssecbf\ssecrm
+\setfont\ssecsc\scbshape{10}{1000}{OT1}
+\font\sseci=cmmi10
+\font\ssecsy=cmsy10
+\def\ssececsize{1000}
+
+% Reduced fonts for @acronym in text (9pt).
+\def\reducednominalsize{9pt}
+\setfont\reducedrm\rmshape{9}{1000}{OT1}
+\setfont\reducedtt\ttshape{9}{1000}{OT1TT}
+\setfont\reducedbf\bfshape{10}{900}{OT1}
+\setfont\reducedit\itshape{9}{1000}{OT1IT}
+\setfont\reducedsl\slshape{9}{1000}{OT1}
+\setfont\reducedsf\sfshape{9}{1000}{OT1}
+\setfont\reducedsc\scshape{10}{900}{OT1}
+\setfont\reducedttsl\ttslshape{10}{900}{OT1TT}
+\font\reducedi=cmmi9
+\font\reducedsy=cmsy9
+\def\reducedecsize{0900}
+
+\divide\parskip by 2 % reduce space between paragraphs
+\textleading = 12pt % line spacing for 10pt CM
+\textfonts % reset the current fonts
+\rm
+} % end of 10pt text font size definitions, \definetextfontsizex
+
+% Fonts for short table of contents.
+\setfont\shortcontrm\rmshape{12}{1000}{OT1}
+\setfont\shortcontbf\bfshape{10}{\magstep1}{OT1} % no cmb12
+\setfont\shortcontsl\slshape{12}{1000}{OT1}
+\setfont\shortconttt\ttshape{12}{1000}{OT1TT}
+
+
+% We provide the user-level command
+% @fonttextsize 10
+% (or 11) to redefine the text font size. pt is assumed.
+%
+\def\xiword{11}
+\def\xword{10}
+\def\xwordpt{10pt}
+%
+\parseargdef\fonttextsize{%
+ \def\textsizearg{#1}%
+ %\wlog{doing @fonttextsize \textsizearg}%
+ %
+ % Set \globaldefs so that documents can use this inside @tex, since
+ % makeinfo 4.8 does not support it, but we need it nonetheless.
+ %
+ \begingroup \globaldefs=1
+ \ifx\textsizearg\xword \definetextfontsizex
+ \else \ifx\textsizearg\xiword \definetextfontsizexi
+ \else
+ \errhelp=\EMsimple
+ \errmessage{@fonttextsize only supports `10' or `11', not `\textsizearg'}
+ \fi\fi
+ \endgroup
+}
+
+%
+% Change the current font style to #1, remembering it in \curfontstyle.
+% For now, we do not accumulate font styles: @b{@i{foo}} prints foo in
+% italics, not bold italics.
+%
+\def\setfontstyle#1{%
+ \def\curfontstyle{#1}% not as a control sequence, because we are \edef'd.
+ \csname #1font\endcsname % change the current font
+}
+
+\def\rm{\fam=0 \setfontstyle{rm}}
+\def\it{\fam=\itfam \setfontstyle{it}}
+\def\sl{\fam=\slfam \setfontstyle{sl}}
+\def\bf{\fam=\bffam \setfontstyle{bf}}\def\bfstylename{bf}
+\def\tt{\fam=\ttfam \setfontstyle{tt}}
+
+% Texinfo sort of supports the sans serif font style, which plain TeX does not.
+% So we set up a \sf.
+\newfam\sffam
+\def\sf{\fam=\sffam \setfontstyle{sf}}
+
+% We don't need math for this font style.
+\def\ttsl{\setfontstyle{ttsl}}
+
+
+% In order for the font changes to affect most math symbols and letters,
+% we have to define the \textfont of the standard families.
+% We don't bother to reset \scriptscriptfont; awaiting user need.
+%
+\def\resetmathfonts{%
+ \textfont0=\rmfont \textfont1=\ifont \textfont2=\syfont
+ \textfont\itfam=\itfont \textfont\slfam=\slfont \textfont\bffam=\bffont
+ \textfont\ttfam=\ttfont \textfont\sffam=\sffont
+ %
+ % Fonts for superscript. Note that the 7pt fonts are used regardless
+ % of the current font size.
+ \scriptfont0=\sevenrm \scriptfont1=\seveni \scriptfont2=\sevensy
+ \scriptfont\itfam=\sevenit \scriptfont\slfam=\sevensl
+ \scriptfont\bffam=\sevenbf \scriptfont\ttfam=\seventt
+ \scriptfont\sffam=\sevensf
+}
+
+%
+
+% The font-changing commands (all called \...fonts) redefine the meanings
+% of \STYLEfont, instead of just \STYLE. We do this because \STYLE needs
+% to also set the current \fam for math mode. Our \STYLE (e.g., \rm)
+% commands hardwire \STYLEfont to set the current font.
+%
+% The fonts used for \ifont are for "math italics" (\itfont is for italics
+% in regular text). \syfont is also used in math mode only.
+%
+% Each font-changing command also sets the names \lsize (one size lower)
+% and \lllsize (three sizes lower). These relative commands are used
+% in, e.g., the LaTeX logo and acronyms.
+%
+% This all needs generalizing, badly.
+%
+
+\def\assignfonts#1{%
+ \expandafter\let\expandafter\rmfont\csname #1rm\endcsname
+ \expandafter\let\expandafter\itfont\csname #1it\endcsname
+ \expandafter\let\expandafter\slfont\csname #1sl\endcsname
+ \expandafter\let\expandafter\bffont\csname #1bf\endcsname
+ \expandafter\let\expandafter\ttfont\csname #1tt\endcsname
+ \expandafter\let\expandafter\smallcaps\csname #1sc\endcsname
+ \expandafter\let\expandafter\sffont \csname #1sf\endcsname
+ \expandafter\let\expandafter\ifont \csname #1i\endcsname
+ \expandafter\let\expandafter\syfont \csname #1sy\endcsname
+ \expandafter\let\expandafter\ttslfont\csname #1ttsl\endcsname
+}
+
+\newif\ifrmisbold
+
+% Select smaller font size with the current style. Used to change font size
+% in, e.g., the LaTeX logo and acronyms. If we are using bold fonts for
+% normal roman text, also use bold fonts for roman text in the smaller size.
+\def\switchtolllsize{%
+ \expandafter\assignfonts\expandafter{\lllsize}%
+ \ifrmisbold
+ \let\rmfont\bffont
+ \fi
+ \csname\curfontstyle\endcsname
+}%
+
+\def\switchtolsize{%
+ \expandafter\assignfonts\expandafter{\lsize}%
+ \ifrmisbold
+ \let\rmfont\bffont
+ \fi
+ \csname\curfontstyle\endcsname
+}%
+
+\def\definefontsetatsize#1#2#3#4#5{%
+\expandafter\def\csname #1fonts\endcsname{%
+ \def\curfontsize{#1}%
+ \def\lsize{#2}\def\lllsize{#3}%
+ \csname rmisbold#5\endcsname
+ \assignfonts{#1}%
+ \resetmathfonts
+ \setleading{#4}%
+}}
+
+\definefontsetatsize{text} {reduced}{smaller}{\textleading}{false}
+\definefontsetatsize{title} {chap} {subsec} {27pt} {true}
+\definefontsetatsize{chap} {sec} {text} {19pt} {true}
+\definefontsetatsize{sec} {subsec} {reduced}{17pt} {true}
+\definefontsetatsize{ssec} {text} {small} {15pt} {true}
+\definefontsetatsize{reduced}{small} {smaller}{10.5pt}{false}
+\definefontsetatsize{small} {smaller}{smaller}{10.5pt}{false}
+\definefontsetatsize{smaller}{smaller}{smaller}{9.5pt} {false}
+
+\def\titlefont#1{{\titlefonts\rm #1}}
+\let\subsecfonts = \ssecfonts
+\let\subsubsecfonts = \ssecfonts
+
+% Define these just so they can be easily changed for other fonts.
+\def\angleleft{$\langle$}
+\def\angleright{$\rangle$}
+
+% Set the fonts to use with the @small... environments.
+\let\smallexamplefonts = \smallfonts
+
+% About \smallexamplefonts. If we use \smallfonts (9pt), @smallexample
+% can fit this many characters:
+% 8.5x11=86 smallbook=72 a4=90 a5=69
+% If we use \scriptfonts (8pt), then we can fit this many characters:
+% 8.5x11=90+ smallbook=80 a4=90+ a5=77
+% For me, subjectively, the few extra characters that fit aren't worth
+% the additional smallness of 8pt. So I'm making the default 9pt.
+%
+% By the way, for comparison, here's what fits with @example (10pt):
+% 8.5x11=71 smallbook=60 a4=75 a5=58
+% --karl, 24jan03.
+
+% Set up the default fonts, so we can use them for creating boxes.
+%
+\definetextfontsizexi
+
+
+\message{markup,}
+
+% Check if we are currently using a typewriter font. Since all the
+% Computer Modern typewriter fonts have zero interword stretch (and
+% shrink), and it is reasonable to expect all typewriter fonts to have
+% this property, we can check that font parameter.
+%
+\def\ifmonospace{\ifdim\fontdimen3\font=0pt }
+
+% Markup style infrastructure. \defmarkupstylesetup\INITMACRO will
+% define and register \INITMACRO to be called on markup style changes.
+% \INITMACRO can check \currentmarkupstyle for the innermost
+% style.
+
+\let\currentmarkupstyle\empty
+
+\def\setupmarkupstyle#1{%
+ \def\currentmarkupstyle{#1}%
+ \markupstylesetup
+}
+
+\let\markupstylesetup\empty
+
+\def\defmarkupstylesetup#1{%
+ \expandafter\def\expandafter\markupstylesetup
+ \expandafter{\markupstylesetup #1}%
+ \def#1%
+}
+
+% Markup style setup for left and right quotes.
+\defmarkupstylesetup\markupsetuplq{%
+ \expandafter\let\expandafter \temp
+ \csname markupsetuplq\currentmarkupstyle\endcsname
+ \ifx\temp\relax \markupsetuplqdefault \else \temp \fi
+}
+
+\defmarkupstylesetup\markupsetuprq{%
+ \expandafter\let\expandafter \temp
+ \csname markupsetuprq\currentmarkupstyle\endcsname
+ \ifx\temp\relax \markupsetuprqdefault \else \temp \fi
+}
+
+{
+\catcode`\'=\active
+\catcode`\`=\active
+
+\gdef\markupsetuplqdefault{\let`\lq}
+\gdef\markupsetuprqdefault{\let'\rq}
+
+\gdef\markupsetcodequoteleft{\let`\codequoteleft}
+\gdef\markupsetcodequoteright{\let'\codequoteright}
+}
+
+\let\markupsetuplqcode \markupsetcodequoteleft
+\let\markupsetuprqcode \markupsetcodequoteright
+%
+\let\markupsetuplqexample \markupsetcodequoteleft
+\let\markupsetuprqexample \markupsetcodequoteright
+%
+\let\markupsetuplqkbd \markupsetcodequoteleft
+\let\markupsetuprqkbd \markupsetcodequoteright
+%
+\let\markupsetuplqsamp \markupsetcodequoteleft
+\let\markupsetuprqsamp \markupsetcodequoteright
+%
+\let\markupsetuplqverb \markupsetcodequoteleft
+\let\markupsetuprqverb \markupsetcodequoteright
+%
+\let\markupsetuplqverbatim \markupsetcodequoteleft
+\let\markupsetuprqverbatim \markupsetcodequoteright
+
+% Allow an option to not use regular directed right quote/apostrophe
+% (char 0x27), but instead the undirected quote from cmtt (char 0x0d).
+% The undirected quote is ugly, so don't make it the default, but it
+% works for pasting with more pdf viewers (at least evince), the
+% lilypond developers report. xpdf does work with the regular 0x27.
+%
+\def\codequoteright{%
+ \ifmonospace
+ \expandafter\ifx\csname SETtxicodequoteundirected\endcsname\relax
+ \expandafter\ifx\csname SETcodequoteundirected\endcsname\relax
+ '%
+ \else \char'15 \fi
+ \else \char'15 \fi
+ \else
+ '%
+ \fi
+}
+%
+% and a similar option for the left quote char vs. a grave accent.
+% Modern fonts display ASCII 0x60 as a grave accent, so some people like
+% the code environments to do likewise.
+%
+\def\codequoteleft{%
+ \ifmonospace
+ \expandafter\ifx\csname SETtxicodequotebacktick\endcsname\relax
+ \expandafter\ifx\csname SETcodequotebacktick\endcsname\relax
+ % [Knuth] pp. 380,381,391
+ % \relax disables Spanish ligatures ?` and !` of \tt font.
+ \relax`%
+ \else \char'22 \fi
+ \else \char'22 \fi
+ \else
+ \relax`%
+ \fi
+}
+
+% Commands to set the quote options.
+%
+\parseargdef\codequoteundirected{%
+ \def\temp{#1}%
+ \ifx\temp\onword
+ \expandafter\let\csname SETtxicodequoteundirected\endcsname
+ = t%
+ \else\ifx\temp\offword
+ \expandafter\let\csname SETtxicodequoteundirected\endcsname
+ = \relax
+ \else
+ \errhelp = \EMsimple
+ \errmessage{Unknown @codequoteundirected value `\temp', must be on|off}%
+ \fi\fi
+}
+%
+\parseargdef\codequotebacktick{%
+ \def\temp{#1}%
+ \ifx\temp\onword
+ \expandafter\let\csname SETtxicodequotebacktick\endcsname
+ = t%
+ \else\ifx\temp\offword
+ \expandafter\let\csname SETtxicodequotebacktick\endcsname
+ = \relax
+ \else
+ \errhelp = \EMsimple
+ \errmessage{Unknown @codequotebacktick value `\temp', must be on|off}%
+ \fi\fi
+}
+
+% [Knuth] pp. 380,381,391, disable Spanish ligatures ?` and !` of \tt font.
+\def\noligaturesquoteleft{\relax\lq}
+
+% Count depth in font-changes, for error checks
+\newcount\fontdepth \fontdepth=0
+
+% Font commands.
+
+% #1 is the font command (\sl or \it), #2 is the text to slant.
+% If we are in a monospaced environment, however, 1) always use \ttsl,
+% and 2) do not add an italic correction.
+\def\dosmartslant#1#2{%
+ \ifusingtt
+ {{\ttsl #2}\let\next=\relax}%
+ {\def\next{{#1#2}\futurelet\next\smartitaliccorrection}}%
+ \next
+}
+\def\smartslanted{\dosmartslant\sl}
+\def\smartitalic{\dosmartslant\it}
+
+% Output an italic correction unless \next (presumed to be the following
+% character) is such as not to need one.
+\def\smartitaliccorrection{%
+ \ifx\next,%
+ \else\ifx\next-%
+ \else\ifx\next.%
+ \else\ifx\next\.%
+ \else\ifx\next\comma%
+ \else\ptexslash
+ \fi\fi\fi\fi\fi
+ \aftersmartic
+}
+
+% Unconditional use \ttsl, and no ic. @var is set to this for defuns.
+\def\ttslanted#1{{\ttsl #1}}
+
+% @cite is like \smartslanted except unconditionally use \sl. We never want
+% ttsl for book titles, do we?
+\def\cite#1{{\sl #1}\futurelet\next\smartitaliccorrection}
+
+\def\aftersmartic{}
+\def\var#1{%
+ \let\saveaftersmartic = \aftersmartic
+ \def\aftersmartic{\null\let\aftersmartic=\saveaftersmartic}%
+ \smartslanted{#1}%
+}
+
+\let\i=\smartitalic
+\let\slanted=\smartslanted
+\let\dfn=\smartslanted
+\let\emph=\smartitalic
+
+% Explicit font changes: @r, @sc, undocumented @ii.
+\def\r#1{{\rm #1}} % roman font
+\def\sc#1{{\smallcaps#1}} % smallcaps font
+\def\ii#1{{\it #1}} % italic font
+
+% @b, explicit bold. Also @strong.
+\def\b#1{{\bf #1}}
+\let\strong=\b
+
+% @sansserif, explicit sans.
+\def\sansserif#1{{\sf #1}}
+
+% We can't just use \exhyphenpenalty, because that only has effect at
+% the end of a paragraph. Restore normal hyphenation at the end of the
+% group within which \nohyphenation is presumably called.
+%
+\def\nohyphenation{\hyphenchar\font = -1 \aftergroup\restorehyphenation}
+\def\restorehyphenation{\hyphenchar\font = `- }
+
+% Set sfcode to normal for the chars that usually have another value.
+% Can't use plain's \frenchspacing because it uses the `\x notation, and
+% sometimes \x has an active definition that messes things up.
+%
+\catcode`@=11
+ \def\plainfrenchspacing{%
+ \sfcode`\.=\@m \sfcode`\?=\@m \sfcode`\!=\@m
+ \sfcode`\:=\@m \sfcode`\;=\@m \sfcode`\,=\@m
+ \def\endofsentencespacefactor{1000}% for @. and friends
+ }
+ \def\plainnonfrenchspacing{%
+ \sfcode`\.3000\sfcode`\?3000\sfcode`\!3000
+ \sfcode`\:2000\sfcode`\;1500\sfcode`\,1250
+ \def\endofsentencespacefactor{3000}% for @. and friends
+ }
+\catcode`@=\other
+\def\endofsentencespacefactor{3000}% default
+
+% @t, explicit typewriter.
+\def\t#1{%
+ {\tt \plainfrenchspacing #1}%
+ \null
+}
+
+% @samp.
+\def\samp#1{{\setupmarkupstyle{samp}\lq\tclose{#1}\rq\null}}
+
+% @indicateurl is \samp, that is, with quotes.
+\let\indicateurl=\samp
+
+% @code (and similar) prints in typewriter, but with spaces the same
+% size as normal in the surrounding text, without hyphenation, etc.
+% This is a subroutine for that.
+\def\tclose#1{%
+ {%
+ % Change normal interword space to be same as for the current font.
+ \spaceskip = \fontdimen2\font
+ %
+ % Switch to typewriter.
+ \tt
+ %
+ % But `\ ' produces the large typewriter interword space.
+ \def\ {{\spaceskip = 0pt{} }}%
+ %
+ % Turn off hyphenation.
+ \nohyphenation
+ %
+ \plainfrenchspacing
+ #1%
+ }%
+ \null % reset spacefactor to 1000
+}
+
+% We *must* turn on hyphenation at `-' and `_' in @code.
+% (But see \codedashfinish below.)
+% Otherwise, it is too hard to avoid overfull hboxes
+% in the Emacs manual, the Library manual, etc.
+%
+% Unfortunately, TeX uses one parameter (\hyphenchar) to control
+% both hyphenation at - and hyphenation within words.
+% We must therefore turn them both off (\tclose does that)
+% and arrange explicitly to hyphenate at a dash. -- rms.
+{
+ \catcode`\-=\active \catcode`\_=\active
+ \catcode`\'=\active \catcode`\`=\active
+ \global\let'=\rq \global\let`=\lq % default definitions
+ %
+ \global\def\code{\begingroup
+ \setupmarkupstyle{code}%
+ % The following should really be moved into \setupmarkupstyle handlers.
+ \catcode\dashChar=\active \catcode\underChar=\active
+ \ifallowcodebreaks
+ \let-\codedash
+ \let_\codeunder
+ \else
+ \let-\normaldash
+ \let_\realunder
+ \fi
+ % Given -foo (with a single dash), we do not want to allow a break
+ % after the hyphen.
+ \global\let\codedashprev=\codedash
+ %
+ \codex
+ }
+ %
+ \gdef\codedash{\futurelet\next\codedashfinish}
+ \gdef\codedashfinish{%
+ \normaldash % always output the dash character itself.
+ %
+ % Now, output a discretionary to allow a line break, unless
+ % (a) the next character is a -, or
+ % (b) the preceding character is a -.
+ % E.g., given --posix, we do not want to allow a break after either -.
+ % Given --foo-bar, we do want to allow a break between the - and the b.
+ \ifx\next\codedash \else
+ \ifx\codedashprev\codedash
+ \else \discretionary{}{}{}\fi
+ \fi
+ % we need the space after the = for the case when \next itself is a
+ % space token; it would get swallowed otherwise. As in @code{- a}.
+ \global\let\codedashprev= \next
+ }
+}
+\def\normaldash{-}
+%
+\def\codex #1{\tclose{#1}\endgroup}
+
+\def\codeunder{%
+ % this is all so @math{@code{var_name}+1} can work. In math mode, _
+ % is "active" (mathcode"8000) and \normalunderscore (or \char95, etc.)
+ % will therefore expand the active definition of _, which is us
+ % (inside @code that is), therefore an endless loop.
+ \ifusingtt{\ifmmode
+ \mathchar"075F % class 0=ordinary, family 7=ttfam, pos 0x5F=_.
+ \else\normalunderscore \fi
+ \discretionary{}{}{}}%
+ {\_}%
+}
+
+% An additional complication: the above will allow breaks after, e.g.,
+% each of the four underscores in __typeof__. This is bad.
+% @allowcodebreaks provides a document-level way to turn breaking at -
+% and _ on and off.
+%
+\newif\ifallowcodebreaks \allowcodebreakstrue
+
+\def\keywordtrue{true}
+\def\keywordfalse{false}
+
+\parseargdef\allowcodebreaks{%
+ \def\txiarg{#1}%
+ \ifx\txiarg\keywordtrue
+ \allowcodebreakstrue
+ \else\ifx\txiarg\keywordfalse
+ \allowcodebreaksfalse
+ \else
+ \errhelp = \EMsimple
+ \errmessage{Unknown @allowcodebreaks option `\txiarg', must be true|false}%
+ \fi\fi
+}
+
+% For @command, @env, @file, @option quotes seem unnecessary,
+% so use \code rather than \samp.
+\let\command=\code
+\let\env=\code
+\let\file=\code
+\let\option=\code
+
+% @uref (abbreviation for `urlref') aka @url takes an optional
+% (comma-separated) second argument specifying the text to display and
+% an optional third arg as text to display instead of (rather than in
+% addition to) the url itself. First (mandatory) arg is the url.
+
+% TeX-only option to allow changing PDF output to show only the second
+% arg (if given), and not the url (which is then just the link target).
+\newif\ifurefurlonlylink
+
+% The main macro is \urefbreak, which allows breaking at expected
+% places within the url. (There used to be another version, which
+% didn't support automatic breaking.)
+\def\urefbreak{\begingroup \urefcatcodes \dourefbreak}
+\let\uref=\urefbreak
+%
+\def\dourefbreak#1{\urefbreakfinish #1,,,\finish}
+\def\urefbreakfinish#1,#2,#3,#4\finish{% doesn't work in @example
+ \unsepspaces
+ \pdfurl{#1}%
+ \setbox0 = \hbox{\ignorespaces #3}%
+ \ifdim\wd0 > 0pt
+ \unhbox0 % third arg given, show only that
+ \else
+ \setbox0 = \hbox{\ignorespaces #2}% look for second arg
+ \ifdim\wd0 > 0pt
+ \ifpdf
+ % For pdfTeX and LuaTeX
+ \ifurefurlonlylink
+ % PDF plus option to not display url, show just arg
+ \unhbox0
+ \else
+ % PDF, normally display both arg and url for consistency,
+ % visibility, if the pdf is eventually used to print, etc.
+ \unhbox0\ (\urefcode{#1})%
+ \fi
+ \else
+ \ifx\XeTeXrevision\thisisundefined
+ \unhbox0\ (\urefcode{#1})% DVI, always show arg and url
+ \else
+ % For XeTeX
+ \ifurefurlonlylink
+ % PDF plus option to not display url, show just arg
+ \unhbox0
+ \else
+ % PDF, normally display both arg and url for consistency,
+ % visibility, if the pdf is eventually used to print, etc.
+ \unhbox0\ (\urefcode{#1})%
+ \fi
+ \fi
+ \fi
+ \else
+ \urefcode{#1}% only url given, so show it
+ \fi
+ \fi
+ \endlink
+\endgroup}
+
+% Allow line breaks around only a few characters (only).
+\def\urefcatcodes{%
+ \catcode`\&=\active \catcode`\.=\active
+ \catcode`\#=\active \catcode`\?=\active
+ \catcode`\/=\active
+}
+{
+ \urefcatcodes
+ %
+ \global\def\urefcode{\begingroup
+ \setupmarkupstyle{code}%
+ \urefcatcodes
+ \let&\urefcodeamp
+ \let.\urefcodedot
+ \let#\urefcodehash
+ \let?\urefcodequest
+ \let/\urefcodeslash
+ \codex
+ }
+ %
+ % By default, they are just regular characters.
+ \global\def&{\normalamp}
+ \global\def.{\normaldot}
+ \global\def#{\normalhash}
+ \global\def?{\normalquest}
+ \global\def/{\normalslash}
+}
+
+\def\urefcodeamp{\urefprebreak \&\urefpostbreak}
+\def\urefcodedot{\urefprebreak .\urefpostbreak}
+\def\urefcodehash{\urefprebreak \#\urefpostbreak}
+\def\urefcodequest{\urefprebreak ?\urefpostbreak}
+\def\urefcodeslash{\futurelet\next\urefcodeslashfinish}
+{
+ \catcode`\/=\active
+ \global\def\urefcodeslashfinish{%
+ \urefprebreak \slashChar
+ % Allow line break only after the final / in a sequence of
+ % slashes, to avoid line break between the slashes in http://.
+ \ifx\next/\else \urefpostbreak \fi
+ }
+}
+
+% By default we'll break after the special characters, but some people like to
+% break before the special chars, so allow that. Also allow no breaking at
+% all, for manual control.
+%
+\parseargdef\urefbreakstyle{%
+ \def\txiarg{#1}%
+ \ifx\txiarg\wordnone
+ \def\urefprebreak{\nobreak}\def\urefpostbreak{\nobreak}
+ \else\ifx\txiarg\wordbefore
+ \def\urefprebreak{\urefallowbreak}\def\urefpostbreak{\nobreak}
+ \else\ifx\txiarg\wordafter
+ \def\urefprebreak{\nobreak}\def\urefpostbreak{\urefallowbreak}
+ \else
+ \errhelp = \EMsimple
+ \errmessage{Unknown @urefbreakstyle setting `\txiarg'}%
+ \fi\fi\fi
+}
+\def\wordafter{after}
+\def\wordbefore{before}
+\def\wordnone{none}
+
+% Allow a ragged right output to aid breaking long URL's. There can
+% be a break at the \allowbreak with no extra glue (if the existing stretch in
+% the line is sufficent), a break at the \penalty100 with extra glue added
+% at the end of the line, or no break at all here.
+% Changing the value of the penalty and/or the amount of stretch affects how
+% preferrable one choice is over the other.
+\def\urefallowbreak{%
+ \allowbreak
+ \hskip 0pt plus 2 em\relax
+ \penalty300
+ \hskip 0pt plus -2 em\relax
+}
+
+\urefbreakstyle after
+
+% @url synonym for @uref, since that's how everyone uses it.
+%
+\let\url=\uref
+
+% rms does not like angle brackets --karl, 17may97.
+% So now @email is just like @uref, unless we are pdf.
+%
+%\def\email#1{\angleleft{\tt #1}\angleright}
+\ifpdforxetex
+ \def\email#1{\doemail#1,,\finish}
+ \def\doemail#1,#2,#3\finish{\begingroup
+ \unsepspaces
+ \pdfurl{mailto:#1}%
+ \setbox0 = \hbox{\ignorespaces #2}%
+ \ifdim\wd0>0pt\unhbox0\else\code{#1}\fi
+ \endlink
+ \endgroup}
+\else
+ \let\email=\uref
+\fi
+
+% @kbdinputstyle -- arg is `distinct' (@kbd uses slanted tty font always),
+% `example' (@kbd uses ttsl only inside of @example and friends),
+% or `code' (@kbd uses normal tty font always).
+\parseargdef\kbdinputstyle{%
+ \def\txiarg{#1}%
+ \ifx\txiarg\worddistinct
+ \gdef\kbdexamplefont{\ttsl}\gdef\kbdfont{\ttsl}%
+ \else\ifx\txiarg\wordexample
+ \gdef\kbdexamplefont{\ttsl}\gdef\kbdfont{\tt}%
+ \else\ifx\txiarg\wordcode
+ \gdef\kbdexamplefont{\tt}\gdef\kbdfont{\tt}%
+ \else
+ \errhelp = \EMsimple
+ \errmessage{Unknown @kbdinputstyle setting `\txiarg'}%
+ \fi\fi\fi
+}
+\def\worddistinct{distinct}
+\def\wordexample{example}
+\def\wordcode{code}
+
+% Default is `distinct'.
+\kbdinputstyle distinct
+
+% @kbd is like @code, except that if the argument is just one @key command,
+% then @kbd has no effect.
+\def\kbd#1{{\def\look{#1}\expandafter\kbdsub\look??\par}}
+
+\def\xkey{\key}
+\def\kbdsub#1#2#3\par{%
+ \def\one{#1}\def\three{#3}\def\threex{??}%
+ \ifx\one\xkey\ifx\threex\three \key{#2}%
+ \else{\tclose{\kbdfont\setupmarkupstyle{kbd}\look}}\fi
+ \else{\tclose{\kbdfont\setupmarkupstyle{kbd}\look}}\fi
+}
+
+% definition of @key that produces a lozenge. Doesn't adjust to text size.
+%\setfont\keyrm\rmshape{8}{1000}{OT1}
+%\font\keysy=cmsy9
+%\def\key#1{{\keyrm\textfont2=\keysy \leavevmode\hbox{%
+% \raise0.4pt\hbox{\angleleft}\kern-.08em\vtop{%
+% \vbox{\hrule\kern-0.4pt
+% \hbox{\raise0.4pt\hbox{\vphantom{\angleleft}}#1}}%
+% \kern-0.4pt\hrule}%
+% \kern-.06em\raise0.4pt\hbox{\angleright}}}}
+
+% definition of @key with no lozenge. If the current font is already
+% monospace, don't change it; that way, we respect @kbdinputstyle. But
+% if it isn't monospace, then use \tt.
+%
+\def\key#1{{\setupmarkupstyle{key}%
+ \nohyphenation
+ \ifmonospace\else\tt\fi
+ #1}\null}
+
+% @clicksequence{File @click{} Open ...}
+\def\clicksequence#1{\begingroup #1\endgroup}
+
+% @clickstyle @arrow (by default)
+\parseargdef\clickstyle{\def\click{#1}}
+\def\click{\arrow}
+
+% Typeset a dimension, e.g., `in' or `pt'. The only reason for the
+% argument is to make the input look right: @dmn{pt} instead of @dmn{}pt.
+%
+\def\dmn#1{\thinspace #1}
+
+% @acronym for "FBI", "NATO", and the like.
+% We print this one point size smaller, since it's intended for
+% all-uppercase.
+%
+\def\acronym#1{\doacronym #1,,\finish}
+\def\doacronym#1,#2,#3\finish{%
+ {\switchtolsize #1}%
+ \def\temp{#2}%
+ \ifx\temp\empty \else
+ \space ({\unsepspaces \ignorespaces \temp \unskip})%
+ \fi
+ \null % reset \spacefactor=1000
+}
+
+% @abbr for "Comput. J." and the like.
+% No font change, but don't do end-of-sentence spacing.
+%
+\def\abbr#1{\doabbr #1,,\finish}
+\def\doabbr#1,#2,#3\finish{%
+ {\plainfrenchspacing #1}%
+ \def\temp{#2}%
+ \ifx\temp\empty \else
+ \space ({\unsepspaces \ignorespaces \temp \unskip})%
+ \fi
+ \null % reset \spacefactor=1000
+}
+
+% @asis just yields its argument. Used with @table, for example.
+%
+\def\asis#1{#1}
+
+% @math outputs its argument in math mode.
+%
+% One complication: _ usually means subscripts, but it could also mean
+% an actual _ character, as in @math{@var{some_variable} + 1}. So make
+% _ active, and distinguish by seeing if the current family is \slfam,
+% which is what @var uses.
+{
+ \catcode`\_ = \active
+ \gdef\mathunderscore{%
+ \catcode`\_=\active
+ \def_{\ifnum\fam=\slfam \_\else\sb\fi}%
+ }
+}
+% Another complication: we want \\ (and @\) to output a math (or tt) \.
+% FYI, plain.tex uses \\ as a temporary control sequence (for no
+% particular reason), but this is not advertised and we don't care.
+%
+% The \mathchar is class=0=ordinary, family=7=ttfam, position=5C=\.
+\def\mathbackslash{\ifnum\fam=\ttfam \mathchar"075C \else\backslash \fi}
+%
+\def\math{%
+ \ifmmode\else % only go into math if not in math mode already
+ \tex
+ \mathunderscore
+ \let\\ = \mathbackslash
+ \mathactive
+ % make the texinfo accent commands work in math mode
+ \let\"=\ddot
+ \let\'=\acute
+ \let\==\bar
+ \let\^=\hat
+ \let\`=\grave
+ \let\u=\breve
+ \let\v=\check
+ \let\~=\tilde
+ \let\dotaccent=\dot
+ % have to provide another name for sup operator
+ \let\mathopsup=\sup
+ $\expandafter\finishmath\fi
+}
+\def\finishmath#1{#1$\endgroup} % Close the group opened by \tex.
+
+% Some active characters (such as <) are spaced differently in math.
+% We have to reset their definitions in case the @math was an argument
+% to a command which sets the catcodes (such as @item or @section).
+%
+{
+ \catcode`^ = \active
+ \catcode`< = \active
+ \catcode`> = \active
+ \catcode`+ = \active
+ \catcode`' = \active
+ \gdef\mathactive{%
+ \let^ = \ptexhat
+ \let< = \ptexless
+ \let> = \ptexgtr
+ \let+ = \ptexplus
+ \let' = \ptexquoteright
+ }
+}
+
+% for @sub and @sup, if in math mode, just do a normal sub/superscript.
+% If in text, use math to place as sub/superscript, but switch
+% into text mode, with smaller fonts. This is a different font than the
+% one used for real math sub/superscripts (8pt vs. 7pt), but let's not
+% fix it (significant additions to font machinery) until someone notices.
+%
+\def\sub{\ifmmode \expandafter\sb \else \expandafter\finishsub\fi}
+\def\finishsub#1{$\sb{\hbox{\switchtolllsize #1}}$}%
+%
+\def\sup{\ifmmode \expandafter\ptexsp \else \expandafter\finishsup\fi}
+\def\finishsup#1{$\ptexsp{\hbox{\switchtolllsize #1}}$}%
+
+% @inlinefmt{FMTNAME,PROCESSED-TEXT} and @inlineraw{FMTNAME,RAW-TEXT}.
+% Ignore unless FMTNAME == tex; then it is like @iftex and @tex,
+% except specified as a normal braced arg, so no newlines to worry about.
+%
+\def\outfmtnametex{tex}
+%
+\long\def\inlinefmt#1{\doinlinefmt #1,\finish}
+\long\def\doinlinefmt#1,#2,\finish{%
+ \def\inlinefmtname{#1}%
+ \ifx\inlinefmtname\outfmtnametex \ignorespaces #2\fi
+}
+%
+% @inlinefmtifelse{FMTNAME,THEN-TEXT,ELSE-TEXT} expands THEN-TEXT if
+% FMTNAME is tex, else ELSE-TEXT.
+\long\def\inlinefmtifelse#1{\doinlinefmtifelse #1,,,\finish}
+\long\def\doinlinefmtifelse#1,#2,#3,#4,\finish{%
+ \def\inlinefmtname{#1}%
+ \ifx\inlinefmtname\outfmtnametex \ignorespaces #2\else \ignorespaces #3\fi
+}
+%
+% For raw, must switch into @tex before parsing the argument, to avoid
+% setting catcodes prematurely. Doing it this way means that, for
+% example, @inlineraw{html, foo{bar} gets a parse error instead of being
+% ignored. But this isn't important because if people want a literal
+% *right* brace they would have to use a command anyway, so they may as
+% well use a command to get a left brace too. We could re-use the
+% delimiter character idea from \verb, but it seems like overkill.
+%
+\long\def\inlineraw{\tex \doinlineraw}
+\long\def\doinlineraw#1{\doinlinerawtwo #1,\finish}
+\def\doinlinerawtwo#1,#2,\finish{%
+ \def\inlinerawname{#1}%
+ \ifx\inlinerawname\outfmtnametex \ignorespaces #2\fi
+ \endgroup % close group opened by \tex.
+}
+
+% @inlineifset{VAR, TEXT} expands TEXT if VAR is @set.
+%
+\long\def\inlineifset#1{\doinlineifset #1,\finish}
+\long\def\doinlineifset#1,#2,\finish{%
+ \def\inlinevarname{#1}%
+ \expandafter\ifx\csname SET\inlinevarname\endcsname\relax
+ \else\ignorespaces#2\fi
+}
+
+% @inlineifclear{VAR, TEXT} expands TEXT if VAR is not @set.
+%
+\long\def\inlineifclear#1{\doinlineifclear #1,\finish}
+\long\def\doinlineifclear#1,#2,\finish{%
+ \def\inlinevarname{#1}%
+ \expandafter\ifx\csname SET\inlinevarname\endcsname\relax \ignorespaces#2\fi
+}
+
+
+\message{glyphs,}
+% and logos.
+
+% @@ prints an @, as does @atchar{}.
+\def\@{\char64 }
+\let\atchar=\@
+
+% @{ @} @lbracechar{} @rbracechar{} all generate brace characters.
+\def\lbracechar{{\ifmonospace\char123\else\ensuremath\lbrace\fi}}
+\def\rbracechar{{\ifmonospace\char125\else\ensuremath\rbrace\fi}}
+\let\{=\lbracechar
+\let\}=\rbracechar
+
+% @comma{} to avoid , parsing problems.
+\let\comma = ,
+
+% Accents: @, @dotaccent @ringaccent @ubaraccent @udotaccent
+% Others are defined by plain TeX: @` @' @" @^ @~ @= @u @v @H.
+\let\, = \ptexc
+\let\dotaccent = \ptexdot
+\def\ringaccent#1{{\accent23 #1}}
+\let\tieaccent = \ptext
+\let\ubaraccent = \ptexb
+\let\udotaccent = \d
+
+% Other special characters: @questiondown @exclamdown @ordf @ordm
+% Plain TeX defines: @AA @AE @O @OE @L (plus lowercase versions) @ss.
+\def\questiondown{?`}
+\def\exclamdown{!`}
+\def\ordf{\leavevmode\raise1ex\hbox{\switchtolllsize \underbar{a}}}
+\def\ordm{\leavevmode\raise1ex\hbox{\switchtolllsize \underbar{o}}}
+
+% Dotless i and dotless j, used for accents.
+\def\imacro{i}
+\def\jmacro{j}
+\def\dotless#1{%
+ \def\temp{#1}%
+ \ifx\temp\imacro \ifmmode\imath \else\ptexi \fi
+ \else\ifx\temp\jmacro \ifmmode\jmath \else\j \fi
+ \else \errmessage{@dotless can be used only with i or j}%
+ \fi\fi
+}
+
+% The \TeX{} logo, as in plain, but resetting the spacing so that a
+% period following counts as ending a sentence. (Idea found in latex.)
+%
+\edef\TeX{\TeX \spacefactor=1000 }
+
+% @LaTeX{} logo. Not quite the same results as the definition in
+% latex.ltx, since we use a different font for the raised A; it's most
+% convenient for us to use an explicitly smaller font, rather than using
+% the \scriptstyle font (since we don't reset \scriptstyle and
+% \scriptscriptstyle).
+%
+\def\LaTeX{%
+ L\kern-.36em
+ {\setbox0=\hbox{T}%
+ \vbox to \ht0{\hbox{%
+ \ifx\textnominalsize\xwordpt
+ % for 10pt running text, lllsize (8pt) is too small for the A in LaTeX.
+ % Revert to plain's \scriptsize, which is 7pt.
+ \count255=\the\fam $\fam\count255 \scriptstyle A$%
+ \else
+ % For 11pt, we can use our lllsize.
+ \switchtolllsize A%
+ \fi
+ }%
+ \vss
+ }}%
+ \kern-.15em
+ \TeX
+}
+
+% Some math mode symbols. Define \ensuremath to switch into math mode
+% unless we are already there. Expansion tricks may not be needed here,
+% but safer, and can't hurt.
+\def\ensuremath{\ifmmode \expandafter\asis \else\expandafter\ensuredmath \fi}
+\def\ensuredmath#1{$\relax#1$}
+%
+\def\bullet{\ensuremath\ptexbullet}
+\def\geq{\ensuremath\ge}
+\def\leq{\ensuremath\le}
+\def\minus{\ensuremath-}
+
+% @dots{} outputs an ellipsis using the current font.
+% We do .5em per period so that it has the same spacing in the cm
+% typewriter fonts as three actual period characters; on the other hand,
+% in other typewriter fonts three periods are wider than 1.5em. So do
+% whichever is larger.
+%
+\def\dots{%
+ \leavevmode
+ \setbox0=\hbox{...}% get width of three periods
+ \ifdim\wd0 > 1.5em
+ \dimen0 = \wd0
+ \else
+ \dimen0 = 1.5em
+ \fi
+ \hbox to \dimen0{%
+ \hskip 0pt plus.25fil
+ .\hskip 0pt plus1fil
+ .\hskip 0pt plus1fil
+ .\hskip 0pt plus.5fil
+ }%
+}
+
+% @enddots{} is an end-of-sentence ellipsis.
+%
+\def\enddots{%
+ \dots
+ \spacefactor=\endofsentencespacefactor
+}
+
+% @point{}, @result{}, @expansion{}, @print{}, @equiv{}.
+%
+% Since these characters are used in examples, they should be an even number of
+% \tt widths. Each \tt character is 1en, so two makes it 1em.
+%
+\def\point{$\star$}
+\def\arrow{\leavevmode\raise.05ex\hbox to 1em{\hfil$\rightarrow$\hfil}}
+\def\result{\leavevmode\raise.05ex\hbox to 1em{\hfil$\Rightarrow$\hfil}}
+\def\expansion{\leavevmode\hbox to 1em{\hfil$\mapsto$\hfil}}
+\def\print{\leavevmode\lower.1ex\hbox to 1em{\hfil$\dashv$\hfil}}
+\def\equiv{\leavevmode\hbox to 1em{\hfil$\ptexequiv$\hfil}}
+
+% The @error{} command.
+% Adapted from the TeXbook's \boxit.
+%
+\newbox\errorbox
+%
+{\ttfont \global\dimen0 = 3em}% Width of the box.
+\dimen2 = .55pt % Thickness of rules
+% The text. (`r' is open on the right, `e' somewhat less so on the left.)
+\setbox0 = \hbox{\kern-.75pt \reducedsf \putworderror\kern-1.5pt}
+%
+\setbox\errorbox=\hbox to \dimen0{\hfil
+ \hsize = \dimen0 \advance\hsize by -5.8pt % Space to left+right.
+ \advance\hsize by -2\dimen2 % Rules.
+ \vbox{%
+ \hrule height\dimen2
+ \hbox{\vrule width\dimen2 \kern3pt % Space to left of text.
+ \vtop{\kern2.4pt \box0 \kern2.4pt}% Space above/below.
+ \kern3pt\vrule width\dimen2}% Space to right.
+ \hrule height\dimen2}
+ \hfil}
+%
+\def\error{\leavevmode\lower.7ex\copy\errorbox}
+
+% @pounds{} is a sterling sign, which Knuth put in the CM italic font.
+%
+\def\pounds{{\it\$}}
+
+% @euro{} comes from a separate font, depending on the current style.
+% We use the free feym* fonts from the eurosym package by Henrik
+% Theiling, which support regular, slanted, bold and bold slanted (and
+% "outlined" (blackboard board, sort of) versions, which we don't need).
+% It is available from http://www.ctan.org/tex-archive/fonts/eurosym.
+%
+% Although only regular is the truly official Euro symbol, we ignore
+% that. The Euro is designed to be slightly taller than the regular
+% font height.
+%
+% feymr - regular
+% feymo - slanted
+% feybr - bold
+% feybo - bold slanted
+%
+% There is no good (free) typewriter version, to my knowledge.
+% A feymr10 euro is ~7.3pt wide, while a normal cmtt10 char is ~5.25pt wide.
+% Hmm.
+%
+% Also doesn't work in math. Do we need to do math with euro symbols?
+% Hope not.
+%
+%
+\def\euro{{\eurofont e}}
+\def\eurofont{%
+ % We set the font at each command, rather than predefining it in
+ % \textfonts and the other font-switching commands, so that
+ % installations which never need the symbol don't have to have the
+ % font installed.
+ %
+ % There is only one designed size (nominal 10pt), so we always scale
+ % that to the current nominal size.
+ %
+ % By the way, simply using "at 1em" works for cmr10 and the like, but
+ % does not work for cmbx10 and other extended/shrunken fonts.
+ %
+ \def\eurosize{\csname\curfontsize nominalsize\endcsname}%
+ %
+ \ifx\curfontstyle\bfstylename
+ % bold:
+ \font\thiseurofont = \ifusingit{feybo10}{feybr10} at \eurosize
+ \else
+ % regular:
+ \font\thiseurofont = \ifusingit{feymo10}{feymr10} at \eurosize
+ \fi
+ \thiseurofont
+}
+
+% Glyphs from the EC fonts. We don't use \let for the aliases, because
+% sometimes we redefine the original macro, and the alias should reflect
+% the redefinition.
+%
+% Use LaTeX names for the Icelandic letters.
+\def\DH{{\ecfont \char"D0}} % Eth
+\def\dh{{\ecfont \char"F0}} % eth
+\def\TH{{\ecfont \char"DE}} % Thorn
+\def\th{{\ecfont \char"FE}} % thorn
+%
+\def\guillemetleft{{\ecfont \char"13}}
+\def\guillemotleft{\guillemetleft}
+\def\guillemetright{{\ecfont \char"14}}
+\def\guillemotright{\guillemetright}
+\def\guilsinglleft{{\ecfont \char"0E}}
+\def\guilsinglright{{\ecfont \char"0F}}
+\def\quotedblbase{{\ecfont \char"12}}
+\def\quotesinglbase{{\ecfont \char"0D}}
+%
+% This positioning is not perfect (see the ogonek LaTeX package), but
+% we have the precomposed glyphs for the most common cases. We put the
+% tests to use those glyphs in the single \ogonek macro so we have fewer
+% dummy definitions to worry about for index entries, etc.
+%
+% ogonek is also used with other letters in Lithuanian (IOU), but using
+% the precomposed glyphs for those is not so easy since they aren't in
+% the same EC font.
+\def\ogonek#1{{%
+ \def\temp{#1}%
+ \ifx\temp\macrocharA\Aogonek
+ \else\ifx\temp\macrochara\aogonek
+ \else\ifx\temp\macrocharE\Eogonek
+ \else\ifx\temp\macrochare\eogonek
+ \else
+ \ecfont \setbox0=\hbox{#1}%
+ \ifdim\ht0=1ex\accent"0C #1%
+ \else\ooalign{\unhbox0\crcr\hidewidth\char"0C \hidewidth}%
+ \fi
+ \fi\fi\fi\fi
+ }%
+}
+\def\Aogonek{{\ecfont \char"81}}\def\macrocharA{A}
+\def\aogonek{{\ecfont \char"A1}}\def\macrochara{a}
+\def\Eogonek{{\ecfont \char"86}}\def\macrocharE{E}
+\def\eogonek{{\ecfont \char"A6}}\def\macrochare{e}
+%
+% Use the European Computer Modern fonts (cm-super in outline format)
+% for non-CM glyphs. That is ec* for regular text and tc* for the text
+% companion symbols (LaTeX TS1 encoding). Both are part of the ec
+% package and follow the same conventions.
+%
+\def\ecfont{\etcfont{e}}
+\def\tcfont{\etcfont{t}}
+%
+\def\etcfont#1{%
+ % We can't distinguish serif/sans and italic/slanted, but this
+ % is used for crude hacks anyway (like adding French and German
+ % quotes to documents typeset with CM, where we lose kerning), so
+ % hopefully nobody will notice/care.
+ \edef\ecsize{\csname\curfontsize ecsize\endcsname}%
+ \edef\nominalsize{\csname\curfontsize nominalsize\endcsname}%
+ \ifmonospace
+ % typewriter:
+ \font\thisecfont = #1ctt\ecsize \space at \nominalsize
+ \else
+ \ifx\curfontstyle\bfstylename
+ % bold:
+ \font\thisecfont = #1cb\ifusingit{i}{x}\ecsize \space at \nominalsize
+ \else
+ % regular:
+ \font\thisecfont = #1c\ifusingit{ti}{rm}\ecsize \space at \nominalsize
+ \fi
+ \fi
+ \thisecfont
+}
+
+% @registeredsymbol - R in a circle. The font for the R should really
+% be smaller yet, but lllsize is the best we can do for now.
+% Adapted from the plain.tex definition of \copyright.
+%
+\def\registeredsymbol{%
+ $^{{\ooalign{\hfil\raise.07ex\hbox{\switchtolllsize R}%
+ \hfil\crcr\Orb}}%
+ }$%
+}
+
+% @textdegree - the normal degrees sign.
+%
+\def\textdegree{$^\circ$}
+
+% Laurent Siebenmann reports \Orb undefined with:
+% Textures 1.7.7 (preloaded format=plain 93.10.14) (68K) 16 APR 2004 02:38
+% so we'll define it if necessary.
+%
+\ifx\Orb\thisisundefined
+\def\Orb{\mathhexbox20D}
+\fi
+
+% Quotes.
+\chardef\quotedblleft="5C
+\chardef\quotedblright=`\"
+\chardef\quoteleft=`\`
+\chardef\quoteright=`\'
+
+
+\message{page headings,}
+
+\newskip\titlepagetopglue \titlepagetopglue = 1.5in
+\newskip\titlepagebottomglue \titlepagebottomglue = 2pc
+
+% First the title page. Must do @settitle before @titlepage.
+\newif\ifseenauthor
+\newif\iffinishedtitlepage
+
+% @setcontentsaftertitlepage used to do an implicit @contents or
+% @shortcontents after @end titlepage, but it is now obsolete.
+\def\setcontentsaftertitlepage{%
+ \errmessage{@setcontentsaftertitlepage has been removed as a Texinfo
+ command; move your @contents command if you want the contents
+ after the title page.}}%
+\def\setshortcontentsaftertitlepage{%
+ \errmessage{@setshortcontentsaftertitlepage has been removed as a Texinfo
+ command; move your @shortcontents and @contents commands if you
+ want the contents after the title page.}}%
+
+\parseargdef\shorttitlepage{%
+ \begingroup \hbox{}\vskip 1.5in \chaprm \centerline{#1}%
+ \endgroup\page\hbox{}\page}
+
+\envdef\titlepage{%
+ % Open one extra group, as we want to close it in the middle of \Etitlepage.
+ \begingroup
+ \parindent=0pt \textfonts
+ % Leave some space at the very top of the page.
+ \vglue\titlepagetopglue
+ % No rule at page bottom unless we print one at the top with @title.
+ \finishedtitlepagetrue
+ %
+ % Most title ``pages'' are actually two pages long, with space
+ % at the top of the second. We don't want the ragged left on the second.
+ \let\oldpage = \page
+ \def\page{%
+ \iffinishedtitlepage\else
+ \finishtitlepage
+ \fi
+ \let\page = \oldpage
+ \page
+ \null
+ }%
+}
+
+\def\Etitlepage{%
+ \iffinishedtitlepage\else
+ \finishtitlepage
+ \fi
+ % It is important to do the page break before ending the group,
+ % because the headline and footline are only empty inside the group.
+ % If we use the new definition of \page, we always get a blank page
+ % after the title page, which we certainly don't want.
+ \oldpage
+ \endgroup
+ %
+ % Need this before the \...aftertitlepage checks so that if they are
+ % in effect the toc pages will come out with page numbers.
+ \HEADINGSon
+}
+
+\def\finishtitlepage{%
+ \vskip4pt \hrule height 2pt width \hsize
+ \vskip\titlepagebottomglue
+ \finishedtitlepagetrue
+}
+
+% Settings used for typesetting titles: no hyphenation, no indentation,
+% don't worry much about spacing, ragged right. This should be used
+% inside a \vbox, and fonts need to be set appropriately first. \par should
+% be specified before the end of the \vbox, since a vbox is a group.
+%
+\def\raggedtitlesettings{%
+ \rm
+ \hyphenpenalty=10000
+ \parindent=0pt
+ \tolerance=5000
+ \ptexraggedright
+}
+
+% Macros to be used within @titlepage:
+
+\let\subtitlerm=\rmfont
+\def\subtitlefont{\subtitlerm \normalbaselineskip = 13pt \normalbaselines}
+
+\parseargdef\title{%
+ \checkenv\titlepage
+ \vbox{\titlefonts \raggedtitlesettings #1\par}%
+ % print a rule at the page bottom also.
+ \finishedtitlepagefalse
+ \vskip4pt \hrule height 4pt width \hsize \vskip4pt
+}
+
+\parseargdef\subtitle{%
+ \checkenv\titlepage
+ {\subtitlefont \rightline{#1}}%
+}
+
+% @author should come last, but may come many times.
+% It can also be used inside @quotation.
+%
+\parseargdef\author{%
+ \def\temp{\quotation}%
+ \ifx\thisenv\temp
+ \def\quotationauthor{#1}% printed in \Equotation.
+ \else
+ \checkenv\titlepage
+ \ifseenauthor\else \vskip 0pt plus 1filll \seenauthortrue \fi
+ {\secfonts\rm \leftline{#1}}%
+ \fi
+}
+
+
+% Set up page headings and footings.
+
+\let\thispage=\folio
+
+\newtoks\evenheadline % headline on even pages
+\newtoks\oddheadline % headline on odd pages
+\newtoks\evenfootline % footline on even pages
+\newtoks\oddfootline % footline on odd pages
+
+% Now make \makeheadline and \makefootline in Plain TeX use those variables
+\headline={{\textfonts\rm \ifodd\pageno \the\oddheadline
+ \else \the\evenheadline \fi}}
+\footline={{\textfonts\rm \ifodd\pageno \the\oddfootline
+ \else \the\evenfootline \fi}\HEADINGShook}
+\let\HEADINGShook=\relax
+
+% Commands to set those variables.
+% For example, this is what @headings on does
+% @evenheading @thistitle|@thispage|@thischapter
+% @oddheading @thischapter|@thispage|@thistitle
+% @evenfooting @thisfile||
+% @oddfooting ||@thisfile
+
+
+\def\evenheading{\parsearg\evenheadingxxx}
+\def\evenheadingxxx #1{\evenheadingyyy #1\|\|\|\|\finish}
+\def\evenheadingyyy #1\|#2\|#3\|#4\finish{%
+\global\evenheadline={\rlap{\centerline{#2}}\line{#1\hfil#3}}}
+
+\def\oddheading{\parsearg\oddheadingxxx}
+\def\oddheadingxxx #1{\oddheadingyyy #1\|\|\|\|\finish}
+\def\oddheadingyyy #1\|#2\|#3\|#4\finish{%
+\global\oddheadline={\rlap{\centerline{#2}}\line{#1\hfil#3}}}
+
+\parseargdef\everyheading{\oddheadingxxx{#1}\evenheadingxxx{#1}}%
+
+\def\evenfooting{\parsearg\evenfootingxxx}
+\def\evenfootingxxx #1{\evenfootingyyy #1\|\|\|\|\finish}
+\def\evenfootingyyy #1\|#2\|#3\|#4\finish{%
+\global\evenfootline={\rlap{\centerline{#2}}\line{#1\hfil#3}}}
+
+\def\oddfooting{\parsearg\oddfootingxxx}
+\def\oddfootingxxx #1{\oddfootingyyy #1\|\|\|\|\finish}
+\def\oddfootingyyy #1\|#2\|#3\|#4\finish{%
+ \global\oddfootline = {\rlap{\centerline{#2}}\line{#1\hfil#3}}%
+ %
+ % Leave some space for the footline. Hopefully ok to assume
+ % @evenfooting will not be used by itself.
+ \global\advance\txipageheight by -12pt
+ \global\advance\vsize by -12pt
+}
+
+\parseargdef\everyfooting{\oddfootingxxx{#1}\evenfootingxxx{#1}}
+
+% @evenheadingmarks top \thischapter <- chapter at the top of a page
+% @evenheadingmarks bottom \thischapter <- chapter at the bottom of a page
+%
+% The same set of arguments for:
+%
+% @oddheadingmarks
+% @evenfootingmarks
+% @oddfootingmarks
+% @everyheadingmarks
+% @everyfootingmarks
+
+% These define \getoddheadingmarks, \getevenheadingmarks,
+% \getoddfootingmarks, and \getevenfootingmarks, each to one of
+% \gettopheadingmarks, \getbottomheadingmarks.
+%
+\def\evenheadingmarks{\headingmarks{even}{heading}}
+\def\oddheadingmarks{\headingmarks{odd}{heading}}
+\def\evenfootingmarks{\headingmarks{even}{footing}}
+\def\oddfootingmarks{\headingmarks{odd}{footing}}
+\parseargdef\everyheadingmarks{\headingmarks{even}{heading}{#1}
+ \headingmarks{odd}{heading}{#1} }
+\parseargdef\everyfootingmarks{\headingmarks{even}{footing}{#1}
+ \headingmarks{odd}{footing}{#1} }
+% #1 = even/odd, #2 = heading/footing, #3 = top/bottom.
+\def\headingmarks#1#2#3 {%
+ \expandafter\let\expandafter\temp \csname get#3headingmarks\endcsname
+ \global\expandafter\let\csname get#1#2marks\endcsname \temp
+}
+
+\everyheadingmarks bottom
+\everyfootingmarks bottom
+
+% @headings double turns headings on for double-sided printing.
+% @headings single turns headings on for single-sided printing.
+% @headings off turns them off.
+% @headings on same as @headings double, retained for compatibility.
+% @headings after turns on double-sided headings after this page.
+% @headings doubleafter turns on double-sided headings after this page.
+% @headings singleafter turns on single-sided headings after this page.
+% By default, they are off at the start of a document,
+% and turned `on' after @end titlepage.
+
+\parseargdef\headings{\csname HEADINGS#1\endcsname}
+
+\def\headingsoff{% non-global headings elimination
+ \evenheadline={\hfil}\evenfootline={\hfil}%
+ \oddheadline={\hfil}\oddfootline={\hfil}%
+}
+
+\def\HEADINGSoff{{\globaldefs=1 \headingsoff}} % global setting
+\HEADINGSoff % it's the default
+
+% When we turn headings on, set the page number to 1.
+% For double-sided printing, put current file name in lower left corner,
+% chapter name on inside top of right hand pages, document
+% title on inside top of left hand pages, and page numbers on outside top
+% edge of all pages.
+\def\HEADINGSdouble{%
+\global\pageno=1
+\global\evenfootline={\hfil}
+\global\oddfootline={\hfil}
+\global\evenheadline={\line{\folio\hfil\thistitle}}
+\global\oddheadline={\line{\thischapterheading\hfil\folio}}
+\global\let\contentsalignmacro = \chapoddpage
+}
+\let\contentsalignmacro = \chappager
+
+% For single-sided printing, chapter title goes across top left of page,
+% page number on top right.
+\def\HEADINGSsingle{%
+\global\pageno=1
+\global\evenfootline={\hfil}
+\global\oddfootline={\hfil}
+\global\evenheadline={\line{\thischapterheading\hfil\folio}}
+\global\oddheadline={\line{\thischapterheading\hfil\folio}}
+\global\let\contentsalignmacro = \chappager
+}
+\def\HEADINGSon{\HEADINGSdouble}
+
+\def\HEADINGSafter{\let\HEADINGShook=\HEADINGSdoublex}
+\let\HEADINGSdoubleafter=\HEADINGSafter
+\def\HEADINGSdoublex{%
+\global\evenfootline={\hfil}
+\global\oddfootline={\hfil}
+\global\evenheadline={\line{\folio\hfil\thistitle}}
+\global\oddheadline={\line{\thischapterheading\hfil\folio}}
+\global\let\contentsalignmacro = \chapoddpage
+}
+
+\def\HEADINGSsingleafter{\let\HEADINGShook=\HEADINGSsinglex}
+\def\HEADINGSsinglex{%
+\global\evenfootline={\hfil}
+\global\oddfootline={\hfil}
+\global\evenheadline={\line{\thischapterheading\hfil\folio}}
+\global\oddheadline={\line{\thischapterheading\hfil\folio}}
+\global\let\contentsalignmacro = \chappager
+}
+
+% Subroutines used in generating headings
+% This produces Day Month Year style of output.
+% Only define if not already defined, in case a txi-??.tex file has set
+% up a different format (e.g., txi-cs.tex does this).
+\ifx\today\thisisundefined
+\def\today{%
+ \number\day\space
+ \ifcase\month
+ \or\putwordMJan\or\putwordMFeb\or\putwordMMar\or\putwordMApr
+ \or\putwordMMay\or\putwordMJun\or\putwordMJul\or\putwordMAug
+ \or\putwordMSep\or\putwordMOct\or\putwordMNov\or\putwordMDec
+ \fi
+ \space\number\year}
+\fi
+
+% @settitle line... specifies the title of the document, for headings.
+% It generates no output of its own.
+\def\thistitle{\putwordNoTitle}
+\def\settitle{\parsearg{\gdef\thistitle}}
+
+
+\message{tables,}
+% Tables -- @table, @ftable, @vtable, @item(x).
+
+% default indentation of table text
+\newdimen\tableindent \tableindent=.8in
+% default indentation of @itemize and @enumerate text
+\newdimen\itemindent \itemindent=.3in
+% margin between end of table item and start of table text.
+\newdimen\itemmargin \itemmargin=.1in
+
+% used internally for \itemindent minus \itemmargin
+\newdimen\itemmax
+
+% Note @table, @ftable, and @vtable define @item, @itemx, etc., with
+% these defs.
+% They also define \itemindex
+% to index the item name in whatever manner is desired (perhaps none).
+
+\newif\ifitemxneedsnegativevskip
+
+\def\itemxpar{\par\ifitemxneedsnegativevskip\nobreak\vskip-\parskip\nobreak\fi}
+
+\def\internalBitem{\smallbreak \parsearg\itemzzz}
+\def\internalBitemx{\itemxpar \parsearg\itemzzz}
+
+\def\itemzzz #1{\begingroup %
+ \advance\hsize by -\rightskip
+ \advance\hsize by -\tableindent
+ \setbox0=\hbox{\itemindicate{#1}}%
+ \itemindex{#1}%
+ \nobreak % This prevents a break before @itemx.
+ %
+ % If the item text does not fit in the space we have, put it on a line
+ % by itself, and do not allow a page break either before or after that
+ % line. We do not start a paragraph here because then if the next
+ % command is, e.g., @kindex, the whatsit would get put into the
+ % horizontal list on a line by itself, resulting in extra blank space.
+ \ifdim \wd0>\itemmax
+ %
+ % Make this a paragraph so we get the \parskip glue and wrapping,
+ % but leave it ragged-right.
+ \begingroup
+ \advance\leftskip by-\tableindent
+ \advance\hsize by\tableindent
+ \advance\rightskip by0pt plus1fil\relax
+ \leavevmode\unhbox0\par
+ \endgroup
+ %
+ % We're going to be starting a paragraph, but we don't want the
+ % \parskip glue -- logically it's part of the @item we just started.
+ \nobreak \vskip-\parskip
+ %
+ % Stop a page break at the \parskip glue coming up. However, if
+ % what follows is an environment such as @example, there will be no
+ % \parskip glue; then the negative vskip we just inserted would
+ % cause the example and the item to crash together. So we use this
+ % bizarre value of 10001 as a signal to \aboveenvbreak to insert
+ % \parskip glue after all. Section titles are handled this way also.
+ %
+ \penalty 10001
+ \endgroup
+ \itemxneedsnegativevskipfalse
+ \else
+ % The item text fits into the space. Start a paragraph, so that the
+ % following text (if any) will end up on the same line.
+ \noindent
+ % Do this with kerns and \unhbox so that if there is a footnote in
+ % the item text, it can migrate to the main vertical list and
+ % eventually be printed.
+ \nobreak\kern-\tableindent
+ \dimen0 = \itemmax \advance\dimen0 by \itemmargin \advance\dimen0 by -\wd0
+ \unhbox0
+ \nobreak\kern\dimen0
+ \endgroup
+ \itemxneedsnegativevskiptrue
+ \fi
+}
+
+\def\item{\errmessage{@item while not in a list environment}}
+\def\itemx{\errmessage{@itemx while not in a list environment}}
+
+% @table, @ftable, @vtable.
+\envdef\table{%
+ \let\itemindex\gobble
+ \tablecheck{table}%
+}
+\envdef\ftable{%
+ \def\itemindex ##1{\doind {fn}{\code{##1}}}%
+ \tablecheck{ftable}%
+}
+\envdef\vtable{%
+ \def\itemindex ##1{\doind {vr}{\code{##1}}}%
+ \tablecheck{vtable}%
+}
+\def\tablecheck#1{%
+ \ifnum \the\catcode`\^^M=\active
+ \endgroup
+ \errmessage{This command won't work in this context; perhaps the problem is
+ that we are \inenvironment\thisenv}%
+ \def\next{\doignore{#1}}%
+ \else
+ \let\next\tablex
+ \fi
+ \next
+}
+\def\tablex#1{%
+ \def\itemindicate{#1}%
+ \parsearg\tabley
+}
+\def\tabley#1{%
+ {%
+ \makevalueexpandable
+ \edef\temp{\noexpand\tablez #1\space\space\space}%
+ \expandafter
+ }\temp \endtablez
+}
+\def\tablez #1 #2 #3 #4\endtablez{%
+ \aboveenvbreak
+ \ifnum 0#1>0 \advance \leftskip by #1\mil \fi
+ \ifnum 0#2>0 \tableindent=#2\mil \fi
+ \ifnum 0#3>0 \advance \rightskip by #3\mil \fi
+ \itemmax=\tableindent
+ \advance \itemmax by -\itemmargin
+ \advance \leftskip by \tableindent
+ \exdentamount=\tableindent
+ \parindent = 0pt
+ \parskip = \smallskipamount
+ \ifdim \parskip=0pt \parskip=2pt \fi
+ \let\item = \internalBitem
+ \let\itemx = \internalBitemx
+}
+\def\Etable{\endgraf\afterenvbreak}
+\let\Eftable\Etable
+\let\Evtable\Etable
+\let\Eitemize\Etable
+\let\Eenumerate\Etable
+
+% This is the counter used by @enumerate, which is really @itemize
+
+\newcount \itemno
+
+\envdef\itemize{\parsearg\doitemize}
+
+\def\doitemize#1{%
+ \aboveenvbreak
+ \itemmax=\itemindent
+ \advance\itemmax by -\itemmargin
+ \advance\leftskip by \itemindent
+ \exdentamount=\itemindent
+ \parindent=0pt
+ \parskip=\smallskipamount
+ \ifdim\parskip=0pt \parskip=2pt \fi
+ %
+ % Try typesetting the item mark so that if the document erroneously says
+ % something like @itemize @samp (intending @table), there's an error
+ % right away at the @itemize. It's not the best error message in the
+ % world, but it's better than leaving it to the @item. This means if
+ % the user wants an empty mark, they have to say @w{} not just @w.
+ \def\itemcontents{#1}%
+ \setbox0 = \hbox{\itemcontents}%
+ %
+ % @itemize with no arg is equivalent to @itemize @bullet.
+ \ifx\itemcontents\empty\def\itemcontents{\bullet}\fi
+ %
+ \let\item=\itemizeitem
+}
+
+% Definition of @item while inside @itemize and @enumerate.
+%
+\def\itemizeitem{%
+ \advance\itemno by 1 % for enumerations
+ {\let\par=\endgraf \smallbreak}% reasonable place to break
+ {%
+ % If the document has an @itemize directly after a section title, a
+ % \nobreak will be last on the list, and \sectionheading will have
+ % done a \vskip-\parskip. In that case, we don't want to zero
+ % parskip, or the item text will crash with the heading. On the
+ % other hand, when there is normal text preceding the item (as there
+ % usually is), we do want to zero parskip, or there would be too much
+ % space. In that case, we won't have a \nobreak before. At least
+ % that's the theory.
+ \ifnum\lastpenalty<10000 \parskip=0in \fi
+ \noindent
+ \hbox to 0pt{\hss \itemcontents \kern\itemmargin}%
+ %
+ \ifinner\else
+ \vadjust{\penalty 1200}% not good to break after first line of item.
+ \fi
+ % We can be in inner vertical mode in a footnote, although an
+ % @itemize looks awful there.
+ }%
+ \flushcr
+}
+
+% \splitoff TOKENS\endmark defines \first to be the first token in
+% TOKENS, and \rest to be the remainder.
+%
+\def\splitoff#1#2\endmark{\def\first{#1}\def\rest{#2}}%
+
+% Allow an optional argument of an uppercase letter, lowercase letter,
+% or number, to specify the first label in the enumerated list. No
+% argument is the same as `1'.
+%
+\envparseargdef\enumerate{\enumeratey #1 \endenumeratey}
+\def\enumeratey #1 #2\endenumeratey{%
+ % If we were given no argument, pretend we were given `1'.
+ \def\thearg{#1}%
+ \ifx\thearg\empty \def\thearg{1}\fi
+ %
+ % Detect if the argument is a single token. If so, it might be a
+ % letter. Otherwise, the only valid thing it can be is a number.
+ % (We will always have one token, because of the test we just made.
+ % This is a good thing, since \splitoff doesn't work given nothing at
+ % all -- the first parameter is undelimited.)
+ \expandafter\splitoff\thearg\endmark
+ \ifx\rest\empty
+ % Only one token in the argument. It could still be anything.
+ % A ``lowercase letter'' is one whose \lccode is nonzero.
+ % An ``uppercase letter'' is one whose \lccode is both nonzero, and
+ % not equal to itself.
+ % Otherwise, we assume it's a number.
+ %
+ % We need the \relax at the end of the \ifnum lines to stop TeX from
+ % continuing to look for a .
+ %
+ \ifnum\lccode\expandafter`\thearg=0\relax
+ \numericenumerate % a number (we hope)
+ \else
+ % It's a letter.
+ \ifnum\lccode\expandafter`\thearg=\expandafter`\thearg\relax
+ \lowercaseenumerate % lowercase letter
+ \else
+ \uppercaseenumerate % uppercase letter
+ \fi
+ \fi
+ \else
+ % Multiple tokens in the argument. We hope it's a number.
+ \numericenumerate
+ \fi
+}
+
+% An @enumerate whose labels are integers. The starting integer is
+% given in \thearg.
+%
+\def\numericenumerate{%
+ \itemno = \thearg
+ \startenumeration{\the\itemno}%
+}
+
+% The starting (lowercase) letter is in \thearg.
+\def\lowercaseenumerate{%
+ \itemno = \expandafter`\thearg
+ \startenumeration{%
+ % Be sure we're not beyond the end of the alphabet.
+ \ifnum\itemno=0
+ \errmessage{No more lowercase letters in @enumerate; get a bigger
+ alphabet}%
+ \fi
+ \char\lccode\itemno
+ }%
+}
+
+% The starting (uppercase) letter is in \thearg.
+\def\uppercaseenumerate{%
+ \itemno = \expandafter`\thearg
+ \startenumeration{%
+ % Be sure we're not beyond the end of the alphabet.
+ \ifnum\itemno=0
+ \errmessage{No more uppercase letters in @enumerate; get a bigger
+ alphabet}
+ \fi
+ \char\uccode\itemno
+ }%
+}
+
+% Call \doitemize, adding a period to the first argument and supplying the
+% common last two arguments. Also subtract one from the initial value in
+% \itemno, since @item increments \itemno.
+%
+\def\startenumeration#1{%
+ \advance\itemno by -1
+ \doitemize{#1.}\flushcr
+}
+
+% @alphaenumerate and @capsenumerate are abbreviations for giving an arg
+% to @enumerate.
+%
+\def\alphaenumerate{\enumerate{a}}
+\def\capsenumerate{\enumerate{A}}
+\def\Ealphaenumerate{\Eenumerate}
+\def\Ecapsenumerate{\Eenumerate}
+
+
+% @multitable macros
+% Amy Hendrickson, 8/18/94, 3/6/96
+%
+% @multitable ... @end multitable will make as many columns as desired.
+% Contents of each column will wrap at width given in preamble. Width
+% can be specified either with sample text given in a template line,
+% or in percent of \hsize, the current width of text on page.
+
+% Table can continue over pages but will only break between lines.
+
+% To make preamble:
+%
+% Either define widths of columns in terms of percent of \hsize:
+% @multitable @columnfractions .25 .3 .45
+% @item ...
+%
+% Numbers following @columnfractions are the percent of the total
+% current hsize to be used for each column. You may use as many
+% columns as desired.
+
+
+% Or use a template:
+% @multitable {Column 1 template} {Column 2 template} {Column 3 template}
+% @item ...
+% using the widest term desired in each column.
+
+% Each new table line starts with @item, each subsequent new column
+% starts with @tab. Empty columns may be produced by supplying @tab's
+% with nothing between them for as many times as empty columns are needed,
+% ie, @tab@tab@tab will produce two empty columns.
+
+% @item, @tab do not need to be on their own lines, but it will not hurt
+% if they are.
+
+% Sample multitable:
+
+% @multitable {Column 1 template} {Column 2 template} {Column 3 template}
+% @item first col stuff @tab second col stuff @tab third col
+% @item
+% first col stuff
+% @tab
+% second col stuff
+% @tab
+% third col
+% @item first col stuff @tab second col stuff
+% @tab Many paragraphs of text may be used in any column.
+%
+% They will wrap at the width determined by the template.
+% @item@tab@tab This will be in third column.
+% @end multitable
+
+% Default dimensions may be reset by user.
+% @multitableparskip is vertical space between paragraphs in table.
+% @multitableparindent is paragraph indent in table.
+% @multitablecolmargin is horizontal space to be left between columns.
+% @multitablelinespace is space to leave between table items, baseline
+% to baseline.
+% 0pt means it depends on current normal line spacing.
+%
+\newskip\multitableparskip
+\newskip\multitableparindent
+\newdimen\multitablecolspace
+\newskip\multitablelinespace
+\multitableparskip=0pt
+\multitableparindent=6pt
+\multitablecolspace=12pt
+\multitablelinespace=0pt
+
+% Macros used to set up halign preamble:
+%
+\let\endsetuptable\relax
+\def\xendsetuptable{\endsetuptable}
+\let\columnfractions\relax
+\def\xcolumnfractions{\columnfractions}
+\newif\ifsetpercent
+
+% #1 is the @columnfraction, usually a decimal number like .5, but might
+% be just 1. We just use it, whatever it is.
+%
+\def\pickupwholefraction#1 {%
+ \global\advance\colcount by 1
+ \expandafter\xdef\csname col\the\colcount\endcsname{#1\hsize}%
+ \setuptable
+}
+
+\newcount\colcount
+\def\setuptable#1{%
+ \def\firstarg{#1}%
+ \ifx\firstarg\xendsetuptable
+ \let\go = \relax
+ \else
+ \ifx\firstarg\xcolumnfractions
+ \global\setpercenttrue
+ \else
+ \ifsetpercent
+ \let\go\pickupwholefraction
+ \else
+ \global\advance\colcount by 1
+ \setbox0=\hbox{#1\unskip\space}% Add a normal word space as a
+ % separator; typically that is always in the input, anyway.
+ \expandafter\xdef\csname col\the\colcount\endcsname{\the\wd0}%
+ \fi
+ \fi
+ \ifx\go\pickupwholefraction
+ % Put the argument back for the \pickupwholefraction call, so
+ % we'll always have a period there to be parsed.
+ \def\go{\pickupwholefraction#1}%
+ \else
+ \let\go = \setuptable
+ \fi%
+ \fi
+ \go
+}
+
+% multitable-only commands.
+%
+% @headitem starts a heading row, which we typeset in bold. Assignments
+% have to be global since we are inside the implicit group of an
+% alignment entry. \everycr below resets \everytab so we don't have to
+% undo it ourselves.
+\def\headitemfont{\b}% for people to use in the template row; not changeable
+\def\headitem{%
+ \checkenv\multitable
+ \crcr
+ \gdef\headitemcrhook{\nobreak}% attempt to avoid page break after headings
+ \global\everytab={\bf}% can't use \headitemfont since the parsing differs
+ \the\everytab % for the first item
+}%
+%
+% default for tables with no headings.
+\let\headitemcrhook=\relax
+%
+% A \tab used to include \hskip1sp. But then the space in a template
+% line is not enough. That is bad. So let's go back to just `&' until
+% we again encounter the problem the 1sp was intended to solve.
+% --karl, nathan@acm.org, 20apr99.
+\def\tab{\checkenv\multitable &\the\everytab}%
+
+% @multitable ... @end multitable definitions:
+%
+\newtoks\everytab % insert after every tab.
+%
+\envdef\multitable{%
+ \vskip\parskip
+ \startsavinginserts
+ %
+ % @item within a multitable starts a normal row.
+ % We use \def instead of \let so that if one of the multitable entries
+ % contains an @itemize, we don't choke on the \item (seen as \crcr aka
+ % \endtemplate) expanding \doitemize.
+ \def\item{\crcr}%
+ %
+ \tolerance=9500
+ \hbadness=9500
+ \setmultitablespacing
+ \parskip=\multitableparskip
+ \parindent=\multitableparindent
+ \overfullrule=0pt
+ \global\colcount=0
+ %
+ \everycr = {%
+ \noalign{%
+ \global\everytab={}% Reset from possible headitem.
+ \global\colcount=0 % Reset the column counter.
+ %
+ % Check for saved footnotes, etc.:
+ \checkinserts
+ %
+ % Perhaps a \nobreak, then reset:
+ \headitemcrhook
+ \global\let\headitemcrhook=\relax
+ }%
+ }%
+ %
+ \parsearg\domultitable
+}
+\def\domultitable#1{%
+ % To parse everything between @multitable and @item:
+ \setuptable#1 \endsetuptable
+ %
+ % This preamble sets up a generic column definition, which will
+ % be used as many times as user calls for columns.
+ % \vtop will set a single line and will also let text wrap and
+ % continue for many paragraphs if desired.
+ \halign\bgroup &%
+ \global\advance\colcount by 1
+ \multistrut
+ \vtop{%
+ % Use the current \colcount to find the correct column width:
+ \hsize=\expandafter\csname col\the\colcount\endcsname
+ %
+ % In order to keep entries from bumping into each other
+ % we will add a \leftskip of \multitablecolspace to all columns after
+ % the first one.
+ %
+ % If a template has been used, we will add \multitablecolspace
+ % to the width of each template entry.
+ %
+ % If the user has set preamble in terms of percent of \hsize we will
+ % use that dimension as the width of the column, and the \leftskip
+ % will keep entries from bumping into each other. Table will start at
+ % left margin and final column will justify at right margin.
+ %
+ % Make sure we don't inherit \rightskip from the outer environment.
+ \rightskip=0pt
+ \ifnum\colcount=1
+ % The first column will be indented with the surrounding text.
+ \advance\hsize by\leftskip
+ \else
+ \ifsetpercent \else
+ % If user has not set preamble in terms of percent of \hsize
+ % we will advance \hsize by \multitablecolspace.
+ \advance\hsize by \multitablecolspace
+ \fi
+ % In either case we will make \leftskip=\multitablecolspace:
+ \leftskip=\multitablecolspace
+ \fi
+ % Ignoring space at the beginning and end avoids an occasional spurious
+ % blank line, when TeX decides to break the line at the space before the
+ % box from the multistrut, so the strut ends up on a line by itself.
+ % For example:
+ % @multitable @columnfractions .11 .89
+ % @item @code{#}
+ % @tab Legal holiday which is valid in major parts of the whole country.
+ % Is automatically provided with highlighting sequences respectively
+ % marking characters.
+ \noindent\ignorespaces##\unskip\multistrut
+ }\cr
+}
+\def\Emultitable{%
+ \crcr
+ \egroup % end the \halign
+ \global\setpercentfalse
+}
+
+\def\setmultitablespacing{%
+ \def\multistrut{\strut}% just use the standard line spacing
+ %
+ % Compute \multitablelinespace (if not defined by user) for use in
+ % \multitableparskip calculation. We used define \multistrut based on
+ % this, but (ironically) that caused the spacing to be off.
+ % See bug-texinfo report from Werner Lemberg, 31 Oct 2004 12:52:20 +0100.
+\ifdim\multitablelinespace=0pt
+\setbox0=\vbox{X}\global\multitablelinespace=\the\baselineskip
+\global\advance\multitablelinespace by-\ht0
+\fi
+% Test to see if parskip is larger than space between lines of
+% table. If not, do nothing.
+% If so, set to same dimension as multitablelinespace.
+\ifdim\multitableparskip>\multitablelinespace
+\global\multitableparskip=\multitablelinespace
+\global\advance\multitableparskip-7pt % to keep parskip somewhat smaller
+ % than skip between lines in the table.
+\fi%
+\ifdim\multitableparskip=0pt
+\global\multitableparskip=\multitablelinespace
+\global\advance\multitableparskip-7pt % to keep parskip somewhat smaller
+ % than skip between lines in the table.
+\fi}
+
+
+\message{conditionals,}
+
+% @iftex, @ifnotdocbook, @ifnothtml, @ifnotinfo, @ifnotplaintext,
+% @ifnotxml always succeed. They currently do nothing; we don't
+% attempt to check whether the conditionals are properly nested. But we
+% have to remember that they are conditionals, so that @end doesn't
+% attempt to close an environment group.
+%
+\def\makecond#1{%
+ \expandafter\let\csname #1\endcsname = \relax
+ \expandafter\let\csname iscond.#1\endcsname = 1
+}
+\makecond{iftex}
+\makecond{ifnotdocbook}
+\makecond{ifnothtml}
+\makecond{ifnotinfo}
+\makecond{ifnotplaintext}
+\makecond{ifnotxml}
+
+% Ignore @ignore, @ifhtml, @ifinfo, and the like.
+%
+\def\direntry{\doignore{direntry}}
+\def\documentdescription{\doignore{documentdescription}}
+\def\docbook{\doignore{docbook}}
+\def\html{\doignore{html}}
+\def\ifdocbook{\doignore{ifdocbook}}
+\def\ifhtml{\doignore{ifhtml}}
+\def\ifinfo{\doignore{ifinfo}}
+\def\ifnottex{\doignore{ifnottex}}
+\def\ifplaintext{\doignore{ifplaintext}}
+\def\ifxml{\doignore{ifxml}}
+\def\ignore{\doignore{ignore}}
+\def\menu{\doignore{menu}}
+\def\xml{\doignore{xml}}
+
+% Ignore text until a line `@end #1', keeping track of nested conditionals.
+%
+% A count to remember the depth of nesting.
+\newcount\doignorecount
+
+\def\doignore#1{\begingroup
+ % Scan in ``verbatim'' mode:
+ \obeylines
+ \catcode`\@ = \other
+ \catcode`\{ = \other
+ \catcode`\} = \other
+ %
+ % Make sure that spaces turn into tokens that match what \doignoretext wants.
+ \spaceisspace
+ %
+ % Count number of #1's that we've seen.
+ \doignorecount = 0
+ %
+ % Swallow text until we reach the matching `@end #1'.
+ \dodoignore{#1}%
+}
+
+{ \catcode`_=11 % We want to use \_STOP_ which cannot appear in texinfo source.
+ \obeylines %
+ %
+ \gdef\dodoignore#1{%
+ % #1 contains the command name as a string, e.g., `ifinfo'.
+ %
+ % Define a command to find the next `@end #1'.
+ \long\def\doignoretext##1^^M@end #1{%
+ \doignoretextyyy##1^^M@#1\_STOP_}%
+ %
+ % And this command to find another #1 command, at the beginning of a
+ % line. (Otherwise, we would consider a line `@c @ifset', for
+ % example, to count as an @ifset for nesting.)
+ \long\def\doignoretextyyy##1^^M@#1##2\_STOP_{\doignoreyyy{##2}\_STOP_}%
+ %
+ % And now expand that command.
+ \doignoretext ^^M%
+ }%
+}
+
+\def\doignoreyyy#1{%
+ \def\temp{#1}%
+ \ifx\temp\empty % Nothing found.
+ \let\next\doignoretextzzz
+ \else % Found a nested condition, ...
+ \advance\doignorecount by 1
+ \let\next\doignoretextyyy % ..., look for another.
+ % If we're here, #1 ends with ^^M\ifinfo (for example).
+ \fi
+ \next #1% the token \_STOP_ is present just after this macro.
+}
+
+% We have to swallow the remaining "\_STOP_".
+%
+\def\doignoretextzzz#1{%
+ \ifnum\doignorecount = 0 % We have just found the outermost @end.
+ \let\next\enddoignore
+ \else % Still inside a nested condition.
+ \advance\doignorecount by -1
+ \let\next\doignoretext % Look for the next @end.
+ \fi
+ \next
+}
+
+% Finish off ignored text.
+{ \obeylines%
+ % Ignore anything after the last `@end #1'; this matters in verbatim
+ % environments, where otherwise the newline after an ignored conditional
+ % would result in a blank line in the output.
+ \gdef\enddoignore#1^^M{\endgroup\ignorespaces}%
+}
+
+
+% @set VAR sets the variable VAR to an empty value.
+% @set VAR REST-OF-LINE sets VAR to the value REST-OF-LINE.
+%
+% Since we want to separate VAR from REST-OF-LINE (which might be
+% empty), we can't just use \parsearg; we have to insert a space of our
+% own to delimit the rest of the line, and then take it out again if we
+% didn't need it.
+% We rely on the fact that \parsearg sets \catcode`\ =10.
+%
+\parseargdef\set{\setyyy#1 \endsetyyy}
+\def\setyyy#1 #2\endsetyyy{%
+ {%
+ \makevalueexpandable
+ \def\temp{#2}%
+ \edef\next{\gdef\makecsname{SET#1}}%
+ \ifx\temp\empty
+ \next{}%
+ \else
+ \setzzz#2\endsetzzz
+ \fi
+ }%
+}
+% Remove the trailing space \setxxx inserted.
+\def\setzzz#1 \endsetzzz{\next{#1}}
+
+% @clear VAR clears (i.e., unsets) the variable VAR.
+%
+\parseargdef\clear{%
+ {%
+ \makevalueexpandable
+ \global\expandafter\let\csname SET#1\endcsname=\relax
+ }%
+}
+
+% @value{foo} gets the text saved in variable foo.
+\def\value{\begingroup\makevalueexpandable\valuexxx}
+\def\valuexxx#1{\expandablevalue{#1}\endgroup}
+{
+ \catcode`\-=\active \catcode`\_=\active
+ %
+ \gdef\makevalueexpandable{%
+ \let\value = \expandablevalue
+ % We don't want these characters active, ...
+ \catcode`\-=\other \catcode`\_=\other
+ % ..., but we might end up with active ones in the argument if
+ % we're called from @code, as @code{@value{foo-bar_}}, though.
+ % So \let them to their normal equivalents.
+ \let-\normaldash \let_\normalunderscore
+ }
+}
+
+\def\expandablevalue#1{%
+ \expandafter\ifx\csname SET#1\endcsname\relax
+ {[No value for ``#1'']}%
+ \message{Variable `#1', used in @value, is not set.}%
+ \else
+ \csname SET#1\endcsname
+ \fi
+}
+
+% Like \expandablevalue, but completely expandable (the \message in the
+% definition above operates at the execution level of TeX). Used when
+% writing to auxiliary files, due to the expansion that \write does.
+% If flag is undefined, pass through an unexpanded @value command: maybe it
+% will be set by the time it is read back in.
+%
+% NB flag names containing - or _ may not work here.
+\def\dummyvalue#1{%
+ \expandafter\ifx\csname SET#1\endcsname\relax
+ \string\value{#1}%
+ \else
+ \csname SET#1\endcsname
+ \fi
+}
+
+% Used for @value's in index entries to form the sort key: expand the @value
+% if possible, otherwise sort late.
+\def\indexnofontsvalue#1{%
+ \expandafter\ifx\csname SET#1\endcsname\relax
+ ZZZZZZZ%
+ \else
+ \csname SET#1\endcsname
+ \fi
+}
+
+% @ifset VAR ... @end ifset reads the `...' iff VAR has been defined
+% with @set.
+%
+% To get the special treatment we need for `@end ifset,' we call
+% \makecond and then redefine.
+%
+\makecond{ifset}
+\def\ifset{\parsearg{\doifset{\let\next=\ifsetfail}}}
+\def\doifset#1#2{%
+ {%
+ \makevalueexpandable
+ \let\next=\empty
+ \expandafter\ifx\csname SET#2\endcsname\relax
+ #1% If not set, redefine \next.
+ \fi
+ \expandafter
+ }\next
+}
+\def\ifsetfail{\doignore{ifset}}
+
+% @ifclear VAR ... @end executes the `...' iff VAR has never been
+% defined with @set, or has been undefined with @clear.
+%
+% The `\else' inside the `\doifset' parameter is a trick to reuse the
+% above code: if the variable is not set, do nothing, if it is set,
+% then redefine \next to \ifclearfail.
+%
+\makecond{ifclear}
+\def\ifclear{\parsearg{\doifset{\else \let\next=\ifclearfail}}}
+\def\ifclearfail{\doignore{ifclear}}
+
+% @ifcommandisdefined CMD ... @end executes the `...' if CMD (written
+% without the @) is in fact defined. We can only feasibly check at the
+% TeX level, so something like `mathcode' is going to considered
+% defined even though it is not a Texinfo command.
+%
+\makecond{ifcommanddefined}
+\def\ifcommanddefined{\parsearg{\doifcmddefined{\let\next=\ifcmddefinedfail}}}
+%
+\def\doifcmddefined#1#2{{%
+ \makevalueexpandable
+ \let\next=\empty
+ \expandafter\ifx\csname #2\endcsname\relax
+ #1% If not defined, \let\next as above.
+ \fi
+ \expandafter
+ }\next
+}
+\def\ifcmddefinedfail{\doignore{ifcommanddefined}}
+
+% @ifcommandnotdefined CMD ... handled similar to @ifclear above.
+\makecond{ifcommandnotdefined}
+\def\ifcommandnotdefined{%
+ \parsearg{\doifcmddefined{\else \let\next=\ifcmdnotdefinedfail}}}
+\def\ifcmdnotdefinedfail{\doignore{ifcommandnotdefined}}
+
+% Set the `txicommandconditionals' variable, so documents have a way to
+% test if the @ifcommand...defined conditionals are available.
+\set txicommandconditionals
+
+% @dircategory CATEGORY -- specify a category of the dir file
+% which this file should belong to. Ignore this in TeX.
+\let\dircategory=\comment
+
+% @defininfoenclose.
+\let\definfoenclose=\comment
+
+
+\message{indexing,}
+% Index generation facilities
+
+% Define \newwrite to be identical to plain tex's \newwrite
+% except not \outer, so it can be used within macros and \if's.
+\edef\newwrite{\makecsname{ptexnewwrite}}
+
+% \newindex {foo} defines an index named IX.
+% It automatically defines \IXindex such that
+% \IXindex ...rest of line... puts an entry in the index IX.
+% It also defines \IXindfile to be the number of the output channel for
+% the file that accumulates this index. The file's extension is IX.
+% The name of an index should be no more than 2 characters long
+% for the sake of vms.
+%
+\def\newindex#1{%
+ \expandafter\chardef\csname#1indfile\endcsname=0
+ \expandafter\xdef\csname#1index\endcsname{% % Define @#1index
+ \noexpand\doindex{#1}}
+}
+
+% @defindex foo == \newindex{foo}
+%
+\def\defindex{\parsearg\newindex}
+
+% Define @defcodeindex, like @defindex except put all entries in @code.
+%
+\def\defcodeindex{\parsearg\newcodeindex}
+%
+\def\newcodeindex#1{%
+ \expandafter\chardef\csname#1indfile\endcsname=0
+ \expandafter\xdef\csname#1index\endcsname{%
+ \noexpand\docodeindex{#1}}%
+}
+
+% The default indices:
+\newindex{cp}% concepts,
+\newcodeindex{fn}% functions,
+\newcodeindex{vr}% variables,
+\newcodeindex{tp}% types,
+\newcodeindex{ky}% keys
+\newcodeindex{pg}% and programs.
+
+
+% @synindex foo bar makes index foo feed into index bar.
+% Do this instead of @defindex foo if you don't want it as a separate index.
+%
+% @syncodeindex foo bar similar, but put all entries made for index foo
+% inside @code.
+%
+\def\synindex#1 #2 {\dosynindex\doindex{#1}{#2}}
+\def\syncodeindex#1 #2 {\dosynindex\docodeindex{#1}{#2}}
+
+% #1 is \doindex or \docodeindex, #2 the index getting redefined (foo),
+% #3 the target index (bar).
+\def\dosynindex#1#2#3{%
+ \requireopenindexfile{#3}%
+ % redefine \fooindfile:
+ \expandafter\let\expandafter\temp\expandafter=\csname#3indfile\endcsname
+ \expandafter\let\csname#2indfile\endcsname=\temp
+ % redefine \fooindex:
+ \expandafter\xdef\csname#2index\endcsname{\noexpand#1{#3}}%
+}
+
+% Define \doindex, the driver for all index macros.
+% Argument #1 is generated by the calling \fooindex macro,
+% and it is the two-letter name of the index.
+
+\def\doindex#1{\edef\indexname{#1}\parsearg\doindexxxx}
+\def\doindexxxx #1{\doind{\indexname}{#1}}
+
+% like the previous two, but they put @code around the argument.
+\def\docodeindex#1{\edef\indexname{#1}\parsearg\docodeindexxxx}
+\def\docodeindexxxx #1{\doind{\indexname}{\code{#1}}}
+
+
+% Used for the aux, toc and index files to prevent expansion of Texinfo
+% commands.
+%
+\def\atdummies{%
+ \definedummyletter\@%
+ \definedummyletter\ %
+ \definedummyletter\{%
+ \definedummyletter\}%
+ \definedummyletter\&%
+ %
+ % Do the redefinitions.
+ \definedummies
+ \otherbackslash
+}
+
+% \definedummyword defines \#1 as \string\#1\space, thus effectively
+% preventing its expansion. This is used only for control words,
+% not control letters, because the \space would be incorrect for
+% control characters, but is needed to separate the control word
+% from whatever follows.
+%
+% These can be used both for control words that take an argument and
+% those that do not. If it is followed by {arg} in the input, then
+% that will dutifully get written to the index (or wherever).
+%
+% For control letters, we have \definedummyletter, which omits the
+% space.
+%
+\def\definedummyword #1{\def#1{\string#1\space}}%
+\def\definedummyletter#1{\def#1{\string#1}}%
+\let\definedummyaccent\definedummyletter
+
+% Called from \atdummies to prevent the expansion of commands.
+%
+\def\definedummies{%
+ %
+ \let\commondummyword\definedummyword
+ \let\commondummyletter\definedummyletter
+ \let\commondummyaccent\definedummyaccent
+ \commondummiesnofonts
+ %
+ \definedummyletter\_%
+ \definedummyletter\-%
+ %
+ % Non-English letters.
+ \definedummyword\AA
+ \definedummyword\AE
+ \definedummyword\DH
+ \definedummyword\L
+ \definedummyword\O
+ \definedummyword\OE
+ \definedummyword\TH
+ \definedummyword\aa
+ \definedummyword\ae
+ \definedummyword\dh
+ \definedummyword\exclamdown
+ \definedummyword\l
+ \definedummyword\o
+ \definedummyword\oe
+ \definedummyword\ordf
+ \definedummyword\ordm
+ \definedummyword\questiondown
+ \definedummyword\ss
+ \definedummyword\th
+ %
+ % Although these internal commands shouldn't show up, sometimes they do.
+ \definedummyword\bf
+ \definedummyword\gtr
+ \definedummyword\hat
+ \definedummyword\less
+ \definedummyword\sf
+ \definedummyword\sl
+ \definedummyword\tclose
+ \definedummyword\tt
+ %
+ \definedummyword\LaTeX
+ \definedummyword\TeX
+ %
+ % Assorted special characters.
+ \definedummyword\ampchar
+ \definedummyword\atchar
+ \definedummyword\arrow
+ \definedummyword\backslashchar
+ \definedummyword\bullet
+ \definedummyword\comma
+ \definedummyword\copyright
+ \definedummyword\registeredsymbol
+ \definedummyword\dots
+ \definedummyword\enddots
+ \definedummyword\entrybreak
+ \definedummyword\equiv
+ \definedummyword\error
+ \definedummyword\euro
+ \definedummyword\expansion
+ \definedummyword\geq
+ \definedummyword\guillemetleft
+ \definedummyword\guillemetright
+ \definedummyword\guilsinglleft
+ \definedummyword\guilsinglright
+ \definedummyword\lbracechar
+ \definedummyword\leq
+ \definedummyword\mathopsup
+ \definedummyword\minus
+ \definedummyword\ogonek
+ \definedummyword\pounds
+ \definedummyword\point
+ \definedummyword\print
+ \definedummyword\quotedblbase
+ \definedummyword\quotedblleft
+ \definedummyword\quotedblright
+ \definedummyword\quoteleft
+ \definedummyword\quoteright
+ \definedummyword\quotesinglbase
+ \definedummyword\rbracechar
+ \definedummyword\result
+ \definedummyword\sub
+ \definedummyword\sup
+ \definedummyword\textdegree
+ %
+ \definedummyword\subentry
+ %
+ % We want to disable all macros so that they are not expanded by \write.
+ \macrolist
+ \let\value\dummyvalue
+ %
+ \normalturnoffactive
+}
+
+% \commondummiesnofonts: common to \definedummies and \indexnofonts.
+% Define \commondummyletter, \commondummyaccent and \commondummyword before
+% using. Used for accents, font commands, and various control letters.
+%
+\def\commondummiesnofonts{%
+ % Control letters and accents.
+ \commondummyletter\!%
+ \commondummyaccent\"%
+ \commondummyaccent\'%
+ \commondummyletter\*%
+ \commondummyaccent\,%
+ \commondummyletter\.%
+ \commondummyletter\/%
+ \commondummyletter\:%
+ \commondummyaccent\=%
+ \commondummyletter\?%
+ \commondummyaccent\^%
+ \commondummyaccent\`%
+ \commondummyaccent\~%
+ \commondummyword\u
+ \commondummyword\v
+ \commondummyword\H
+ \commondummyword\dotaccent
+ \commondummyword\ogonek
+ \commondummyword\ringaccent
+ \commondummyword\tieaccent
+ \commondummyword\ubaraccent
+ \commondummyword\udotaccent
+ \commondummyword\dotless
+ %
+ % Texinfo font commands.
+ \commondummyword\b
+ \commondummyword\i
+ \commondummyword\r
+ \commondummyword\sansserif
+ \commondummyword\sc
+ \commondummyword\slanted
+ \commondummyword\t
+ %
+ % Commands that take arguments.
+ \commondummyword\abbr
+ \commondummyword\acronym
+ \commondummyword\anchor
+ \commondummyword\cite
+ \commondummyword\code
+ \commondummyword\command
+ \commondummyword\dfn
+ \commondummyword\dmn
+ \commondummyword\email
+ \commondummyword\emph
+ \commondummyword\env
+ \commondummyword\file
+ \commondummyword\image
+ \commondummyword\indicateurl
+ \commondummyword\inforef
+ \commondummyword\kbd
+ \commondummyword\key
+ \commondummyword\math
+ \commondummyword\option
+ \commondummyword\pxref
+ \commondummyword\ref
+ \commondummyword\samp
+ \commondummyword\strong
+ \commondummyword\tie
+ \commondummyword\U
+ \commondummyword\uref
+ \commondummyword\url
+ \commondummyword\var
+ \commondummyword\verb
+ \commondummyword\w
+ \commondummyword\xref
+}
+
+\let\indexlbrace\relax
+\let\indexrbrace\relax
+\let\indexatchar\relax
+\let\indexbackslash\relax
+
+{\catcode`\@=0
+\catcode`\\=13
+ @gdef@backslashdisappear{@def\{}}
+}
+
+{
+\catcode`\<=13
+\catcode`\-=13
+\catcode`\`=13
+ \gdef\indexnonalnumdisappear{%
+ \expandafter\ifx\csname SETtxiindexlquoteignore\endcsname\relax\else
+ % @set txiindexlquoteignore makes us ignore left quotes in the sort term.
+ % (Introduced for FSFS 2nd ed.)
+ \let`=\empty
+ \fi
+ %
+ \expandafter\ifx\csname SETtxiindexbackslashignore\endcsname\relax\else
+ \backslashdisappear
+ \fi
+ %
+ \expandafter\ifx\csname SETtxiindexhyphenignore\endcsname\relax\else
+ \def-{}%
+ \fi
+ \expandafter\ifx\csname SETtxiindexlessthanignore\endcsname\relax\else
+ \def<{}%
+ \fi
+ \expandafter\ifx\csname SETtxiindexatsignignore\endcsname\relax\else
+ \def\@{}%
+ \fi
+ }
+
+ \gdef\indexnonalnumreappear{%
+ \let-\normaldash
+ \let<\normalless
+ }
+}
+
+
+% \indexnofonts is used when outputting the strings to sort the index
+% by, and when constructing control sequence names. It eliminates all
+% control sequences and just writes whatever the best ASCII sort string
+% would be for a given command (usually its argument).
+%
+\def\indexnofonts{%
+ % Accent commands should become @asis.
+ \def\commondummyaccent##1{\let##1\asis}%
+ % We can just ignore other control letters.
+ \def\commondummyletter##1{\let##1\empty}%
+ % All control words become @asis by default; overrides below.
+ \let\commondummyword\commondummyaccent
+ \commondummiesnofonts
+ %
+ % Don't no-op \tt, since it isn't a user-level command
+ % and is used in the definitions of the active chars like <, >, |, etc.
+ % Likewise with the other plain tex font commands.
+ %\let\tt=\asis
+ %
+ \def\ { }%
+ \def\@{@}%
+ \def\_{\normalunderscore}%
+ \def\-{}% @- shouldn't affect sorting
+ %
+ \uccode`\1=`\{ \uppercase{\def\{{1}}%
+ \uccode`\1=`\} \uppercase{\def\}{1}}%
+ \let\lbracechar\{%
+ \let\rbracechar\}%
+ %
+ % Non-English letters.
+ \def\AA{AA}%
+ \def\AE{AE}%
+ \def\DH{DZZ}%
+ \def\L{L}%
+ \def\OE{OE}%
+ \def\O{O}%
+ \def\TH{TH}%
+ \def\aa{aa}%
+ \def\ae{ae}%
+ \def\dh{dzz}%
+ \def\exclamdown{!}%
+ \def\l{l}%
+ \def\oe{oe}%
+ \def\ordf{a}%
+ \def\ordm{o}%
+ \def\o{o}%
+ \def\questiondown{?}%
+ \def\ss{ss}%
+ \def\th{th}%
+ %
+ \def\LaTeX{LaTeX}%
+ \def\TeX{TeX}%
+ %
+ % Assorted special characters. \defglyph gives the control sequence a
+ % definition that removes the {} that follows its use.
+ \defglyph\atchar{@}%
+ \defglyph\arrow{->}%
+ \defglyph\bullet{bullet}%
+ \defglyph\comma{,}%
+ \defglyph\copyright{copyright}%
+ \defglyph\dots{...}%
+ \defglyph\enddots{...}%
+ \defglyph\equiv{==}%
+ \defglyph\error{error}%
+ \defglyph\euro{euro}%
+ \defglyph\expansion{==>}%
+ \defglyph\geq{>=}%
+ \defglyph\guillemetleft{<<}%
+ \defglyph\guillemetright{>>}%
+ \defglyph\guilsinglleft{<}%
+ \defglyph\guilsinglright{>}%
+ \defglyph\leq{<=}%
+ \defglyph\lbracechar{\{}%
+ \defglyph\minus{-}%
+ \defglyph\point{.}%
+ \defglyph\pounds{pounds}%
+ \defglyph\print{-|}%
+ \defglyph\quotedblbase{"}%
+ \defglyph\quotedblleft{"}%
+ \defglyph\quotedblright{"}%
+ \defglyph\quoteleft{`}%
+ \defglyph\quoteright{'}%
+ \defglyph\quotesinglbase{,}%
+ \defglyph\rbracechar{\}}%
+ \defglyph\registeredsymbol{R}%
+ \defglyph\result{=>}%
+ \defglyph\textdegree{o}%
+ %
+ % We need to get rid of all macros, leaving only the arguments (if present).
+ % Of course this is not nearly correct, but it is the best we can do for now.
+ % makeinfo does not expand macros in the argument to @deffn, which ends up
+ % writing an index entry, and texindex isn't prepared for an index sort entry
+ % that starts with \.
+ %
+ % Since macro invocations are followed by braces, we can just redefine them
+ % to take a single TeX argument. The case of a macro invocation that
+ % goes to end-of-line is not handled.
+ %
+ \macrolist
+ \let\value\indexnofontsvalue
+}
+\def\defglyph#1#2{\def#1##1{#2}} % see above
+
+
+
+
+% #1 is the index name, #2 is the entry text.
+\def\doind#1#2{%
+ \iflinks
+ {%
+ %
+ \requireopenindexfile{#1}%
+ \edef\writeto{\csname#1indfile\endcsname}%
+ %
+ \def\indextext{#2}%
+ \safewhatsit\doindwrite
+ }%
+ \fi
+}
+
+% Check if an index file has been opened, and if not, open it.
+\def\requireopenindexfile#1{%
+\ifnum\csname #1indfile\endcsname=0
+ \expandafter\newwrite \csname#1indfile\endcsname
+ \edef\suffix{#1}%
+ % A .fls suffix would conflict with the file extension for the output
+ % of -recorder, so use .f1s instead.
+ \ifx\suffix\indexisfl\def\suffix{f1}\fi
+ % Open the file
+ \immediate\openout\csname#1indfile\endcsname \jobname.\suffix
+ % Using \immediate above here prevents an object entering into the current
+ % box, which could confound checks such as those in \safewhatsit for
+ % preceding skips.
+ \typeout{Writing index file \jobname.\suffix}%
+\fi}
+\def\indexisfl{fl}
+
+% Definition for writing index entry sort key.
+{
+\catcode`\-=13
+\gdef\indexwritesortas{%
+ \begingroup
+ \indexnonalnumreappear
+ \indexwritesortasxxx}
+\gdef\indexwritesortasxxx#1{%
+ \xdef\indexsortkey{#1}\endgroup}
+}
+
+\def\indexwriteseealso#1{
+ \gdef\pagenumbertext{\string\seealso{#1}}%
+}
+\def\indexwriteseeentry#1{
+ \gdef\pagenumbertext{\string\seeentry{#1}}%
+}
+
+% The default definitions
+\def\sortas#1{}%
+\def\seealso#1{\i{\putwordSeeAlso}\ #1}% for sorted index file only
+\def\putwordSeeAlso{See also}
+\def\seeentry#1{\i{\putwordSee}\ #1}% for sorted index file only
+
+
+% Given index entry text like "aaa @subentry bbb @sortas{ZZZ}":
+% * Set \bracedtext to "{aaa}{bbb}"
+% * Set \fullindexsortkey to "aaa @subentry ZZZ"
+% * If @seealso occurs, set \pagenumbertext
+%
+\def\splitindexentry#1{%
+ \gdef\fullindexsortkey{}%
+ \xdef\bracedtext{}%
+ \def\sep{}%
+ \def\seealso##1{}%
+ \def\seeentry##1{}%
+ \expandafter\doindexsegment#1\subentry\finish\subentry
+}
+
+% append the results from the next segment
+\def\doindexsegment#1\subentry{%
+ \def\segment{#1}%
+ \ifx\segment\isfinish
+ \else
+ %
+ % Fully expand the segment, throwing away any @sortas directives, and
+ % trim spaces.
+ \edef\trimmed{\segment}%
+ \edef\trimmed{\expandafter\eatspaces\expandafter{\trimmed}}%
+ %
+ \xdef\bracedtext{\bracedtext{\trimmed}}%
+ %
+ % Get the string to sort by. Process the segment with all
+ % font commands turned off.
+ \bgroup
+ \let\sortas\indexwritesortas
+ \let\seealso\indexwriteseealso
+ \let\seeentry\indexwriteseeentry
+ \indexnofonts
+ % The braces around the commands are recognized by texindex.
+ \def\lbracechar{{\string\indexlbrace}}%
+ \def\rbracechar{{\string\indexrbrace}}%
+ \let\{=\lbracechar
+ \let\}=\rbracechar
+ \def\@{{\string\indexatchar}}%
+ \def\atchar##1{\@}%
+ \def\backslashchar{{\string\indexbackslash}}%
+ \uccode`\~=`\\ \uppercase{\let~\backslashchar}%
+ %
+ \let\indexsortkey\empty
+ \global\let\pagenumbertext\empty
+ % Execute the segment and throw away the typeset output. This executes
+ % any @sortas or @seealso commands in this segment.
+ \setbox\dummybox = \hbox{\segment}%
+ \ifx\indexsortkey\empty{%
+ \indexnonalnumdisappear
+ \xdef\trimmed{\segment}%
+ \xdef\trimmed{\expandafter\eatspaces\expandafter{\trimmed}}%
+ \xdef\indexsortkey{\trimmed}%
+ \ifx\indexsortkey\empty\xdef\indexsortkey{ }\fi
+ }\fi
+ %
+ % Append to \fullindexsortkey.
+ \edef\tmp{\gdef\noexpand\fullindexsortkey{%
+ \fullindexsortkey\sep\indexsortkey}}%
+ \tmp
+ \egroup
+ \def\sep{\subentry}%
+ %
+ \expandafter\doindexsegment
+ \fi
+}
+\def\isfinish{\finish}%
+\newbox\dummybox % used above
+
+\let\subentry\relax
+
+% Use \ instead of @ in index files. To support old texi2dvi and texindex.
+% This works without changing the escape character used in the toc or aux
+% files because the index entries are fully expanded here, and \string uses
+% the current value of \escapechar.
+\def\escapeisbackslash{\escapechar=`\\}
+
+% Use \ in index files by default. texi2dvi didn't support @ as the escape
+% character (as it checked for "\entry" in the files, and not "@entry"). When
+% the new version of texi2dvi has had a chance to become more prevalent, then
+% the escape character can change back to @ again. This should be an easy
+% change to make now because both @ and \ are only used as escape characters in
+% index files, never standing for themselves.
+%
+\set txiindexescapeisbackslash
+
+% Write the entry in \indextext to the index file.
+%
+\def\doindwrite{%
+ \maybemarginindex
+ %
+ \atdummies
+ %
+ \expandafter\ifx\csname SETtxiindexescapeisbackslash\endcsname\relax\else
+ \escapeisbackslash
+ \fi
+ %
+ % For texindex which always views { and } as separators.
+ \def\{{\lbracechar{}}%
+ \def\}{\rbracechar{}}%
+ \uccode`\~=`\\ \uppercase{\def~{\backslashchar{}}}%
+ %
+ % Split the entry into primary entry and any subentries, and get the index
+ % sort key.
+ \splitindexentry\indextext
+ %
+ % Set up the complete index entry, with both the sort key and
+ % the original text, including any font commands. We write
+ % three arguments to \entry to the .?? file (four in the
+ % subentry case), texindex reduces to two when writing the .??s
+ % sorted result.
+ %
+ \edef\temp{%
+ \write\writeto{%
+ \string\entry{\fullindexsortkey}%
+ {\ifx\pagenumbertext\empty\noexpand\folio\else\pagenumbertext\fi}%
+ \bracedtext}%
+ }%
+ \temp
+}
+
+% Put the index entry in the margin if desired (undocumented).
+\def\maybemarginindex{%
+ \ifx\SETmarginindex\relax\else
+ \insert\margin{\hbox{\vrule height8pt depth3pt width0pt \relax\indextext}}%
+ \fi
+}
+\let\SETmarginindex=\relax
+
+
+% Take care of unwanted page breaks/skips around a whatsit:
+%
+% If a skip is the last thing on the list now, preserve it
+% by backing up by \lastskip, doing the \write, then inserting
+% the skip again. Otherwise, the whatsit generated by the
+% \write or \pdfdest will make \lastskip zero. The result is that
+% sequences like this:
+% @end defun
+% @tindex whatever
+% @defun ...
+% will have extra space inserted, because the \medbreak in the
+% start of the @defun won't see the skip inserted by the @end of
+% the previous defun.
+%
+% But don't do any of this if we're not in vertical mode. We
+% don't want to do a \vskip and prematurely end a paragraph.
+%
+% Avoid page breaks due to these extra skips, too.
+%
+% But wait, there is a catch there:
+% We'll have to check whether \lastskip is zero skip. \ifdim is not
+% sufficient for this purpose, as it ignores stretch and shrink parts
+% of the skip. The only way seems to be to check the textual
+% representation of the skip.
+%
+% The following is almost like \def\zeroskipmacro{0.0pt} except that
+% the ``p'' and ``t'' characters have catcode \other, not 11 (letter).
+%
+\edef\zeroskipmacro{\expandafter\the\csname z@skip\endcsname}
+%
+\newskip\whatsitskip
+\newcount\whatsitpenalty
+%
+% ..., ready, GO:
+%
+\def\safewhatsit#1{\ifhmode
+ #1%
+ \else
+ % \lastskip and \lastpenalty cannot both be nonzero simultaneously.
+ \whatsitskip = \lastskip
+ \edef\lastskipmacro{\the\lastskip}%
+ \whatsitpenalty = \lastpenalty
+ %
+ % If \lastskip is nonzero, that means the last item was a
+ % skip. And since a skip is discardable, that means this
+ % -\whatsitskip glue we're inserting is preceded by a
+ % non-discardable item, therefore it is not a potential
+ % breakpoint, therefore no \nobreak needed.
+ \ifx\lastskipmacro\zeroskipmacro
+ \else
+ \vskip-\whatsitskip
+ \fi
+ %
+ #1%
+ %
+ \ifx\lastskipmacro\zeroskipmacro
+ % If \lastskip was zero, perhaps the last item was a penalty, and
+ % perhaps it was >=10000, e.g., a \nobreak. In that case, we want
+ % to re-insert the same penalty (values >10000 are used for various
+ % signals); since we just inserted a non-discardable item, any
+ % following glue (such as a \parskip) would be a breakpoint. For example:
+ % @deffn deffn-whatever
+ % @vindex index-whatever
+ % Description.
+ % would allow a break between the index-whatever whatsit
+ % and the "Description." paragraph.
+ \ifnum\whatsitpenalty>9999 \penalty\whatsitpenalty \fi
+ \else
+ % On the other hand, if we had a nonzero \lastskip,
+ % this make-up glue would be preceded by a non-discardable item
+ % (the whatsit from the \write), so we must insert a \nobreak.
+ \nobreak\vskip\whatsitskip
+ \fi
+\fi}
+
+% The index entry written in the file actually looks like
+% \entry {sortstring}{page}{topic}
+% or
+% \entry {sortstring}{page}{topic}{subtopic}
+% The texindex program reads in these files and writes files
+% containing these kinds of lines:
+% \initial {c}
+% before the first topic whose initial is c
+% \entry {topic}{pagelist}
+% for a topic that is used without subtopics
+% \primary {topic}
+% \entry {topic}{}
+% for the beginning of a topic that is used with subtopics
+% \secondary {subtopic}{pagelist}
+% for each subtopic.
+% \secondary {subtopic}{}
+% for a subtopic with sub-subtopics
+% \tertiary {subtopic}{subsubtopic}{pagelist}
+% for each sub-subtopic.
+
+% Define the user-accessible indexing commands
+% @findex, @vindex, @kindex, @cindex.
+
+\def\findex {\fnindex}
+\def\kindex {\kyindex}
+\def\cindex {\cpindex}
+\def\vindex {\vrindex}
+\def\tindex {\tpindex}
+\def\pindex {\pgindex}
+
+% Define the macros used in formatting output of the sorted index material.
+
+% @printindex causes a particular index (the ??s file) to get printed.
+% It does not print any chapter heading (usually an @unnumbered).
+%
+\parseargdef\printindex{\begingroup
+ \dobreak \chapheadingskip{10000}%
+ %
+ \smallfonts \rm
+ \tolerance = 9500
+ \plainfrenchspacing
+ \everypar = {}% don't want the \kern\-parindent from indentation suppression.
+ %
+ % See comment in \requireopenindexfile.
+ \def\indexname{#1}\ifx\indexname\indexisfl\def\indexname{f1}\fi
+ %
+ % See if the index file exists and is nonempty.
+ \openin 1 \jobname.\indexname s
+ \ifeof 1
+ % \enddoublecolumns gets confused if there is no text in the index,
+ % and it loses the chapter title and the aux file entries for the
+ % index. The easiest way to prevent this problem is to make sure
+ % there is some text.
+ \putwordIndexNonexistent
+ \typeout{No file \jobname.\indexname s.}%
+ \else
+ % If the index file exists but is empty, then \openin leaves \ifeof
+ % false. We have to make TeX try to read something from the file, so
+ % it can discover if there is anything in it.
+ \read 1 to \thisline
+ \ifeof 1
+ \putwordIndexIsEmpty
+ \else
+ \expandafter\printindexzz\thisline\relax\relax\finish%
+ \fi
+ \fi
+ \closein 1
+\endgroup}
+
+% If the index file starts with a backslash, forgo reading the index
+% file altogether. If somebody upgrades texinfo.tex they may still have
+% old index files using \ as the escape character. Reading this would
+% at best lead to typesetting garbage, at worst a TeX syntax error.
+\def\printindexzz#1#2\finish{%
+ \expandafter\ifx\csname SETtxiindexescapeisbackslash\endcsname\relax
+ \uccode`\~=`\\ \uppercase{\if\noexpand~}\noexpand#1
+ \expandafter\ifx\csname SETtxiskipindexfileswithbackslash\endcsname\relax
+\errmessage{%
+ERROR: A sorted index file in an obsolete format was skipped.
+To fix this problem, please upgrade your version of 'texi2dvi'
+or 'texi2pdf' to that at .
+If you are using an old version of 'texindex' (part of the Texinfo
+distribution), you may also need to upgrade to a newer version (at least 6.0).
+You may be able to typeset the index if you run
+'texindex \jobname.\indexname' yourself.
+You could also try setting the 'txiindexescapeisbackslash' flag by
+running a command like
+'texi2dvi -t "@set txiindexescapeisbackslash" \jobname.texi'. If you do
+this, Texinfo will try to use index files in the old format.
+If you continue to have problems, deleting the index files and starting again
+might help (with 'rm \jobname.?? \jobname.??s')%
+}%
+ \else
+ (Skipped sorted index file in obsolete format)
+ \fi
+ \else
+ \begindoublecolumns
+ \input \jobname.\indexname s
+ \enddoublecolumns
+ \fi
+ \else
+ \begindoublecolumns
+ \catcode`\\=0\relax
+ \catcode`\@=12\relax
+ \input \jobname.\indexname s
+ \enddoublecolumns
+ \fi
+}
+
+% These macros are used by the sorted index file itself.
+% Change them to control the appearance of the index.
+
+{\catcode`\/=13 \catcode`\-=13 \catcode`\^=13 \catcode`\~=13 \catcode`\_=13
+\catcode`\|=13 \catcode`\<=13 \catcode`\>=13 \catcode`\+=13 \catcode`\"=13
+\catcode`\$=3
+\gdef\initialglyphs{%
+ % special control sequences used in the index sort key
+ \let\indexlbrace\{%
+ \let\indexrbrace\}%
+ \let\indexatchar\@%
+ \def\indexbackslash{\math{\backslash}}%
+ %
+ % Some changes for non-alphabetic characters. Using the glyphs from the
+ % math fonts looks more consistent than the typewriter font used elsewhere
+ % for these characters.
+ \uccode`\~=`\\ \uppercase{\def~{\math{\backslash}}}
+ %
+ % In case @\ is used for backslash
+ \uppercase{\let\\=~}
+ % Can't get bold backslash so don't use bold forward slash
+ \catcode`\/=13
+ \def/{{\secrmnotbold \normalslash}}%
+ \def-{{\normaldash\normaldash}}% en dash `--'
+ \def^{{\chapbf \normalcaret}}%
+ \def~{{\chapbf \normaltilde}}%
+ \def\_{%
+ \leavevmode \kern.07em \vbox{\hrule width.3em height.1ex}\kern .07em }%
+ \def|{$\vert$}%
+ \def<{$\less$}%
+ \def>{$\gtr$}%
+ \def+{$\normalplus$}%
+}}
+
+\def\initial{%
+ \bgroup
+ \initialglyphs
+ \initialx
+}
+
+\def\initialx#1{%
+ % Remove any glue we may have, we'll be inserting our own.
+ \removelastskip
+ %
+ % We like breaks before the index initials, so insert a bonus.
+ % The glue before the bonus allows a little bit of space at the
+ % bottom of a column to reduce an increase in inter-line spacing.
+ \nobreak
+ \vskip 0pt plus 5\baselineskip
+ \penalty -300
+ \vskip 0pt plus -5\baselineskip
+ %
+ % Typeset the initial. Making this add up to a whole number of
+ % baselineskips increases the chance of the dots lining up from column
+ % to column. It still won't often be perfect, because of the stretch
+ % we need before each entry, but it's better.
+ %
+ % No shrink because it confuses \balancecolumns.
+ \vskip 1.67\baselineskip plus 1\baselineskip
+ \leftline{\secfonts \kern-0.05em \secbf #1}%
+ % \secfonts is inside the argument of \leftline so that the change of
+ % \baselineskip will not affect any glue inserted before the vbox that
+ % \leftline creates.
+ % Do our best not to break after the initial.
+ \nobreak
+ \vskip .33\baselineskip plus .1\baselineskip
+ \egroup % \initialglyphs
+}
+
+\newdimen\entryrightmargin
+\entryrightmargin=0pt
+
+% \entry typesets a paragraph consisting of the text (#1), dot leaders, and
+% then page number (#2) flushed to the right margin. It is used for index
+% and table of contents entries. The paragraph is indented by \leftskip.
+%
+\def\entry{%
+ \begingroup
+ %
+ % Start a new paragraph if necessary, so our assignments below can't
+ % affect previous text.
+ \par
+ %
+ % No extra space above this paragraph.
+ \parskip = 0in
+ %
+ % When reading the text of entry, convert explicit line breaks
+ % from @* into spaces. The user might give these in long section
+ % titles, for instance.
+ \def\*{\unskip\space\ignorespaces}%
+ \def\entrybreak{\hfil\break}% An undocumented command
+ %
+ % Swallow the left brace of the text (first parameter):
+ \afterassignment\doentry
+ \let\temp =
+}
+\def\entrybreak{\unskip\space\ignorespaces}%
+\def\doentry{%
+ % Save the text of the entry
+ \global\setbox\boxA=\hbox\bgroup
+ \bgroup % Instead of the swallowed brace.
+ \noindent
+ \aftergroup\finishentry
+ % And now comes the text of the entry.
+ % Not absorbing as a macro argument reduces the chance of problems
+ % with catcodes occurring.
+}
+{\catcode`\@=11
+\gdef\finishentry#1{%
+ \egroup % end box A
+ \dimen@ = \wd\boxA % Length of text of entry
+ \global\setbox\boxA=\hbox\bgroup
+ \unhbox\boxA
+ % #1 is the page number.
+ %
+ % Get the width of the page numbers, and only use
+ % leaders if they are present.
+ \global\setbox\boxB = \hbox{#1}%
+ \ifdim\wd\boxB = 0pt
+ \null\nobreak\hfill\ %
+ \else
+ %
+ \null\nobreak\indexdotfill % Have leaders before the page number.
+ %
+ \ifpdforxetex
+ \pdfgettoks#1.%
+ \hskip\skip\thinshrinkable\the\toksA
+ \else
+ \hskip\skip\thinshrinkable #1%
+ \fi
+ \fi
+ \egroup % end \boxA
+ \ifdim\wd\boxB = 0pt
+ \noindent\unhbox\boxA\par
+ \nobreak
+ \else\bgroup
+ % We want the text of the entries to be aligned to the left, and the
+ % page numbers to be aligned to the right.
+ %
+ \parindent = 0pt
+ \advance\leftskip by 0pt plus 1fil
+ \advance\leftskip by 0pt plus -1fill
+ \rightskip = 0pt plus -1fil
+ \advance\rightskip by 0pt plus 1fill
+ % Cause last line, which could consist of page numbers on their own
+ % if the list of page numbers is long, to be aligned to the right.
+ \parfillskip=0pt plus -1fill
+ %
+ \advance\rightskip by \entryrightmargin
+ % Determine how far we can stretch into the margin.
+ % This allows, e.g., "Appendix H GNU Free Documentation License" to
+ % fit on one line in @letterpaper format.
+ \ifdim\entryrightmargin>2.1em
+ \dimen@i=2.1em
+ \else
+ \dimen@i=0em
+ \fi
+ \advance \parfillskip by 0pt minus 1\dimen@i
+ %
+ \dimen@ii = \hsize
+ \advance\dimen@ii by -1\leftskip
+ \advance\dimen@ii by -1\entryrightmargin
+ \advance\dimen@ii by 1\dimen@i
+ \ifdim\wd\boxA > \dimen@ii % If the entry doesn't fit in one line
+ \ifdim\dimen@ > 0.8\dimen@ii % due to long index text
+ % Try to split the text roughly evenly. \dimen@ will be the length of
+ % the first line.
+ \dimen@ = 0.7\dimen@
+ \dimen@ii = \hsize
+ \ifnum\dimen@>\dimen@ii
+ % If the entry is too long (for example, if it needs more than
+ % two lines), use all the space in the first line.
+ \dimen@ = \dimen@ii
+ \fi
+ \advance\leftskip by 0pt plus 1fill % ragged right
+ \advance \dimen@ by 1\rightskip
+ \parshape = 2 0pt \dimen@ 0em \dimen@ii
+ % Ideally we'd add a finite glue at the end of the first line only,
+ % instead of using \parshape with explicit line lengths, but TeX
+ % doesn't seem to provide a way to do such a thing.
+ %
+ % Indent all lines but the first one.
+ \advance\leftskip by 1em
+ \advance\parindent by -1em
+ \fi\fi
+ \indent % start paragraph
+ \unhbox\boxA
+ %
+ % Do not prefer a separate line ending with a hyphen to fewer lines.
+ \finalhyphendemerits = 0
+ %
+ % Word spacing - no stretch
+ \spaceskip=\fontdimen2\font minus \fontdimen4\font
+ %
+ \linepenalty=1000 % Discourage line breaks.
+ \hyphenpenalty=5000 % Discourage hyphenation.
+ %
+ \par % format the paragraph
+ \egroup % The \vbox
+ \fi
+ \endgroup
+}}
+
+\newskip\thinshrinkable
+\skip\thinshrinkable=.15em minus .15em
+
+% Like plain.tex's \dotfill, except uses up at least 1 em.
+% The filll stretch here overpowers both the fil and fill stretch to push
+% the page number to the right.
+\def\indexdotfill{\cleaders
+ \hbox{$\mathsurround=0pt \mkern1.5mu.\mkern1.5mu$}\hskip 1em plus 1filll}
+
+
+\def\primary #1{\line{#1\hfil}}
+
+\def\secondary{\indententry{0.5cm}}
+\def\tertiary{\indententry{1cm}}
+
+\def\indententry#1#2#3{%
+ \bgroup
+ \leftskip=#1
+ \entry{#2}{#3}%
+ \egroup
+}
+
+% Define two-column mode, which we use to typeset indexes.
+% Adapted from the TeXbook, page 416, which is to say,
+% the manmac.tex format used to print the TeXbook itself.
+\catcode`\@=11 % private names
+
+\newbox\partialpage
+\newdimen\doublecolumnhsize
+
+\def\begindoublecolumns{\begingroup % ended by \enddoublecolumns
+ % If not much space left on page, start a new page.
+ \ifdim\pagetotal>0.8\vsize\vfill\eject\fi
+ %
+ % Grab any single-column material above us.
+ \output = {%
+ \savetopmark
+ %
+ \global\setbox\partialpage = \vbox{%
+ % Unvbox the main output page.
+ \unvbox\PAGE
+ \kern-\topskip \kern\baselineskip
+ }%
+ }%
+ \eject % run that output routine to set \partialpage
+ %
+ % Use the double-column output routine for subsequent pages.
+ \output = {\doublecolumnout}%
+ %
+ % Change the page size parameters. We could do this once outside this
+ % routine, in each of @smallbook, @afourpaper, and the default 8.5x11
+ % format, but then we repeat the same computation. Repeating a couple
+ % of assignments once per index is clearly meaningless for the
+ % execution time, so we may as well do it in one place.
+ %
+ % First we halve the line length, less a little for the gutter between
+ % the columns. We compute the gutter based on the line length, so it
+ % changes automatically with the paper format. The magic constant
+ % below is chosen so that the gutter has the same value (well, +-<1pt)
+ % as it did when we hard-coded it.
+ %
+ % We put the result in a separate register, \doublecolumhsize, so we
+ % can restore it in \pagesofar, after \hsize itself has (potentially)
+ % been clobbered.
+ %
+ \doublecolumnhsize = \hsize
+ \advance\doublecolumnhsize by -.04154\hsize
+ \divide\doublecolumnhsize by 2
+ \hsize = \doublecolumnhsize
+ %
+ % Get the available space for the double columns -- the normal
+ % (undoubled) page height minus any material left over from the
+ % previous page.
+ \advance\vsize by -\ht\partialpage
+ \vsize = 2\vsize
+ %
+ % For the benefit of balancing columns
+ \advance\baselineskip by 0pt plus 0.5pt
+}
+
+% The double-column output routine for all double-column pages except
+% the last, which is done by \balancecolumns.
+%
+\def\doublecolumnout{%
+ %
+ \savetopmark
+ \splittopskip=\topskip \splitmaxdepth=\maxdepth
+ \dimen@ = \vsize
+ \divide\dimen@ by 2
+ %
+ % box0 will be the left-hand column, box2 the right.
+ \setbox0=\vsplit\PAGE to\dimen@ \setbox2=\vsplit\PAGE to\dimen@
+ \global\advance\vsize by 2\ht\partialpage
+ \onepageout\pagesofar % empty except for the first time we are called
+ \unvbox\PAGE
+ \penalty\outputpenalty
+}
+%
+% Re-output the contents of the output page -- any previous material,
+% followed by the two boxes we just split, in box0 and box2.
+\def\pagesofar{%
+ \unvbox\partialpage
+ %
+ \hsize = \doublecolumnhsize
+ \wd0=\hsize \wd2=\hsize
+ \hbox to\txipagewidth{\box0\hfil\box2}%
+}
+
+
+% Finished with double columns.
+\def\enddoublecolumns{%
+ % The following penalty ensures that the page builder is exercised
+ % _before_ we change the output routine. This is necessary in the
+ % following situation:
+ %
+ % The last section of the index consists only of a single entry.
+ % Before this section, \pagetotal is less than \pagegoal, so no
+ % break occurs before the last section starts. However, the last
+ % section, consisting of \initial and the single \entry, does not
+ % fit on the page and has to be broken off. Without the following
+ % penalty the page builder will not be exercised until \eject
+ % below, and by that time we'll already have changed the output
+ % routine to the \balancecolumns version, so the next-to-last
+ % double-column page will be processed with \balancecolumns, which
+ % is wrong: The two columns will go to the main vertical list, with
+ % the broken-off section in the recent contributions. As soon as
+ % the output routine finishes, TeX starts reconsidering the page
+ % break. The two columns and the broken-off section both fit on the
+ % page, because the two columns now take up only half of the page
+ % goal. When TeX sees \eject from below which follows the final
+ % section, it invokes the new output routine that we've set after
+ % \balancecolumns below; \onepageout will try to fit the two columns
+ % and the final section into the vbox of \txipageheight (see
+ % \pagebody), causing an overfull box.
+ %
+ % Note that glue won't work here, because glue does not exercise the
+ % page builder, unlike penalties (see The TeXbook, pp. 280-281).
+ \penalty0
+ %
+ \output = {%
+ % Split the last of the double-column material.
+ \savetopmark
+ \balancecolumns
+ }%
+ \eject % call the \output just set
+ \ifdim\pagetotal=0pt
+ % Having called \balancecolumns once, we do not
+ % want to call it again. Therefore, reset \output to its normal
+ % definition right away.
+ \global\output=\expandafter{\the\defaultoutput}
+ %
+ \endgroup % started in \begindoublecolumns
+ % Leave the double-column material on the current page, no automatic
+ % page break.
+ \box\balancedcolumns
+ %
+ % \pagegoal was set to the doubled \vsize above, since we restarted
+ % the current page. We're now back to normal single-column
+ % typesetting, so reset \pagegoal to the normal \vsize.
+ \global\vsize = \txipageheight %
+ \pagegoal = \txipageheight %
+ \else
+ % We had some left-over material. This might happen when \doublecolumnout
+ % is called in \balancecolumns. Try again.
+ \expandafter\enddoublecolumns
+ \fi
+}
+\newbox\balancedcolumns
+\setbox\balancedcolumns=\vbox{shouldnt see this}%
+%
+% Only called for the last of the double column material. \doublecolumnout
+% does the others.
+\def\balancecolumns{%
+ \setbox0 = \vbox{\unvbox\PAGE}% like \box255 but more efficient, see p.120.
+ \dimen@ = \ht0
+ \ifdim\dimen@<7\baselineskip
+ % Don't split a short final column in two.
+ \setbox2=\vbox{}%
+ \global\setbox\balancedcolumns=\vbox{\pagesofar}%
+ \else
+ % double the leading vertical space
+ \advance\dimen@ by \topskip
+ \advance\dimen@ by-\baselineskip
+ \divide\dimen@ by 2 % target to split to
+ \dimen@ii = \dimen@
+ \splittopskip = \topskip
+ % Loop until left column is at least as high as the right column.
+ {%
+ \vbadness = 10000
+ \loop
+ \global\setbox3 = \copy0
+ \global\setbox1 = \vsplit3 to \dimen@
+ \ifdim\ht1<\ht3
+ \global\advance\dimen@ by 1pt
+ \repeat
+ }%
+ % Now the left column is in box 1, and the right column in box 3.
+ %
+ % Check whether the left column has come out higher than the page itself.
+ % (Note that we have doubled \vsize for the double columns, so
+ % the actual height of the page is 0.5\vsize).
+ \ifdim2\ht1>\vsize
+ % It appears that we have been called upon to balance too much material.
+ % Output some of it with \doublecolumnout, leaving the rest on the page.
+ \setbox\PAGE=\box0
+ \doublecolumnout
+ \else
+ % Compare the heights of the two columns.
+ \ifdim4\ht1>5\ht3
+ % Column heights are too different, so don't make their bottoms
+ % flush with each other.
+ \setbox2=\vbox to \ht1 {\unvbox3\vfill}%
+ \setbox0=\vbox to \ht1 {\unvbox1\vfill}%
+ \else
+ % Make column bottoms flush with each other.
+ \setbox2=\vbox to\ht1{\unvbox3\unskip}%
+ \setbox0=\vbox to\ht1{\unvbox1\unskip}%
+ \fi
+ \global\setbox\balancedcolumns=\vbox{\pagesofar}%
+ \fi
+ \fi
+ %
+}
+\catcode`\@ = \other
+
+
+\message{sectioning,}
+% Chapters, sections, etc.
+
+% Let's start with @part.
+\outer\parseargdef\part{\partzzz{#1}}
+\def\partzzz#1{%
+ \chapoddpage
+ \null
+ \vskip.3\vsize % move it down on the page a bit
+ \begingroup
+ \noindent \titlefonts\rm #1\par % the text
+ \let\lastnode=\empty % no node to associate with
+ \writetocentry{part}{#1}{}% but put it in the toc
+ \headingsoff % no headline or footline on the part page
+ % This outputs a mark at the end of the page that clears \thischapter
+ % and \thissection, as is done in \startcontents.
+ \let\pchapsepmacro\relax
+ \chapmacro{}{Yomitfromtoc}{}%
+ \chapoddpage
+ \endgroup
+}
+
+% \unnumberedno is an oxymoron. But we count the unnumbered
+% sections so that we can refer to them unambiguously in the pdf
+% outlines by their "section number". We avoid collisions with chapter
+% numbers by starting them at 10000. (If a document ever has 10000
+% chapters, we're in trouble anyway, I'm sure.)
+\newcount\unnumberedno \unnumberedno = 10000
+\newcount\chapno
+\newcount\secno \secno=0
+\newcount\subsecno \subsecno=0
+\newcount\subsubsecno \subsubsecno=0
+
+% This counter is funny since it counts through charcodes of letters A, B, ...
+\newcount\appendixno \appendixno = `\@
+%
+% \def\appendixletter{\char\the\appendixno}
+% We do the following ugly conditional instead of the above simple
+% construct for the sake of pdftex, which needs the actual
+% letter in the expansion, not just typeset.
+%
+\def\appendixletter{%
+ \ifnum\appendixno=`A A%
+ \else\ifnum\appendixno=`B B%
+ \else\ifnum\appendixno=`C C%
+ \else\ifnum\appendixno=`D D%
+ \else\ifnum\appendixno=`E E%
+ \else\ifnum\appendixno=`F F%
+ \else\ifnum\appendixno=`G G%
+ \else\ifnum\appendixno=`H H%
+ \else\ifnum\appendixno=`I I%
+ \else\ifnum\appendixno=`J J%
+ \else\ifnum\appendixno=`K K%
+ \else\ifnum\appendixno=`L L%
+ \else\ifnum\appendixno=`M M%
+ \else\ifnum\appendixno=`N N%
+ \else\ifnum\appendixno=`O O%
+ \else\ifnum\appendixno=`P P%
+ \else\ifnum\appendixno=`Q Q%
+ \else\ifnum\appendixno=`R R%
+ \else\ifnum\appendixno=`S S%
+ \else\ifnum\appendixno=`T T%
+ \else\ifnum\appendixno=`U U%
+ \else\ifnum\appendixno=`V V%
+ \else\ifnum\appendixno=`W W%
+ \else\ifnum\appendixno=`X X%
+ \else\ifnum\appendixno=`Y Y%
+ \else\ifnum\appendixno=`Z Z%
+ % The \the is necessary, despite appearances, because \appendixletter is
+ % expanded while writing the .toc file. \char\appendixno is not
+ % expandable, thus it is written literally, thus all appendixes come out
+ % with the same letter (or @) in the toc without it.
+ \else\char\the\appendixno
+ \fi\fi\fi\fi\fi\fi\fi\fi\fi\fi\fi\fi\fi
+ \fi\fi\fi\fi\fi\fi\fi\fi\fi\fi\fi\fi\fi}
+
+% Each @chapter defines these (using marks) as the number+name, number
+% and name of the chapter. Page headings and footings can use
+% these. @section does likewise.
+\def\thischapter{}
+\def\thischapternum{}
+\def\thischaptername{}
+\def\thissection{}
+\def\thissectionnum{}
+\def\thissectionname{}
+
+\newcount\absseclevel % used to calculate proper heading level
+\newcount\secbase\secbase=0 % @raisesections/@lowersections modify this count
+
+% @raisesections: treat @section as chapter, @subsection as section, etc.
+\def\raisesections{\global\advance\secbase by -1}
+
+% @lowersections: treat @chapter as section, @section as subsection, etc.
+\def\lowersections{\global\advance\secbase by 1}
+
+% we only have subsub.
+\chardef\maxseclevel = 3
+%
+% A numbered section within an unnumbered changes to unnumbered too.
+% To achieve this, remember the "biggest" unnum. sec. we are currently in:
+\chardef\unnlevel = \maxseclevel
+%
+% Trace whether the current chapter is an appendix or not:
+% \chapheadtype is "N" or "A", unnumbered chapters are ignored.
+\def\chapheadtype{N}
+
+% Choose a heading macro
+% #1 is heading type
+% #2 is heading level
+% #3 is text for heading
+\def\genhead#1#2#3{%
+ % Compute the abs. sec. level:
+ \absseclevel=#2
+ \advance\absseclevel by \secbase
+ % Make sure \absseclevel doesn't fall outside the range:
+ \ifnum \absseclevel < 0
+ \absseclevel = 0
+ \else
+ \ifnum \absseclevel > 3
+ \absseclevel = 3
+ \fi
+ \fi
+ % The heading type:
+ \def\headtype{#1}%
+ \if \headtype U%
+ \ifnum \absseclevel < \unnlevel
+ \chardef\unnlevel = \absseclevel
+ \fi
+ \else
+ % Check for appendix sections:
+ \ifnum \absseclevel = 0
+ \edef\chapheadtype{\headtype}%
+ \else
+ \if \headtype A\if \chapheadtype N%
+ \errmessage{@appendix... within a non-appendix chapter}%
+ \fi\fi
+ \fi
+ % Check for numbered within unnumbered:
+ \ifnum \absseclevel > \unnlevel
+ \def\headtype{U}%
+ \else
+ \chardef\unnlevel = 3
+ \fi
+ \fi
+ % Now print the heading:
+ \if \headtype U%
+ \ifcase\absseclevel
+ \unnumberedzzz{#3}%
+ \or \unnumberedseczzz{#3}%
+ \or \unnumberedsubseczzz{#3}%
+ \or \unnumberedsubsubseczzz{#3}%
+ \fi
+ \else
+ \if \headtype A%
+ \ifcase\absseclevel
+ \appendixzzz{#3}%
+ \or \appendixsectionzzz{#3}%
+ \or \appendixsubseczzz{#3}%
+ \or \appendixsubsubseczzz{#3}%
+ \fi
+ \else
+ \ifcase\absseclevel
+ \chapterzzz{#3}%
+ \or \seczzz{#3}%
+ \or \numberedsubseczzz{#3}%
+ \or \numberedsubsubseczzz{#3}%
+ \fi
+ \fi
+ \fi
+ \suppressfirstparagraphindent
+}
+
+% an interface:
+\def\numhead{\genhead N}
+\def\apphead{\genhead A}
+\def\unnmhead{\genhead U}
+
+% @chapter, @appendix, @unnumbered. Increment top-level counter, reset
+% all lower-level sectioning counters to zero.
+%
+% Also set \chaplevelprefix, which we prepend to @float sequence numbers
+% (e.g., figures), q.v. By default (before any chapter), that is empty.
+\let\chaplevelprefix = \empty
+%
+\outer\parseargdef\chapter{\numhead0{#1}} % normally numhead0 calls chapterzzz
+\def\chapterzzz#1{%
+ % section resetting is \global in case the chapter is in a group, such
+ % as an @include file.
+ \global\secno=0 \global\subsecno=0 \global\subsubsecno=0
+ \global\advance\chapno by 1
+ %
+ % Used for \float.
+ \gdef\chaplevelprefix{\the\chapno.}%
+ \resetallfloatnos
+ %
+ % \putwordChapter can contain complex things in translations.
+ \toks0=\expandafter{\putwordChapter}%
+ \message{\the\toks0 \space \the\chapno}%
+ %
+ % Write the actual heading.
+ \chapmacro{#1}{Ynumbered}{\the\chapno}%
+ %
+ % So @section and the like are numbered underneath this chapter.
+ \global\let\section = \numberedsec
+ \global\let\subsection = \numberedsubsec
+ \global\let\subsubsection = \numberedsubsubsec
+}
+
+\outer\parseargdef\appendix{\apphead0{#1}} % normally calls appendixzzz
+%
+\def\appendixzzz#1{%
+ \global\secno=0 \global\subsecno=0 \global\subsubsecno=0
+ \global\advance\appendixno by 1
+ \gdef\chaplevelprefix{\appendixletter.}%
+ \resetallfloatnos
+ %
+ % \putwordAppendix can contain complex things in translations.
+ \toks0=\expandafter{\putwordAppendix}%
+ \message{\the\toks0 \space \appendixletter}%
+ %
+ \chapmacro{#1}{Yappendix}{\appendixletter}%
+ %
+ \global\let\section = \appendixsec
+ \global\let\subsection = \appendixsubsec
+ \global\let\subsubsection = \appendixsubsubsec
+}
+
+% normally unnmhead0 calls unnumberedzzz:
+\outer\parseargdef\unnumbered{\unnmhead0{#1}}
+\def\unnumberedzzz#1{%
+ \global\secno=0 \global\subsecno=0 \global\subsubsecno=0
+ \global\advance\unnumberedno by 1
+ %
+ % Since an unnumbered has no number, no prefix for figures.
+ \global\let\chaplevelprefix = \empty
+ \resetallfloatnos
+ %
+ % This used to be simply \message{#1}, but TeX fully expands the
+ % argument to \message. Therefore, if #1 contained @-commands, TeX
+ % expanded them. For example, in `@unnumbered The @cite{Book}', TeX
+ % expanded @cite (which turns out to cause errors because \cite is meant
+ % to be executed, not expanded).
+ %
+ % Anyway, we don't want the fully-expanded definition of @cite to appear
+ % as a result of the \message, we just want `@cite' itself. We use
+ % \the to achieve this: TeX expands \the only once,
+ % simply yielding the contents of . (We also do this for
+ % the toc entries.)
+ \toks0 = {#1}%
+ \message{(\the\toks0)}%
+ %
+ \chapmacro{#1}{Ynothing}{\the\unnumberedno}%
+ %
+ \global\let\section = \unnumberedsec
+ \global\let\subsection = \unnumberedsubsec
+ \global\let\subsubsection = \unnumberedsubsubsec
+}
+
+% @centerchap is like @unnumbered, but the heading is centered.
+\outer\parseargdef\centerchap{%
+ \let\centerparametersmaybe = \centerparameters
+ \unnmhead0{#1}%
+ \let\centerparametersmaybe = \relax
+}
+
+% @top is like @unnumbered.
+\let\top\unnumbered
+
+% Sections.
+%
+\outer\parseargdef\numberedsec{\numhead1{#1}} % normally calls seczzz
+\def\seczzz#1{%
+ \global\subsecno=0 \global\subsubsecno=0 \global\advance\secno by 1
+ \sectionheading{#1}{sec}{Ynumbered}{\the\chapno.\the\secno}%
+}
+
+% normally calls appendixsectionzzz:
+\outer\parseargdef\appendixsection{\apphead1{#1}}
+\def\appendixsectionzzz#1{%
+ \global\subsecno=0 \global\subsubsecno=0 \global\advance\secno by 1
+ \sectionheading{#1}{sec}{Yappendix}{\appendixletter.\the\secno}%
+}
+\let\appendixsec\appendixsection
+
+% normally calls unnumberedseczzz:
+\outer\parseargdef\unnumberedsec{\unnmhead1{#1}}
+\def\unnumberedseczzz#1{%
+ \global\subsecno=0 \global\subsubsecno=0 \global\advance\secno by 1
+ \sectionheading{#1}{sec}{Ynothing}{\the\unnumberedno.\the\secno}%
+}
+
+% Subsections.
+%
+% normally calls numberedsubseczzz:
+\outer\parseargdef\numberedsubsec{\numhead2{#1}}
+\def\numberedsubseczzz#1{%
+ \global\subsubsecno=0 \global\advance\subsecno by 1
+ \sectionheading{#1}{subsec}{Ynumbered}{\the\chapno.\the\secno.\the\subsecno}%
+}
+
+% normally calls appendixsubseczzz:
+\outer\parseargdef\appendixsubsec{\apphead2{#1}}
+\def\appendixsubseczzz#1{%
+ \global\subsubsecno=0 \global\advance\subsecno by 1
+ \sectionheading{#1}{subsec}{Yappendix}%
+ {\appendixletter.\the\secno.\the\subsecno}%
+}
+
+% normally calls unnumberedsubseczzz:
+\outer\parseargdef\unnumberedsubsec{\unnmhead2{#1}}
+\def\unnumberedsubseczzz#1{%
+ \global\subsubsecno=0 \global\advance\subsecno by 1
+ \sectionheading{#1}{subsec}{Ynothing}%
+ {\the\unnumberedno.\the\secno.\the\subsecno}%
+}
+
+% Subsubsections.
+%
+% normally numberedsubsubseczzz:
+\outer\parseargdef\numberedsubsubsec{\numhead3{#1}}
+\def\numberedsubsubseczzz#1{%
+ \global\advance\subsubsecno by 1
+ \sectionheading{#1}{subsubsec}{Ynumbered}%
+ {\the\chapno.\the\secno.\the\subsecno.\the\subsubsecno}%
+}
+
+% normally appendixsubsubseczzz:
+\outer\parseargdef\appendixsubsubsec{\apphead3{#1}}
+\def\appendixsubsubseczzz#1{%
+ \global\advance\subsubsecno by 1
+ \sectionheading{#1}{subsubsec}{Yappendix}%
+ {\appendixletter.\the\secno.\the\subsecno.\the\subsubsecno}%
+}
+
+% normally unnumberedsubsubseczzz:
+\outer\parseargdef\unnumberedsubsubsec{\unnmhead3{#1}}
+\def\unnumberedsubsubseczzz#1{%
+ \global\advance\subsubsecno by 1
+ \sectionheading{#1}{subsubsec}{Ynothing}%
+ {\the\unnumberedno.\the\secno.\the\subsecno.\the\subsubsecno}%
+}
+
+% These macros control what the section commands do, according
+% to what kind of chapter we are in (ordinary, appendix, or unnumbered).
+% Define them by default for a numbered chapter.
+\let\section = \numberedsec
+\let\subsection = \numberedsubsec
+\let\subsubsection = \numberedsubsubsec
+
+% Define @majorheading, @heading and @subheading
+
+\def\majorheading{%
+ {\advance\chapheadingskip by 10pt \chapbreak }%
+ \parsearg\chapheadingzzz
+}
+
+\def\chapheading{\chapbreak \parsearg\chapheadingzzz}
+\def\chapheadingzzz#1{%
+ \vbox{\chapfonts \raggedtitlesettings #1\par}%
+ \nobreak\bigskip \nobreak
+ \suppressfirstparagraphindent
+}
+
+% @heading, @subheading, @subsubheading.
+\parseargdef\heading{\sectionheading{#1}{sec}{Yomitfromtoc}{}
+ \suppressfirstparagraphindent}
+\parseargdef\subheading{\sectionheading{#1}{subsec}{Yomitfromtoc}{}
+ \suppressfirstparagraphindent}
+\parseargdef\subsubheading{\sectionheading{#1}{subsubsec}{Yomitfromtoc}{}
+ \suppressfirstparagraphindent}
+
+% These macros generate a chapter, section, etc. heading only
+% (including whitespace, linebreaking, etc. around it),
+% given all the information in convenient, parsed form.
+
+% Args are the skip and penalty (usually negative)
+\def\dobreak#1#2{\par\ifdim\lastskip<#1\removelastskip\penalty#2\vskip#1\fi}
+
+% Parameter controlling skip before chapter headings (if needed)
+\newskip\chapheadingskip
+
+% Define plain chapter starts, and page on/off switching for it.
+\def\chapbreak{\dobreak \chapheadingskip {-4000}}
+
+% Start a new page
+\def\chappager{\par\vfill\supereject}
+
+% \chapoddpage - start on an odd page for a new chapter
+% Because \domark is called before \chapoddpage, the filler page will
+% get the headings for the next chapter, which is wrong. But we don't
+% care -- we just disable all headings on the filler page.
+\def\chapoddpage{%
+ \chappager
+ \ifodd\pageno \else
+ \begingroup
+ \headingsoff
+ \null
+ \chappager
+ \endgroup
+ \fi
+}
+
+\parseargdef\setchapternewpage{\csname CHAPPAG#1\endcsname}
+
+\def\CHAPPAGoff{%
+\global\let\contentsalignmacro = \chappager
+\global\let\pchapsepmacro=\chapbreak
+\global\let\pagealignmacro=\chappager}
+
+\def\CHAPPAGon{%
+\global\let\contentsalignmacro = \chappager
+\global\let\pchapsepmacro=\chappager
+\global\let\pagealignmacro=\chappager
+\global\def\HEADINGSon{\HEADINGSsingle}}
+
+\def\CHAPPAGodd{%
+\global\let\contentsalignmacro = \chapoddpage
+\global\let\pchapsepmacro=\chapoddpage
+\global\let\pagealignmacro=\chapoddpage
+\global\def\HEADINGSon{\HEADINGSdouble}}
+
+\CHAPPAGon
+
+% \chapmacro - Chapter opening.
+%
+% #1 is the text, #2 is the section type (Ynumbered, Ynothing,
+% Yappendix, Yomitfromtoc), #3 the chapter number.
+% Not used for @heading series.
+%
+% To test against our argument.
+\def\Ynothingkeyword{Ynothing}
+\def\Yappendixkeyword{Yappendix}
+\def\Yomitfromtockeyword{Yomitfromtoc}
+%
+\def\chapmacro#1#2#3{%
+ \expandafter\ifx\thisenv\titlepage\else
+ \checkenv{}% chapters, etc., should not start inside an environment.
+ \fi
+ % Insert the first mark before the heading break (see notes for \domark).
+ \let\prevchapterdefs=\currentchapterdefs
+ \let\prevsectiondefs=\currentsectiondefs
+ \gdef\currentsectiondefs{\gdef\thissectionname{}\gdef\thissectionnum{}%
+ \gdef\thissection{}}%
+ %
+ \def\temptype{#2}%
+ \ifx\temptype\Ynothingkeyword
+ \gdef\currentchapterdefs{\gdef\thischaptername{#1}\gdef\thischapternum{}%
+ \gdef\thischapter{\thischaptername}}%
+ \else\ifx\temptype\Yomitfromtockeyword
+ \gdef\currentchapterdefs{\gdef\thischaptername{#1}\gdef\thischapternum{}%
+ \gdef\thischapter{}}%
+ \else\ifx\temptype\Yappendixkeyword
+ \toks0={#1}%
+ \xdef\currentchapterdefs{%
+ \gdef\noexpand\thischaptername{\the\toks0}%
+ \gdef\noexpand\thischapternum{\appendixletter}%
+ % \noexpand\putwordAppendix avoids expanding indigestible
+ % commands in some of the translations.
+ \gdef\noexpand\thischapter{\noexpand\putwordAppendix{}
+ \noexpand\thischapternum:
+ \noexpand\thischaptername}%
+ }%
+ \else
+ \toks0={#1}%
+ \xdef\currentchapterdefs{%
+ \gdef\noexpand\thischaptername{\the\toks0}%
+ \gdef\noexpand\thischapternum{\the\chapno}%
+ % \noexpand\putwordChapter avoids expanding indigestible
+ % commands in some of the translations.
+ \gdef\noexpand\thischapter{\noexpand\putwordChapter{}
+ \noexpand\thischapternum:
+ \noexpand\thischaptername}%
+ }%
+ \fi\fi\fi
+ %
+ % Output the mark. Pass it through \safewhatsit, to take care of
+ % the preceding space.
+ \safewhatsit\domark
+ %
+ % Insert the chapter heading break.
+ \pchapsepmacro
+ %
+ % Now the second mark, after the heading break. No break points
+ % between here and the heading.
+ \let\prevchapterdefs=\currentchapterdefs
+ \let\prevsectiondefs=\currentsectiondefs
+ \domark
+ %
+ {%
+ \chapfonts \rm
+ \let\footnote=\errfootnoteheading % give better error message
+ %
+ % Have to define \currentsection before calling \donoderef, because the
+ % xref code eventually uses it. On the other hand, it has to be called
+ % after \pchapsepmacro, or the headline will change too soon.
+ \gdef\currentsection{#1}%
+ %
+ % Only insert the separating space if we have a chapter/appendix
+ % number, and don't print the unnumbered ``number''.
+ \ifx\temptype\Ynothingkeyword
+ \setbox0 = \hbox{}%
+ \def\toctype{unnchap}%
+ \else\ifx\temptype\Yomitfromtockeyword
+ \setbox0 = \hbox{}% contents like unnumbered, but no toc entry
+ \def\toctype{omit}%
+ \else\ifx\temptype\Yappendixkeyword
+ \setbox0 = \hbox{\putwordAppendix{} #3\enspace}%
+ \def\toctype{app}%
+ \else
+ \setbox0 = \hbox{#3\enspace}%
+ \def\toctype{numchap}%
+ \fi\fi\fi
+ %
+ % Write the toc entry for this chapter. Must come before the
+ % \donoderef, because we include the current node name in the toc
+ % entry, and \donoderef resets it to empty.
+ \writetocentry{\toctype}{#1}{#3}%
+ %
+ % For pdftex, we have to write out the node definition (aka, make
+ % the pdfdest) after any page break, but before the actual text has
+ % been typeset. If the destination for the pdf outline is after the
+ % text, then jumping from the outline may wind up with the text not
+ % being visible, for instance under high magnification.
+ \donoderef{#2}%
+ %
+ % Typeset the actual heading.
+ \nobreak % Avoid page breaks at the interline glue.
+ \vbox{\raggedtitlesettings \hangindent=\wd0 \centerparametersmaybe
+ \unhbox0 #1\par}%
+ }%
+ \nobreak\bigskip % no page break after a chapter title
+ \nobreak
+}
+
+% @centerchap -- centered and unnumbered.
+\let\centerparametersmaybe = \relax
+\def\centerparameters{%
+ \advance\rightskip by 3\rightskip
+ \leftskip = \rightskip
+ \parfillskip = 0pt
+}
+
+
+% Section titles. These macros combine the section number parts and
+% call the generic \sectionheading to do the printing.
+%
+\newskip\secheadingskip
+\def\secheadingbreak{\dobreak \secheadingskip{-1000}}
+
+% Subsection titles.
+\newskip\subsecheadingskip
+\def\subsecheadingbreak{\dobreak \subsecheadingskip{-500}}
+
+% Subsubsection titles.
+\def\subsubsecheadingskip{\subsecheadingskip}
+\def\subsubsecheadingbreak{\subsecheadingbreak}
+
+
+% Print any size, any type, section title.
+%
+% #1 is the text of the title,
+% #2 is the section level (sec/subsec/subsubsec),
+% #3 is the section type (Ynumbered, Ynothing, Yappendix, Yomitfromtoc),
+% #4 is the section number.
+%
+\def\seckeyword{sec}
+%
+\def\sectionheading#1#2#3#4{%
+ {%
+ \def\sectionlevel{#2}%
+ \def\temptype{#3}%
+ %
+ % It is ok for the @heading series commands to appear inside an
+ % environment (it's been historically allowed, though the logic is
+ % dubious), but not the others.
+ \ifx\temptype\Yomitfromtockeyword\else
+ \checkenv{}% non-@*heading should not be in an environment.
+ \fi
+ \let\footnote=\errfootnoteheading
+ %
+ % Switch to the right set of fonts.
+ \csname #2fonts\endcsname \rm
+ %
+ % Insert first mark before the heading break (see notes for \domark).
+ \let\prevsectiondefs=\currentsectiondefs
+ \ifx\temptype\Ynothingkeyword
+ \ifx\sectionlevel\seckeyword
+ \gdef\currentsectiondefs{\gdef\thissectionname{#1}\gdef\thissectionnum{}%
+ \gdef\thissection{\thissectionname}}%
+ \fi
+ \else\ifx\temptype\Yomitfromtockeyword
+ % Don't redefine \thissection.
+ \else\ifx\temptype\Yappendixkeyword
+ \ifx\sectionlevel\seckeyword
+ \toks0={#1}%
+ \xdef\currentsectiondefs{%
+ \gdef\noexpand\thissectionname{\the\toks0}%
+ \gdef\noexpand\thissectionnum{#4}%
+ % \noexpand\putwordSection avoids expanding indigestible
+ % commands in some of the translations.
+ \gdef\noexpand\thissection{\noexpand\putwordSection{}
+ \noexpand\thissectionnum:
+ \noexpand\thissectionname}%
+ }%
+ \fi
+ \else
+ \ifx\sectionlevel\seckeyword
+ \toks0={#1}%
+ \xdef\currentsectiondefs{%
+ \gdef\noexpand\thissectionname{\the\toks0}%
+ \gdef\noexpand\thissectionnum{#4}%
+ % \noexpand\putwordSection avoids expanding indigestible
+ % commands in some of the translations.
+ \gdef\noexpand\thissection{\noexpand\putwordSection{}
+ \noexpand\thissectionnum:
+ \noexpand\thissectionname}%
+ }%
+ \fi
+ \fi\fi\fi
+ %
+ % Go into vertical mode. Usually we'll already be there, but we
+ % don't want the following whatsit to end up in a preceding paragraph
+ % if the document didn't happen to have a blank line.
+ \par
+ %
+ % Output the mark. Pass it through \safewhatsit, to take care of
+ % the preceding space.
+ \safewhatsit\domark
+ %
+ % Insert space above the heading.
+ \csname #2headingbreak\endcsname
+ %
+ % Now the second mark, after the heading break. No break points
+ % between here and the heading.
+ \global\let\prevsectiondefs=\currentsectiondefs
+ \domark
+ %
+ % Only insert the space after the number if we have a section number.
+ \ifx\temptype\Ynothingkeyword
+ \setbox0 = \hbox{}%
+ \def\toctype{unn}%
+ \gdef\currentsection{#1}%
+ \else\ifx\temptype\Yomitfromtockeyword
+ % for @headings -- no section number, don't include in toc,
+ % and don't redefine \currentsection.
+ \setbox0 = \hbox{}%
+ \def\toctype{omit}%
+ \let\sectionlevel=\empty
+ \else\ifx\temptype\Yappendixkeyword
+ \setbox0 = \hbox{#4\enspace}%
+ \def\toctype{app}%
+ \gdef\currentsection{#1}%
+ \else
+ \setbox0 = \hbox{#4\enspace}%
+ \def\toctype{num}%
+ \gdef\currentsection{#1}%
+ \fi\fi\fi
+ %
+ % Write the toc entry (before \donoderef). See comments in \chapmacro.
+ \writetocentry{\toctype\sectionlevel}{#1}{#4}%
+ %
+ % Write the node reference (= pdf destination for pdftex).
+ % Again, see comments in \chapmacro.
+ \donoderef{#3}%
+ %
+ % Interline glue will be inserted when the vbox is completed.
+ % That glue will be a valid breakpoint for the page, since it'll be
+ % preceded by a whatsit (usually from the \donoderef, or from the
+ % \writetocentry if there was no node). We don't want to allow that
+ % break, since then the whatsits could end up on page n while the
+ % section is on page n+1, thus toc/etc. are wrong. Debian bug 276000.
+ \nobreak
+ %
+ % Output the actual section heading.
+ \vbox{\hyphenpenalty=10000 \tolerance=5000 \parindent=0pt \ptexraggedright
+ \hangindent=\wd0 % zero if no section number
+ \unhbox0 #1}%
+ }%
+ % Add extra space after the heading -- half of whatever came above it.
+ % Don't allow stretch, though.
+ \kern .5 \csname #2headingskip\endcsname
+ %
+ % Do not let the kern be a potential breakpoint, as it would be if it
+ % was followed by glue.
+ \nobreak
+ %
+ % We'll almost certainly start a paragraph next, so don't let that
+ % glue accumulate. (Not a breakpoint because it's preceded by a
+ % discardable item.) However, when a paragraph is not started next
+ % (\startdefun, \cartouche, \center, etc.), this needs to be wiped out
+ % or the negative glue will cause weirdly wrong output, typically
+ % obscuring the section heading with something else.
+ \vskip-\parskip
+ %
+ % This is so the last item on the main vertical list is a known
+ % \penalty > 10000, so \startdefun, etc., can recognize the situation
+ % and do the needful.
+ \penalty 10001
+}
+
+
+\message{toc,}
+% Table of contents.
+\newwrite\tocfile
+
+% Write an entry to the toc file, opening it if necessary.
+% Called from @chapter, etc.
+%
+% Example usage: \writetocentry{sec}{Section Name}{\the\chapno.\the\secno}
+% We append the current node name (if any) and page number as additional
+% arguments for the \{chap,sec,...}entry macros which will eventually
+% read this. The node name is used in the pdf outlines as the
+% destination to jump to.
+%
+% We open the .toc file for writing here instead of at @setfilename (or
+% any other fixed time) so that @contents can be anywhere in the document.
+% But if #1 is `omit', then we don't do anything. This is used for the
+% table of contents chapter openings themselves.
+%
+\newif\iftocfileopened
+\def\omitkeyword{omit}%
+%
+\def\writetocentry#1#2#3{%
+ \edef\writetoctype{#1}%
+ \ifx\writetoctype\omitkeyword \else
+ \iftocfileopened\else
+ \immediate\openout\tocfile = \jobname.toc
+ \global\tocfileopenedtrue
+ \fi
+ %
+ \iflinks
+ {\atdummies
+ \edef\temp{%
+ \write\tocfile{@#1entry{#2}{#3}{\lastnode}{\noexpand\folio}}}%
+ \temp
+ }%
+ \fi
+ \fi
+ %
+ % Tell \shipout to create a pdf destination on each page, if we're
+ % writing pdf. These are used in the table of contents. We can't
+ % just write one on every page because the title pages are numbered
+ % 1 and 2 (the page numbers aren't printed), and so are the first
+ % two pages of the document. Thus, we'd have two destinations named
+ % `1', and two named `2'.
+ \ifpdforxetex
+ \global\pdfmakepagedesttrue
+ \fi
+}
+
+
+% These characters do not print properly in the Computer Modern roman
+% fonts, so we must take special care. This is more or less redundant
+% with the Texinfo input format setup at the end of this file.
+%
+\def\activecatcodes{%
+ \catcode`\"=\active
+ \catcode`\$=\active
+ \catcode`\<=\active
+ \catcode`\>=\active
+ \catcode`\\=\active
+ \catcode`\^=\active
+ \catcode`\_=\active
+ \catcode`\|=\active
+ \catcode`\~=\active
+}
+
+
+% Read the toc file, which is essentially Texinfo input.
+\def\readtocfile{%
+ \setupdatafile
+ \activecatcodes
+ \input \tocreadfilename
+}
+
+\newskip\contentsrightmargin \contentsrightmargin=1in
+\newcount\savepageno
+\newcount\lastnegativepageno \lastnegativepageno = -1
+
+% Prepare to read what we've written to \tocfile.
+%
+\def\startcontents#1{%
+ % If @setchapternewpage on, and @headings double, the contents should
+ % start on an odd page, unlike chapters. Thus, we maintain
+ % \contentsalignmacro in parallel with \pagealignmacro.
+ % From: Torbjorn Granlund
+ \contentsalignmacro
+ \immediate\closeout\tocfile
+ %
+ % Don't need to put `Contents' or `Short Contents' in the headline.
+ % It is abundantly clear what they are.
+ \chapmacro{#1}{Yomitfromtoc}{}%
+ %
+ \savepageno = \pageno
+ \begingroup % Set up to handle contents files properly.
+ \raggedbottom % Worry more about breakpoints than the bottom.
+ \entryrightmargin=\contentsrightmargin % Don't use the full line length.
+ %
+ % Roman numerals for page numbers.
+ \ifnum \pageno>0 \global\pageno = \lastnegativepageno \fi
+}
+
+% redefined for the two-volume lispref. We always output on
+% \jobname.toc even if this is redefined.
+%
+\def\tocreadfilename{\jobname.toc}
+
+% Normal (long) toc.
+%
+\def\contents{%
+ \startcontents{\putwordTOC}%
+ \openin 1 \tocreadfilename\space
+ \ifeof 1 \else
+ \readtocfile
+ \fi
+ \vfill \eject
+ \contentsalignmacro % in case @setchapternewpage odd is in effect
+ \ifeof 1 \else
+ \pdfmakeoutlines
+ \fi
+ \closein 1
+ \endgroup
+ \lastnegativepageno = \pageno
+ \global\pageno = \savepageno
+}
+
+% And just the chapters.
+\def\summarycontents{%
+ \startcontents{\putwordShortTOC}%
+ %
+ \let\partentry = \shortpartentry
+ \let\numchapentry = \shortchapentry
+ \let\appentry = \shortchapentry
+ \let\unnchapentry = \shortunnchapentry
+ % We want a true roman here for the page numbers.
+ \secfonts
+ \let\rm=\shortcontrm \let\bf=\shortcontbf
+ \let\sl=\shortcontsl \let\tt=\shortconttt
+ \rm
+ \hyphenpenalty = 10000
+ \advance\baselineskip by 1pt % Open it up a little.
+ \def\numsecentry##1##2##3##4{}
+ \let\appsecentry = \numsecentry
+ \let\unnsecentry = \numsecentry
+ \let\numsubsecentry = \numsecentry
+ \let\appsubsecentry = \numsecentry
+ \let\unnsubsecentry = \numsecentry
+ \let\numsubsubsecentry = \numsecentry
+ \let\appsubsubsecentry = \numsecentry
+ \let\unnsubsubsecentry = \numsecentry
+ \openin 1 \tocreadfilename\space
+ \ifeof 1 \else
+ \readtocfile
+ \fi
+ \closein 1
+ \vfill \eject
+ \contentsalignmacro % in case @setchapternewpage odd is in effect
+ \endgroup
+ \lastnegativepageno = \pageno
+ \global\pageno = \savepageno
+}
+\let\shortcontents = \summarycontents
+
+% Typeset the label for a chapter or appendix for the short contents.
+% The arg is, e.g., `A' for an appendix, or `3' for a chapter.
+%
+\def\shortchaplabel#1{%
+ % This space should be enough, since a single number is .5em, and the
+ % widest letter (M) is 1em, at least in the Computer Modern fonts.
+ % But use \hss just in case.
+ % (This space doesn't include the extra space that gets added after
+ % the label; that gets put in by \shortchapentry above.)
+ %
+ % We'd like to right-justify chapter numbers, but that looks strange
+ % with appendix letters. And right-justifying numbers and
+ % left-justifying letters looks strange when there is less than 10
+ % chapters. Have to read the whole toc once to know how many chapters
+ % there are before deciding ...
+ \hbox to 1em{#1\hss}%
+}
+
+% These macros generate individual entries in the table of contents.
+% The first argument is the chapter or section name.
+% The last argument is the page number.
+% The arguments in between are the chapter number, section number, ...
+
+% Parts, in the main contents. Replace the part number, which doesn't
+% exist, with an empty box. Let's hope all the numbers have the same width.
+% Also ignore the page number, which is conventionally not printed.
+\def\numeralbox{\setbox0=\hbox{8}\hbox to \wd0{\hfil}}
+\def\partentry#1#2#3#4{%
+ % Add stretch and a bonus for breaking the page before the part heading.
+ % This reduces the chance of the page being broken immediately after the
+ % part heading, before a following chapter heading.
+ \vskip 0pt plus 5\baselineskip
+ \penalty-300
+ \vskip 0pt plus -5\baselineskip
+ \dochapentry{\numeralbox\labelspace#1}{}%
+}
+%
+% Parts, in the short toc.
+\def\shortpartentry#1#2#3#4{%
+ \penalty-300
+ \vskip.5\baselineskip plus.15\baselineskip minus.1\baselineskip
+ \shortchapentry{{\bf #1}}{\numeralbox}{}{}%
+}
+
+% Chapters, in the main contents.
+\def\numchapentry#1#2#3#4{\dochapentry{#2\labelspace#1}{#4}}
+
+% Chapters, in the short toc.
+% See comments in \dochapentry re vbox and related settings.
+\def\shortchapentry#1#2#3#4{%
+ \tocentry{\shortchaplabel{#2}\labelspace #1}{\doshortpageno\bgroup#4\egroup}%
+}
+
+% Appendices, in the main contents.
+% Need the word Appendix, and a fixed-size box.
+%
+\def\appendixbox#1{%
+ % We use M since it's probably the widest letter.
+ \setbox0 = \hbox{\putwordAppendix{} M}%
+ \hbox to \wd0{\putwordAppendix{} #1\hss}}
+%
+\def\appentry#1#2#3#4{\dochapentry{\appendixbox{#2}\hskip.7em#1}{#4}}
+
+% Unnumbered chapters.
+\def\unnchapentry#1#2#3#4{\dochapentry{#1}{#4}}
+\def\shortunnchapentry#1#2#3#4{\tocentry{#1}{\doshortpageno\bgroup#4\egroup}}
+
+% Sections.
+\def\numsecentry#1#2#3#4{\dosecentry{#2\labelspace#1}{#4}}
+\let\appsecentry=\numsecentry
+\def\unnsecentry#1#2#3#4{\dosecentry{#1}{#4}}
+
+% Subsections.
+\def\numsubsecentry#1#2#3#4{\dosubsecentry{#2\labelspace#1}{#4}}
+\let\appsubsecentry=\numsubsecentry
+\def\unnsubsecentry#1#2#3#4{\dosubsecentry{#1}{#4}}
+
+% And subsubsections.
+\def\numsubsubsecentry#1#2#3#4{\dosubsubsecentry{#2\labelspace#1}{#4}}
+\let\appsubsubsecentry=\numsubsubsecentry
+\def\unnsubsubsecentry#1#2#3#4{\dosubsubsecentry{#1}{#4}}
+
+% This parameter controls the indentation of the various levels.
+% Same as \defaultparindent.
+\newdimen\tocindent \tocindent = 15pt
+
+% Now for the actual typesetting. In all these, #1 is the text and #2 is the
+% page number.
+%
+% If the toc has to be broken over pages, we want it to be at chapters
+% if at all possible; hence the \penalty.
+\def\dochapentry#1#2{%
+ \penalty-300 \vskip1\baselineskip plus.33\baselineskip minus.25\baselineskip
+ \begingroup
+ % Move the page numbers slightly to the right
+ \advance\entryrightmargin by -0.05em
+ \chapentryfonts
+ \tocentry{#1}{\dopageno\bgroup#2\egroup}%
+ \endgroup
+ \nobreak\vskip .25\baselineskip plus.1\baselineskip
+}
+
+\def\dosecentry#1#2{\begingroup
+ \secentryfonts \leftskip=\tocindent
+ \tocentry{#1}{\dopageno\bgroup#2\egroup}%
+\endgroup}
+
+\def\dosubsecentry#1#2{\begingroup
+ \subsecentryfonts \leftskip=2\tocindent
+ \tocentry{#1}{\dopageno\bgroup#2\egroup}%
+\endgroup}
+
+\def\dosubsubsecentry#1#2{\begingroup
+ \subsubsecentryfonts \leftskip=3\tocindent
+ \tocentry{#1}{\dopageno\bgroup#2\egroup}%
+\endgroup}
+
+% We use the same \entry macro as for the index entries.
+\let\tocentry = \entry
+
+% Space between chapter (or whatever) number and the title.
+\def\labelspace{\hskip1em \relax}
+
+\def\dopageno#1{{\rm #1}}
+\def\doshortpageno#1{{\rm #1}}
+
+\def\chapentryfonts{\secfonts \rm}
+\def\secentryfonts{\textfonts}
+\def\subsecentryfonts{\textfonts}
+\def\subsubsecentryfonts{\textfonts}
+
+
+\message{environments,}
+% @foo ... @end foo.
+
+% @tex ... @end tex escapes into raw TeX temporarily.
+% One exception: @ is still an escape character, so that @end tex works.
+% But \@ or @@ will get a plain @ character.
+
+\envdef\tex{%
+ \setupmarkupstyle{tex}%
+ \catcode `\\=0 \catcode `\{=1 \catcode `\}=2
+ \catcode `\$=3 \catcode `\&=4 \catcode `\#=6
+ \catcode `\^=7 \catcode `\_=8 \catcode `\~=\active \let~=\tie
+ \catcode `\%=14
+ \catcode `\+=\other
+ \catcode `\"=\other
+ \catcode `\|=\other
+ \catcode `\<=\other
+ \catcode `\>=\other
+ \catcode `\`=\other
+ \catcode `\'=\other
+ %
+ % ' is active in math mode (mathcode"8000). So reset it, and all our
+ % other math active characters (just in case), to plain's definitions.
+ \mathactive
+ %
+ % Inverse of the list at the beginning of the file.
+ \let\b=\ptexb
+ \let\bullet=\ptexbullet
+ \let\c=\ptexc
+ \let\,=\ptexcomma
+ \let\.=\ptexdot
+ \let\dots=\ptexdots
+ \let\equiv=\ptexequiv
+ \let\!=\ptexexclam
+ \let\i=\ptexi
+ \let\indent=\ptexindent
+ \let\noindent=\ptexnoindent
+ \let\{=\ptexlbrace
+ \let\+=\tabalign
+ \let\}=\ptexrbrace
+ \let\/=\ptexslash
+ \let\sp=\ptexsp
+ \let\*=\ptexstar
+ %\let\sup=\ptexsup % do not redefine, we want @sup to work in math mode
+ \let\t=\ptext
+ \expandafter \let\csname top\endcsname=\ptextop % we've made it outer
+ \let\frenchspacing=\plainfrenchspacing
+ %
+ \def\endldots{\mathinner{\ldots\ldots\ldots\ldots}}%
+ \def\enddots{\relax\ifmmode\endldots\else$\mathsurround=0pt \endldots\,$\fi}%
+ \def\@{@}%
+}
+% There is no need to define \Etex.
+
+% Define @lisp ... @end lisp.
+% @lisp environment forms a group so it can rebind things,
+% including the definition of @end lisp (which normally is erroneous).
+
+% Amount to narrow the margins by for @lisp.
+\newskip\lispnarrowing \lispnarrowing=0.4in
+
+% This is the definition that ^^M gets inside @lisp, @example, and other
+% such environments. \null is better than a space, since it doesn't
+% have any width.
+\def\lisppar{\null\endgraf}
+
+% This space is always present above and below environments.
+\newskip\envskipamount \envskipamount = 0pt
+
+% Make spacing and below environment symmetrical. We use \parskip here
+% to help in doing that, since in @example-like environments \parskip
+% is reset to zero; thus the \afterenvbreak inserts no space -- but the
+% start of the next paragraph will insert \parskip.
+%
+\def\aboveenvbreak{{%
+ % =10000 instead of <10000 because of a special case in \itemzzz and
+ % \sectionheading, q.v.
+ \ifnum \lastpenalty=10000 \else
+ \advance\envskipamount by \parskip
+ \endgraf
+ \ifdim\lastskip<\envskipamount
+ \removelastskip
+ \ifnum\lastpenalty<10000
+ % Penalize breaking before the environment, because preceding text
+ % often leads into it.
+ \penalty100
+ \fi
+ \vskip\envskipamount
+ \fi
+ \fi
+}}
+
+\def\afterenvbreak{{%
+ % =10000 instead of <10000 because of a special case in \itemzzz and
+ % \sectionheading, q.v.
+ \ifnum \lastpenalty=10000 \else
+ \advance\envskipamount by \parskip
+ \endgraf
+ \ifdim\lastskip<\envskipamount
+ \removelastskip
+ % it's not a good place to break if the last penalty was \nobreak
+ % or better ...
+ \ifnum\lastpenalty<10000 \penalty-50 \fi
+ \vskip\envskipamount
+ \fi
+ \fi
+}}
+
+% \nonarrowing is a flag. If "set", @lisp etc don't narrow margins; it will
+% also clear it, so that its embedded environments do the narrowing again.
+\let\nonarrowing=\relax
+
+% @cartouche ... @end cartouche: draw rectangle w/rounded corners around
+% environment contents.
+
+%
+\def\ctl{{\circle\char'013\hskip -6pt}}% 6pt from pl file: 1/2charwidth
+\def\ctr{{\hskip 6pt\circle\char'010}}
+\def\cbl{{\circle\char'012\hskip -6pt}}
+\def\cbr{{\hskip 6pt\circle\char'011}}
+\def\carttop{\hbox to \cartouter{\hskip\lskip
+ \ctl\leaders\hrule height\circthick\hfil\ctr
+ \hskip\rskip}}
+\def\cartbot{\hbox to \cartouter{\hskip\lskip
+ \cbl\leaders\hrule height\circthick\hfil\cbr
+ \hskip\rskip}}
+%
+\newskip\lskip\newskip\rskip
+
+% only require the font if @cartouche is actually used
+\def\cartouchefontdefs{%
+ \font\circle=lcircle10\relax
+ \circthick=\fontdimen8\circle
+}
+\newdimen\circthick
+\newdimen\cartouter\newdimen\cartinner
+\newskip\normbskip\newskip\normpskip\newskip\normlskip
+
+
+\envdef\cartouche{%
+ \cartouchefontdefs
+ \ifhmode\par\fi % can't be in the midst of a paragraph.
+ \startsavinginserts
+ \lskip=\leftskip \rskip=\rightskip
+ \leftskip=0pt\rightskip=0pt % we want these *outside*.
+ \cartinner=\hsize \advance\cartinner by-\lskip
+ \advance\cartinner by-\rskip
+ \cartouter=\hsize
+ \advance\cartouter by 18.4pt % allow for 3pt kerns on either
+ % side, and for 6pt waste from
+ % each corner char, and rule thickness
+ \normbskip=\baselineskip \normpskip=\parskip \normlskip=\lineskip
+ %
+ % If this cartouche directly follows a sectioning command, we need the
+ % \parskip glue (backspaced over by default) or the cartouche can
+ % collide with the section heading.
+ \ifnum\lastpenalty>10000 \vskip\parskip \penalty\lastpenalty \fi
+ %
+ \setbox\groupbox=\vbox\bgroup
+ \baselineskip=0pt\parskip=0pt\lineskip=0pt
+ \carttop
+ \hbox\bgroup
+ \hskip\lskip
+ \vrule\kern3pt
+ \vbox\bgroup
+ \kern3pt
+ \hsize=\cartinner
+ \baselineskip=\normbskip
+ \lineskip=\normlskip
+ \parskip=\normpskip
+ \vskip -\parskip
+ \comment % For explanation, see the end of def\group.
+}
+\def\Ecartouche{%
+ \ifhmode\par\fi
+ \kern3pt
+ \egroup
+ \kern3pt\vrule
+ \hskip\rskip
+ \egroup
+ \cartbot
+ \egroup
+ \addgroupbox
+ \checkinserts
+}
+
+
+% This macro is called at the beginning of all the @example variants,
+% inside a group.
+\newdimen\nonfillparindent
+\def\nonfillstart{%
+ \aboveenvbreak
+ \ifdim\hfuzz < 12pt \hfuzz = 12pt \fi % Don't be fussy
+ \sepspaces % Make spaces be word-separators rather than space tokens.
+ \let\par = \lisppar % don't ignore blank lines
+ \obeylines % each line of input is a line of output
+ \parskip = 0pt
+ % Turn off paragraph indentation but redefine \indent to emulate
+ % the normal \indent.
+ \nonfillparindent=\parindent
+ \parindent = 0pt
+ \let\indent\nonfillindent
+ %
+ \emergencystretch = 0pt % don't try to avoid overfull boxes
+ \ifx\nonarrowing\relax
+ \advance \leftskip by \lispnarrowing
+ \exdentamount=\lispnarrowing
+ \else
+ \let\nonarrowing = \relax
+ \fi
+ \let\exdent=\nofillexdent
+}
+
+\begingroup
+\obeyspaces
+% We want to swallow spaces (but not other tokens) after the fake
+% @indent in our nonfill-environments, where spaces are normally
+% active and set to @tie, resulting in them not being ignored after
+% @indent.
+\gdef\nonfillindent{\futurelet\temp\nonfillindentcheck}%
+\gdef\nonfillindentcheck{%
+\ifx\temp %
+\expandafter\nonfillindentgobble%
+\else%
+\leavevmode\nonfillindentbox%
+\fi%
+}%
+\endgroup
+\def\nonfillindentgobble#1{\nonfillindent}
+\def\nonfillindentbox{\hbox to \nonfillparindent{\hss}}
+
+% If you want all examples etc. small: @set dispenvsize small.
+% If you want even small examples the full size: @set dispenvsize nosmall.
+% This affects the following displayed environments:
+% @example, @display, @format, @lisp
+%
+\def\smallword{small}
+\def\nosmallword{nosmall}
+\let\SETdispenvsize\relax
+\def\setnormaldispenv{%
+ \ifx\SETdispenvsize\smallword
+ % end paragraph for sake of leading, in case document has no blank
+ % line. This is redundant with what happens in \aboveenvbreak, but
+ % we need to do it before changing the fonts, and it's inconvenient
+ % to change the fonts afterward.
+ \ifnum \lastpenalty=10000 \else \endgraf \fi
+ \smallexamplefonts \rm
+ \fi
+}
+\def\setsmalldispenv{%
+ \ifx\SETdispenvsize\nosmallword
+ \else
+ \ifnum \lastpenalty=10000 \else \endgraf \fi
+ \smallexamplefonts \rm
+ \fi
+}
+
+% We often define two environments, @foo and @smallfoo.
+% Let's do it in one command. #1 is the env name, #2 the definition.
+\def\makedispenvdef#1#2{%
+ \expandafter\envdef\csname#1\endcsname {\setnormaldispenv #2}%
+ \expandafter\envdef\csname small#1\endcsname {\setsmalldispenv #2}%
+ \expandafter\let\csname E#1\endcsname \afterenvbreak
+ \expandafter\let\csname Esmall#1\endcsname \afterenvbreak
+}
+
+% Define two environment synonyms (#1 and #2) for an environment.
+\def\maketwodispenvdef#1#2#3{%
+ \makedispenvdef{#1}{#3}%
+ \makedispenvdef{#2}{#3}%
+}
+%
+% @lisp: indented, narrowed, typewriter font;
+% @example: same as @lisp.
+%
+% @smallexample and @smalllisp: use smaller fonts.
+% Originally contributed by Pavel@xerox.
+%
+\maketwodispenvdef{lisp}{example}{%
+ \nonfillstart
+ \tt\setupmarkupstyle{example}%
+ \let\kbdfont = \kbdexamplefont % Allow @kbd to do something special.
+ \gobble % eat return
+}
+% @display/@smalldisplay: same as @lisp except keep current font.
+%
+\makedispenvdef{display}{%
+ \nonfillstart
+ \gobble
+}
+
+% @format/@smallformat: same as @display except don't narrow margins.
+%
+\makedispenvdef{format}{%
+ \let\nonarrowing = t%
+ \nonfillstart
+ \gobble
+}
+
+% @flushleft: same as @format, but doesn't obey \SETdispenvsize.
+\envdef\flushleft{%
+ \let\nonarrowing = t%
+ \nonfillstart
+ \gobble
+}
+\let\Eflushleft = \afterenvbreak
+
+% @flushright.
+%
+\envdef\flushright{%
+ \let\nonarrowing = t%
+ \nonfillstart
+ \advance\leftskip by 0pt plus 1fill\relax
+ \gobble
+}
+\let\Eflushright = \afterenvbreak
+
+
+% @raggedright does more-or-less normal line breaking but no right
+% justification. From plain.tex.
+\envdef\raggedright{%
+ \rightskip0pt plus2.4em \spaceskip.3333em \xspaceskip.5em\relax
+}
+\let\Eraggedright\par
+
+\envdef\raggedleft{%
+ \parindent=0pt \leftskip0pt plus2em
+ \spaceskip.3333em \xspaceskip.5em \parfillskip=0pt
+ \hbadness=10000 % Last line will usually be underfull, so turn off
+ % badness reporting.
+}
+\let\Eraggedleft\par
+
+\envdef\raggedcenter{%
+ \parindent=0pt \rightskip0pt plus1em \leftskip0pt plus1em
+ \spaceskip.3333em \xspaceskip.5em \parfillskip=0pt
+ \hbadness=10000 % Last line will usually be underfull, so turn off
+ % badness reporting.
+}
+\let\Eraggedcenter\par
+
+
+% @quotation does normal linebreaking (hence we can't use \nonfillstart)
+% and narrows the margins. We keep \parskip nonzero in general, since
+% we're doing normal filling. So, when using \aboveenvbreak and
+% \afterenvbreak, temporarily make \parskip 0.
+%
+\makedispenvdef{quotation}{\quotationstart}
+%
+\def\quotationstart{%
+ \indentedblockstart % same as \indentedblock, but increase right margin too.
+ \ifx\nonarrowing\relax
+ \advance\rightskip by \lispnarrowing
+ \fi
+ \parsearg\quotationlabel
+}
+
+% We have retained a nonzero parskip for the environment, since we're
+% doing normal filling.
+%
+\def\Equotation{%
+ \par
+ \ifx\quotationauthor\thisisundefined\else
+ % indent a bit.
+ \leftline{\kern 2\leftskip \sl ---\quotationauthor}%
+ \fi
+ {\parskip=0pt \afterenvbreak}%
+}
+\def\Esmallquotation{\Equotation}
+
+% If we're given an argument, typeset it in bold with a colon after.
+\def\quotationlabel#1{%
+ \def\temp{#1}%
+ \ifx\temp\empty \else
+ {\bf #1: }%
+ \fi
+}
+
+% @indentedblock is like @quotation, but indents only on the left and
+% has no optional argument.
+%
+\makedispenvdef{indentedblock}{\indentedblockstart}
+%
+\def\indentedblockstart{%
+ {\parskip=0pt \aboveenvbreak}% because \aboveenvbreak inserts \parskip
+ \parindent=0pt
+ %
+ % @cartouche defines \nonarrowing to inhibit narrowing at next level down.
+ \ifx\nonarrowing\relax
+ \advance\leftskip by \lispnarrowing
+ \exdentamount = \lispnarrowing
+ \else
+ \let\nonarrowing = \relax
+ \fi
+}
+
+% Keep a nonzero parskip for the environment, since we're doing normal filling.
+%
+\def\Eindentedblock{%
+ \par
+ {\parskip=0pt \afterenvbreak}%
+}
+\def\Esmallindentedblock{\Eindentedblock}
+
+
+% LaTeX-like @verbatim...@end verbatim and @verb{...}
+% If we want to allow any as delimiter,
+% we need the curly braces so that makeinfo sees the @verb command, eg:
+% `@verbx...x' would look like the '@verbx' command. --janneke@gnu.org
+%
+% [Knuth]: Donald Ervin Knuth, 1996. The TeXbook.
+%
+% [Knuth] p.344; only we need to do the other characters Texinfo sets
+% active too. Otherwise, they get lost as the first character on a
+% verbatim line.
+\def\dospecials{%
+ \do\ \do\\\do\{\do\}\do\$\do\&%
+ \do\#\do\^\do\^^K\do\_\do\^^A\do\%\do\~%
+ \do\<\do\>\do\|\do\@\do+\do\"%
+ % Don't do the quotes -- if we do, @set txicodequoteundirected and
+ % @set txicodequotebacktick will not have effect on @verb and
+ % @verbatim, and ?` and !` ligatures won't get disabled.
+ %\do\`\do\'%
+}
+%
+% [Knuth] p. 380
+\def\uncatcodespecials{%
+ \def\do##1{\catcode`##1=\other}\dospecials}
+%
+% Setup for the @verb command.
+%
+% Eight spaces for a tab
+\begingroup
+ \catcode`\^^I=\active
+ \gdef\tabeightspaces{\catcode`\^^I=\active\def^^I{\ \ \ \ \ \ \ \ }}
+\endgroup
+%
+\def\setupverb{%
+ \tt % easiest (and conventionally used) font for verbatim
+ \def\par{\leavevmode\endgraf}%
+ \setupmarkupstyle{verb}%
+ \tabeightspaces
+ % Respect line breaks,
+ % print special symbols as themselves, and
+ % make each space count
+ % must do in this order:
+ \obeylines \uncatcodespecials \sepspaces
+}
+
+% Setup for the @verbatim environment
+%
+% Real tab expansion.
+\newdimen\tabw \setbox0=\hbox{\tt\space} \tabw=8\wd0 % tab amount
+%
+% We typeset each line of the verbatim in an \hbox, so we can handle
+% tabs. The \global is in case the verbatim line starts with an accent,
+% or some other command that starts with a begin-group. Otherwise, the
+% entire \verbbox would disappear at the corresponding end-group, before
+% it is typeset. Meanwhile, we can't have nested verbatim commands
+% (can we?), so the \global won't be overwriting itself.
+\newbox\verbbox
+\def\starttabbox{\global\setbox\verbbox=\hbox\bgroup}
+%
+\begingroup
+ \catcode`\^^I=\active
+ \gdef\tabexpand{%
+ \catcode`\^^I=\active
+ \def^^I{\leavevmode\egroup
+ \dimen\verbbox=\wd\verbbox % the width so far, or since the previous tab
+ \divide\dimen\verbbox by\tabw
+ \multiply\dimen\verbbox by\tabw % compute previous multiple of \tabw
+ \advance\dimen\verbbox by\tabw % advance to next multiple of \tabw
+ \wd\verbbox=\dimen\verbbox \box\verbbox \starttabbox
+ }%
+ }
+\endgroup
+
+% start the verbatim environment.
+\def\setupverbatim{%
+ \let\nonarrowing = t%
+ \nonfillstart
+ \tt % easiest (and conventionally used) font for verbatim
+ % The \leavevmode here is for blank lines. Otherwise, we would
+ % never \starttabbox and the \egroup would end verbatim mode.
+ \def\par{\leavevmode\egroup\box\verbbox\endgraf}%
+ \tabexpand
+ \setupmarkupstyle{verbatim}%
+ % Respect line breaks,
+ % print special symbols as themselves, and
+ % make each space count.
+ % Must do in this order:
+ \obeylines \uncatcodespecials \sepspaces
+ \everypar{\starttabbox}%
+}
+
+% Do the @verb magic: verbatim text is quoted by unique
+% delimiter characters. Before first delimiter expect a
+% right brace, after last delimiter expect closing brace:
+%
+% \def\doverb'{'#1'}'{#1}
+%
+% [Knuth] p. 382; only eat outer {}
+\begingroup
+ \catcode`[=1\catcode`]=2\catcode`\{=\other\catcode`\}=\other
+ \gdef\doverb{#1[\def\next##1#1}[##1\endgroup]\next]
+\endgroup
+%
+\def\verb{\begingroup\setupverb\doverb}
+%
+%
+% Do the @verbatim magic: define the macro \doverbatim so that
+% the (first) argument ends when '@end verbatim' is reached, ie:
+%
+% \def\doverbatim#1@end verbatim{#1}
+%
+% For Texinfo it's a lot easier than for LaTeX,
+% because texinfo's \verbatim doesn't stop at '\end{verbatim}':
+% we need not redefine '\', '{' and '}'.
+%
+% Inspired by LaTeX's verbatim command set [latex.ltx]
+%
+\begingroup
+ \catcode`\ =\active
+ \obeylines %
+ % ignore everything up to the first ^^M, that's the newline at the end
+ % of the @verbatim input line itself. Otherwise we get an extra blank
+ % line in the output.
+ \xdef\doverbatim#1^^M#2@end verbatim{#2\noexpand\end\gobble verbatim}%
+ % We really want {...\end verbatim} in the body of the macro, but
+ % without the active space; thus we have to use \xdef and \gobble.
+\endgroup
+%
+\envdef\verbatim{%
+ \setupverbatim\doverbatim
+}
+\let\Everbatim = \afterenvbreak
+
+
+% @verbatiminclude FILE - insert text of file in verbatim environment.
+%
+\def\verbatiminclude{\parseargusing\filenamecatcodes\doverbatiminclude}
+%
+\def\doverbatiminclude#1{%
+ {%
+ \makevalueexpandable
+ \setupverbatim
+ {%
+ \indexnofonts % Allow `@@' and other weird things in file names.
+ \wlog{texinfo.tex: doing @verbatiminclude of #1^^J}%
+ \edef\tmp{\noexpand\input #1 }
+ \expandafter
+ }\tmp
+ \afterenvbreak
+ }%
+}
+
+% @copying ... @end copying.
+% Save the text away for @insertcopying later.
+%
+% We save the uninterpreted tokens, rather than creating a box.
+% Saving the text in a box would be much easier, but then all the
+% typesetting commands (@smallbook, font changes, etc.) have to be done
+% beforehand -- and a) we want @copying to be done first in the source
+% file; b) letting users define the frontmatter in as flexible order as
+% possible is desirable.
+%
+\def\copying{\checkenv{}\begingroup\scanargctxt\docopying}
+\def\docopying#1@end copying{\endgroup\def\copyingtext{#1}}
+%
+\def\insertcopying{%
+ \begingroup
+ \parindent = 0pt % paragraph indentation looks wrong on title page
+ \scanexp\copyingtext
+ \endgroup
+}
+
+
+\message{defuns,}
+% @defun etc.
+
+\newskip\defbodyindent \defbodyindent=.4in
+\newskip\defargsindent \defargsindent=50pt
+\newskip\deflastargmargin \deflastargmargin=18pt
+\newcount\defunpenalty
+
+% Start the processing of @deffn:
+\def\startdefun{%
+ \ifnum\lastpenalty<10000
+ \medbreak
+ \defunpenalty=10003 % Will keep this @deffn together with the
+ % following @def command, see below.
+ \else
+ % If there are two @def commands in a row, we'll have a \nobreak,
+ % which is there to keep the function description together with its
+ % header. But if there's nothing but headers, we need to allow a
+ % break somewhere. Check specifically for penalty 10002, inserted
+ % by \printdefunline, instead of 10000, since the sectioning
+ % commands also insert a nobreak penalty, and we don't want to allow
+ % a break between a section heading and a defun.
+ %
+ % As a further refinement, we avoid "club" headers by signalling
+ % with penalty of 10003 after the very first @deffn in the
+ % sequence (see above), and penalty of 10002 after any following
+ % @def command.
+ \ifnum\lastpenalty=10002 \penalty2000 \else \defunpenalty=10002 \fi
+ %
+ % Similarly, after a section heading, do not allow a break.
+ % But do insert the glue.
+ \medskip % preceded by discardable penalty, so not a breakpoint
+ \fi
+ %
+ \parindent=0in
+ \advance\leftskip by \defbodyindent
+ \exdentamount=\defbodyindent
+}
+
+\def\dodefunx#1{%
+ % First, check whether we are in the right environment:
+ \checkenv#1%
+ %
+ % As above, allow line break if we have multiple x headers in a row.
+ % It's not a great place, though.
+ \ifnum\lastpenalty=10002 \penalty3000 \else \defunpenalty=10002 \fi
+ %
+ % And now, it's time to reuse the body of the original defun:
+ \expandafter\gobbledefun#1%
+}
+\def\gobbledefun#1\startdefun{}
+
+% \printdefunline \deffnheader{text}
+%
+\def\printdefunline#1#2{%
+ \begingroup
+ % call \deffnheader:
+ #1#2 \endheader
+ % common ending:
+ \interlinepenalty = 10000
+ \advance\rightskip by 0pt plus 1fil\relax
+ \endgraf
+ \nobreak\vskip -\parskip
+ \penalty\defunpenalty % signal to \startdefun and \dodefunx
+ % Some of the @defun-type tags do not enable magic parentheses,
+ % rendering the following check redundant. But we don't optimize.
+ \checkparencounts
+ \endgroup
+}
+
+\def\Edefun{\endgraf\medbreak}
+
+% \makedefun{deffn} creates \deffn, \deffnx and \Edeffn;
+% the only thing remaining is to define \deffnheader.
+%
+\def\makedefun#1{%
+ \expandafter\let\csname E#1\endcsname = \Edefun
+ \edef\temp{\noexpand\domakedefun
+ \makecsname{#1}\makecsname{#1x}\makecsname{#1header}}%
+ \temp
+}
+
+% \domakedefun \deffn \deffnx \deffnheader { (defn. of \deffnheader) }
+%
+% Define \deffn and \deffnx, without parameters.
+% \deffnheader has to be defined explicitly.
+%
+\def\domakedefun#1#2#3{%
+ \envdef#1{%
+ \startdefun
+ \doingtypefnfalse % distinguish typed functions from all else
+ \parseargusing\activeparens{\printdefunline#3}%
+ }%
+ \def#2{\dodefunx#1}%
+ \def#3%
+}
+
+\newif\ifdoingtypefn % doing typed function?
+\newif\ifrettypeownline % typeset return type on its own line?
+
+% @deftypefnnewline on|off says whether the return type of typed functions
+% are printed on their own line. This affects @deftypefn, @deftypefun,
+% @deftypeop, and @deftypemethod.
+%
+\parseargdef\deftypefnnewline{%
+ \def\temp{#1}%
+ \ifx\temp\onword
+ \expandafter\let\csname SETtxideftypefnnl\endcsname
+ = \empty
+ \else\ifx\temp\offword
+ \expandafter\let\csname SETtxideftypefnnl\endcsname
+ = \relax
+ \else
+ \errhelp = \EMsimple
+ \errmessage{Unknown @txideftypefnnl value `\temp',
+ must be on|off}%
+ \fi\fi
+}
+
+% \dosubind {index}{topic}{subtopic}
+%
+% If SUBTOPIC is present, precede it with a space, and call \doind.
+% (At some time during the 20th century, this made a two-level entry in an
+% index such as the operation index. Nobody seemed to notice the change in
+% behaviour though.)
+\def\dosubind#1#2#3{%
+ \def\thirdarg{#3}%
+ \ifx\thirdarg\empty
+ \doind{#1}{#2}%
+ \else
+ \doind{#1}{#2\space#3}%
+ \fi
+}
+
+% Untyped functions:
+
+% @deffn category name args
+\makedefun{deffn}{\deffngeneral{}}
+
+% @deffn category class name args
+\makedefun{defop}#1 {\defopon{#1\ \putwordon}}
+
+% \defopon {category on}class name args
+\def\defopon#1#2 {\deffngeneral{\putwordon\ \code{#2}}{#1\ \code{#2}} }
+
+% \deffngeneral {subind}category name args
+%
+\def\deffngeneral#1#2 #3 #4\endheader{%
+ \dosubind{fn}{\code{#3}}{#1}%
+ \defname{#2}{}{#3}\magicamp\defunargs{#4\unskip}%
+}
+
+% Typed functions:
+
+% @deftypefn category type name args
+\makedefun{deftypefn}{\deftypefngeneral{}}
+
+% @deftypeop category class type name args
+\makedefun{deftypeop}#1 {\deftypeopon{#1\ \putwordon}}
+
+% \deftypeopon {category on}class type name args
+\def\deftypeopon#1#2 {\deftypefngeneral{\putwordon\ \code{#2}}{#1\ \code{#2}} }
+
+% \deftypefngeneral {subind}category type name args
+%
+\def\deftypefngeneral#1#2 #3 #4 #5\endheader{%
+ \dosubind{fn}{\code{#4}}{#1}%
+ \doingtypefntrue
+ \defname{#2}{#3}{#4}\defunargs{#5\unskip}%
+}
+
+% Typed variables:
+
+% @deftypevr category type var args
+\makedefun{deftypevr}{\deftypecvgeneral{}}
+
+% @deftypecv category class type var args
+\makedefun{deftypecv}#1 {\deftypecvof{#1\ \putwordof}}
+
+% \deftypecvof {category of}class type var args
+\def\deftypecvof#1#2 {\deftypecvgeneral{\putwordof\ \code{#2}}{#1\ \code{#2}} }
+
+% \deftypecvgeneral {subind}category type var args
+%
+\def\deftypecvgeneral#1#2 #3 #4 #5\endheader{%
+ \dosubind{vr}{\code{#4}}{#1}%
+ \defname{#2}{#3}{#4}\defunargs{#5\unskip}%
+}
+
+% Untyped variables:
+
+% @defvr category var args
+\makedefun{defvr}#1 {\deftypevrheader{#1} {} }
+
+% @defcv category class var args
+\makedefun{defcv}#1 {\defcvof{#1\ \putwordof}}
+
+% \defcvof {category of}class var args
+\def\defcvof#1#2 {\deftypecvof{#1}#2 {} }
+
+% Types:
+
+% @deftp category name args
+\makedefun{deftp}#1 #2 #3\endheader{%
+ \doind{tp}{\code{#2}}%
+ \defname{#1}{}{#2}\defunargs{#3\unskip}%
+}
+
+% Remaining @defun-like shortcuts:
+\makedefun{defun}{\deffnheader{\putwordDeffunc} }
+\makedefun{defmac}{\deffnheader{\putwordDefmac} }
+\makedefun{defspec}{\deffnheader{\putwordDefspec} }
+\makedefun{deftypefun}{\deftypefnheader{\putwordDeffunc} }
+\makedefun{defvar}{\defvrheader{\putwordDefvar} }
+\makedefun{defopt}{\defvrheader{\putwordDefopt} }
+\makedefun{deftypevar}{\deftypevrheader{\putwordDefvar} }
+\makedefun{defmethod}{\defopon\putwordMethodon}
+\makedefun{deftypemethod}{\deftypeopon\putwordMethodon}
+\makedefun{defivar}{\defcvof\putwordInstanceVariableof}
+\makedefun{deftypeivar}{\deftypecvof\putwordInstanceVariableof}
+
+% \defname, which formats the name of the @def (not the args).
+% #1 is the category, such as "Function".
+% #2 is the return type, if any.
+% #3 is the function name.
+%
+% We are followed by (but not passed) the arguments, if any.
+%
+\def\defname#1#2#3{%
+ \par
+ % Get the values of \leftskip and \rightskip as they were outside the @def...
+ \advance\leftskip by -\defbodyindent
+ %
+ % Determine if we are typesetting the return type of a typed function
+ % on a line by itself.
+ \rettypeownlinefalse
+ \ifdoingtypefn % doing a typed function specifically?
+ % then check user option for putting return type on its own line:
+ \expandafter\ifx\csname SETtxideftypefnnl\endcsname\relax \else
+ \rettypeownlinetrue
+ \fi
+ \fi
+ %
+ % How we'll format the category name. Putting it in brackets helps
+ % distinguish it from the body text that may end up on the next line
+ % just below it.
+ \def\temp{#1}%
+ \setbox0=\hbox{\kern\deflastargmargin \ifx\temp\empty\else [\rm\temp]\fi}
+ %
+ % Figure out line sizes for the paragraph shape. We'll always have at
+ % least two.
+ \tempnum = 2
+ %
+ % The first line needs space for \box0; but if \rightskip is nonzero,
+ % we need only space for the part of \box0 which exceeds it:
+ \dimen0=\hsize \advance\dimen0 by -\wd0 \advance\dimen0 by \rightskip
+ %
+ % If doing a return type on its own line, we'll have another line.
+ \ifrettypeownline
+ \advance\tempnum by 1
+ \def\maybeshapeline{0in \hsize}%
+ \else
+ \def\maybeshapeline{}%
+ \fi
+ %
+ % The continuations:
+ \dimen2=\hsize \advance\dimen2 by -\defargsindent
+ %
+ % The final paragraph shape:
+ \parshape \tempnum 0in \dimen0 \maybeshapeline \defargsindent \dimen2
+ %
+ % Put the category name at the right margin.
+ \noindent
+ \hbox to 0pt{%
+ \hfil\box0 \kern-\hsize
+ % \hsize has to be shortened this way:
+ \kern\leftskip
+ % Intentionally do not respect \rightskip, since we need the space.
+ }%
+ %
+ % Allow all lines to be underfull without complaint:
+ \tolerance=10000 \hbadness=10000
+ \exdentamount=\defbodyindent
+ {%
+ % defun fonts. We use typewriter by default (used to be bold) because:
+ % . we're printing identifiers, they should be in tt in principle.
+ % . in languages with many accents, such as Czech or French, it's
+ % common to leave accents off identifiers. The result looks ok in
+ % tt, but exceedingly strange in rm.
+ % . we don't want -- and --- to be treated as ligatures.
+ % . this still does not fix the ?` and !` ligatures, but so far no
+ % one has made identifiers using them :).
+ \df \tt
+ \def\temp{#2}% text of the return type
+ \ifx\temp\empty\else
+ \tclose{\temp}% typeset the return type
+ \ifrettypeownline
+ % put return type on its own line; prohibit line break following:
+ \hfil\vadjust{\nobreak}\break
+ \else
+ \space % type on same line, so just followed by a space
+ \fi
+ \fi % no return type
+ #3% output function name
+ }%
+ {\rm\enskip}% hskip 0.5 em of \rmfont
+ %
+ \boldbrax
+ % arguments will be output next, if any.
+}
+
+% Print arguments in slanted roman (not ttsl), inconsistently with using
+% tt for the name. This is because literal text is sometimes needed in
+% the argument list (groff manual), and ttsl and tt are not very
+% distinguishable. Prevent hyphenation at `-' chars.
+%
+\def\defunargs#1{%
+ % use sl by default (not ttsl),
+ % tt for the names.
+ \df \sl \hyphenchar\font=0
+ %
+ % On the other hand, if an argument has two dashes (for instance), we
+ % want a way to get ttsl. We used to recommend @var for that, so
+ % leave the code in, but it's strange for @var to lead to typewriter.
+ % Nowadays we recommend @code, since the difference between a ttsl hyphen
+ % and a tt hyphen is pretty tiny. @code also disables ?` !`.
+ \def\var##1{{\setupmarkupstyle{var}\ttslanted{##1}}}%
+ #1%
+ \sl\hyphenchar\font=45
+}
+
+% We want ()&[] to print specially on the defun line.
+%
+\def\activeparens{%
+ \catcode`\(=\active \catcode`\)=\active
+ \catcode`\[=\active \catcode`\]=\active
+ \catcode`\&=\active
+}
+
+% Make control sequences which act like normal parenthesis chars.
+\let\lparen = ( \let\rparen = )
+
+% Be sure that we always have a definition for `(', etc. For example,
+% if the fn name has parens in it, \boldbrax will not be in effect yet,
+% so TeX would otherwise complain about undefined control sequence.
+{
+ \activeparens
+ \global\let(=\lparen \global\let)=\rparen
+ \global\let[=\lbrack \global\let]=\rbrack
+ \global\let& = \&
+
+ \gdef\boldbrax{\let(=\opnr\let)=\clnr\let[=\lbrb\let]=\rbrb}
+ \gdef\magicamp{\let&=\amprm}
+}
+\let\ampchar\&
+
+\newcount\parencount
+
+% If we encounter &foo, then turn on ()-hacking afterwards
+\newif\ifampseen
+\def\amprm#1 {\ampseentrue{\bf\ }}
+
+\def\parenfont{%
+ \ifampseen
+ % At the first level, print parens in roman,
+ % otherwise use the default font.
+ \ifnum \parencount=1 \rm \fi
+ \else
+ % The \sf parens (in \boldbrax) actually are a little bolder than
+ % the contained text. This is especially needed for [ and ] .
+ \sf
+ \fi
+}
+\def\infirstlevel#1{%
+ \ifampseen
+ \ifnum\parencount=1
+ #1%
+ \fi
+ \fi
+}
+\def\bfafterword#1 {#1 \bf}
+
+\def\opnr{%
+ \global\advance\parencount by 1
+ {\parenfont(}%
+ \infirstlevel \bfafterword
+}
+\def\clnr{%
+ {\parenfont)}%
+ \infirstlevel \sl
+ \global\advance\parencount by -1
+}
+
+\newcount\brackcount
+\def\lbrb{%
+ \global\advance\brackcount by 1
+ {\bf[}%
+}
+\def\rbrb{%
+ {\bf]}%
+ \global\advance\brackcount by -1
+}
+
+\def\checkparencounts{%
+ \ifnum\parencount=0 \else \badparencount \fi
+ \ifnum\brackcount=0 \else \badbrackcount \fi
+}
+% these should not use \errmessage; the glibc manual, at least, actually
+% has such constructs (when documenting function pointers).
+\def\badparencount{%
+ \message{Warning: unbalanced parentheses in @def...}%
+ \global\parencount=0
+}
+\def\badbrackcount{%
+ \message{Warning: unbalanced square brackets in @def...}%
+ \global\brackcount=0
+}
+
+
+\message{macros,}
+% @macro.
+
+% To do this right we need a feature of e-TeX, \scantokens,
+% which we arrange to emulate with a temporary file in ordinary TeX.
+\ifx\eTeXversion\thisisundefined
+ \newwrite\macscribble
+ \def\scantokens#1{%
+ \toks0={#1}%
+ \immediate\openout\macscribble=\jobname.tmp
+ \immediate\write\macscribble{\the\toks0}%
+ \immediate\closeout\macscribble
+ \input \jobname.tmp
+ }
+\fi
+
+% Used at the time of macro expansion.
+% Argument is macro body with arguments substituted
+\def\scanmacro#1{%
+ \newlinechar`\^^M
+ \def\xeatspaces{\eatspaces}%
+ %
+ % Process the macro body under the current catcode regime.
+ \scantokens{#1@comment}%
+ %
+ % The \comment is to remove the \newlinechar added by \scantokens, and
+ % can be noticed by \parsearg. Note \c isn't used because this means cedilla
+ % in math mode.
+}
+
+% Used for copying and captions
+\def\scanexp#1{%
+ \expandafter\scanmacro\expandafter{#1}%
+}
+
+\newcount\paramno % Count of parameters
+\newtoks\macname % Macro name
+\newif\ifrecursive % Is it recursive?
+
+% List of all defined macros in the form
+% \commondummyword\macro1\commondummyword\macro2...
+% Currently is also contains all @aliases; the list can be split
+% if there is a need.
+\def\macrolist{}
+
+% Add the macro to \macrolist
+\def\addtomacrolist#1{\expandafter \addtomacrolistxxx \csname#1\endcsname}
+\def\addtomacrolistxxx#1{%
+ \toks0 = \expandafter{\macrolist\commondummyword#1}%
+ \xdef\macrolist{\the\toks0}%
+}
+
+% Utility routines.
+% This does \let #1 = #2, with \csnames; that is,
+% \let \csname#1\endcsname = \csname#2\endcsname
+% (except of course we have to play expansion games).
+%
+\def\cslet#1#2{%
+ \expandafter\let
+ \csname#1\expandafter\endcsname
+ \csname#2\endcsname
+}
+
+% Trim leading and trailing spaces off a string.
+% Concepts from aro-bend problem 15 (see CTAN).
+{\catcode`\@=11
+\gdef\eatspaces #1{\expandafter\trim@\expandafter{#1 }}
+\gdef\trim@ #1{\trim@@ @#1 @ #1 @ @@}
+\gdef\trim@@ #1@ #2@ #3@@{\trim@@@\empty #2 @}
+\def\unbrace#1{#1}
+\unbrace{\gdef\trim@@@ #1 } #2@{#1}
+}
+
+% Trim a single trailing ^^M off a string.
+{\catcode`\^^M=\other \catcode`\Q=3%
+\gdef\eatcr #1{\eatcra #1Q^^MQ}%
+\gdef\eatcra#1^^MQ{\eatcrb#1Q}%
+\gdef\eatcrb#1Q#2Q{#1}%
+}
+
+% Macro bodies are absorbed as an argument in a context where
+% all characters are catcode 10, 11 or 12, except \ which is active
+% (as in normal texinfo). It is necessary to change the definition of \
+% to recognize macro arguments; this is the job of \mbodybackslash.
+%
+% Non-ASCII encodings make 8-bit characters active, so un-activate
+% them to avoid their expansion. Must do this non-globally, to
+% confine the change to the current group.
+%
+% It's necessary to have hard CRs when the macro is executed. This is
+% done by making ^^M (\endlinechar) catcode 12 when reading the macro
+% body, and then making it the \newlinechar in \scanmacro.
+%
+\def\scanctxt{% used as subroutine
+ \catcode`\"=\other
+ \catcode`\+=\other
+ \catcode`\<=\other
+ \catcode`\>=\other
+ \catcode`\^=\other
+ \catcode`\_=\other
+ \catcode`\|=\other
+ \catcode`\~=\other
+ \passthroughcharstrue
+}
+
+\def\scanargctxt{% used for copying and captions, not macros.
+ \scanctxt
+ \catcode`\@=\other
+ \catcode`\\=\other
+ \catcode`\^^M=\other
+}
+
+\def\macrobodyctxt{% used for @macro definitions
+ \scanctxt
+ \catcode`\ =\other
+ \catcode`\@=\other
+ \catcode`\{=\other
+ \catcode`\}=\other
+ \catcode`\^^M=\other
+ \usembodybackslash
+}
+
+% Used when scanning braced macro arguments. Note, however, that catcode
+% changes here are ineffectual if the macro invocation was nested inside
+% an argument to another Texinfo command.
+\def\macroargctxt{%
+ \scanctxt
+ \catcode`\ =\active
+ \catcode`\@=\other
+ \catcode`\^^M=\other
+ \catcode`\\=\active
+}
+
+\def\macrolineargctxt{% used for whole-line arguments without braces
+ \scanctxt
+ \catcode`\@=\other
+ \catcode`\{=\other
+ \catcode`\}=\other
+}
+
+% \mbodybackslash is the definition of \ in @macro bodies.
+% It maps \foo\ => \csname macarg.foo\endcsname => #N
+% where N is the macro parameter number.
+% We define \csname macarg.\endcsname to be \realbackslash, so
+% \\ in macro replacement text gets you a backslash.
+%
+{\catcode`@=0 @catcode`@\=@active
+ @gdef@usembodybackslash{@let\=@mbodybackslash}
+ @gdef@mbodybackslash#1\{@csname macarg.#1@endcsname}
+}
+\expandafter\def\csname macarg.\endcsname{\realbackslash}
+
+\def\margbackslash#1{\char`\#1 }
+
+\def\macro{\recursivefalse\parsearg\macroxxx}
+\def\rmacro{\recursivetrue\parsearg\macroxxx}
+
+\def\macroxxx#1{%
+ \getargs{#1}% now \macname is the macname and \argl the arglist
+ \ifx\argl\empty % no arguments
+ \paramno=0\relax
+ \else
+ \expandafter\parsemargdef \argl;%
+ \if\paramno>256\relax
+ \ifx\eTeXversion\thisisundefined
+ \errhelp = \EMsimple
+ \errmessage{You need eTeX to compile a file with macros with more than 256 arguments}
+ \fi
+ \fi
+ \fi
+ \if1\csname ismacro.\the\macname\endcsname
+ \message{Warning: redefining \the\macname}%
+ \else
+ \expandafter\ifx\csname \the\macname\endcsname \relax
+ \else \errmessage{Macro name \the\macname\space already defined}\fi
+ \global\cslet{macsave.\the\macname}{\the\macname}%
+ \global\expandafter\let\csname ismacro.\the\macname\endcsname=1%
+ \addtomacrolist{\the\macname}%
+ \fi
+ \begingroup \macrobodyctxt
+ \ifrecursive \expandafter\parsermacbody
+ \else \expandafter\parsemacbody
+ \fi}
+
+\parseargdef\unmacro{%
+ \if1\csname ismacro.#1\endcsname
+ \global\cslet{#1}{macsave.#1}%
+ \global\expandafter\let \csname ismacro.#1\endcsname=0%
+ % Remove the macro name from \macrolist:
+ \begingroup
+ \expandafter\let\csname#1\endcsname \relax
+ \let\commondummyword\unmacrodo
+ \xdef\macrolist{\macrolist}%
+ \endgroup
+ \else
+ \errmessage{Macro #1 not defined}%
+ \fi
+}
+
+% Called by \do from \dounmacro on each macro. The idea is to omit any
+% macro definitions that have been changed to \relax.
+%
+\def\unmacrodo#1{%
+ \ifx #1\relax
+ % remove this
+ \else
+ \noexpand\commondummyword \noexpand#1%
+ \fi
+}
+
+% \getargs -- Parse the arguments to a @macro line. Set \macname to
+% the name of the macro, and \argl to the braced argument list.
+\def\getargs#1{\getargsxxx#1{}}
+\def\getargsxxx#1#{\getmacname #1 \relax\getmacargs}
+\def\getmacname#1 #2\relax{\macname={#1}}
+\def\getmacargs#1{\def\argl{#1}}
+% This made use of the feature that if the last token of a
+% is #, then the preceding argument is delimited by
+% an opening brace, and that opening brace is not consumed.
+
+% Parse the optional {params} list to @macro or @rmacro.
+% Set \paramno to the number of arguments,
+% and \paramlist to a parameter text for the macro (e.g. #1,#2,#3 for a
+% three-param macro.) Define \macarg.BLAH for each BLAH in the params
+% list to some hook where the argument is to be expanded. If there are
+% less than 10 arguments that hook is to be replaced by ##N where N
+% is the position in that list, that is to say the macro arguments are to be
+% defined `a la TeX in the macro body.
+%
+% That gets used by \mbodybackslash (above).
+%
+% If there are 10 or more arguments, a different technique is used: see
+% \parsemmanyargdef.
+%
+\def\parsemargdef#1;{%
+ \paramno=0\def\paramlist{}%
+ \let\hash\relax
+ % \hash is redefined to `#' later to get it into definitions
+ \let\xeatspaces\relax
+ \parsemargdefxxx#1,;,%
+ \ifnum\paramno<10\relax\else
+ \paramno0\relax
+ \parsemmanyargdef@@#1,;,% 10 or more arguments
+ \fi
+}
+\def\parsemargdefxxx#1,{%
+ \if#1;\let\next=\relax
+ \else \let\next=\parsemargdefxxx
+ \advance\paramno by 1
+ \expandafter\edef\csname macarg.\eatspaces{#1}\endcsname
+ {\xeatspaces{\hash\the\paramno}}%
+ \edef\paramlist{\paramlist\hash\the\paramno,}%
+ \fi\next}
+
+% \parsemacbody, \parsermacbody
+%
+% Read recursive and nonrecursive macro bodies. (They're different since
+% rec and nonrec macros end differently.)
+%
+% We are in \macrobodyctxt, and the \xdef causes backslashshes in the macro
+% body to be transformed.
+% Set \macrobody to the body of the macro, and call \defmacro.
+%
+{\catcode`\ =\other\long\gdef\parsemacbody#1@end macro{%
+\xdef\macrobody{\eatcr{#1}}\endgroup\defmacro}}%
+{\catcode`\ =\other\long\gdef\parsermacbody#1@end rmacro{%
+\xdef\macrobody{\eatcr{#1}}\endgroup\defmacro}}%
+
+% Make @ a letter, so that we can make private-to-Texinfo macro names.
+\edef\texiatcatcode{\the\catcode`\@}
+\catcode `@=11\relax
+
+%%%%%%%%%%%%%% Code for > 10 arguments only %%%%%%%%%%%%%%%%%%
+
+% If there are 10 or more arguments, a different technique is used, where the
+% hook remains in the body, and when macro is to be expanded the body is
+% processed again to replace the arguments.
+%
+% In that case, the hook is \the\toks N-1, and we simply set \toks N-1 to the
+% argument N value and then \edef the body (nothing else will expand because of
+% the catcode regime under which the body was input).
+%
+% If you compile with TeX (not eTeX), and you have macros with 10 or more
+% arguments, no macro can have more than 256 arguments (else error).
+%
+% In case that there are 10 or more arguments we parse again the arguments
+% list to set new definitions for the \macarg.BLAH macros corresponding to
+% each BLAH argument. It was anyhow needed to parse already once this list
+% in order to count the arguments, and as macros with at most 9 arguments
+% are by far more frequent than macro with 10 or more arguments, defining
+% twice the \macarg.BLAH macros does not cost too much processing power.
+\def\parsemmanyargdef@@#1,{%
+ \if#1;\let\next=\relax
+ \else
+ \let\next=\parsemmanyargdef@@
+ \edef\tempb{\eatspaces{#1}}%
+ \expandafter\def\expandafter\tempa
+ \expandafter{\csname macarg.\tempb\endcsname}%
+ % Note that we need some extra \noexpand\noexpand, this is because we
+ % don't want \the to be expanded in the \parsermacbody as it uses an
+ % \xdef .
+ \expandafter\edef\tempa
+ {\noexpand\noexpand\noexpand\the\toks\the\paramno}%
+ \advance\paramno by 1\relax
+ \fi\next}
+
+
+\let\endargs@\relax
+\let\nil@\relax
+\def\nilm@{\nil@}%
+\long\def\nillm@{\nil@}%
+
+% This macro is expanded during the Texinfo macro expansion, not during its
+% definition. It gets all the arguments' values and assigns them to macros
+% macarg.ARGNAME
+%
+% #1 is the macro name
+% #2 is the list of argument names
+% #3 is the list of argument values
+\def\getargvals@#1#2#3{%
+ \def\macargdeflist@{}%
+ \def\saveparamlist@{#2}% Need to keep a copy for parameter expansion.
+ \def\paramlist{#2,\nil@}%
+ \def\macroname{#1}%
+ \begingroup
+ \macroargctxt
+ \def\argvaluelist{#3,\nil@}%
+ \def\@tempa{#3}%
+ \ifx\@tempa\empty
+ \setemptyargvalues@
+ \else
+ \getargvals@@
+ \fi
+}
+\def\getargvals@@{%
+ \ifx\paramlist\nilm@
+ % Some sanity check needed here that \argvaluelist is also empty.
+ \ifx\argvaluelist\nillm@
+ \else
+ \errhelp = \EMsimple
+ \errmessage{Too many arguments in macro `\macroname'!}%
+ \fi
+ \let\next\macargexpandinbody@
+ \else
+ \ifx\argvaluelist\nillm@
+ % No more arguments values passed to macro. Set remaining named-arg
+ % macros to empty.
+ \let\next\setemptyargvalues@
+ \else
+ % pop current arg name into \@tempb
+ \def\@tempa##1{\pop@{\@tempb}{\paramlist}##1\endargs@}%
+ \expandafter\@tempa\expandafter{\paramlist}%
+ % pop current argument value into \@tempc
+ \def\@tempa##1{\longpop@{\@tempc}{\argvaluelist}##1\endargs@}%
+ \expandafter\@tempa\expandafter{\argvaluelist}%
+ % Here \@tempb is the current arg name and \@tempc is the current arg value.
+ % First place the new argument macro definition into \@tempd
+ \expandafter\macname\expandafter{\@tempc}%
+ \expandafter\let\csname macarg.\@tempb\endcsname\relax
+ \expandafter\def\expandafter\@tempe\expandafter{%
+ \csname macarg.\@tempb\endcsname}%
+ \edef\@tempd{\long\def\@tempe{\the\macname}}%
+ \push@\@tempd\macargdeflist@
+ \let\next\getargvals@@
+ \fi
+ \fi
+ \next
+}
+
+\def\push@#1#2{%
+ \expandafter\expandafter\expandafter\def
+ \expandafter\expandafter\expandafter#2%
+ \expandafter\expandafter\expandafter{%
+ \expandafter#1#2}%
+}
+
+% Replace arguments by their values in the macro body, and place the result
+% in macro \@tempa.
+%
+\def\macvalstoargs@{%
+ % To do this we use the property that token registers that are \the'ed
+ % within an \edef expand only once. So we are going to place all argument
+ % values into respective token registers.
+ %
+ % First we save the token context, and initialize argument numbering.
+ \begingroup
+ \paramno0\relax
+ % Then, for each argument number #N, we place the corresponding argument
+ % value into a new token list register \toks#N
+ \expandafter\putargsintokens@\saveparamlist@,;,%
+ % Then, we expand the body so that argument are replaced by their
+ % values. The trick for values not to be expanded themselves is that they
+ % are within tokens and that tokens expand only once in an \edef .
+ \edef\@tempc{\csname mac.\macroname .body\endcsname}%
+ % Now we restore the token stack pointer to free the token list registers
+ % which we have used, but we make sure that expanded body is saved after
+ % group.
+ \expandafter
+ \endgroup
+ \expandafter\def\expandafter\@tempa\expandafter{\@tempc}%
+ }
+
+% Define the named-macro outside of this group and then close this group.
+%
+\def\macargexpandinbody@{%
+ \expandafter
+ \endgroup
+ \macargdeflist@
+ % First the replace in body the macro arguments by their values, the result
+ % is in \@tempa .
+ \macvalstoargs@
+ % Then we point at the \norecurse or \gobble (for recursive) macro value
+ % with \@tempb .
+ \expandafter\let\expandafter\@tempb\csname mac.\macroname .recurse\endcsname
+ % Depending on whether it is recursive or not, we need some tailing
+ % \egroup .
+ \ifx\@tempb\gobble
+ \let\@tempc\relax
+ \else
+ \let\@tempc\egroup
+ \fi
+ % And now we do the real job:
+ \edef\@tempd{\noexpand\@tempb{\macroname}\noexpand\scanmacro{\@tempa}\@tempc}%
+ \@tempd
+}
+
+\def\putargsintokens@#1,{%
+ \if#1;\let\next\relax
+ \else
+ \let\next\putargsintokens@
+ % First we allocate the new token list register, and give it a temporary
+ % alias \@tempb .
+ \toksdef\@tempb\the\paramno
+ % Then we place the argument value into that token list register.
+ \expandafter\let\expandafter\@tempa\csname macarg.#1\endcsname
+ \expandafter\@tempb\expandafter{\@tempa}%
+ \advance\paramno by 1\relax
+ \fi
+ \next
+}
+
+% Trailing missing arguments are set to empty.
+%
+\def\setemptyargvalues@{%
+ \ifx\paramlist\nilm@
+ \let\next\macargexpandinbody@
+ \else
+ \expandafter\setemptyargvaluesparser@\paramlist\endargs@
+ \let\next\setemptyargvalues@
+ \fi
+ \next
+}
+
+\def\setemptyargvaluesparser@#1,#2\endargs@{%
+ \expandafter\def\expandafter\@tempa\expandafter{%
+ \expandafter\def\csname macarg.#1\endcsname{}}%
+ \push@\@tempa\macargdeflist@
+ \def\paramlist{#2}%
+}
+
+% #1 is the element target macro
+% #2 is the list macro
+% #3,#4\endargs@ is the list value
+\def\pop@#1#2#3,#4\endargs@{%
+ \def#1{#3}%
+ \def#2{#4}%
+}
+\long\def\longpop@#1#2#3,#4\endargs@{%
+ \long\def#1{#3}%
+ \long\def#2{#4}%
+}
+
+
+%%%%%%%%%%%%%% End of code for > 10 arguments %%%%%%%%%%%%%%%%%%
+
+
+% This defines a Texinfo @macro or @rmacro, called by \parsemacbody.
+% \macrobody has the body of the macro in it, with placeholders for
+% its parameters, looking like "\xeatspaces{\hash 1}".
+% \paramno is the number of parameters
+% \paramlist is a TeX parameter text, e.g. "#1,#2,#3,"
+% There are four cases: macros of zero, one, up to nine, and many arguments.
+% \xdef is used so that macro definitions will survive the file
+% they're defined in: @include reads the file inside a group.
+%
+\def\defmacro{%
+ \let\hash=##% convert placeholders to macro parameter chars
+ \ifnum\paramno=1
+ \def\xeatspaces##1{##1}%
+ % This removes the pair of braces around the argument. We don't
+ % use \eatspaces, because this can cause ends of lines to be lost
+ % when the argument to \eatspaces is read, leading to line-based
+ % commands like "@itemize" not being read correctly.
+ \else
+ \let\xeatspaces\relax % suppress expansion
+ \fi
+ \ifcase\paramno
+ % 0
+ \expandafter\xdef\csname\the\macname\endcsname{%
+ \bgroup
+ \noexpand\spaceisspace
+ \noexpand\endlineisspace
+ \noexpand\expandafter % skip any whitespace after the macro name.
+ \expandafter\noexpand\csname\the\macname @@@\endcsname}%
+ \expandafter\xdef\csname\the\macname @@@\endcsname{%
+ \egroup
+ \noexpand\scanmacro{\macrobody}}%
+ \or % 1
+ \expandafter\xdef\csname\the\macname\endcsname{%
+ \bgroup
+ \noexpand\braceorline
+ \expandafter\noexpand\csname\the\macname @@@\endcsname}%
+ \expandafter\xdef\csname\the\macname @@@\endcsname##1{%
+ \egroup
+ \noexpand\scanmacro{\macrobody}%
+ }%
+ \else % at most 9
+ \ifnum\paramno<10\relax
+ % @MACNAME sets the context for reading the macro argument
+ % @MACNAME@@ gets the argument, processes backslashes and appends a
+ % comma.
+ % @MACNAME@@@ removes braces surrounding the argument list.
+ % @MACNAME@@@@ scans the macro body with arguments substituted.
+ \expandafter\xdef\csname\the\macname\endcsname{%
+ \bgroup
+ \noexpand\expandafter % This \expandafter skip any spaces after the
+ \noexpand\macroargctxt % macro before we change the catcode of space.
+ \noexpand\expandafter
+ \expandafter\noexpand\csname\the\macname @@\endcsname}%
+ \expandafter\xdef\csname\the\macname @@\endcsname##1{%
+ \noexpand\passargtomacro
+ \expandafter\noexpand\csname\the\macname @@@\endcsname{##1,}}%
+ \expandafter\xdef\csname\the\macname @@@\endcsname##1{%
+ \expandafter\noexpand\csname\the\macname @@@@\endcsname ##1}%
+ \expandafter\expandafter
+ \expandafter\xdef
+ \expandafter\expandafter
+ \csname\the\macname @@@@\endcsname\paramlist{%
+ \egroup\noexpand\scanmacro{\macrobody}}%
+ \else % 10 or more:
+ \expandafter\xdef\csname\the\macname\endcsname{%
+ \noexpand\getargvals@{\the\macname}{\argl}%
+ }%
+ \global\expandafter\let\csname mac.\the\macname .body\endcsname\macrobody
+ \global\expandafter\let\csname mac.\the\macname .recurse\endcsname\gobble
+ \fi
+ \fi}
+
+\catcode `\@\texiatcatcode\relax % end private-to-Texinfo catcodes
+
+\def\norecurse#1{\bgroup\cslet{#1}{macsave.#1}}
+
+
+%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%
+%
+{\catcode`\@=0 \catcode`\\=13 % We need to manipulate \ so use @ as escape
+@catcode`@_=11 % private names
+@catcode`@!=11 % used as argument separator
+
+% \passargtomacro#1#2 -
+% Call #1 with a list of tokens #2, with any doubled backslashes in #2
+% compressed to one.
+%
+% This implementation works by expansion, and not execution (so we cannot use
+% \def or similar). This reduces the risk of this failing in contexts where
+% complete expansion is done with no execution (for example, in writing out to
+% an auxiliary file for an index entry).
+%
+% State is kept in the input stream: the argument passed to
+% @look_ahead, @gobble_and_check_finish and @add_segment is
+%
+% THE_MACRO ARG_RESULT ! {PENDING_BS} NEXT_TOKEN (... rest of input)
+%
+% where:
+% THE_MACRO - name of the macro we want to call
+% ARG_RESULT - argument list we build to pass to that macro
+% PENDING_BS - either a backslash or nothing
+% NEXT_TOKEN - used to look ahead in the input stream to see what's coming next
+
+@gdef@passargtomacro#1#2{%
+ @add_segment #1!{}@relax#2\@_finish\%
+}
+@gdef@_finish{@_finishx} @global@let@_finishx@relax
+
+% #1 - THE_MACRO ARG_RESULT
+% #2 - PENDING_BS
+% #3 - NEXT_TOKEN
+% #4 used to look ahead
+%
+% If the next token is not a backslash, process the rest of the argument;
+% otherwise, remove the next token.
+@gdef@look_ahead#1!#2#3#4{%
+ @ifx#4\%
+ @expandafter@gobble_and_check_finish
+ @else
+ @expandafter@add_segment
+ @fi#1!{#2}#4#4%
+}
+
+% #1 - THE_MACRO ARG_RESULT
+% #2 - PENDING_BS
+% #3 - NEXT_TOKEN
+% #4 should be a backslash, which is gobbled.
+% #5 looks ahead
+%
+% Double backslash found. Add a single backslash, and look ahead.
+@gdef@gobble_and_check_finish#1!#2#3#4#5{%
+ @add_segment#1\!{}#5#5%
+}
+
+@gdef@is_fi{@fi}
+
+% #1 - THE_MACRO ARG_RESULT
+% #2 - PENDING_BS
+% #3 - NEXT_TOKEN
+% #4 is input stream until next backslash
+%
+% Input stream is either at the start of the argument, or just after a
+% backslash sequence, either a lone backslash, or a doubled backslash.
+% NEXT_TOKEN contains the first token in the input stream: if it is \finish,
+% finish; otherwise, append to ARG_RESULT the segment of the argument up until
+% the next backslash. PENDING_BACKSLASH contains a backslash to represent
+% a backslash just before the start of the input stream that has not been
+% added to ARG_RESULT.
+@gdef@add_segment#1!#2#3#4\{%
+@ifx#3@_finish
+ @call_the_macro#1!%
+@else
+ % append the pending backslash to the result, followed by the next segment
+ @expandafter@is_fi@look_ahead#1#2#4!{\}@fi
+ % this @fi is discarded by @look_ahead.
+ % we can't get rid of it with \expandafter because we don't know how
+ % long #4 is.
+}
+
+% #1 - THE_MACRO
+% #2 - ARG_RESULT
+% #3 discards the res of the conditional in @add_segment, and @is_fi ends the
+% conditional.
+@gdef@call_the_macro#1#2!#3@fi{@is_fi #1{#2}}
+
+}
+%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%
+
+% \braceorline MAC is used for a one-argument macro MAC. It checks
+% whether the next non-whitespace character is a {. It sets the context
+% for reading the argument (slightly different in the two cases). Then,
+% to read the argument, in the whole-line case, it then calls the regular
+% \parsearg MAC; in the lbrace case, it calls \passargtomacro MAC.
+%
+\def\braceorline#1{\let\macnamexxx=#1\futurelet\nchar\braceorlinexxx}
+\def\braceorlinexxx{%
+ \ifx\nchar\bgroup
+ \macroargctxt
+ \expandafter\passargtomacro
+ \else
+ \macrolineargctxt\expandafter\parsearg
+ \fi \macnamexxx}
+
+
+% @alias.
+% We need some trickery to remove the optional spaces around the equal
+% sign. Make them active and then expand them all to nothing.
+%
+\def\alias{\parseargusing\obeyspaces\aliasxxx}
+\def\aliasxxx #1{\aliasyyy#1\relax}
+\def\aliasyyy #1=#2\relax{%
+ {%
+ \expandafter\let\obeyedspace=\empty
+ \addtomacrolist{#1}%
+ \xdef\next{\global\let\makecsname{#1}=\makecsname{#2}}%
+ }%
+ \next
+}
+
+
+\message{cross references,}
+
+\newwrite\auxfile
+\newif\ifhavexrefs % True if xref values are known.
+\newif\ifwarnedxrefs % True if we warned once that they aren't known.
+
+% @inforef is relatively simple.
+\def\inforef #1{\inforefzzz #1,,,,**}
+\def\inforefzzz #1,#2,#3,#4**{%
+ \putwordSee{} \putwordInfo{} \putwordfile{} \file{\ignorespaces #3{}},
+ node \samp{\ignorespaces#1{}}}
+
+% @node's only job in TeX is to define \lastnode, which is used in
+% cross-references. The @node line might or might not have commas, and
+% might or might not have spaces before the first comma, like:
+% @node foo , bar , ...
+% We don't want such trailing spaces in the node name.
+%
+\parseargdef\node{\checkenv{}\donode #1 ,\finishnodeparse}
+%
+% also remove a trailing comma, in case of something like this:
+% @node Help-Cross, , , Cross-refs
+\def\donode#1 ,#2\finishnodeparse{\dodonode #1,\finishnodeparse}
+\def\dodonode#1,#2\finishnodeparse{\gdef\lastnode{#1}\omittopnode}
+
+% Used so that the @top node doesn't have to be wrapped in an @ifnottex
+% conditional.
+% \doignore goes to more effort to skip nested conditionals but we don't need
+% that here.
+\def\omittopnode{%
+ \ifx\lastnode\wordTop
+ \expandafter\ignorenode\fi
+}
+\def\wordTop{Top}
+
+% Until the next @node or @bye command, divert output to a box that is not
+% output.
+\def\ignorenode{\setbox\dummybox\vbox\bgroup\def\node{\egroup\node}%
+\ignorenodebye
+}
+
+{\let\bye\relax
+\gdef\ignorenodebye{\let\bye\ignorenodebyedef}
+\gdef\ignorenodebyedef{\egroup(`Top' node ignored)\bye}}
+% The redefinition of \bye here is because it is declared \outer
+
+\let\lastnode=\empty
+
+% Write a cross-reference definition for the current node. #1 is the
+% type (Ynumbered, Yappendix, Ynothing).
+%
+\def\donoderef#1{%
+ \ifx\lastnode\empty\else
+ \setref{\lastnode}{#1}%
+ \global\let\lastnode=\empty
+ \fi
+}
+
+% @anchor{NAME} -- define xref target at arbitrary point.
+%
+\newcount\savesfregister
+%
+\def\savesf{\relax \ifhmode \savesfregister=\spacefactor \fi}
+\def\restoresf{\relax \ifhmode \spacefactor=\savesfregister \fi}
+\def\anchor#1{\savesf \setref{#1}{Ynothing}\restoresf \ignorespaces}
+
+% \setref{NAME}{SNT} defines a cross-reference point NAME (a node or an
+% anchor), which consists of three parts:
+% 1) NAME-title - the current sectioning name taken from \currentsection,
+% or the anchor name.
+% 2) NAME-snt - section number and type, passed as the SNT arg, or
+% empty for anchors.
+% 3) NAME-pg - the page number.
+%
+% This is called from \donoderef, \anchor, and \dofloat. In the case of
+% floats, there is an additional part, which is not written here:
+% 4) NAME-lof - the text as it should appear in a @listoffloats.
+%
+\def\setref#1#2{%
+ \pdfmkdest{#1}%
+ \iflinks
+ {%
+ \requireauxfile
+ \atdummies % preserve commands, but don't expand them
+ % match definition in \xrdef, \refx, \xrefX.
+ \def\value##1{##1}%
+ \edef\writexrdef##1##2{%
+ \write\auxfile{@xrdef{#1-% #1 of \setref, expanded by the \edef
+ ##1}{##2}}% these are parameters of \writexrdef
+ }%
+ \toks0 = \expandafter{\currentsection}%
+ \immediate \writexrdef{title}{\the\toks0 }%
+ \immediate \writexrdef{snt}{\csname #2\endcsname}% \Ynumbered etc.
+ \safewhatsit{\writexrdef{pg}{\folio}}% will be written later, at \shipout
+ }%
+ \fi
+}
+
+% @xrefautosectiontitle on|off says whether @section(ing) names are used
+% automatically in xrefs, if the third arg is not explicitly specified.
+% This was provided as a "secret" @set xref-automatic-section-title
+% variable, now it's official.
+%
+\parseargdef\xrefautomaticsectiontitle{%
+ \def\temp{#1}%
+ \ifx\temp\onword
+ \expandafter\let\csname SETxref-automatic-section-title\endcsname
+ = \empty
+ \else\ifx\temp\offword
+ \expandafter\let\csname SETxref-automatic-section-title\endcsname
+ = \relax
+ \else
+ \errhelp = \EMsimple
+ \errmessage{Unknown @xrefautomaticsectiontitle value `\temp',
+ must be on|off}%
+ \fi\fi
+}
+
+%
+% @xref, @pxref, and @ref generate cross-references. For \xrefX, #1 is
+% the node name, #2 the name of the Info cross-reference, #3 the printed
+% node name, #4 the name of the Info file, #5 the name of the printed
+% manual. All but the node name can be omitted.
+%
+\def\pxref{\putwordsee{} \xrefXX}
+\def\xref{\putwordSee{} \xrefXX}
+\def\ref{\xrefXX}
+
+\def\xrefXX#1{\def\xrefXXarg{#1}\futurelet\tokenafterxref\xrefXXX}
+\def\xrefXXX{\expandafter\xrefX\expandafter[\xrefXXarg,,,,,,,]}
+%
+\newbox\toprefbox
+\newbox\printedrefnamebox
+\newbox\infofilenamebox
+\newbox\printedmanualbox
+%
+\def\xrefX[#1,#2,#3,#4,#5,#6]{\begingroup
+ \unsepspaces
+ %
+ % Get args without leading/trailing spaces.
+ \def\printedrefname{\ignorespaces #3}%
+ \setbox\printedrefnamebox = \hbox{\printedrefname\unskip}%
+ %
+ \def\infofilename{\ignorespaces #4}%
+ \setbox\infofilenamebox = \hbox{\infofilename\unskip}%
+ %
+ \def\printedmanual{\ignorespaces #5}%
+ \setbox\printedmanualbox = \hbox{\printedmanual\unskip}%
+ %
+ % If the printed reference name (arg #3) was not explicitly given in
+ % the @xref, figure out what we want to use.
+ \ifdim \wd\printedrefnamebox = 0pt
+ % No printed node name was explicitly given.
+ \expandafter\ifx\csname SETxref-automatic-section-title\endcsname \relax
+ % Not auto section-title: use node name inside the square brackets.
+ \def\printedrefname{\ignorespaces #1}%
+ \else
+ % Auto section-title: use chapter/section title inside
+ % the square brackets if we have it.
+ \ifdim \wd\printedmanualbox > 0pt
+ % It is in another manual, so we don't have it; use node name.
+ \def\printedrefname{\ignorespaces #1}%
+ \else
+ \ifhavexrefs
+ % We (should) know the real title if we have the xref values.
+ \def\printedrefname{\refx{#1-title}{}}%
+ \else
+ % Otherwise just copy the Info node name.
+ \def\printedrefname{\ignorespaces #1}%
+ \fi%
+ \fi
+ \fi
+ \fi
+ %
+ % Make link in pdf output.
+ \ifpdf
+ % For pdfTeX and LuaTeX
+ {\indexnofonts
+ \makevalueexpandable
+ \turnoffactive
+ % This expands tokens, so do it after making catcode changes, so _
+ % etc. don't get their TeX definitions. This ignores all spaces in
+ % #4, including (wrongly) those in the middle of the filename.
+ \getfilename{#4}%
+ %
+ % This (wrongly) does not take account of leading or trailing
+ % spaces in #1, which should be ignored.
+ \setpdfdestname{#1}%
+ %
+ \ifx\pdfdestname\empty
+ \def\pdfdestname{Top}% no empty targets
+ \fi
+ %
+ \leavevmode
+ \startlink attr{/Border [0 0 0]}%
+ \ifnum\filenamelength>0
+ goto file{\the\filename.pdf} name{\pdfdestname}%
+ \else
+ goto name{\pdfmkpgn{\pdfdestname}}%
+ \fi
+ }%
+ \setcolor{\linkcolor}%
+ \else
+ \ifx\XeTeXrevision\thisisundefined
+ \else
+ % For XeTeX
+ {\indexnofonts
+ \makevalueexpandable
+ \turnoffactive
+ % This expands tokens, so do it after making catcode changes, so _
+ % etc. don't get their TeX definitions. This ignores all spaces in
+ % #4, including (wrongly) those in the middle of the filename.
+ \getfilename{#4}%
+ %
+ % This (wrongly) does not take account of leading or trailing
+ % spaces in #1, which should be ignored.
+ \setpdfdestname{#1}%
+ %
+ \ifx\pdfdestname\empty
+ \def\pdfdestname{Top}% no empty targets
+ \fi
+ %
+ \leavevmode
+ \ifnum\filenamelength>0
+ % With default settings,
+ % XeTeX (xdvipdfmx) replaces link destination names with integers.
+ % In this case, the replaced destination names of
+ % remote PDFs are no longer known. In order to avoid a replacement,
+ % you can use xdvipdfmx's command line option `-C 0x0010'.
+ % If you use XeTeX 0.99996+ (TeX Live 2016+),
+ % this command line option is no longer necessary
+ % because we can use the `dvipdfmx:config' special.
+ \special{pdf:bann << /Border [0 0 0] /Type /Annot /Subtype /Link /A
+ << /S /GoToR /F (\the\filename.pdf) /D (\pdfdestname) >> >>}%
+ \else
+ \special{pdf:bann << /Border [0 0 0] /Type /Annot /Subtype /Link /A
+ << /S /GoTo /D (\pdfdestname) >> >>}%
+ \fi
+ }%
+ \setcolor{\linkcolor}%
+ \fi
+ \fi
+ {%
+ % Have to otherify everything special to allow the \csname to
+ % include an _ in the xref name, etc.
+ \indexnofonts
+ \turnoffactive
+ \def\value##1{##1}%
+ \expandafter\global\expandafter\let\expandafter\Xthisreftitle
+ \csname XR#1-title\endcsname
+ }%
+ %
+ % Float references are printed completely differently: "Figure 1.2"
+ % instead of "[somenode], p.3". \iffloat distinguishes them by
+ % \Xthisreftitle being set to a magic string.
+ \iffloat\Xthisreftitle
+ % If the user specified the print name (third arg) to the ref,
+ % print it instead of our usual "Figure 1.2".
+ \ifdim\wd\printedrefnamebox = 0pt
+ \refx{#1-snt}{}%
+ \else
+ \printedrefname
+ \fi
+ %
+ % If the user also gave the printed manual name (fifth arg), append
+ % "in MANUALNAME".
+ \ifdim \wd\printedmanualbox > 0pt
+ \space \putwordin{} \cite{\printedmanual}%
+ \fi
+ \else
+ % node/anchor (non-float) references.
+ %
+ % If we use \unhbox to print the node names, TeX does not insert
+ % empty discretionaries after hyphens, which means that it will not
+ % find a line break at a hyphen in a node names. Since some manuals
+ % are best written with fairly long node names, containing hyphens,
+ % this is a loss. Therefore, we give the text of the node name
+ % again, so it is as if TeX is seeing it for the first time.
+ %
+ \ifdim \wd\printedmanualbox > 0pt
+ % Cross-manual reference with a printed manual name.
+ %
+ \crossmanualxref{\cite{\printedmanual\unskip}}%
+ %
+ \else\ifdim \wd\infofilenamebox > 0pt
+ % Cross-manual reference with only an info filename (arg 4), no
+ % printed manual name (arg 5). This is essentially the same as
+ % the case above; we output the filename, since we have nothing else.
+ %
+ \crossmanualxref{\code{\infofilename\unskip}}%
+ %
+ \else
+ % Reference within this manual.
+ %
+ % Only output a following space if the -snt ref is nonempty; for
+ % @unnumbered and @anchor, it won't be.
+ \setbox2 = \hbox{\ignorespaces \refx{#1-snt}{}}%
+ \ifdim \wd2 > 0pt \refx{#1-snt}\space\fi
+ %
+ % output the `[mynode]' via the macro below so it can be overridden.
+ \xrefprintnodename\printedrefname
+ %
+ % But we always want a comma and a space:
+ ,\space
+ %
+ % output the `page 3'.
+ \turnoffactive \putwordpage\tie\refx{#1-pg}{}%
+ % Add a , if xref followed by a space
+ \if\space\noexpand\tokenafterxref ,%
+ \else\ifx\ \tokenafterxref ,% @TAB
+ \else\ifx\*\tokenafterxref ,% @*
+ \else\ifx\ \tokenafterxref ,% @SPACE
+ \else\ifx\
+ \tokenafterxref ,% @NL
+ \else\ifx\tie\tokenafterxref ,% @tie
+ \fi\fi\fi\fi\fi\fi
+ \fi\fi
+ \fi
+ \endlink
+\endgroup}
+
+% Output a cross-manual xref to #1. Used just above (twice).
+%
+% Only include the text "Section ``foo'' in" if the foo is neither
+% missing or Top. Thus, @xref{,,,foo,The Foo Manual} outputs simply
+% "see The Foo Manual", the idea being to refer to the whole manual.
+%
+% But, this being TeX, we can't easily compare our node name against the
+% string "Top" while ignoring the possible spaces before and after in
+% the input. By adding the arbitrary 7sp below, we make it much less
+% likely that a real node name would have the same width as "Top" (e.g.,
+% in a monospaced font). Hopefully it will never happen in practice.
+%
+% For the same basic reason, we retypeset the "Top" at every
+% reference, since the current font is indeterminate.
+%
+\def\crossmanualxref#1{%
+ \setbox\toprefbox = \hbox{Top\kern7sp}%
+ \setbox2 = \hbox{\ignorespaces \printedrefname \unskip \kern7sp}%
+ \ifdim \wd2 > 7sp % nonempty?
+ \ifdim \wd2 = \wd\toprefbox \else % same as Top?
+ \putwordSection{} ``\printedrefname'' \putwordin{}\space
+ \fi
+ \fi
+ #1%
+}
+
+% This macro is called from \xrefX for the `[nodename]' part of xref
+% output. It's a separate macro only so it can be changed more easily,
+% since square brackets don't work well in some documents. Particularly
+% one that Bob is working on :).
+%
+\def\xrefprintnodename#1{[#1]}
+
+% Things referred to by \setref.
+%
+\def\Ynothing{}
+\def\Yomitfromtoc{}
+\def\Ynumbered{%
+ \ifnum\secno=0
+ \putwordChapter@tie \the\chapno
+ \else \ifnum\subsecno=0
+ \putwordSection@tie \the\chapno.\the\secno
+ \else \ifnum\subsubsecno=0
+ \putwordSection@tie \the\chapno.\the\secno.\the\subsecno
+ \else
+ \putwordSection@tie \the\chapno.\the\secno.\the\subsecno.\the\subsubsecno
+ \fi\fi\fi
+}
+\def\Yappendix{%
+ \ifnum\secno=0
+ \putwordAppendix@tie @char\the\appendixno{}%
+ \else \ifnum\subsecno=0
+ \putwordSection@tie @char\the\appendixno.\the\secno
+ \else \ifnum\subsubsecno=0
+ \putwordSection@tie @char\the\appendixno.\the\secno.\the\subsecno
+ \else
+ \putwordSection@tie
+ @char\the\appendixno.\the\secno.\the\subsecno.\the\subsubsecno
+ \fi\fi\fi
+}
+
+% \refx{NAME}{SUFFIX} - reference a cross-reference string named NAME. SUFFIX
+% is output afterwards if non-empty.
+\def\refx#1#2{%
+ \requireauxfile
+ {%
+ \indexnofonts
+ \turnoffactive
+ \def\value##1{##1}%
+ \expandafter\global\expandafter\let\expandafter\thisrefX
+ \csname XR#1\endcsname
+ }%
+ \ifx\thisrefX\relax
+ % If not defined, say something at least.
+ \angleleft un\-de\-fined\angleright
+ \iflinks
+ \ifhavexrefs
+ {\toks0 = {#1}% avoid expansion of possibly-complex value
+ \message{\linenumber Undefined cross reference `\the\toks0'.}}%
+ \else
+ \ifwarnedxrefs\else
+ \global\warnedxrefstrue
+ \message{Cross reference values unknown; you must run TeX again.}%
+ \fi
+ \fi
+ \fi
+ \else
+ % It's defined, so just use it.
+ \thisrefX
+ \fi
+ #2% Output the suffix in any case.
+}
+
+% This is the macro invoked by entries in the aux file. Define a control
+% sequence for a cross-reference target (we prepend XR to the control sequence
+% name to avoid collisions). The value is the page number. If this is a float
+% type, we have more work to do.
+%
+\def\xrdef#1#2{%
+ {% Expand the node or anchor name to remove control sequences.
+ % \turnoffactive stops 8-bit characters being changed to commands
+ % like @'e. \refx does the same to retrieve the value in the definition.
+ \indexnofonts
+ \turnoffactive
+ \def\value##1{##1}%
+ \xdef\safexrefname{#1}%
+ }%
+ %
+ \bgroup
+ \expandafter\gdef\csname XR\safexrefname\endcsname{#2}%
+ \egroup
+ % We put the \gdef inside a group to avoid the definitions building up on
+ % TeX's save stack, which can cause it to run out of space for aux files with
+ % thousands of lines. \gdef doesn't use the save stack, but \csname does
+ % when it defines an unknown control sequence as \relax.
+ %
+ % Was that xref control sequence that we just defined for a float?
+ \expandafter\iffloat\csname XR\safexrefname\endcsname
+ % it was a float, and we have the (safe) float type in \iffloattype.
+ \expandafter\let\expandafter\floatlist
+ \csname floatlist\iffloattype\endcsname
+ %
+ % Is this the first time we've seen this float type?
+ \expandafter\ifx\floatlist\relax
+ \toks0 = {\do}% yes, so just \do
+ \else
+ % had it before, so preserve previous elements in list.
+ \toks0 = \expandafter{\floatlist\do}%
+ \fi
+ %
+ % Remember this xref in the control sequence \floatlistFLOATTYPE,
+ % for later use in \listoffloats.
+ \expandafter\xdef\csname floatlist\iffloattype\endcsname{\the\toks0
+ {\safexrefname}}%
+ \fi
+}
+
+% If working on a large document in chapters, it is convenient to
+% be able to disable indexing, cross-referencing, and contents, for test runs.
+% This is done with @novalidate at the beginning of the file.
+%
+\newif\iflinks \linkstrue % by default we want the aux files.
+\let\novalidate = \linksfalse
+
+% Used when writing to the aux file, or when using data from it.
+\def\requireauxfile{%
+ \iflinks
+ \tryauxfile
+ % Open the new aux file. TeX will close it automatically at exit.
+ \immediate\openout\auxfile=\jobname.aux
+ \fi
+ \global\let\requireauxfile=\relax % Only do this once.
+}
+
+% Read the last existing aux file, if any. No error if none exists.
+%
+\def\tryauxfile{%
+ \openin 1 \jobname.aux
+ \ifeof 1 \else
+ \readdatafile{aux}%
+ \global\havexrefstrue
+ \fi
+ \closein 1
+}
+
+\def\setupdatafile{%
+ \catcode`\^^@=\other
+ \catcode`\^^A=\other
+ \catcode`\^^B=\other
+ \catcode`\^^C=\other
+ \catcode`\^^D=\other
+ \catcode`\^^E=\other
+ \catcode`\^^F=\other
+ \catcode`\^^G=\other
+ \catcode`\^^H=\other
+ \catcode`\^^K=\other
+ \catcode`\^^L=\other
+ \catcode`\^^N=\other
+ \catcode`\^^P=\other
+ \catcode`\^^Q=\other
+ \catcode`\^^R=\other
+ \catcode`\^^S=\other
+ \catcode`\^^T=\other
+ \catcode`\^^U=\other
+ \catcode`\^^V=\other
+ \catcode`\^^W=\other
+ \catcode`\^^X=\other
+ \catcode`\^^Z=\other
+ \catcode`\^^[=\other
+ \catcode`\^^\=\other
+ \catcode`\^^]=\other
+ \catcode`\^^^=\other
+ \catcode`\^^_=\other
+ \catcode`\^=\other
+ %
+ % Special characters. Should be turned off anyway, but...
+ \catcode`\~=\other
+ \catcode`\[=\other
+ \catcode`\]=\other
+ \catcode`\"=\other
+ \catcode`\_=\other
+ \catcode`\|=\other
+ \catcode`\<=\other
+ \catcode`\>=\other
+ \catcode`\$=\other
+ \catcode`\#=\other
+ \catcode`\&=\other
+ \catcode`\%=\other
+ \catcode`+=\other % avoid \+ for paranoia even though we've turned it off
+ %
+ \catcode`\\=\active
+ %
+ % @ is our escape character in .aux files, and we need braces.
+ \catcode`\{=1
+ \catcode`\}=2
+ \catcode`\@=0
+}
+
+\def\readdatafile#1{%
+\begingroup
+ \setupdatafile
+ \input\jobname.#1
+\endgroup}
+
+
+\message{insertions,}
+% including footnotes.
+
+\newcount \footnoteno
+
+% The trailing space in the following definition for supereject is
+% vital for proper filling; pages come out unaligned when you do a
+% pagealignmacro call if that space before the closing brace is
+% removed. (Generally, numeric constants should always be followed by a
+% space to prevent strange expansion errors.)
+\def\supereject{\par\penalty -20000\footnoteno =0 }
+
+% @footnotestyle is meaningful for Info output only.
+\let\footnotestyle=\comment
+
+{\catcode `\@=11
+%
+% Auto-number footnotes. Otherwise like plain.
+\gdef\footnote{%
+ \global\advance\footnoteno by \@ne
+ \edef\thisfootno{$^{\the\footnoteno}$}%
+ %
+ % In case the footnote comes at the end of a sentence, preserve the
+ % extra spacing after we do the footnote number.
+ \let\@sf\empty
+ \ifhmode\edef\@sf{\spacefactor\the\spacefactor}\ptexslash\fi
+ %
+ % Remove inadvertent blank space before typesetting the footnote number.
+ \unskip
+ \thisfootno\@sf
+ \dofootnote
+}%
+
+% Don't bother with the trickery in plain.tex to not require the
+% footnote text as a parameter. Our footnotes don't need to be so general.
+%
+% Oh yes, they do; otherwise, @ifset (and anything else that uses
+% \parseargline) fails inside footnotes because the tokens are fixed when
+% the footnote is read. --karl, 16nov96.
+%
+\gdef\dofootnote{%
+ \insert\footins\bgroup
+ %
+ % Nested footnotes are not supported in TeX, that would take a lot
+ % more work. (\startsavinginserts does not suffice.)
+ \let\footnote=\errfootnotenest
+ %
+ % We want to typeset this text as a normal paragraph, even if the
+ % footnote reference occurs in (for example) a display environment.
+ % So reset some parameters.
+ \hsize=\txipagewidth
+ \interlinepenalty\interfootnotelinepenalty
+ \splittopskip\ht\strutbox % top baseline for broken footnotes
+ \splitmaxdepth\dp\strutbox
+ \floatingpenalty\@MM
+ \leftskip\z@skip
+ \rightskip\z@skip
+ \spaceskip\z@skip
+ \xspaceskip\z@skip
+ \parindent\defaultparindent
+ %
+ \smallfonts \rm
+ %
+ % Because we use hanging indentation in footnotes, a @noindent appears
+ % to exdent this text, so make it be a no-op. makeinfo does not use
+ % hanging indentation so @noindent can still be needed within footnote
+ % text after an @example or the like (not that this is good style).
+ \let\noindent = \relax
+ %
+ % Hang the footnote text off the number. Use \everypar in case the
+ % footnote extends for more than one paragraph.
+ \everypar = {\hang}%
+ \textindent{\thisfootno}%
+ %
+ % Don't crash into the line above the footnote text. Since this
+ % expands into a box, it must come within the paragraph, lest it
+ % provide a place where TeX can split the footnote.
+ \footstrut
+ %
+ % Invoke rest of plain TeX footnote routine.
+ \futurelet\next\fo@t
+}
+}%end \catcode `\@=11
+
+\def\errfootnotenest{%
+ \errhelp=\EMsimple
+ \errmessage{Nested footnotes not supported in texinfo.tex,
+ even though they work in makeinfo; sorry}
+}
+
+\def\errfootnoteheading{%
+ \errhelp=\EMsimple
+ \errmessage{Footnotes in chapters, sections, etc., are not supported}
+}
+
+% In case a @footnote appears in a vbox, save the footnote text and create
+% the real \insert just after the vbox finished. Otherwise, the insertion
+% would be lost.
+% Similarly, if a @footnote appears inside an alignment, save the footnote
+% text to a box and make the \insert when a row of the table is finished.
+% And the same can be done for other insert classes. --kasal, 16nov03.
+%
+% Replace the \insert primitive by a cheating macro.
+% Deeper inside, just make sure that the saved insertions are not spilled
+% out prematurely.
+%
+\def\startsavinginserts{%
+ \ifx \insert\ptexinsert
+ \let\insert\saveinsert
+ \else
+ \let\checkinserts\relax
+ \fi
+}
+
+% This \insert replacement works for both \insert\footins{foo} and
+% \insert\footins\bgroup foo\egroup, but it doesn't work for \insert27{foo}.
+%
+\def\saveinsert#1{%
+ \edef\next{\noexpand\savetobox \makeSAVEname#1}%
+ \afterassignment\next
+ % swallow the left brace
+ \let\temp =
+}
+\def\makeSAVEname#1{\makecsname{SAVE\expandafter\gobble\string#1}}
+\def\savetobox#1{\global\setbox#1 = \vbox\bgroup \unvbox#1}
+
+\def\checksaveins#1{\ifvoid#1\else \placesaveins#1\fi}
+
+\def\placesaveins#1{%
+ \ptexinsert \csname\expandafter\gobblesave\string#1\endcsname
+ {\box#1}%
+}
+
+% eat @SAVE -- beware, all of them have catcode \other:
+{
+ \def\dospecials{\do S\do A\do V\do E} \uncatcodespecials % ;-)
+ \gdef\gobblesave @SAVE{}
+}
+
+% initialization:
+\def\newsaveins #1{%
+ \edef\next{\noexpand\newsaveinsX \makeSAVEname#1}%
+ \next
+}
+\def\newsaveinsX #1{%
+ \csname newbox\endcsname #1%
+ \expandafter\def\expandafter\checkinserts\expandafter{\checkinserts
+ \checksaveins #1}%
+}
+
+% initialize:
+\let\checkinserts\empty
+\newsaveins\footins
+\newsaveins\margin
+
+
+% @image. We use the macros from epsf.tex to support this.
+% If epsf.tex is not installed and @image is used, we complain.
+%
+% Check for and read epsf.tex up front. If we read it only at @image
+% time, we might be inside a group, and then its definitions would get
+% undone and the next image would fail.
+\openin 1 = epsf.tex
+\ifeof 1 \else
+ % Do not bother showing banner with epsf.tex v2.7k (available in
+ % doc/epsf.tex and on ctan).
+ \def\epsfannounce{\toks0 = }%
+ \input epsf.tex
+\fi
+\closein 1
+%
+% We will only complain once about lack of epsf.tex.
+\newif\ifwarnednoepsf
+\newhelp\noepsfhelp{epsf.tex must be installed for images to
+ work. It is also included in the Texinfo distribution, or you can get
+ it from https://ctan.org/texarchive/macros/texinfo/texinfo/doc/epsf.tex.}
+%
+\def\image#1{%
+ \ifx\epsfbox\thisisundefined
+ \ifwarnednoepsf \else
+ \errhelp = \noepsfhelp
+ \errmessage{epsf.tex not found, images will be ignored}%
+ \global\warnednoepsftrue
+ \fi
+ \else
+ \imagexxx #1,,,,,\finish
+ \fi
+}
+%
+% Arguments to @image:
+% #1 is (mandatory) image filename; we tack on .eps extension.
+% #2 is (optional) width, #3 is (optional) height.
+% #4 is (ignored optional) html alt text.
+% #5 is (ignored optional) extension.
+% #6 is just the usual extra ignored arg for parsing stuff.
+\newif\ifimagevmode
+\def\imagexxx#1,#2,#3,#4,#5,#6\finish{\begingroup
+ \catcode`\^^M = 5 % in case we're inside an example
+ \normalturnoffactive % allow _ et al. in names
+ \def\xprocessmacroarg{\eatspaces}% in case we are being used via a macro
+ % If the image is by itself, center it.
+ \ifvmode
+ \imagevmodetrue
+ \else \ifx\centersub\centerV
+ % for @center @image, we need a vbox so we can have our vertical space
+ \imagevmodetrue
+ \vbox\bgroup % vbox has better behavior than vtop herev
+ \fi\fi
+ %
+ \ifimagevmode
+ \nobreak\medskip
+ % Usually we'll have text after the image which will insert
+ % \parskip glue, so insert it here too to equalize the space
+ % above and below.
+ \nobreak\vskip\parskip
+ \nobreak
+ \fi
+ %
+ % Leave vertical mode so that indentation from an enclosing
+ % environment such as @quotation is respected.
+ % However, if we're at the top level, we don't want the
+ % normal paragraph indentation.
+ % On the other hand, if we are in the case of @center @image, we don't
+ % want to start a paragraph, which will create a hsize-width box and
+ % eradicate the centering.
+ \ifx\centersub\centerV\else \noindent \fi
+ %
+ % Output the image.
+ \ifpdf
+ % For pdfTeX and LuaTeX <= 0.80
+ \dopdfimage{#1}{#2}{#3}%
+ \else
+ \ifx\XeTeXrevision\thisisundefined
+ % For epsf.tex
+ % \epsfbox itself resets \epsf?size at each figure.
+ \setbox0 = \hbox{\ignorespaces #2}%
+ \ifdim\wd0 > 0pt \epsfxsize=#2\relax \fi
+ \setbox0 = \hbox{\ignorespaces #3}%
+ \ifdim\wd0 > 0pt \epsfysize=#3\relax \fi
+ \epsfbox{#1.eps}%
+ \else
+ % For XeTeX
+ \doxeteximage{#1}{#2}{#3}%
+ \fi
+ \fi
+ %
+ \ifimagevmode
+ \medskip % space after a standalone image
+ \fi
+ \ifx\centersub\centerV \egroup \fi
+\endgroup}
+
+
+% @float FLOATTYPE,LABEL,LOC ... @end float for displayed figures, tables,
+% etc. We don't actually implement floating yet, we always include the
+% float "here". But it seemed the best name for the future.
+%
+\envparseargdef\float{\eatcommaspace\eatcommaspace\dofloat#1, , ,\finish}
+
+% There may be a space before second and/or third parameter; delete it.
+\def\eatcommaspace#1, {#1,}
+
+% #1 is the optional FLOATTYPE, the text label for this float, typically
+% "Figure", "Table", "Example", etc. Can't contain commas. If omitted,
+% this float will not be numbered and cannot be referred to.
+%
+% #2 is the optional xref label. Also must be present for the float to
+% be referable.
+%
+% #3 is the optional positioning argument; for now, it is ignored. It
+% will somehow specify the positions allowed to float to (here, top, bottom).
+%
+% We keep a separate counter for each FLOATTYPE, which we reset at each
+% chapter-level command.
+\let\resetallfloatnos=\empty
+%
+\def\dofloat#1,#2,#3,#4\finish{%
+ \let\thiscaption=\empty
+ \let\thisshortcaption=\empty
+ %
+ % don't lose footnotes inside @float.
+ %
+ % BEWARE: when the floats start float, we have to issue warning whenever an
+ % insert appears inside a float which could possibly float. --kasal, 26may04
+ %
+ \startsavinginserts
+ %
+ % We can't be used inside a paragraph.
+ \par
+ %
+ \vtop\bgroup
+ \def\floattype{#1}%
+ \def\floatlabel{#2}%
+ \def\floatloc{#3}% we do nothing with this yet.
+ %
+ \ifx\floattype\empty
+ \let\safefloattype=\empty
+ \else
+ {%
+ % the floattype might have accents or other special characters,
+ % but we need to use it in a control sequence name.
+ \indexnofonts
+ \turnoffactive
+ \xdef\safefloattype{\floattype}%
+ }%
+ \fi
+ %
+ % If label is given but no type, we handle that as the empty type.
+ \ifx\floatlabel\empty \else
+ % We want each FLOATTYPE to be numbered separately (Figure 1,
+ % Table 1, Figure 2, ...). (And if no label, no number.)
+ %
+ \expandafter\getfloatno\csname\safefloattype floatno\endcsname
+ \global\advance\floatno by 1
+ %
+ {%
+ % This magic value for \currentsection is output by \setref as the
+ % XREFLABEL-title value. \xrefX uses it to distinguish float
+ % labels (which have a completely different output format) from
+ % node and anchor labels. And \xrdef uses it to construct the
+ % lists of floats.
+ %
+ \edef\currentsection{\floatmagic=\safefloattype}%
+ \setref{\floatlabel}{Yfloat}%
+ }%
+ \fi
+ %
+ % start with \parskip glue, I guess.
+ \vskip\parskip
+ %
+ % Don't suppress indentation if a float happens to start a section.
+ \restorefirstparagraphindent
+}
+
+% we have these possibilities:
+% @float Foo,lbl & @caption{Cap}: Foo 1.1: Cap
+% @float Foo,lbl & no caption: Foo 1.1
+% @float Foo & @caption{Cap}: Foo: Cap
+% @float Foo & no caption: Foo
+% @float ,lbl & Caption{Cap}: 1.1: Cap
+% @float ,lbl & no caption: 1.1
+% @float & @caption{Cap}: Cap
+% @float & no caption:
+%
+\def\Efloat{%
+ \let\floatident = \empty
+ %
+ % In all cases, if we have a float type, it comes first.
+ \ifx\floattype\empty \else \def\floatident{\floattype}\fi
+ %
+ % If we have an xref label, the number comes next.
+ \ifx\floatlabel\empty \else
+ \ifx\floattype\empty \else % if also had float type, need tie first.
+ \appendtomacro\floatident{\tie}%
+ \fi
+ % the number.
+ \appendtomacro\floatident{\chaplevelprefix\the\floatno}%
+ \fi
+ %
+ % Start the printed caption with what we've constructed in
+ % \floatident, but keep it separate; we need \floatident again.
+ \let\captionline = \floatident
+ %
+ \ifx\thiscaption\empty \else
+ \ifx\floatident\empty \else
+ \appendtomacro\captionline{: }% had ident, so need a colon between
+ \fi
+ %
+ % caption text.
+ \appendtomacro\captionline{\scanexp\thiscaption}%
+ \fi
+ %
+ % If we have anything to print, print it, with space before.
+ % Eventually this needs to become an \insert.
+ \ifx\captionline\empty \else
+ \vskip.5\parskip
+ \captionline
+ %
+ % Space below caption.
+ \vskip\parskip
+ \fi
+ %
+ % If have an xref label, write the list of floats info. Do this
+ % after the caption, to avoid chance of it being a breakpoint.
+ \ifx\floatlabel\empty \else
+ % Write the text that goes in the lof to the aux file as
+ % \floatlabel-lof. Besides \floatident, we include the short
+ % caption if specified, else the full caption if specified, else nothing.
+ {%
+ \requireauxfile
+ \atdummies
+ %
+ \ifx\thisshortcaption\empty
+ \def\gtemp{\thiscaption}%
+ \else
+ \def\gtemp{\thisshortcaption}%
+ \fi
+ \immediate\write\auxfile{@xrdef{\floatlabel-lof}{\floatident
+ \ifx\gtemp\empty \else : \gtemp \fi}}%
+ }%
+ \fi
+ \egroup % end of \vtop
+ %
+ \checkinserts
+}
+
+% Append the tokens #2 to the definition of macro #1, not expanding either.
+%
+\def\appendtomacro#1#2{%
+ \expandafter\def\expandafter#1\expandafter{#1#2}%
+}
+
+% @caption, @shortcaption
+%
+\def\caption{\docaption\thiscaption}
+\def\shortcaption{\docaption\thisshortcaption}
+\def\docaption{\checkenv\float \bgroup\scanargctxt\defcaption}
+\def\defcaption#1#2{\egroup \def#1{#2}}
+
+% The parameter is the control sequence identifying the counter we are
+% going to use. Create it if it doesn't exist and assign it to \floatno.
+\def\getfloatno#1{%
+ \ifx#1\relax
+ % Haven't seen this figure type before.
+ \csname newcount\endcsname #1%
+ %
+ % Remember to reset this floatno at the next chap.
+ \expandafter\gdef\expandafter\resetallfloatnos
+ \expandafter{\resetallfloatnos #1=0 }%
+ \fi
+ \let\floatno#1%
+}
+
+% \setref calls this to get the XREFLABEL-snt value. We want an @xref
+% to the FLOATLABEL to expand to "Figure 3.1". We call \setref when we
+% first read the @float command.
+%
+\def\Yfloat{\floattype@tie \chaplevelprefix\the\floatno}%
+
+% Magic string used for the XREFLABEL-title value, so \xrefX can
+% distinguish floats from other xref types.
+\def\floatmagic{!!float!!}
+
+% #1 is the control sequence we are passed; we expand into a conditional
+% which is true if #1 represents a float ref. That is, the magic
+% \currentsection value which we \setref above.
+%
+\def\iffloat#1{\expandafter\doiffloat#1==\finish}
+%
+% #1 is (maybe) the \floatmagic string. If so, #2 will be the
+% (safe) float type for this float. We set \iffloattype to #2.
+%
+\def\doiffloat#1=#2=#3\finish{%
+ \def\temp{#1}%
+ \def\iffloattype{#2}%
+ \ifx\temp\floatmagic
+}
+
+% @listoffloats FLOATTYPE - print a list of floats like a table of contents.
+%
+\parseargdef\listoffloats{%
+ \def\floattype{#1}% floattype
+ {%
+ % the floattype might have accents or other special characters,
+ % but we need to use it in a control sequence name.
+ \indexnofonts
+ \turnoffactive
+ \xdef\safefloattype{\floattype}%
+ }%
+ %
+ % \xrdef saves the floats as a \do-list in \floatlistSAFEFLOATTYPE.
+ \expandafter\ifx\csname floatlist\safefloattype\endcsname \relax
+ \ifhavexrefs
+ % if the user said @listoffloats foo but never @float foo.
+ \message{\linenumber No `\safefloattype' floats to list.}%
+ \fi
+ \else
+ \begingroup
+ \leftskip=\tocindent % indent these entries like a toc
+ \let\do=\listoffloatsdo
+ \csname floatlist\safefloattype\endcsname
+ \endgroup
+ \fi
+}
+
+% This is called on each entry in a list of floats. We're passed the
+% xref label, in the form LABEL-title, which is how we save it in the
+% aux file. We strip off the -title and look up \XRLABEL-lof, which
+% has the text we're supposed to typeset here.
+%
+% Figures without xref labels will not be included in the list (since
+% they won't appear in the aux file).
+%
+\def\listoffloatsdo#1{\listoffloatsdoentry#1\finish}
+\def\listoffloatsdoentry#1-title\finish{{%
+ % Can't fully expand XR#1-lof because it can contain anything. Just
+ % pass the control sequence. On the other hand, XR#1-pg is just the
+ % page number, and we want to fully expand that so we can get a link
+ % in pdf output.
+ \toksA = \expandafter{\csname XR#1-lof\endcsname}%
+ %
+ % use the same \entry macro we use to generate the TOC and index.
+ \edef\writeentry{\noexpand\entry{\the\toksA}{\csname XR#1-pg\endcsname}}%
+ \writeentry
+}}
+
+
+\message{localization,}
+
+% For single-language documents, @documentlanguage is usually given very
+% early, just after @documentencoding. Single argument is the language
+% (de) or locale (de_DE) abbreviation.
+%
+{
+ \catcode`\_ = \active
+ \globaldefs=1
+\parseargdef\documentlanguage{%
+ \tex % read txi-??.tex file in plain TeX.
+ % Read the file by the name they passed if it exists.
+ \let_ = \normalunderscore % normal _ character for filename test
+ \openin 1 txi-#1.tex
+ \ifeof 1
+ \documentlanguagetrywithoutunderscore #1_\finish
+ \else
+ \globaldefs = 1 % everything in the txi-LL files needs to persist
+ \input txi-#1.tex
+ \fi
+ \closein 1
+ \endgroup % end raw TeX
+}
+%
+% If they passed de_DE, and txi-de_DE.tex doesn't exist,
+% try txi-de.tex.
+%
+\gdef\documentlanguagetrywithoutunderscore#1_#2\finish{%
+ \openin 1 txi-#1.tex
+ \ifeof 1
+ \errhelp = \nolanghelp
+ \errmessage{Cannot read language file txi-#1.tex}%
+ \else
+ \globaldefs = 1 % everything in the txi-LL files needs to persist
+ \input txi-#1.tex
+ \fi
+ \closein 1
+}
+}% end of special _ catcode
+%
+\newhelp\nolanghelp{The given language definition file cannot be found or
+is empty. Maybe you need to install it? Putting it in the current
+directory should work if nowhere else does.}
+
+% This macro is called from txi-??.tex files; the first argument is the
+% \language name to set (without the "\lang@" prefix), the second and
+% third args are \{left,right}hyphenmin.
+%
+% The language names to pass are determined when the format is built.
+% See the etex.log file created at that time, e.g.,
+% /usr/local/texlive/2008/texmf-var/web2c/pdftex/etex.log.
+%
+% With TeX Live 2008, etex now includes hyphenation patterns for all
+% available languages. This means we can support hyphenation in
+% Texinfo, at least to some extent. (This still doesn't solve the
+% accented characters problem.)
+%
+\catcode`@=11
+\def\txisetlanguage#1#2#3{%
+ % do not set the language if the name is undefined in the current TeX.
+ \expandafter\ifx\csname lang@#1\endcsname \relax
+ \message{no patterns for #1}%
+ \else
+ \global\language = \csname lang@#1\endcsname
+ \fi
+ % but there is no harm in adjusting the hyphenmin values regardless.
+ \global\lefthyphenmin = #2\relax
+ \global\righthyphenmin = #3\relax
+}
+
+% XeTeX and LuaTeX can handle Unicode natively.
+% Their default I/O uses UTF-8 sequences instead of a byte-wise operation.
+% Other TeX engines' I/O (pdfTeX, etc.) is byte-wise.
+%
+\newif\iftxinativeunicodecapable
+\newif\iftxiusebytewiseio
+
+\ifx\XeTeXrevision\thisisundefined
+ \ifx\luatexversion\thisisundefined
+ \txinativeunicodecapablefalse
+ \txiusebytewiseiotrue
+ \else
+ \txinativeunicodecapabletrue
+ \txiusebytewiseiofalse
+ \fi
+\else
+ \txinativeunicodecapabletrue
+ \txiusebytewiseiofalse
+\fi
+
+% Set I/O by bytes instead of UTF-8 sequence for XeTeX and LuaTex
+% for non-UTF-8 (byte-wise) encodings.
+%
+\def\setbytewiseio{%
+ \ifx\XeTeXrevision\thisisundefined
+ \else
+ \XeTeXdefaultencoding "bytes" % For subsequent files to be read
+ \XeTeXinputencoding "bytes" % For document root file
+ % Unfortunately, there seems to be no corresponding XeTeX command for
+ % output encoding. This is a problem for auxiliary index and TOC files.
+ % The only solution would be perhaps to write out @U{...} sequences in
+ % place of non-ASCII characters.
+ \fi
+
+ \ifx\luatexversion\thisisundefined
+ \else
+ \directlua{
+ local utf8_char, byte, gsub = unicode.utf8.char, string.byte, string.gsub
+ local function convert_char (char)
+ return utf8_char(byte(char))
+ end
+
+ local function convert_line (line)
+ return gsub(line, ".", convert_char)
+ end
+
+ callback.register("process_input_buffer", convert_line)
+
+ local function convert_line_out (line)
+ local line_out = ""
+ for c in string.utfvalues(line) do
+ line_out = line_out .. string.char(c)
+ end
+ return line_out
+ end
+
+ callback.register("process_output_buffer", convert_line_out)
+ }
+ \fi
+
+ \txiusebytewiseiotrue
+}
+
+
+% Helpers for encodings.
+% Set the catcode of characters 128 through 255 to the specified number.
+%
+\def\setnonasciicharscatcode#1{%
+ \count255=128
+ \loop\ifnum\count255<256
+ \global\catcode\count255=#1\relax
+ \advance\count255 by 1
+ \repeat
+}
+
+\def\setnonasciicharscatcodenonglobal#1{%
+ \count255=128
+ \loop\ifnum\count255<256
+ \catcode\count255=#1\relax
+ \advance\count255 by 1
+ \repeat
+}
+
+% @documentencoding sets the definition of non-ASCII characters
+% according to the specified encoding.
+%
+\def\documentencoding{\parseargusing\filenamecatcodes\documentencodingzzz}
+\def\documentencodingzzz#1{%
+ %
+ % Encoding being declared for the document.
+ \def\declaredencoding{\csname #1.enc\endcsname}%
+ %
+ % Supported encodings: names converted to tokens in order to be able
+ % to compare them with \ifx.
+ \def\ascii{\csname US-ASCII.enc\endcsname}%
+ \def\latnine{\csname ISO-8859-15.enc\endcsname}%
+ \def\latone{\csname ISO-8859-1.enc\endcsname}%
+ \def\lattwo{\csname ISO-8859-2.enc\endcsname}%
+ \def\utfeight{\csname UTF-8.enc\endcsname}%
+ %
+ \ifx \declaredencoding \ascii
+ \asciichardefs
+ %
+ \else \ifx \declaredencoding \lattwo
+ \iftxinativeunicodecapable
+ \setbytewiseio
+ \fi
+ \setnonasciicharscatcode\active
+ \lattwochardefs
+ %
+ \else \ifx \declaredencoding \latone
+ \iftxinativeunicodecapable
+ \setbytewiseio
+ \fi
+ \setnonasciicharscatcode\active
+ \latonechardefs
+ %
+ \else \ifx \declaredencoding \latnine
+ \iftxinativeunicodecapable
+ \setbytewiseio
+ \fi
+ \setnonasciicharscatcode\active
+ \latninechardefs
+ %
+ \else \ifx \declaredencoding \utfeight
+ \iftxinativeunicodecapable
+ % For native Unicode handling (XeTeX and LuaTeX)
+ \nativeunicodechardefs
+ \else
+ % For treating UTF-8 as byte sequences (TeX, eTeX and pdfTeX)
+ \setnonasciicharscatcode\active
+ % since we already invoked \utfeightchardefs at the top level
+ % (below), do not re-invoke it, otherwise our check for duplicated
+ % definitions gets triggered. Making non-ascii chars active is
+ % sufficient.
+ \fi
+ %
+ \else
+ \message{Ignoring unknown document encoding: #1.}%
+ %
+ \fi % utfeight
+ \fi % latnine
+ \fi % latone
+ \fi % lattwo
+ \fi % ascii
+ %
+ \ifx\XeTeXrevision\thisisundefined
+ \else
+ \ifx \declaredencoding \utfeight
+ \else
+ \ifx \declaredencoding \ascii
+ \else
+ \message{Warning: XeTeX with non-UTF-8 encodings cannot handle %
+ non-ASCII characters in auxiliary files.}%
+ \fi
+ \fi
+ \fi
+}
+
+% emacs-page
+% A message to be logged when using a character that isn't available
+% the default font encoding (OT1).
+%
+\def\missingcharmsg#1{\message{Character missing, sorry: #1.}}
+
+% Take account of \c (plain) vs. \, (Texinfo) difference.
+\def\cedilla#1{\ifx\c\ptexc\c{#1}\else\,{#1}\fi}
+
+% First, make active non-ASCII characters in order for them to be
+% correctly categorized when TeX reads the replacement text of
+% macros containing the character definitions.
+\setnonasciicharscatcode\active
+%
+
+\def\gdefchar#1#2{%
+\gdef#1{%
+ \ifpassthroughchars
+ \string#1%
+ \else
+ #2%
+ \fi
+}}
+
+% Latin1 (ISO-8859-1) character definitions.
+\def\latonechardefs{%
+ \gdefchar^^a0{\tie}
+ \gdefchar^^a1{\exclamdown}
+ \gdefchar^^a2{{\tcfont \char162}} % cent
+ \gdefchar^^a3{\pounds{}}
+ \gdefchar^^a4{{\tcfont \char164}} % currency
+ \gdefchar^^a5{{\tcfont \char165}} % yen
+ \gdefchar^^a6{{\tcfont \char166}} % broken bar
+ \gdefchar^^a7{\S}
+ \gdefchar^^a8{\"{}}
+ \gdefchar^^a9{\copyright{}}
+ \gdefchar^^aa{\ordf}
+ \gdefchar^^ab{\guillemetleft{}}
+ \gdefchar^^ac{\ensuremath\lnot}
+ \gdefchar^^ad{\-}
+ \gdefchar^^ae{\registeredsymbol{}}
+ \gdefchar^^af{\={}}
+ %
+ \gdefchar^^b0{\textdegree}
+ \gdefchar^^b1{$\pm$}
+ \gdefchar^^b2{$^2$}
+ \gdefchar^^b3{$^3$}
+ \gdefchar^^b4{\'{}}
+ \gdefchar^^b5{$\mu$}
+ \gdefchar^^b6{\P}
+ \gdefchar^^b7{\ensuremath\cdot}
+ \gdefchar^^b8{\cedilla\ }
+ \gdefchar^^b9{$^1$}
+ \gdefchar^^ba{\ordm}
+ \gdefchar^^bb{\guillemetright{}}
+ \gdefchar^^bc{$1\over4$}
+ \gdefchar^^bd{$1\over2$}
+ \gdefchar^^be{$3\over4$}
+ \gdefchar^^bf{\questiondown}
+ %
+ \gdefchar^^c0{\`A}
+ \gdefchar^^c1{\'A}
+ \gdefchar^^c2{\^A}
+ \gdefchar^^c3{\~A}
+ \gdefchar^^c4{\"A}
+ \gdefchar^^c5{\ringaccent A}
+ \gdefchar^^c6{\AE}
+ \gdefchar^^c7{\cedilla C}
+ \gdefchar^^c8{\`E}
+ \gdefchar^^c9{\'E}
+ \gdefchar^^ca{\^E}
+ \gdefchar^^cb{\"E}
+ \gdefchar^^cc{\`I}
+ \gdefchar^^cd{\'I}
+ \gdefchar^^ce{\^I}
+ \gdefchar^^cf{\"I}
+ %
+ \gdefchar^^d0{\DH}
+ \gdefchar^^d1{\~N}
+ \gdefchar^^d2{\`O}
+ \gdefchar^^d3{\'O}
+ \gdefchar^^d4{\^O}
+ \gdefchar^^d5{\~O}
+ \gdefchar^^d6{\"O}
+ \gdefchar^^d7{$\times$}
+ \gdefchar^^d8{\O}
+ \gdefchar^^d9{\`U}
+ \gdefchar^^da{\'U}
+ \gdefchar^^db{\^U}
+ \gdefchar^^dc{\"U}
+ \gdefchar^^dd{\'Y}
+ \gdefchar^^de{\TH}
+ \gdefchar^^df{\ss}
+ %
+ \gdefchar^^e0{\`a}
+ \gdefchar^^e1{\'a}
+ \gdefchar^^e2{\^a}
+ \gdefchar^^e3{\~a}
+ \gdefchar^^e4{\"a}
+ \gdefchar^^e5{\ringaccent a}
+ \gdefchar^^e6{\ae}
+ \gdefchar^^e7{\cedilla c}
+ \gdefchar^^e8{\`e}
+ \gdefchar^^e9{\'e}
+ \gdefchar^^ea{\^e}
+ \gdefchar^^eb{\"e}
+ \gdefchar^^ec{\`{\dotless i}}
+ \gdefchar^^ed{\'{\dotless i}}
+ \gdefchar^^ee{\^{\dotless i}}
+ \gdefchar^^ef{\"{\dotless i}}
+ %
+ \gdefchar^^f0{\dh}
+ \gdefchar^^f1{\~n}
+ \gdefchar^^f2{\`o}
+ \gdefchar^^f3{\'o}
+ \gdefchar^^f4{\^o}
+ \gdefchar^^f5{\~o}
+ \gdefchar^^f6{\"o}
+ \gdefchar^^f7{$\div$}
+ \gdefchar^^f8{\o}
+ \gdefchar^^f9{\`u}
+ \gdefchar^^fa{\'u}
+ \gdefchar^^fb{\^u}
+ \gdefchar^^fc{\"u}
+ \gdefchar^^fd{\'y}
+ \gdefchar^^fe{\th}
+ \gdefchar^^ff{\"y}
+}
+
+% Latin9 (ISO-8859-15) encoding character definitions.
+\def\latninechardefs{%
+ % Encoding is almost identical to Latin1.
+ \latonechardefs
+ %
+ \gdefchar^^a4{\euro{}}
+ \gdefchar^^a6{\v S}
+ \gdefchar^^a8{\v s}
+ \gdefchar^^b4{\v Z}
+ \gdefchar^^b8{\v z}
+ \gdefchar^^bc{\OE}
+ \gdefchar^^bd{\oe}
+ \gdefchar^^be{\"Y}
+}
+
+% Latin2 (ISO-8859-2) character definitions.
+\def\lattwochardefs{%
+ \gdefchar^^a0{\tie}
+ \gdefchar^^a1{\ogonek{A}}
+ \gdefchar^^a2{\u{}}
+ \gdefchar^^a3{\L}
+ \gdefchar^^a4{\missingcharmsg{CURRENCY SIGN}}
+ \gdefchar^^a5{\v L}
+ \gdefchar^^a6{\'S}
+ \gdefchar^^a7{\S}
+ \gdefchar^^a8{\"{}}
+ \gdefchar^^a9{\v S}
+ \gdefchar^^aa{\cedilla S}
+ \gdefchar^^ab{\v T}
+ \gdefchar^^ac{\'Z}
+ \gdefchar^^ad{\-}
+ \gdefchar^^ae{\v Z}
+ \gdefchar^^af{\dotaccent Z}
+ %
+ \gdefchar^^b0{\textdegree{}}
+ \gdefchar^^b1{\ogonek{a}}
+ \gdefchar^^b2{\ogonek{ }}
+ \gdefchar^^b3{\l}
+ \gdefchar^^b4{\'{}}
+ \gdefchar^^b5{\v l}
+ \gdefchar^^b6{\'s}
+ \gdefchar^^b7{\v{}}
+ \gdefchar^^b8{\cedilla\ }
+ \gdefchar^^b9{\v s}
+ \gdefchar^^ba{\cedilla s}
+ \gdefchar^^bb{\v t}
+ \gdefchar^^bc{\'z}
+ \gdefchar^^bd{\H{}}
+ \gdefchar^^be{\v z}
+ \gdefchar^^bf{\dotaccent z}
+ %
+ \gdefchar^^c0{\'R}
+ \gdefchar^^c1{\'A}
+ \gdefchar^^c2{\^A}
+ \gdefchar^^c3{\u A}
+ \gdefchar^^c4{\"A}
+ \gdefchar^^c5{\'L}
+ \gdefchar^^c6{\'C}
+ \gdefchar^^c7{\cedilla C}
+ \gdefchar^^c8{\v C}
+ \gdefchar^^c9{\'E}
+ \gdefchar^^ca{\ogonek{E}}
+ \gdefchar^^cb{\"E}
+ \gdefchar^^cc{\v E}
+ \gdefchar^^cd{\'I}
+ \gdefchar^^ce{\^I}
+ \gdefchar^^cf{\v D}
+ %
+ \gdefchar^^d0{\DH}
+ \gdefchar^^d1{\'N}
+ \gdefchar^^d2{\v N}
+ \gdefchar^^d3{\'O}
+ \gdefchar^^d4{\^O}
+ \gdefchar^^d5{\H O}
+ \gdefchar^^d6{\"O}
+ \gdefchar^^d7{$\times$}
+ \gdefchar^^d8{\v R}
+ \gdefchar^^d9{\ringaccent U}
+ \gdefchar^^da{\'U}
+ \gdefchar^^db{\H U}
+ \gdefchar^^dc{\"U}
+ \gdefchar^^dd{\'Y}
+ \gdefchar^^de{\cedilla T}
+ \gdefchar^^df{\ss}
+ %
+ \gdefchar^^e0{\'r}
+ \gdefchar^^e1{\'a}
+ \gdefchar^^e2{\^a}
+ \gdefchar^^e3{\u a}
+ \gdefchar^^e4{\"a}
+ \gdefchar^^e5{\'l}
+ \gdefchar^^e6{\'c}
+ \gdefchar^^e7{\cedilla c}
+ \gdefchar^^e8{\v c}
+ \gdefchar^^e9{\'e}
+ \gdefchar^^ea{\ogonek{e}}
+ \gdefchar^^eb{\"e}
+ \gdefchar^^ec{\v e}
+ \gdefchar^^ed{\'{\dotless{i}}}
+ \gdefchar^^ee{\^{\dotless{i}}}
+ \gdefchar^^ef{\v d}
+ %
+ \gdefchar^^f0{\dh}
+ \gdefchar^^f1{\'n}
+ \gdefchar^^f2{\v n}
+ \gdefchar^^f3{\'o}
+ \gdefchar^^f4{\^o}
+ \gdefchar^^f5{\H o}
+ \gdefchar^^f6{\"o}
+ \gdefchar^^f7{$\div$}
+ \gdefchar^^f8{\v r}
+ \gdefchar^^f9{\ringaccent u}
+ \gdefchar^^fa{\'u}
+ \gdefchar^^fb{\H u}
+ \gdefchar^^fc{\"u}
+ \gdefchar^^fd{\'y}
+ \gdefchar^^fe{\cedilla t}
+ \gdefchar^^ff{\dotaccent{}}
+}
+
+% UTF-8 character definitions.
+%
+% This code to support UTF-8 is based on LaTeX's utf8.def, with some
+% changes for Texinfo conventions. It is included here under the GPL by
+% permission from Frank Mittelbach and the LaTeX team.
+%
+\newcount\countUTFx
+\newcount\countUTFy
+\newcount\countUTFz
+
+\gdef\UTFviiiTwoOctets#1#2{\expandafter
+ \UTFviiiDefined\csname u8:#1\string #2\endcsname}
+%
+\gdef\UTFviiiThreeOctets#1#2#3{\expandafter
+ \UTFviiiDefined\csname u8:#1\string #2\string #3\endcsname}
+%
+\gdef\UTFviiiFourOctets#1#2#3#4{\expandafter
+ \UTFviiiDefined\csname u8:#1\string #2\string #3\string #4\endcsname}
+
+\gdef\UTFviiiDefined#1{%
+ \ifx #1\relax
+ \message{\linenumber Unicode char \string #1 not defined for Texinfo}%
+ \else
+ \expandafter #1%
+ \fi
+}
+
+% Give non-ASCII bytes the active definitions for processing UTF-8 sequences
+\begingroup
+ \catcode`\~13
+ \catcode`\$12
+ \catcode`\"12
+
+ % Loop from \countUTFx to \countUTFy, performing \UTFviiiTmp
+ % substituting ~ and $ with a character token of that value.
+ \def\UTFviiiLoop{%
+ \global\catcode\countUTFx\active
+ \uccode`\~\countUTFx
+ \uccode`\$\countUTFx
+ \uppercase\expandafter{\UTFviiiTmp}%
+ \advance\countUTFx by 1
+ \ifnum\countUTFx < \countUTFy
+ \expandafter\UTFviiiLoop
+ \fi}
+
+ % For bytes other than the first in a UTF-8 sequence. Not expected to
+ % be expanded except when writing to auxiliary files.
+ \countUTFx = "80
+ \countUTFy = "C2
+ \def\UTFviiiTmp{%
+ \gdef~{%
+ \ifpassthroughchars $\fi}}%
+ \UTFviiiLoop
+
+ \countUTFx = "C2
+ \countUTFy = "E0
+ \def\UTFviiiTmp{%
+ \gdef~{%
+ \ifpassthroughchars $%
+ \else\expandafter\UTFviiiTwoOctets\expandafter$\fi}}%
+ \UTFviiiLoop
+
+ \countUTFx = "E0
+ \countUTFy = "F0
+ \def\UTFviiiTmp{%
+ \gdef~{%
+ \ifpassthroughchars $%
+ \else\expandafter\UTFviiiThreeOctets\expandafter$\fi}}%
+ \UTFviiiLoop
+
+ \countUTFx = "F0
+ \countUTFy = "F4
+ \def\UTFviiiTmp{%
+ \gdef~{%
+ \ifpassthroughchars $%
+ \else\expandafter\UTFviiiFourOctets\expandafter$\fi
+ }}%
+ \UTFviiiLoop
+\endgroup
+
+\def\globallet{\global\let} % save some \expandafter's below
+
+% @U{xxxx} to produce U+xxxx, if we support it.
+\def\U#1{%
+ \expandafter\ifx\csname uni:#1\endcsname \relax
+ \iftxinativeunicodecapable
+ % All Unicode characters can be used if native Unicode handling is
+ % active. However, if the font does not have the glyph,
+ % letters are missing.
+ \begingroup
+ \uccode`\.="#1\relax
+ \uppercase{.}
+ \endgroup
+ \else
+ \errhelp = \EMsimple
+ \errmessage{Unicode character U+#1 not supported, sorry}%
+ \fi
+ \else
+ \csname uni:#1\endcsname
+ \fi
+}
+
+% These macros are used here to construct the name of a control
+% sequence to be defined.
+\def\UTFviiiTwoOctetsName#1#2{%
+ \csname u8:#1\string #2\endcsname}%
+\def\UTFviiiThreeOctetsName#1#2#3{%
+ \csname u8:#1\string #2\string #3\endcsname}%
+\def\UTFviiiFourOctetsName#1#2#3#4{%
+ \csname u8:#1\string #2\string #3\string #4\endcsname}%
+
+% For UTF-8 byte sequences (TeX, e-TeX and pdfTeX),
+% provide a definition macro to replace a Unicode character;
+% this gets used by the @U command
+%
+\begingroup
+ \catcode`\"=12
+ \catcode`\<=12
+ \catcode`\.=12
+ \catcode`\,=12
+ \catcode`\;=12
+ \catcode`\!=12
+ \catcode`\~=13
+ \gdef\DeclareUnicodeCharacterUTFviii#1#2{%
+ \countUTFz = "#1\relax
+ \begingroup
+ \parseXMLCharref
+
+ % Give \u8:... its definition. The sequence of seven \expandafter's
+ % expands after the \gdef three times, e.g.
+ %
+ % 1. \UTFviiTwoOctetsName B1 B2
+ % 2. \csname u8:B1 \string B2 \endcsname
+ % 3. \u8: B1 B2 (a single control sequence token)
+ %
+ \expandafter\expandafter
+ \expandafter\expandafter
+ \expandafter\expandafter
+ \expandafter\gdef \UTFviiiTmp{#2}%
+ %
+ \expandafter\ifx\csname uni:#1\endcsname \relax \else
+ \message{Internal error, already defined: #1}%
+ \fi
+ %
+ % define an additional control sequence for this code point.
+ \expandafter\globallet\csname uni:#1\endcsname \UTFviiiTmp
+ \endgroup}
+ %
+ % Given the value in \countUTFz as a Unicode code point, set \UTFviiiTmp
+ % to the corresponding UTF-8 sequence.
+ \gdef\parseXMLCharref{%
+ \ifnum\countUTFz < "A0\relax
+ \errhelp = \EMsimple
+ \errmessage{Cannot define Unicode char value < 00A0}%
+ \else\ifnum\countUTFz < "800\relax
+ \parseUTFviiiA,%
+ \parseUTFviiiB C\UTFviiiTwoOctetsName.,%
+ \else\ifnum\countUTFz < "10000\relax
+ \parseUTFviiiA;%
+ \parseUTFviiiA,%
+ \parseUTFviiiB E\UTFviiiThreeOctetsName.{,;}%
+ \else
+ \parseUTFviiiA;%
+ \parseUTFviiiA,%
+ \parseUTFviiiA!%
+ \parseUTFviiiB F\UTFviiiFourOctetsName.{!,;}%
+ \fi\fi\fi
+ }
+
+ % Extract a byte from the end of the UTF-8 representation of \countUTFx.
+ % It must be a non-initial byte in the sequence.
+ % Change \uccode of #1 for it to be used in \parseUTFviiiB as one
+ % of the bytes.
+ \gdef\parseUTFviiiA#1{%
+ \countUTFx = \countUTFz
+ \divide\countUTFz by 64
+ \countUTFy = \countUTFz % Save to be the future value of \countUTFz.
+ \multiply\countUTFz by 64
+
+ % \countUTFz is now \countUTFx with the last 5 bits cleared. Subtract
+ % in order to get the last five bits.
+ \advance\countUTFx by -\countUTFz
+
+ % Convert this to the byte in the UTF-8 sequence.
+ \advance\countUTFx by 128
+ \uccode `#1\countUTFx
+ \countUTFz = \countUTFy}
+
+ % Used to put a UTF-8 byte sequence into \UTFviiiTmp
+ % #1 is the increment for \countUTFz to yield a the first byte of the UTF-8
+ % sequence.
+ % #2 is one of the \UTFviii*OctetsName macros.
+ % #3 is always a full stop (.)
+ % #4 is a template for the other bytes in the sequence. The values for these
+ % bytes is substituted in here with \uppercase using the \uccode's.
+ \gdef\parseUTFviiiB#1#2#3#4{%
+ \advance\countUTFz by "#10\relax
+ \uccode `#3\countUTFz
+ \uppercase{\gdef\UTFviiiTmp{#2#3#4}}}
+\endgroup
+
+% For native Unicode handling (XeTeX and LuaTeX),
+% provide a definition macro that sets a catcode to `other' non-globally
+%
+\def\DeclareUnicodeCharacterNativeOther#1#2{%
+ \catcode"#1=\other
+}
+
+% https://en.wikipedia.org/wiki/Plane_(Unicode)#Basic_M
+% U+0000..U+007F = https://en.wikipedia.org/wiki/Basic_Latin_(Unicode_block)
+% U+0080..U+00FF = https://en.wikipedia.org/wiki/Latin-1_Supplement_(Unicode_block)
+% U+0100..U+017F = https://en.wikipedia.org/wiki/Latin_Extended-A
+% U+0180..U+024F = https://en.wikipedia.org/wiki/Latin_Extended-B
+%
+% Many of our renditions are less than wonderful, and all the missing
+% characters are available somewhere. Loading the necessary fonts
+% awaits user request. We can't truly support Unicode without
+% reimplementing everything that's been done in LaTeX for many years,
+% plus probably using luatex or xetex, and who knows what else.
+% We won't be doing that here in this simple file. But we can try to at
+% least make most of the characters not bomb out.
+%
+\def\unicodechardefs{%
+ \DeclareUnicodeCharacter{00A0}{\tie}%
+ \DeclareUnicodeCharacter{00A1}{\exclamdown}%
+ \DeclareUnicodeCharacter{00A2}{{\tcfont \char162}}% 0242=cent
+ \DeclareUnicodeCharacter{00A3}{\pounds{}}%
+ \DeclareUnicodeCharacter{00A4}{{\tcfont \char164}}% 0244=currency
+ \DeclareUnicodeCharacter{00A5}{{\tcfont \char165}}% 0245=yen
+ \DeclareUnicodeCharacter{00A6}{{\tcfont \char166}}% 0246=brokenbar
+ \DeclareUnicodeCharacter{00A7}{\S}%
+ \DeclareUnicodeCharacter{00A8}{\"{ }}%
+ \DeclareUnicodeCharacter{00A9}{\copyright{}}%
+ \DeclareUnicodeCharacter{00AA}{\ordf}%
+ \DeclareUnicodeCharacter{00AB}{\guillemetleft{}}%
+ \DeclareUnicodeCharacter{00AC}{\ensuremath\lnot}%
+ \DeclareUnicodeCharacter{00AD}{\-}%
+ \DeclareUnicodeCharacter{00AE}{\registeredsymbol{}}%
+ \DeclareUnicodeCharacter{00AF}{\={ }}%
+ %
+ \DeclareUnicodeCharacter{00B0}{\ringaccent{ }}%
+ \DeclareUnicodeCharacter{00B1}{\ensuremath\pm}%
+ \DeclareUnicodeCharacter{00B2}{$^2$}%
+ \DeclareUnicodeCharacter{00B3}{$^3$}%
+ \DeclareUnicodeCharacter{00B4}{\'{ }}%
+ \DeclareUnicodeCharacter{00B5}{$\mu$}%
+ \DeclareUnicodeCharacter{00B6}{\P}%
+ \DeclareUnicodeCharacter{00B7}{\ensuremath\cdot}%
+ \DeclareUnicodeCharacter{00B8}{\cedilla{ }}%
+ \DeclareUnicodeCharacter{00B9}{$^1$}%
+ \DeclareUnicodeCharacter{00BA}{\ordm}%
+ \DeclareUnicodeCharacter{00BB}{\guillemetright{}}%
+ \DeclareUnicodeCharacter{00BC}{$1\over4$}%
+ \DeclareUnicodeCharacter{00BD}{$1\over2$}%
+ \DeclareUnicodeCharacter{00BE}{$3\over4$}%
+ \DeclareUnicodeCharacter{00BF}{\questiondown}%
+ %
+ \DeclareUnicodeCharacter{00C0}{\`A}%
+ \DeclareUnicodeCharacter{00C1}{\'A}%
+ \DeclareUnicodeCharacter{00C2}{\^A}%
+ \DeclareUnicodeCharacter{00C3}{\~A}%
+ \DeclareUnicodeCharacter{00C4}{\"A}%
+ \DeclareUnicodeCharacter{00C5}{\AA}%
+ \DeclareUnicodeCharacter{00C6}{\AE}%
+ \DeclareUnicodeCharacter{00C7}{\cedilla{C}}%
+ \DeclareUnicodeCharacter{00C8}{\`E}%
+ \DeclareUnicodeCharacter{00C9}{\'E}%
+ \DeclareUnicodeCharacter{00CA}{\^E}%
+ \DeclareUnicodeCharacter{00CB}{\"E}%
+ \DeclareUnicodeCharacter{00CC}{\`I}%
+ \DeclareUnicodeCharacter{00CD}{\'I}%
+ \DeclareUnicodeCharacter{00CE}{\^I}%
+ \DeclareUnicodeCharacter{00CF}{\"I}%
+ %
+ \DeclareUnicodeCharacter{00D0}{\DH}%
+ \DeclareUnicodeCharacter{00D1}{\~N}%
+ \DeclareUnicodeCharacter{00D2}{\`O}%
+ \DeclareUnicodeCharacter{00D3}{\'O}%
+ \DeclareUnicodeCharacter{00D4}{\^O}%
+ \DeclareUnicodeCharacter{00D5}{\~O}%
+ \DeclareUnicodeCharacter{00D6}{\"O}%
+ \DeclareUnicodeCharacter{00D7}{\ensuremath\times}%
+ \DeclareUnicodeCharacter{00D8}{\O}%
+ \DeclareUnicodeCharacter{00D9}{\`U}%
+ \DeclareUnicodeCharacter{00DA}{\'U}%
+ \DeclareUnicodeCharacter{00DB}{\^U}%
+ \DeclareUnicodeCharacter{00DC}{\"U}%
+ \DeclareUnicodeCharacter{00DD}{\'Y}%
+ \DeclareUnicodeCharacter{00DE}{\TH}%
+ \DeclareUnicodeCharacter{00DF}{\ss}%
+ %
+ \DeclareUnicodeCharacter{00E0}{\`a}%
+ \DeclareUnicodeCharacter{00E1}{\'a}%
+ \DeclareUnicodeCharacter{00E2}{\^a}%
+ \DeclareUnicodeCharacter{00E3}{\~a}%
+ \DeclareUnicodeCharacter{00E4}{\"a}%
+ \DeclareUnicodeCharacter{00E5}{\aa}%
+ \DeclareUnicodeCharacter{00E6}{\ae}%
+ \DeclareUnicodeCharacter{00E7}{\cedilla{c}}%
+ \DeclareUnicodeCharacter{00E8}{\`e}%
+ \DeclareUnicodeCharacter{00E9}{\'e}%
+ \DeclareUnicodeCharacter{00EA}{\^e}%
+ \DeclareUnicodeCharacter{00EB}{\"e}%
+ \DeclareUnicodeCharacter{00EC}{\`{\dotless{i}}}%
+ \DeclareUnicodeCharacter{00ED}{\'{\dotless{i}}}%
+ \DeclareUnicodeCharacter{00EE}{\^{\dotless{i}}}%
+ \DeclareUnicodeCharacter{00EF}{\"{\dotless{i}}}%
+ %
+ \DeclareUnicodeCharacter{00F0}{\dh}%
+ \DeclareUnicodeCharacter{00F1}{\~n}%
+ \DeclareUnicodeCharacter{00F2}{\`o}%
+ \DeclareUnicodeCharacter{00F3}{\'o}%
+ \DeclareUnicodeCharacter{00F4}{\^o}%
+ \DeclareUnicodeCharacter{00F5}{\~o}%
+ \DeclareUnicodeCharacter{00F6}{\"o}%
+ \DeclareUnicodeCharacter{00F7}{\ensuremath\div}%
+ \DeclareUnicodeCharacter{00F8}{\o}%
+ \DeclareUnicodeCharacter{00F9}{\`u}%
+ \DeclareUnicodeCharacter{00FA}{\'u}%
+ \DeclareUnicodeCharacter{00FB}{\^u}%
+ \DeclareUnicodeCharacter{00FC}{\"u}%
+ \DeclareUnicodeCharacter{00FD}{\'y}%
+ \DeclareUnicodeCharacter{00FE}{\th}%
+ \DeclareUnicodeCharacter{00FF}{\"y}%
+ %
+ \DeclareUnicodeCharacter{0100}{\=A}%
+ \DeclareUnicodeCharacter{0101}{\=a}%
+ \DeclareUnicodeCharacter{0102}{\u{A}}%
+ \DeclareUnicodeCharacter{0103}{\u{a}}%
+ \DeclareUnicodeCharacter{0104}{\ogonek{A}}%
+ \DeclareUnicodeCharacter{0105}{\ogonek{a}}%
+ \DeclareUnicodeCharacter{0106}{\'C}%
+ \DeclareUnicodeCharacter{0107}{\'c}%
+ \DeclareUnicodeCharacter{0108}{\^C}%
+ \DeclareUnicodeCharacter{0109}{\^c}%
+ \DeclareUnicodeCharacter{010A}{\dotaccent{C}}%
+ \DeclareUnicodeCharacter{010B}{\dotaccent{c}}%
+ \DeclareUnicodeCharacter{010C}{\v{C}}%
+ \DeclareUnicodeCharacter{010D}{\v{c}}%
+ \DeclareUnicodeCharacter{010E}{\v{D}}%
+ \DeclareUnicodeCharacter{010F}{d'}%
+ %
+ \DeclareUnicodeCharacter{0110}{\DH}%
+ \DeclareUnicodeCharacter{0111}{\dh}%
+ \DeclareUnicodeCharacter{0112}{\=E}%
+ \DeclareUnicodeCharacter{0113}{\=e}%
+ \DeclareUnicodeCharacter{0114}{\u{E}}%
+ \DeclareUnicodeCharacter{0115}{\u{e}}%
+ \DeclareUnicodeCharacter{0116}{\dotaccent{E}}%
+ \DeclareUnicodeCharacter{0117}{\dotaccent{e}}%
+ \DeclareUnicodeCharacter{0118}{\ogonek{E}}%
+ \DeclareUnicodeCharacter{0119}{\ogonek{e}}%
+ \DeclareUnicodeCharacter{011A}{\v{E}}%
+ \DeclareUnicodeCharacter{011B}{\v{e}}%
+ \DeclareUnicodeCharacter{011C}{\^G}%
+ \DeclareUnicodeCharacter{011D}{\^g}%
+ \DeclareUnicodeCharacter{011E}{\u{G}}%
+ \DeclareUnicodeCharacter{011F}{\u{g}}%
+ %
+ \DeclareUnicodeCharacter{0120}{\dotaccent{G}}%
+ \DeclareUnicodeCharacter{0121}{\dotaccent{g}}%
+ \DeclareUnicodeCharacter{0122}{\cedilla{G}}%
+ \DeclareUnicodeCharacter{0123}{\cedilla{g}}%
+ \DeclareUnicodeCharacter{0124}{\^H}%
+ \DeclareUnicodeCharacter{0125}{\^h}%
+ \DeclareUnicodeCharacter{0126}{\missingcharmsg{H WITH STROKE}}%
+ \DeclareUnicodeCharacter{0127}{\missingcharmsg{h WITH STROKE}}%
+ \DeclareUnicodeCharacter{0128}{\~I}%
+ \DeclareUnicodeCharacter{0129}{\~{\dotless{i}}}%
+ \DeclareUnicodeCharacter{012A}{\=I}%
+ \DeclareUnicodeCharacter{012B}{\={\dotless{i}}}%
+ \DeclareUnicodeCharacter{012C}{\u{I}}%
+ \DeclareUnicodeCharacter{012D}{\u{\dotless{i}}}%
+ \DeclareUnicodeCharacter{012E}{\ogonek{I}}%
+ \DeclareUnicodeCharacter{012F}{\ogonek{i}}%
+ %
+ \DeclareUnicodeCharacter{0130}{\dotaccent{I}}%
+ \DeclareUnicodeCharacter{0131}{\dotless{i}}%
+ \DeclareUnicodeCharacter{0132}{IJ}%
+ \DeclareUnicodeCharacter{0133}{ij}%
+ \DeclareUnicodeCharacter{0134}{\^J}%
+ \DeclareUnicodeCharacter{0135}{\^{\dotless{j}}}%
+ \DeclareUnicodeCharacter{0136}{\cedilla{K}}%
+ \DeclareUnicodeCharacter{0137}{\cedilla{k}}%
+ \DeclareUnicodeCharacter{0138}{\ensuremath\kappa}%
+ \DeclareUnicodeCharacter{0139}{\'L}%
+ \DeclareUnicodeCharacter{013A}{\'l}%
+ \DeclareUnicodeCharacter{013B}{\cedilla{L}}%
+ \DeclareUnicodeCharacter{013C}{\cedilla{l}}%
+ \DeclareUnicodeCharacter{013D}{L'}% should kern
+ \DeclareUnicodeCharacter{013E}{l'}% should kern
+ \DeclareUnicodeCharacter{013F}{L\U{00B7}}%
+ %
+ \DeclareUnicodeCharacter{0140}{l\U{00B7}}%
+ \DeclareUnicodeCharacter{0141}{\L}%
+ \DeclareUnicodeCharacter{0142}{\l}%
+ \DeclareUnicodeCharacter{0143}{\'N}%
+ \DeclareUnicodeCharacter{0144}{\'n}%
+ \DeclareUnicodeCharacter{0145}{\cedilla{N}}%
+ \DeclareUnicodeCharacter{0146}{\cedilla{n}}%
+ \DeclareUnicodeCharacter{0147}{\v{N}}%
+ \DeclareUnicodeCharacter{0148}{\v{n}}%
+ \DeclareUnicodeCharacter{0149}{'n}%
+ \DeclareUnicodeCharacter{014A}{\missingcharmsg{ENG}}%
+ \DeclareUnicodeCharacter{014B}{\missingcharmsg{eng}}%
+ \DeclareUnicodeCharacter{014C}{\=O}%
+ \DeclareUnicodeCharacter{014D}{\=o}%
+ \DeclareUnicodeCharacter{014E}{\u{O}}%
+ \DeclareUnicodeCharacter{014F}{\u{o}}%
+ %
+ \DeclareUnicodeCharacter{0150}{\H{O}}%
+ \DeclareUnicodeCharacter{0151}{\H{o}}%
+ \DeclareUnicodeCharacter{0152}{\OE}%
+ \DeclareUnicodeCharacter{0153}{\oe}%
+ \DeclareUnicodeCharacter{0154}{\'R}%
+ \DeclareUnicodeCharacter{0155}{\'r}%
+ \DeclareUnicodeCharacter{0156}{\cedilla{R}}%
+ \DeclareUnicodeCharacter{0157}{\cedilla{r}}%
+ \DeclareUnicodeCharacter{0158}{\v{R}}%
+ \DeclareUnicodeCharacter{0159}{\v{r}}%
+ \DeclareUnicodeCharacter{015A}{\'S}%
+ \DeclareUnicodeCharacter{015B}{\'s}%
+ \DeclareUnicodeCharacter{015C}{\^S}%
+ \DeclareUnicodeCharacter{015D}{\^s}%
+ \DeclareUnicodeCharacter{015E}{\cedilla{S}}%
+ \DeclareUnicodeCharacter{015F}{\cedilla{s}}%
+ %
+ \DeclareUnicodeCharacter{0160}{\v{S}}%
+ \DeclareUnicodeCharacter{0161}{\v{s}}%
+ \DeclareUnicodeCharacter{0162}{\cedilla{T}}%
+ \DeclareUnicodeCharacter{0163}{\cedilla{t}}%
+ \DeclareUnicodeCharacter{0164}{\v{T}}%
+ \DeclareUnicodeCharacter{0165}{\v{t}}%
+ \DeclareUnicodeCharacter{0166}{\missingcharmsg{H WITH STROKE}}%
+ \DeclareUnicodeCharacter{0167}{\missingcharmsg{h WITH STROKE}}%
+ \DeclareUnicodeCharacter{0168}{\~U}%
+ \DeclareUnicodeCharacter{0169}{\~u}%
+ \DeclareUnicodeCharacter{016A}{\=U}%
+ \DeclareUnicodeCharacter{016B}{\=u}%
+ \DeclareUnicodeCharacter{016C}{\u{U}}%
+ \DeclareUnicodeCharacter{016D}{\u{u}}%
+ \DeclareUnicodeCharacter{016E}{\ringaccent{U}}%
+ \DeclareUnicodeCharacter{016F}{\ringaccent{u}}%
+ %
+ \DeclareUnicodeCharacter{0170}{\H{U}}%
+ \DeclareUnicodeCharacter{0171}{\H{u}}%
+ \DeclareUnicodeCharacter{0172}{\ogonek{U}}%
+ \DeclareUnicodeCharacter{0173}{\ogonek{u}}%
+ \DeclareUnicodeCharacter{0174}{\^W}%
+ \DeclareUnicodeCharacter{0175}{\^w}%
+ \DeclareUnicodeCharacter{0176}{\^Y}%
+ \DeclareUnicodeCharacter{0177}{\^y}%
+ \DeclareUnicodeCharacter{0178}{\"Y}%
+ \DeclareUnicodeCharacter{0179}{\'Z}%
+ \DeclareUnicodeCharacter{017A}{\'z}%
+ \DeclareUnicodeCharacter{017B}{\dotaccent{Z}}%
+ \DeclareUnicodeCharacter{017C}{\dotaccent{z}}%
+ \DeclareUnicodeCharacter{017D}{\v{Z}}%
+ \DeclareUnicodeCharacter{017E}{\v{z}}%
+ \DeclareUnicodeCharacter{017F}{\missingcharmsg{LONG S}}%
+ %
+ \DeclareUnicodeCharacter{01C4}{D\v{Z}}%
+ \DeclareUnicodeCharacter{01C5}{D\v{z}}%
+ \DeclareUnicodeCharacter{01C6}{d\v{z}}%
+ \DeclareUnicodeCharacter{01C7}{LJ}%
+ \DeclareUnicodeCharacter{01C8}{Lj}%
+ \DeclareUnicodeCharacter{01C9}{lj}%
+ \DeclareUnicodeCharacter{01CA}{NJ}%
+ \DeclareUnicodeCharacter{01CB}{Nj}%
+ \DeclareUnicodeCharacter{01CC}{nj}%
+ \DeclareUnicodeCharacter{01CD}{\v{A}}%
+ \DeclareUnicodeCharacter{01CE}{\v{a}}%
+ \DeclareUnicodeCharacter{01CF}{\v{I}}%
+ %
+ \DeclareUnicodeCharacter{01D0}{\v{\dotless{i}}}%
+ \DeclareUnicodeCharacter{01D1}{\v{O}}%
+ \DeclareUnicodeCharacter{01D2}{\v{o}}%
+ \DeclareUnicodeCharacter{01D3}{\v{U}}%
+ \DeclareUnicodeCharacter{01D4}{\v{u}}%
+ %
+ \DeclareUnicodeCharacter{01E2}{\={\AE}}%
+ \DeclareUnicodeCharacter{01E3}{\={\ae}}%
+ \DeclareUnicodeCharacter{01E6}{\v{G}}%
+ \DeclareUnicodeCharacter{01E7}{\v{g}}%
+ \DeclareUnicodeCharacter{01E8}{\v{K}}%
+ \DeclareUnicodeCharacter{01E9}{\v{k}}%
+ %
+ \DeclareUnicodeCharacter{01F0}{\v{\dotless{j}}}%
+ \DeclareUnicodeCharacter{01F1}{DZ}%
+ \DeclareUnicodeCharacter{01F2}{Dz}%
+ \DeclareUnicodeCharacter{01F3}{dz}%
+ \DeclareUnicodeCharacter{01F4}{\'G}%
+ \DeclareUnicodeCharacter{01F5}{\'g}%
+ \DeclareUnicodeCharacter{01F8}{\`N}%
+ \DeclareUnicodeCharacter{01F9}{\`n}%
+ \DeclareUnicodeCharacter{01FC}{\'{\AE}}%
+ \DeclareUnicodeCharacter{01FD}{\'{\ae}}%
+ \DeclareUnicodeCharacter{01FE}{\'{\O}}%
+ \DeclareUnicodeCharacter{01FF}{\'{\o}}%
+ %
+ \DeclareUnicodeCharacter{021E}{\v{H}}%
+ \DeclareUnicodeCharacter{021F}{\v{h}}%
+ %
+ \DeclareUnicodeCharacter{0226}{\dotaccent{A}}%
+ \DeclareUnicodeCharacter{0227}{\dotaccent{a}}%
+ \DeclareUnicodeCharacter{0228}{\cedilla{E}}%
+ \DeclareUnicodeCharacter{0229}{\cedilla{e}}%
+ \DeclareUnicodeCharacter{022E}{\dotaccent{O}}%
+ \DeclareUnicodeCharacter{022F}{\dotaccent{o}}%
+ %
+ \DeclareUnicodeCharacter{0232}{\=Y}%
+ \DeclareUnicodeCharacter{0233}{\=y}%
+ \DeclareUnicodeCharacter{0237}{\dotless{j}}%
+ %
+ \DeclareUnicodeCharacter{02DB}{\ogonek{ }}%
+ %
+ % Greek letters upper case
+ \DeclareUnicodeCharacter{0391}{{\it A}}%
+ \DeclareUnicodeCharacter{0392}{{\it B}}%
+ \DeclareUnicodeCharacter{0393}{\ensuremath{\mit\Gamma}}%
+ \DeclareUnicodeCharacter{0394}{\ensuremath{\mit\Delta}}%
+ \DeclareUnicodeCharacter{0395}{{\it E}}%
+ \DeclareUnicodeCharacter{0396}{{\it Z}}%
+ \DeclareUnicodeCharacter{0397}{{\it H}}%
+ \DeclareUnicodeCharacter{0398}{\ensuremath{\mit\Theta}}%
+ \DeclareUnicodeCharacter{0399}{{\it I}}%
+ \DeclareUnicodeCharacter{039A}{{\it K}}%
+ \DeclareUnicodeCharacter{039B}{\ensuremath{\mit\Lambda}}%
+ \DeclareUnicodeCharacter{039C}{{\it M}}%
+ \DeclareUnicodeCharacter{039D}{{\it N}}%
+ \DeclareUnicodeCharacter{039E}{\ensuremath{\mit\Xi}}%
+ \DeclareUnicodeCharacter{039F}{{\it O}}%
+ \DeclareUnicodeCharacter{03A0}{\ensuremath{\mit\Pi}}%
+ \DeclareUnicodeCharacter{03A1}{{\it P}}%
+ %\DeclareUnicodeCharacter{03A2}{} % none - corresponds to final sigma
+ \DeclareUnicodeCharacter{03A3}{\ensuremath{\mit\Sigma}}%
+ \DeclareUnicodeCharacter{03A4}{{\it T}}%
+ \DeclareUnicodeCharacter{03A5}{\ensuremath{\mit\Upsilon}}%
+ \DeclareUnicodeCharacter{03A6}{\ensuremath{\mit\Phi}}%
+ \DeclareUnicodeCharacter{03A7}{{\it X}}%
+ \DeclareUnicodeCharacter{03A8}{\ensuremath{\mit\Psi}}%
+ \DeclareUnicodeCharacter{03A9}{\ensuremath{\mit\Omega}}%
+ %
+ % Vowels with accents
+ \DeclareUnicodeCharacter{0390}{\ensuremath{\ddot{\acute\iota}}}%
+ \DeclareUnicodeCharacter{03AC}{\ensuremath{\acute\alpha}}%
+ \DeclareUnicodeCharacter{03AD}{\ensuremath{\acute\epsilon}}%
+ \DeclareUnicodeCharacter{03AE}{\ensuremath{\acute\eta}}%
+ \DeclareUnicodeCharacter{03AF}{\ensuremath{\acute\iota}}%
+ \DeclareUnicodeCharacter{03B0}{\ensuremath{\acute{\ddot\upsilon}}}%
+ %
+ % Standalone accent
+ \DeclareUnicodeCharacter{0384}{\ensuremath{\acute{\ }}}%
+ %
+ % Greek letters lower case
+ \DeclareUnicodeCharacter{03B1}{\ensuremath\alpha}%
+ \DeclareUnicodeCharacter{03B2}{\ensuremath\beta}%
+ \DeclareUnicodeCharacter{03B3}{\ensuremath\gamma}%
+ \DeclareUnicodeCharacter{03B4}{\ensuremath\delta}%
+ \DeclareUnicodeCharacter{03B5}{\ensuremath\epsilon}%
+ \DeclareUnicodeCharacter{03B6}{\ensuremath\zeta}%
+ \DeclareUnicodeCharacter{03B7}{\ensuremath\eta}%
+ \DeclareUnicodeCharacter{03B8}{\ensuremath\theta}%
+ \DeclareUnicodeCharacter{03B9}{\ensuremath\iota}%
+ \DeclareUnicodeCharacter{03BA}{\ensuremath\kappa}%
+ \DeclareUnicodeCharacter{03BB}{\ensuremath\lambda}%
+ \DeclareUnicodeCharacter{03BC}{\ensuremath\mu}%
+ \DeclareUnicodeCharacter{03BD}{\ensuremath\nu}%
+ \DeclareUnicodeCharacter{03BE}{\ensuremath\xi}%
+ \DeclareUnicodeCharacter{03BF}{{\it o}}% omicron
+ \DeclareUnicodeCharacter{03C0}{\ensuremath\pi}%
+ \DeclareUnicodeCharacter{03C1}{\ensuremath\rho}%
+ \DeclareUnicodeCharacter{03C2}{\ensuremath\varsigma}%
+ \DeclareUnicodeCharacter{03C3}{\ensuremath\sigma}%
+ \DeclareUnicodeCharacter{03C4}{\ensuremath\tau}%
+ \DeclareUnicodeCharacter{03C5}{\ensuremath\upsilon}%
+ \DeclareUnicodeCharacter{03C6}{\ensuremath\phi}%
+ \DeclareUnicodeCharacter{03C7}{\ensuremath\chi}%
+ \DeclareUnicodeCharacter{03C8}{\ensuremath\psi}%
+ \DeclareUnicodeCharacter{03C9}{\ensuremath\omega}%
+ %
+ % More Greek vowels with accents
+ \DeclareUnicodeCharacter{03CA}{\ensuremath{\ddot\iota}}%
+ \DeclareUnicodeCharacter{03CB}{\ensuremath{\ddot\upsilon}}%
+ \DeclareUnicodeCharacter{03CC}{\ensuremath{\acute o}}%
+ \DeclareUnicodeCharacter{03CD}{\ensuremath{\acute\upsilon}}%
+ \DeclareUnicodeCharacter{03CE}{\ensuremath{\acute\omega}}%
+ %
+ % Variant Greek letters
+ \DeclareUnicodeCharacter{03D1}{\ensuremath\vartheta}%
+ \DeclareUnicodeCharacter{03D6}{\ensuremath\varpi}%
+ \DeclareUnicodeCharacter{03F1}{\ensuremath\varrho}%
+ %
+ \DeclareUnicodeCharacter{1E02}{\dotaccent{B}}%
+ \DeclareUnicodeCharacter{1E03}{\dotaccent{b}}%
+ \DeclareUnicodeCharacter{1E04}{\udotaccent{B}}%
+ \DeclareUnicodeCharacter{1E05}{\udotaccent{b}}%
+ \DeclareUnicodeCharacter{1E06}{\ubaraccent{B}}%
+ \DeclareUnicodeCharacter{1E07}{\ubaraccent{b}}%
+ \DeclareUnicodeCharacter{1E0A}{\dotaccent{D}}%
+ \DeclareUnicodeCharacter{1E0B}{\dotaccent{d}}%
+ \DeclareUnicodeCharacter{1E0C}{\udotaccent{D}}%
+ \DeclareUnicodeCharacter{1E0D}{\udotaccent{d}}%
+ \DeclareUnicodeCharacter{1E0E}{\ubaraccent{D}}%
+ \DeclareUnicodeCharacter{1E0F}{\ubaraccent{d}}%
+ %
+ \DeclareUnicodeCharacter{1E1E}{\dotaccent{F}}%
+ \DeclareUnicodeCharacter{1E1F}{\dotaccent{f}}%
+ %
+ \DeclareUnicodeCharacter{1E20}{\=G}%
+ \DeclareUnicodeCharacter{1E21}{\=g}%
+ \DeclareUnicodeCharacter{1E22}{\dotaccent{H}}%
+ \DeclareUnicodeCharacter{1E23}{\dotaccent{h}}%
+ \DeclareUnicodeCharacter{1E24}{\udotaccent{H}}%
+ \DeclareUnicodeCharacter{1E25}{\udotaccent{h}}%
+ \DeclareUnicodeCharacter{1E26}{\"H}%
+ \DeclareUnicodeCharacter{1E27}{\"h}%
+ %
+ \DeclareUnicodeCharacter{1E30}{\'K}%
+ \DeclareUnicodeCharacter{1E31}{\'k}%
+ \DeclareUnicodeCharacter{1E32}{\udotaccent{K}}%
+ \DeclareUnicodeCharacter{1E33}{\udotaccent{k}}%
+ \DeclareUnicodeCharacter{1E34}{\ubaraccent{K}}%
+ \DeclareUnicodeCharacter{1E35}{\ubaraccent{k}}%
+ \DeclareUnicodeCharacter{1E36}{\udotaccent{L}}%
+ \DeclareUnicodeCharacter{1E37}{\udotaccent{l}}%
+ \DeclareUnicodeCharacter{1E3A}{\ubaraccent{L}}%
+ \DeclareUnicodeCharacter{1E3B}{\ubaraccent{l}}%
+ \DeclareUnicodeCharacter{1E3E}{\'M}%
+ \DeclareUnicodeCharacter{1E3F}{\'m}%
+ %
+ \DeclareUnicodeCharacter{1E40}{\dotaccent{M}}%
+ \DeclareUnicodeCharacter{1E41}{\dotaccent{m}}%
+ \DeclareUnicodeCharacter{1E42}{\udotaccent{M}}%
+ \DeclareUnicodeCharacter{1E43}{\udotaccent{m}}%
+ \DeclareUnicodeCharacter{1E44}{\dotaccent{N}}%
+ \DeclareUnicodeCharacter{1E45}{\dotaccent{n}}%
+ \DeclareUnicodeCharacter{1E46}{\udotaccent{N}}%
+ \DeclareUnicodeCharacter{1E47}{\udotaccent{n}}%
+ \DeclareUnicodeCharacter{1E48}{\ubaraccent{N}}%
+ \DeclareUnicodeCharacter{1E49}{\ubaraccent{n}}%
+ %
+ \DeclareUnicodeCharacter{1E54}{\'P}%
+ \DeclareUnicodeCharacter{1E55}{\'p}%
+ \DeclareUnicodeCharacter{1E56}{\dotaccent{P}}%
+ \DeclareUnicodeCharacter{1E57}{\dotaccent{p}}%
+ \DeclareUnicodeCharacter{1E58}{\dotaccent{R}}%
+ \DeclareUnicodeCharacter{1E59}{\dotaccent{r}}%
+ \DeclareUnicodeCharacter{1E5A}{\udotaccent{R}}%
+ \DeclareUnicodeCharacter{1E5B}{\udotaccent{r}}%
+ \DeclareUnicodeCharacter{1E5E}{\ubaraccent{R}}%
+ \DeclareUnicodeCharacter{1E5F}{\ubaraccent{r}}%
+ %
+ \DeclareUnicodeCharacter{1E60}{\dotaccent{S}}%
+ \DeclareUnicodeCharacter{1E61}{\dotaccent{s}}%
+ \DeclareUnicodeCharacter{1E62}{\udotaccent{S}}%
+ \DeclareUnicodeCharacter{1E63}{\udotaccent{s}}%
+ \DeclareUnicodeCharacter{1E6A}{\dotaccent{T}}%
+ \DeclareUnicodeCharacter{1E6B}{\dotaccent{t}}%
+ \DeclareUnicodeCharacter{1E6C}{\udotaccent{T}}%
+ \DeclareUnicodeCharacter{1E6D}{\udotaccent{t}}%
+ \DeclareUnicodeCharacter{1E6E}{\ubaraccent{T}}%
+ \DeclareUnicodeCharacter{1E6F}{\ubaraccent{t}}%
+ %
+ \DeclareUnicodeCharacter{1E7C}{\~V}%
+ \DeclareUnicodeCharacter{1E7D}{\~v}%
+ \DeclareUnicodeCharacter{1E7E}{\udotaccent{V}}%
+ \DeclareUnicodeCharacter{1E7F}{\udotaccent{v}}%
+ %
+ \DeclareUnicodeCharacter{1E80}{\`W}%
+ \DeclareUnicodeCharacter{1E81}{\`w}%
+ \DeclareUnicodeCharacter{1E82}{\'W}%
+ \DeclareUnicodeCharacter{1E83}{\'w}%
+ \DeclareUnicodeCharacter{1E84}{\"W}%
+ \DeclareUnicodeCharacter{1E85}{\"w}%
+ \DeclareUnicodeCharacter{1E86}{\dotaccent{W}}%
+ \DeclareUnicodeCharacter{1E87}{\dotaccent{w}}%
+ \DeclareUnicodeCharacter{1E88}{\udotaccent{W}}%
+ \DeclareUnicodeCharacter{1E89}{\udotaccent{w}}%
+ \DeclareUnicodeCharacter{1E8A}{\dotaccent{X}}%
+ \DeclareUnicodeCharacter{1E8B}{\dotaccent{x}}%
+ \DeclareUnicodeCharacter{1E8C}{\"X}%
+ \DeclareUnicodeCharacter{1E8D}{\"x}%
+ \DeclareUnicodeCharacter{1E8E}{\dotaccent{Y}}%
+ \DeclareUnicodeCharacter{1E8F}{\dotaccent{y}}%
+ %
+ \DeclareUnicodeCharacter{1E90}{\^Z}%
+ \DeclareUnicodeCharacter{1E91}{\^z}%
+ \DeclareUnicodeCharacter{1E92}{\udotaccent{Z}}%
+ \DeclareUnicodeCharacter{1E93}{\udotaccent{z}}%
+ \DeclareUnicodeCharacter{1E94}{\ubaraccent{Z}}%
+ \DeclareUnicodeCharacter{1E95}{\ubaraccent{z}}%
+ \DeclareUnicodeCharacter{1E96}{\ubaraccent{h}}%
+ \DeclareUnicodeCharacter{1E97}{\"t}%
+ \DeclareUnicodeCharacter{1E98}{\ringaccent{w}}%
+ \DeclareUnicodeCharacter{1E99}{\ringaccent{y}}%
+ %
+ \DeclareUnicodeCharacter{1EA0}{\udotaccent{A}}%
+ \DeclareUnicodeCharacter{1EA1}{\udotaccent{a}}%
+ %
+ \DeclareUnicodeCharacter{1EB8}{\udotaccent{E}}%
+ \DeclareUnicodeCharacter{1EB9}{\udotaccent{e}}%
+ \DeclareUnicodeCharacter{1EBC}{\~E}%
+ \DeclareUnicodeCharacter{1EBD}{\~e}%
+ %
+ \DeclareUnicodeCharacter{1ECA}{\udotaccent{I}}%
+ \DeclareUnicodeCharacter{1ECB}{\udotaccent{i}}%
+ \DeclareUnicodeCharacter{1ECC}{\udotaccent{O}}%
+ \DeclareUnicodeCharacter{1ECD}{\udotaccent{o}}%
+ %
+ \DeclareUnicodeCharacter{1EE4}{\udotaccent{U}}%
+ \DeclareUnicodeCharacter{1EE5}{\udotaccent{u}}%
+ %
+ \DeclareUnicodeCharacter{1EF2}{\`Y}%
+ \DeclareUnicodeCharacter{1EF3}{\`y}%
+ \DeclareUnicodeCharacter{1EF4}{\udotaccent{Y}}%
+ %
+ \DeclareUnicodeCharacter{1EF8}{\~Y}%
+ \DeclareUnicodeCharacter{1EF9}{\~y}%
+ %
+ % Punctuation
+ \DeclareUnicodeCharacter{2013}{--}%
+ \DeclareUnicodeCharacter{2014}{---}%
+ \DeclareUnicodeCharacter{2018}{\quoteleft{}}%
+ \DeclareUnicodeCharacter{2019}{\quoteright{}}%
+ \DeclareUnicodeCharacter{201A}{\quotesinglbase{}}%
+ \DeclareUnicodeCharacter{201C}{\quotedblleft{}}%
+ \DeclareUnicodeCharacter{201D}{\quotedblright{}}%
+ \DeclareUnicodeCharacter{201E}{\quotedblbase{}}%
+ \DeclareUnicodeCharacter{2020}{\ensuremath\dagger}%
+ \DeclareUnicodeCharacter{2021}{\ensuremath\ddagger}%
+ \DeclareUnicodeCharacter{2022}{\bullet{}}%
+ \DeclareUnicodeCharacter{202F}{\thinspace}%
+ \DeclareUnicodeCharacter{2026}{\dots{}}%
+ \DeclareUnicodeCharacter{2039}{\guilsinglleft{}}%
+ \DeclareUnicodeCharacter{203A}{\guilsinglright{}}%
+ %
+ \DeclareUnicodeCharacter{20AC}{\euro{}}%
+ %
+ \DeclareUnicodeCharacter{2192}{\expansion{}}%
+ \DeclareUnicodeCharacter{21D2}{\result{}}%
+ %
+ % Mathematical symbols
+ \DeclareUnicodeCharacter{2200}{\ensuremath\forall}%
+ \DeclareUnicodeCharacter{2203}{\ensuremath\exists}%
+ \DeclareUnicodeCharacter{2208}{\ensuremath\in}%
+ \DeclareUnicodeCharacter{2212}{\minus{}}%
+ \DeclareUnicodeCharacter{2217}{\ast}%
+ \DeclareUnicodeCharacter{221E}{\ensuremath\infty}%
+ \DeclareUnicodeCharacter{2225}{\ensuremath\parallel}%
+ \DeclareUnicodeCharacter{2227}{\ensuremath\wedge}%
+ \DeclareUnicodeCharacter{2229}{\ensuremath\cap}%
+ \DeclareUnicodeCharacter{2261}{\equiv{}}%
+ \DeclareUnicodeCharacter{2264}{\ensuremath\leq}%
+ \DeclareUnicodeCharacter{2265}{\ensuremath\geq}%
+ \DeclareUnicodeCharacter{2282}{\ensuremath\subset}%
+ \DeclareUnicodeCharacter{2287}{\ensuremath\supseteq}%
+ %
+ \DeclareUnicodeCharacter{2016}{\ensuremath\Vert}%
+ \DeclareUnicodeCharacter{2032}{\ensuremath\prime}%
+ \DeclareUnicodeCharacter{210F}{\ensuremath\hbar}%
+ \DeclareUnicodeCharacter{2111}{\ensuremath\Im}%
+ \DeclareUnicodeCharacter{2113}{\ensuremath\ell}%
+ \DeclareUnicodeCharacter{2118}{\ensuremath\wp}%
+ \DeclareUnicodeCharacter{211C}{\ensuremath\Re}%
+ \DeclareUnicodeCharacter{2135}{\ensuremath\aleph}%
+ \DeclareUnicodeCharacter{2190}{\ensuremath\leftarrow}%
+ \DeclareUnicodeCharacter{2191}{\ensuremath\uparrow}%
+ \DeclareUnicodeCharacter{2193}{\ensuremath\downarrow}%
+ \DeclareUnicodeCharacter{2194}{\ensuremath\leftrightarrow}%
+ \DeclareUnicodeCharacter{2195}{\ensuremath\updownarrow}%
+ \DeclareUnicodeCharacter{2196}{\ensuremath\nwarrow}%
+ \DeclareUnicodeCharacter{2197}{\ensuremath\nearrow}%
+ \DeclareUnicodeCharacter{2198}{\ensuremath\searrow}%
+ \DeclareUnicodeCharacter{2199}{\ensuremath\swarrow}%
+ \DeclareUnicodeCharacter{21A6}{\ensuremath\mapsto}%
+ \DeclareUnicodeCharacter{21A9}{\ensuremath\hookleftarrow}%
+ \DeclareUnicodeCharacter{21AA}{\ensuremath\hookrightarrow}%
+ \DeclareUnicodeCharacter{21BC}{\ensuremath\leftharpoonup}%
+ \DeclareUnicodeCharacter{21BD}{\ensuremath\leftharpoondown}%
+ \DeclareUnicodeCharacter{21C0}{\ensuremath\rightharpoonup}%
+ \DeclareUnicodeCharacter{21C1}{\ensuremath\rightharpoondown}%
+ \DeclareUnicodeCharacter{21CC}{\ensuremath\rightleftharpoons}%
+ \DeclareUnicodeCharacter{21D0}{\ensuremath\Leftarrow}%
+ \DeclareUnicodeCharacter{21D1}{\ensuremath\Uparrow}%
+ \DeclareUnicodeCharacter{21D3}{\ensuremath\Downarrow}%
+ \DeclareUnicodeCharacter{21D4}{\ensuremath\Leftrightarrow}%
+ \DeclareUnicodeCharacter{21D5}{\ensuremath\Updownarrow}%
+ \DeclareUnicodeCharacter{2202}{\ensuremath\partial}%
+ \DeclareUnicodeCharacter{2205}{\ensuremath\emptyset}%
+ \DeclareUnicodeCharacter{2207}{\ensuremath\nabla}%
+ \DeclareUnicodeCharacter{2209}{\ensuremath\notin}%
+ \DeclareUnicodeCharacter{220B}{\ensuremath\owns}%
+ \DeclareUnicodeCharacter{220F}{\ensuremath\prod}%
+ \DeclareUnicodeCharacter{2210}{\ensuremath\coprod}%
+ \DeclareUnicodeCharacter{2211}{\ensuremath\sum}%
+ \DeclareUnicodeCharacter{2213}{\ensuremath\mp}%
+ \DeclareUnicodeCharacter{2218}{\ensuremath\circ}%
+ \DeclareUnicodeCharacter{221A}{\ensuremath\surd}%
+ \DeclareUnicodeCharacter{221D}{\ensuremath\propto}%
+ \DeclareUnicodeCharacter{2220}{\ensuremath\angle}%
+ \DeclareUnicodeCharacter{2223}{\ensuremath\mid}%
+ \DeclareUnicodeCharacter{2228}{\ensuremath\vee}%
+ \DeclareUnicodeCharacter{222A}{\ensuremath\cup}%
+ \DeclareUnicodeCharacter{222B}{\ensuremath\smallint}%
+ \DeclareUnicodeCharacter{222E}{\ensuremath\oint}%
+ \DeclareUnicodeCharacter{223C}{\ensuremath\sim}%
+ \DeclareUnicodeCharacter{2240}{\ensuremath\wr}%
+ \DeclareUnicodeCharacter{2243}{\ensuremath\simeq}%
+ \DeclareUnicodeCharacter{2245}{\ensuremath\cong}%
+ \DeclareUnicodeCharacter{2248}{\ensuremath\approx}%
+ \DeclareUnicodeCharacter{224D}{\ensuremath\asymp}%
+ \DeclareUnicodeCharacter{2250}{\ensuremath\doteq}%
+ \DeclareUnicodeCharacter{2260}{\ensuremath\neq}%
+ \DeclareUnicodeCharacter{226A}{\ensuremath\ll}%
+ \DeclareUnicodeCharacter{226B}{\ensuremath\gg}%
+ \DeclareUnicodeCharacter{227A}{\ensuremath\prec}%
+ \DeclareUnicodeCharacter{227B}{\ensuremath\succ}%
+ \DeclareUnicodeCharacter{2283}{\ensuremath\supset}%
+ \DeclareUnicodeCharacter{2286}{\ensuremath\subseteq}%
+ \DeclareUnicodeCharacter{228E}{\ensuremath\uplus}%
+ \DeclareUnicodeCharacter{2291}{\ensuremath\sqsubseteq}%
+ \DeclareUnicodeCharacter{2292}{\ensuremath\sqsupseteq}%
+ \DeclareUnicodeCharacter{2293}{\ensuremath\sqcap}%
+ \DeclareUnicodeCharacter{2294}{\ensuremath\sqcup}%
+ \DeclareUnicodeCharacter{2295}{\ensuremath\oplus}%
+ \DeclareUnicodeCharacter{2296}{\ensuremath\ominus}%
+ \DeclareUnicodeCharacter{2297}{\ensuremath\otimes}%
+ \DeclareUnicodeCharacter{2298}{\ensuremath\oslash}%
+ \DeclareUnicodeCharacter{2299}{\ensuremath\odot}%
+ \DeclareUnicodeCharacter{22A2}{\ensuremath\vdash}%
+ \DeclareUnicodeCharacter{22A3}{\ensuremath\dashv}%
+ \DeclareUnicodeCharacter{22A4}{\ensuremath\ptextop}%
+ \DeclareUnicodeCharacter{22A5}{\ensuremath\bot}%
+ \DeclareUnicodeCharacter{22A8}{\ensuremath\models}%
+ \DeclareUnicodeCharacter{22C0}{\ensuremath\bigwedge}%
+ \DeclareUnicodeCharacter{22C1}{\ensuremath\bigvee}%
+ \DeclareUnicodeCharacter{22C2}{\ensuremath\bigcap}%
+ \DeclareUnicodeCharacter{22C3}{\ensuremath\bigcup}%
+ \DeclareUnicodeCharacter{22C4}{\ensuremath\diamond}%
+ \DeclareUnicodeCharacter{22C5}{\ensuremath\cdot}%
+ \DeclareUnicodeCharacter{22C6}{\ensuremath\star}%
+ \DeclareUnicodeCharacter{22C8}{\ensuremath\bowtie}%
+ \DeclareUnicodeCharacter{2308}{\ensuremath\lceil}%
+ \DeclareUnicodeCharacter{2309}{\ensuremath\rceil}%
+ \DeclareUnicodeCharacter{230A}{\ensuremath\lfloor}%
+ \DeclareUnicodeCharacter{230B}{\ensuremath\rfloor}%
+ \DeclareUnicodeCharacter{2322}{\ensuremath\frown}%
+ \DeclareUnicodeCharacter{2323}{\ensuremath\smile}%
+ %
+ \DeclareUnicodeCharacter{25B3}{\ensuremath\triangle}%
+ \DeclareUnicodeCharacter{25B7}{\ensuremath\triangleright}%
+ \DeclareUnicodeCharacter{25BD}{\ensuremath\bigtriangledown}%
+ \DeclareUnicodeCharacter{25C1}{\ensuremath\triangleleft}%
+ \DeclareUnicodeCharacter{25C7}{\ensuremath\diamond}%
+ \DeclareUnicodeCharacter{2660}{\ensuremath\spadesuit}%
+ \DeclareUnicodeCharacter{2661}{\ensuremath\heartsuit}%
+ \DeclareUnicodeCharacter{2662}{\ensuremath\diamondsuit}%
+ \DeclareUnicodeCharacter{2663}{\ensuremath\clubsuit}%
+ \DeclareUnicodeCharacter{266D}{\ensuremath\flat}%
+ \DeclareUnicodeCharacter{266E}{\ensuremath\natural}%
+ \DeclareUnicodeCharacter{266F}{\ensuremath\sharp}%
+ \DeclareUnicodeCharacter{26AA}{\ensuremath\bigcirc}%
+ \DeclareUnicodeCharacter{27B9}{\ensuremath\rangle}%
+ \DeclareUnicodeCharacter{27C2}{\ensuremath\perp}%
+ \DeclareUnicodeCharacter{27E8}{\ensuremath\langle}%
+ \DeclareUnicodeCharacter{27F5}{\ensuremath\longleftarrow}%
+ \DeclareUnicodeCharacter{27F6}{\ensuremath\longrightarrow}%
+ \DeclareUnicodeCharacter{27F7}{\ensuremath\longleftrightarrow}%
+ \DeclareUnicodeCharacter{27FC}{\ensuremath\longmapsto}%
+ \DeclareUnicodeCharacter{29F5}{\ensuremath\setminus}%
+ \DeclareUnicodeCharacter{2A00}{\ensuremath\bigodot}%
+ \DeclareUnicodeCharacter{2A01}{\ensuremath\bigoplus}%
+ \DeclareUnicodeCharacter{2A02}{\ensuremath\bigotimes}%
+ \DeclareUnicodeCharacter{2A04}{\ensuremath\biguplus}%
+ \DeclareUnicodeCharacter{2A06}{\ensuremath\bigsqcup}%
+ \DeclareUnicodeCharacter{2A3F}{\ensuremath\amalg}%
+ \DeclareUnicodeCharacter{2AAF}{\ensuremath\preceq}%
+ \DeclareUnicodeCharacter{2AB0}{\ensuremath\succeq}%
+ %
+ \global\mathchardef\checkmark="1370% actually the square root sign
+ \DeclareUnicodeCharacter{2713}{\ensuremath\checkmark}%
+}% end of \unicodechardefs
+
+% UTF-8 byte sequence (pdfTeX) definitions (replacing and @U command)
+% It makes the setting that replace UTF-8 byte sequence.
+\def\utfeightchardefs{%
+ \let\DeclareUnicodeCharacter\DeclareUnicodeCharacterUTFviii
+ \unicodechardefs
+}
+
+% Whether the active definitions of non-ASCII characters expand to
+% non-active tokens with the same character code. This is used to
+% write characters literally, instead of using active definitions for
+% printing the correct glyphs.
+\newif\ifpassthroughchars
+\passthroughcharsfalse
+
+% For native Unicode handling (XeTeX and LuaTeX),
+% provide a definition macro to replace/pass-through a Unicode character
+%
+\def\DeclareUnicodeCharacterNative#1#2{%
+ \catcode"#1=\active
+ \def\dodeclareunicodecharacternative##1##2##3{%
+ \begingroup
+ \uccode`\~="##2\relax
+ \uppercase{\gdef~}{%
+ \ifpassthroughchars
+ ##1%
+ \else
+ ##3%
+ \fi
+ }
+ \endgroup
+ }
+ \begingroup
+ \uccode`\.="#1\relax
+ \uppercase{\def\UTFNativeTmp{.}}%
+ \expandafter\dodeclareunicodecharacternative\UTFNativeTmp{#1}{#2}%
+ \endgroup
+}
+
+% Native Unicode handling (XeTeX and LuaTeX) character replacing definition.
+% It activates the setting that replaces Unicode characters.
+\def\nativeunicodechardefs{%
+ \let\DeclareUnicodeCharacter\DeclareUnicodeCharacterNative
+ \unicodechardefs
+}
+
+% For native Unicode handling (XeTeX and LuaTeX),
+% make the character token expand
+% to the sequences given in \unicodechardefs for printing.
+\def\DeclareUnicodeCharacterNativeAtU#1#2{%
+ \def\UTFAtUTmp{#2}
+ \expandafter\globallet\csname uni:#1\endcsname \UTFAtUTmp
+}
+
+% @U command definitions for native Unicode handling (XeTeX and LuaTeX).
+\def\nativeunicodechardefsatu{%
+ \let\DeclareUnicodeCharacter\DeclareUnicodeCharacterNativeAtU
+ \unicodechardefs
+}
+
+% US-ASCII character definitions.
+\def\asciichardefs{% nothing need be done
+ \relax
+}
+
+% Define all Unicode characters we know about. This makes UTF-8 the default
+% input encoding and allows @U to work.
+\iftxinativeunicodecapable
+ \nativeunicodechardefsatu
+\else
+ \utfeightchardefs
+\fi
+
+\message{formatting,}
+
+\newdimen\defaultparindent \defaultparindent = 15pt
+
+\chapheadingskip = 15pt plus 4pt minus 2pt
+\secheadingskip = 12pt plus 3pt minus 2pt
+\subsecheadingskip = 9pt plus 2pt minus 2pt
+
+% Prevent underfull vbox error messages.
+\vbadness = 10000
+
+% Don't be very finicky about underfull hboxes, either.
+\hbadness = 6666
+
+% Following George Bush, get rid of widows and orphans.
+\widowpenalty=10000
+\clubpenalty=10000
+
+% Use TeX 3.0's \emergencystretch to help line breaking, but if we're
+% using an old version of TeX, don't do anything. We want the amount of
+% stretch added to depend on the line length, hence the dependence on
+% \hsize. We call this whenever the paper size is set.
+%
+\def\setemergencystretch{%
+ \ifx\emergencystretch\thisisundefined
+ % Allow us to assign to \emergencystretch anyway.
+ \def\emergencystretch{\dimen0}%
+ \else
+ \emergencystretch = .15\hsize
+ \fi
+}
+
+% Parameters in order: 1) textheight; 2) textwidth;
+% 3) voffset; 4) hoffset; 5) binding offset; 6) topskip;
+% 7) physical page height; 8) physical page width.
+%
+% We also call \setleading{\textleading}, so the caller should define
+% \textleading. The caller should also set \parskip.
+%
+\def\internalpagesizes#1#2#3#4#5#6#7#8{%
+ \voffset = #3\relax
+ \topskip = #6\relax
+ \splittopskip = \topskip
+ %
+ \vsize = #1\relax
+ \advance\vsize by \topskip
+ \outervsize = \vsize
+ \advance\outervsize by 2\topandbottommargin
+ \txipageheight = \vsize
+ %
+ \hsize = #2\relax
+ \outerhsize = \hsize
+ \advance\outerhsize by 0.5in
+ \txipagewidth = \hsize
+ %
+ \normaloffset = #4\relax
+ \bindingoffset = #5\relax
+ %
+ \ifpdf
+ \pdfpageheight #7\relax
+ \pdfpagewidth #8\relax
+ % if we don't reset these, they will remain at "1 true in" of
+ % whatever layout pdftex was dumped with.
+ \pdfhorigin = 1 true in
+ \pdfvorigin = 1 true in
+ \else
+ \ifx\XeTeXrevision\thisisundefined
+ \special{papersize=#8,#7}%
+ \else
+ \pdfpageheight #7\relax
+ \pdfpagewidth #8\relax
+ % XeTeX does not have \pdfhorigin and \pdfvorigin.
+ \fi
+ \fi
+ %
+ \setleading{\textleading}
+ %
+ \parindent = \defaultparindent
+ \setemergencystretch
+}
+
+% @letterpaper (the default).
+\def\letterpaper{{\globaldefs = 1
+ \parskip = 3pt plus 2pt minus 1pt
+ \textleading = 13.2pt
+ %
+ % If page is nothing but text, make it come out even.
+ \internalpagesizes{607.2pt}{6in}% that's 46 lines
+ {\voffset}{.25in}%
+ {\bindingoffset}{36pt}%
+ {11in}{8.5in}%
+}}
+
+% Use @smallbook to reset parameters for 7x9.25 trim size.
+\def\smallbook{{\globaldefs = 1
+ \parskip = 2pt plus 1pt
+ \textleading = 12pt
+ %
+ \internalpagesizes{7.5in}{5in}%
+ {-.2in}{0in}%
+ {\bindingoffset}{16pt}%
+ {9.25in}{7in}%
+ %
+ \lispnarrowing = 0.3in
+ \tolerance = 700
+ \contentsrightmargin = 0pt
+ \defbodyindent = .5cm
+}}
+
+% Use @smallerbook to reset parameters for 6x9 trim size.
+% (Just testing, parameters still in flux.)
+\def\smallerbook{{\globaldefs = 1
+ \parskip = 1.5pt plus 1pt
+ \textleading = 12pt
+ %
+ \internalpagesizes{7.4in}{4.8in}%
+ {-.2in}{-.4in}%
+ {0pt}{14pt}%
+ {9in}{6in}%
+ %
+ \lispnarrowing = 0.25in
+ \tolerance = 700
+ \contentsrightmargin = 0pt
+ \defbodyindent = .4cm
+}}
+
+% Use @afourpaper to print on European A4 paper.
+\def\afourpaper{{\globaldefs = 1
+ \parskip = 3pt plus 2pt minus 1pt
+ \textleading = 13.2pt
+ %
+ % Double-side printing via postscript on Laserjet 4050
+ % prints double-sided nicely when \bindingoffset=10mm and \hoffset=-6mm.
+ % To change the settings for a different printer or situation, adjust
+ % \normaloffset until the front-side and back-side texts align. Then
+ % do the same for \bindingoffset. You can set these for testing in
+ % your texinfo source file like this:
+ % @tex
+ % \global\normaloffset = -6mm
+ % \global\bindingoffset = 10mm
+ % @end tex
+ \internalpagesizes{673.2pt}{160mm}% that's 51 lines
+ {\voffset}{\hoffset}%
+ {\bindingoffset}{44pt}%
+ {297mm}{210mm}%
+ %
+ \tolerance = 700
+ \contentsrightmargin = 0pt
+ \defbodyindent = 5mm
+}}
+
+% Use @afivepaper to print on European A5 paper.
+% From romildo@urano.iceb.ufop.br, 2 July 2000.
+% He also recommends making @example and @lisp be small.
+\def\afivepaper{{\globaldefs = 1
+ \parskip = 2pt plus 1pt minus 0.1pt
+ \textleading = 12.5pt
+ %
+ \internalpagesizes{160mm}{120mm}%
+ {\voffset}{\hoffset}%
+ {\bindingoffset}{8pt}%
+ {210mm}{148mm}%
+ %
+ \lispnarrowing = 0.2in
+ \tolerance = 800
+ \contentsrightmargin = 0pt
+ \defbodyindent = 2mm
+ \tableindent = 12mm
+}}
+
+% A specific text layout, 24x15cm overall, intended for A4 paper.
+\def\afourlatex{{\globaldefs = 1
+ \afourpaper
+ \internalpagesizes{237mm}{150mm}%
+ {\voffset}{4.6mm}%
+ {\bindingoffset}{7mm}%
+ {297mm}{210mm}%
+ %
+ % Must explicitly reset to 0 because we call \afourpaper.
+ \globaldefs = 0
+}}
+
+% Use @afourwide to print on A4 paper in landscape format.
+\def\afourwide{{\globaldefs = 1
+ \afourpaper
+ \internalpagesizes{241mm}{165mm}%
+ {\voffset}{-2.95mm}%
+ {\bindingoffset}{7mm}%
+ {297mm}{210mm}%
+ \globaldefs = 0
+}}
+
+% @pagesizes TEXTHEIGHT[,TEXTWIDTH]
+% Perhaps we should allow setting the margins, \topskip, \parskip,
+% and/or leading, also. Or perhaps we should compute them somehow.
+%
+\parseargdef\pagesizes{\pagesizesyyy #1,,\finish}
+\def\pagesizesyyy#1,#2,#3\finish{{%
+ \setbox0 = \hbox{\ignorespaces #2}\ifdim\wd0 > 0pt \hsize=#2\relax \fi
+ \globaldefs = 1
+ %
+ \parskip = 3pt plus 2pt minus 1pt
+ \setleading{\textleading}%
+ %
+ \dimen0 = #1\relax
+ \advance\dimen0 by \voffset
+ \advance\dimen0 by 1in % reference point for DVI is 1 inch from top of page
+ %
+ \dimen2 = \hsize
+ \advance\dimen2 by \normaloffset
+ \advance\dimen2 by 1in % reference point is 1 inch from left edge of page
+ %
+ \internalpagesizes{#1}{\hsize}%
+ {\voffset}{\normaloffset}%
+ {\bindingoffset}{44pt}%
+ {\dimen0}{\dimen2}%
+}}
+
+% Set default to letter.
+%
+\letterpaper
+
+% Default value of \hfuzz, for suppressing warnings about overfull hboxes.
+\hfuzz = 1pt
+
+
+\message{and turning on texinfo input format.}
+
+\def^^L{\par} % remove \outer, so ^L can appear in an @comment
+
+% DEL is a comment character, in case @c does not suffice.
+\catcode`\^^? = 14
+
+% Define macros to output various characters with catcode for normal text.
+\catcode`\"=\other \def\normaldoublequote{"}
+\catcode`\$=\other \def\normaldollar{$}%$ font-lock fix
+\catcode`\+=\other \def\normalplus{+}
+\catcode`\<=\other \def\normalless{<}
+\catcode`\>=\other \def\normalgreater{>}
+\catcode`\^=\other \def\normalcaret{^}
+\catcode`\_=\other \def\normalunderscore{_}
+\catcode`\|=\other \def\normalverticalbar{|}
+\catcode`\~=\other \def\normaltilde{~}
+
+% This macro is used to make a character print one way in \tt
+% (where it can probably be output as-is), and another way in other fonts,
+% where something hairier probably needs to be done.
+%
+% #1 is what to print if we are indeed using \tt; #2 is what to print
+% otherwise. Since all the Computer Modern typewriter fonts have zero
+% interword stretch (and shrink), and it is reasonable to expect all
+% typewriter fonts to have this, we can check that font parameter.
+%
+\def\ifusingtt#1#2{\ifdim \fontdimen3\font=0pt #1\else #2\fi}
+
+% Same as above, but check for italic font. Actually this also catches
+% non-italic slanted fonts since it is impossible to distinguish them from
+% italic fonts. But since this is only used by $ and it uses \sl anyway
+% this is not a problem.
+\def\ifusingit#1#2{\ifdim \fontdimen1\font>0pt #1\else #2\fi}
+
+% Set catcodes for Texinfo file
+
+% Active characters for printing the wanted glyph.
+% Most of these we simply print from the \tt font, but for some, we can
+% use math or other variants that look better in normal text.
+%
+\catcode`\"=\active
+\def\activedoublequote{{\tt\char34}}
+\let"=\activedoublequote
+\catcode`\~=\active \def\activetilde{{\tt\char126}} \let~ = \activetilde
+\chardef\hatchar=`\^
+\catcode`\^=\active \def\activehat{{\tt \hatchar}} \let^ = \activehat
+
+\catcode`\_=\active
+\def_{\ifusingtt\normalunderscore\_}
+\def\_{\leavevmode \kern.07em \vbox{\hrule width.3em height.1ex}\kern .07em }
+\let\realunder=_
+
+\catcode`\|=\active \def|{{\tt\char124}}
+
+\chardef \less=`\<
+\catcode`\<=\active \def\activeless{{\tt \less}}\let< = \activeless
+\chardef \gtr=`\>
+\catcode`\>=\active \def\activegtr{{\tt \gtr}}\let> = \activegtr
+\catcode`\+=\active \def+{{\tt \char 43}}
+\catcode`\$=\active \def${\ifusingit{{\sl\$}}\normaldollar}%$ font-lock fix
+\catcode`\-=\active \let-=\normaldash
+
+
+% used for headline/footline in the output routine, in case the page
+% breaks in the middle of an @tex block.
+\def\texinfochars{%
+ \let< = \activeless
+ \let> = \activegtr
+ \let~ = \activetilde
+ \let^ = \activehat
+ \markupsetuplqdefault \markupsetuprqdefault
+ \let\b = \strong
+ \let\i = \smartitalic
+ % in principle, all other definitions in \tex have to be undone too.
+}
+
+% Used sometimes to turn off (effectively) the active characters even after
+% parsing them.
+\def\turnoffactive{%
+ \normalturnoffactive
+ \otherbackslash
+}
+
+\catcode`\@=0
+
+% \backslashcurfont outputs one backslash character in current font,
+% as in \char`\\.
+\global\chardef\backslashcurfont=`\\
+
+% \realbackslash is an actual character `\' with catcode other.
+{\catcode`\\=\other @gdef@realbackslash{\}}
+
+% In Texinfo, backslash is an active character; it prints the backslash
+% in fixed width font.
+\catcode`\\=\active % @ for escape char from now on.
+
+% Print a typewriter backslash. For math mode, we can't simply use
+% \backslashcurfont: the story here is that in math mode, the \char
+% of \backslashcurfont ends up printing the roman \ from the math symbol
+% font (because \char in math mode uses the \mathcode, and plain.tex
+% sets \mathcode`\\="026E). Hence we use an explicit \mathchar,
+% which is the decimal equivalent of "715c (class 7, e.g., use \fam;
+% ignored family value; char position "5C). We can't use " for the
+% usual hex value because it has already been made active.
+
+@def@ttbackslash{{@tt @ifmmode @mathchar29020 @else @backslashcurfont @fi}}
+@let@backslashchar = @ttbackslash % @backslashchar{} is for user documents.
+
+% \otherbackslash defines an active \ to be a literal `\' character with
+% catcode other.
+@gdef@otherbackslash{@let\=@realbackslash}
+
+% Same as @turnoffactive except outputs \ as {\tt\char`\\} instead of
+% the literal character `\'.
+%
+{@catcode`- = @active
+ @gdef@normalturnoffactive{%
+ @passthroughcharstrue
+ @let-=@normaldash
+ @let"=@normaldoublequote
+ @let$=@normaldollar %$ font-lock fix
+ @let+=@normalplus
+ @let<=@normalless
+ @let>=@normalgreater
+ @let^=@normalcaret
+ @let_=@normalunderscore
+ @let|=@normalverticalbar
+ @let~=@normaltilde
+ @let\=@ttbackslash
+ @markupsetuplqdefault
+ @markupsetuprqdefault
+ @unsepspaces
+ }
+}
+
+% If a .fmt file is being used, characters that might appear in a file
+% name cannot be active until we have parsed the command line.
+% So turn them off again, and have @fixbackslash turn them back on.
+@catcode`+=@other @catcode`@_=@other
+
+% \enablebackslashhack - allow file to begin `\input texinfo'
+%
+% If a .fmt file is being used, we don't want the `\input texinfo' to show up.
+% That is what \eatinput is for; after that, the `\' should revert to printing
+% a backslash.
+% If the file did not have a `\input texinfo', then it is turned off after
+% the first line; otherwise the first `\' in the file would cause an error.
+% This is used on the very last line of this file, texinfo.tex.
+% We also use @c to call @fixbackslash, in case ends of lines are hidden.
+{
+@catcode`@^=7
+@catcode`@^^M=13@gdef@enablebackslashhack{%
+ @global@let\ = @eatinput%
+ @catcode`@^^M=13%
+ @def@c{@fixbackslash@c}%
+ % Definition for the newline at the end of this file.
+ @def ^^M{@let^^M@secondlinenl}%
+ % Definition for a newline in the main Texinfo file.
+ @gdef @secondlinenl{@fixbackslash}%
+ % In case the first line has a whole-line command on it
+ @let@originalparsearg@parsearg
+ @def@parsearg{@fixbackslash@originalparsearg}
+}}
+
+{@catcode`@^=7 @catcode`@^^M=13%
+@gdef@eatinput input texinfo#1^^M{@fixbackslash}}
+
+% Emergency active definition of newline, in case an active newline token
+% appears by mistake.
+{@catcode`@^=7 @catcode13=13%
+@gdef@enableemergencynewline{%
+ @gdef^^M{%
+ @par%
+ %@par%
+}}}
+
+
+@gdef@fixbackslash{%
+ @ifx\@eatinput @let\ = @ttbackslash @fi
+ @catcode13=5 % regular end of line
+ @enableemergencynewline
+ @let@c=@comment
+ @let@parsearg@originalparsearg
+ % Also turn back on active characters that might appear in the input
+ % file name, in case not using a pre-dumped format.
+ @catcode`+=@active
+ @catcode`@_=@active
+ %
+ % If texinfo.cnf is present on the system, read it.
+ % Useful for site-wide @afourpaper, etc. This macro, @fixbackslash, gets
+ % called at the beginning of every Texinfo file. Not opening texinfo.cnf
+ % directly in this file, texinfo.tex, makes it possible to make a format
+ % file for Texinfo.
+ %
+ @openin 1 texinfo.cnf
+ @ifeof 1 @else @input texinfo.cnf @fi
+ @closein 1
+}
+
+
+% Say @foo, not \foo, in error messages.
+@escapechar = `@@
+
+% These (along with & and #) are made active for url-breaking, so need
+% active definitions as the normal characters.
+@def@normaldot{.}
+@def@normalquest{?}
+@def@normalslash{/}
+
+% These look ok in all fonts, so just make them not special.
+% @hashchar{} gets its own user-level command, because of #line.
+@catcode`@& = @other @def@normalamp{&}
+@catcode`@# = @other @def@normalhash{#}
+@catcode`@% = @other @def@normalpercent{%}
+
+@let @hashchar = @normalhash
+
+@c Finally, make ` and ' active, so that txicodequoteundirected and
+@c txicodequotebacktick work right in, e.g., @w{@code{`foo'}}. If we
+@c don't make ` and ' active, @code will not get them as active chars.
+@c Do this last of all since we use ` in the previous @catcode assignments.
+@catcode`@'=@active
+@catcode`@`=@active
+@markupsetuplqdefault
+@markupsetuprqdefault
+
+@c Local variables:
+@c eval: (add-hook 'before-save-hook 'time-stamp)
+@c page-delimiter: "^\\\\message\\|emacs-page"
+@c time-stamp-start: "def\\\\texinfoversion{"
+@c time-stamp-format: "%:y-%02m-%02d.%02H"
+@c time-stamp-end: "}"
+@c End:
+
+@c vim:sw=2:
+
+@enablebackslashhack
diff --git a/gcc/mpc/config.sub b/gcc/mpc/config.sub
deleted file mode 100755
index 8f5b018af1..0000000000
--- a/gcc/mpc/config.sub
+++ /dev/null
@@ -1,1807 +0,0 @@
-#!/bin/sh
-# Configuration validation subroutine script.
-# Copyright 1992-2014 Free Software Foundation, Inc.
-
-timestamp='2014-12-03'
-
-# This file is free software; you can redistribute it and/or modify it
-# under the terms of the GNU General Public License as published by
-# the Free Software Foundation; either version 3 of the License, or
-# (at your option) any later version.
-#
-# This program is distributed in the hope that it will be useful, but
-# WITHOUT ANY WARRANTY; without even the implied warranty of
-# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
-# General Public License for more details.
-#
-# You should have received a copy of the GNU General Public License
-# along with this program; if not, see .
-#
-# As a special exception to the GNU General Public License, if you
-# distribute this file as part of a program that contains a
-# configuration script generated by Autoconf, you may include it under
-# the same distribution terms that you use for the rest of that
-# program. This Exception is an additional permission under section 7
-# of the GNU General Public License, version 3 ("GPLv3").
-
-
-# Please send patches to .
-#
-# Configuration subroutine to validate and canonicalize a configuration type.
-# Supply the specified configuration type as an argument.
-# If it is invalid, we print an error message on stderr and exit with code 1.
-# Otherwise, we print the canonical config type on stdout and succeed.
-
-# You can get the latest version of this script from:
-# http://git.savannah.gnu.org/gitweb/?p=config.git;a=blob_plain;f=config.sub;hb=HEAD
-
-# This file is supposed to be the same for all GNU packages
-# and recognize all the CPU types, system types and aliases
-# that are meaningful with *any* GNU software.
-# Each package is responsible for reporting which valid configurations
-# it does not support. The user should be able to distinguish
-# a failure to support a valid configuration from a meaningless
-# configuration.
-
-# The goal of this file is to map all the various variations of a given
-# machine specification into a single specification in the form:
-# CPU_TYPE-MANUFACTURER-OPERATING_SYSTEM
-# or in some cases, the newer four-part form:
-# CPU_TYPE-MANUFACTURER-KERNEL-OPERATING_SYSTEM
-# It is wrong to echo any other type of specification.
-
-me=`echo "$0" | sed -e 's,.*/,,'`
-
-usage="\
-Usage: $0 [OPTION] CPU-MFR-OPSYS
- $0 [OPTION] ALIAS
-
-Canonicalize a configuration name.
-
-Operation modes:
- -h, --help print this help, then exit
- -t, --time-stamp print date of last modification, then exit
- -v, --version print version number, then exit
-
-Report bugs and patches to ."
-
-version="\
-GNU config.sub ($timestamp)
-
-Copyright 1992-2014 Free Software Foundation, Inc.
-
-This is free software; see the source for copying conditions. There is NO
-warranty; not even for MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE."
-
-help="
-Try \`$me --help' for more information."
-
-# Parse command line
-while test $# -gt 0 ; do
- case $1 in
- --time-stamp | --time* | -t )
- echo "$timestamp" ; exit ;;
- --version | -v )
- echo "$version" ; exit ;;
- --help | --h* | -h )
- echo "$usage"; exit ;;
- -- ) # Stop option processing
- shift; break ;;
- - ) # Use stdin as input.
- break ;;
- -* )
- echo "$me: invalid option $1$help"
- exit 1 ;;
-
- *local*)
- # First pass through any local machine types.
- echo $1
- exit ;;
-
- * )
- break ;;
- esac
-done
-
-case $# in
- 0) echo "$me: missing argument$help" >&2
- exit 1;;
- 1) ;;
- *) echo "$me: too many arguments$help" >&2
- exit 1;;
-esac
-
-# Separate what the user gave into CPU-COMPANY and OS or KERNEL-OS (if any).
-# Here we must recognize all the valid KERNEL-OS combinations.
-maybe_os=`echo $1 | sed 's/^\(.*\)-\([^-]*-[^-]*\)$/\2/'`
-case $maybe_os in
- nto-qnx* | linux-gnu* | linux-android* | linux-dietlibc | linux-newlib* | \
- linux-musl* | linux-uclibc* | uclinux-uclibc* | uclinux-gnu* | kfreebsd*-gnu* | \
- knetbsd*-gnu* | netbsd*-gnu* | \
- kopensolaris*-gnu* | \
- storm-chaos* | os2-emx* | rtmk-nova*)
- os=-$maybe_os
- basic_machine=`echo $1 | sed 's/^\(.*\)-\([^-]*-[^-]*\)$/\1/'`
- ;;
- android-linux)
- os=-linux-android
- basic_machine=`echo $1 | sed 's/^\(.*\)-\([^-]*-[^-]*\)$/\1/'`-unknown
- ;;
- *)
- basic_machine=`echo $1 | sed 's/-[^-]*$//'`
- if [ $basic_machine != $1 ]
- then os=`echo $1 | sed 's/.*-/-/'`
- else os=; fi
- ;;
-esac
-
-### Let's recognize common machines as not being operating systems so
-### that things like config.sub decstation-3100 work. We also
-### recognize some manufacturers as not being operating systems, so we
-### can provide default operating systems below.
-case $os in
- -sun*os*)
- # Prevent following clause from handling this invalid input.
- ;;
- -dec* | -mips* | -sequent* | -encore* | -pc532* | -sgi* | -sony* | \
- -att* | -7300* | -3300* | -delta* | -motorola* | -sun[234]* | \
- -unicom* | -ibm* | -next | -hp | -isi* | -apollo | -altos* | \
- -convergent* | -ncr* | -news | -32* | -3600* | -3100* | -hitachi* |\
- -c[123]* | -convex* | -sun | -crds | -omron* | -dg | -ultra | -tti* | \
- -harris | -dolphin | -highlevel | -gould | -cbm | -ns | -masscomp | \
- -apple | -axis | -knuth | -cray | -microblaze*)
- os=
- basic_machine=$1
- ;;
- -bluegene*)
- os=-cnk
- ;;
- -sim | -cisco | -oki | -wec | -winbond)
- os=
- basic_machine=$1
- ;;
- -scout)
- ;;
- -wrs)
- os=-vxworks
- basic_machine=$1
- ;;
- -chorusos*)
- os=-chorusos
- basic_machine=$1
- ;;
- -chorusrdb)
- os=-chorusrdb
- basic_machine=$1
- ;;
- -hiux*)
- os=-hiuxwe2
- ;;
- -sco6)
- os=-sco5v6
- basic_machine=`echo $1 | sed -e 's/86-.*/86-pc/'`
- ;;
- -sco5)
- os=-sco3.2v5
- basic_machine=`echo $1 | sed -e 's/86-.*/86-pc/'`
- ;;
- -sco4)
- os=-sco3.2v4
- basic_machine=`echo $1 | sed -e 's/86-.*/86-pc/'`
- ;;
- -sco3.2.[4-9]*)
- os=`echo $os | sed -e 's/sco3.2./sco3.2v/'`
- basic_machine=`echo $1 | sed -e 's/86-.*/86-pc/'`
- ;;
- -sco3.2v[4-9]*)
- # Don't forget version if it is 3.2v4 or newer.
- basic_machine=`echo $1 | sed -e 's/86-.*/86-pc/'`
- ;;
- -sco5v6*)
- # Don't forget version if it is 3.2v4 or newer.
- basic_machine=`echo $1 | sed -e 's/86-.*/86-pc/'`
- ;;
- -sco*)
- os=-sco3.2v2
- basic_machine=`echo $1 | sed -e 's/86-.*/86-pc/'`
- ;;
- -udk*)
- basic_machine=`echo $1 | sed -e 's/86-.*/86-pc/'`
- ;;
- -isc)
- os=-isc2.2
- basic_machine=`echo $1 | sed -e 's/86-.*/86-pc/'`
- ;;
- -clix*)
- basic_machine=clipper-intergraph
- ;;
- -isc*)
- basic_machine=`echo $1 | sed -e 's/86-.*/86-pc/'`
- ;;
- -lynx*178)
- os=-lynxos178
- ;;
- -lynx*5)
- os=-lynxos5
- ;;
- -lynx*)
- os=-lynxos
- ;;
- -ptx*)
- basic_machine=`echo $1 | sed -e 's/86-.*/86-sequent/'`
- ;;
- -windowsnt*)
- os=`echo $os | sed -e 's/windowsnt/winnt/'`
- ;;
- -psos*)
- os=-psos
- ;;
- -mint | -mint[0-9]*)
- basic_machine=m68k-atari
- os=-mint
- ;;
-esac
-
-# Decode aliases for certain CPU-COMPANY combinations.
-case $basic_machine in
- # Recognize the basic CPU types without company name.
- # Some are omitted here because they have special meanings below.
- 1750a | 580 \
- | a29k \
- | aarch64 | aarch64_be \
- | alpha | alphaev[4-8] | alphaev56 | alphaev6[78] | alphapca5[67] \
- | alpha64 | alpha64ev[4-8] | alpha64ev56 | alpha64ev6[78] | alpha64pca5[67] \
- | am33_2.0 \
- | arc | arceb \
- | arm | arm[bl]e | arme[lb] | armv[2-8] | armv[3-8][lb] | armv7[arm] \
- | avr | avr32 \
- | be32 | be64 \
- | bfin \
- | c4x | c8051 | clipper \
- | d10v | d30v | dlx | dsp16xx \
- | epiphany \
- | fido | fr30 | frv \
- | h8300 | h8500 | hppa | hppa1.[01] | hppa2.0 | hppa2.0[nw] | hppa64 \
- | hexagon \
- | i370 | i860 | i960 | ia64 \
- | ip2k | iq2000 \
- | k1om \
- | le32 | le64 \
- | lm32 \
- | m32c | m32r | m32rle | m68000 | m68k | m88k \
- | maxq | mb | microblaze | microblazeel | mcore | mep | metag \
- | mips | mipsbe | mipseb | mipsel | mipsle \
- | mips16 \
- | mips64 | mips64el \
- | mips64octeon | mips64octeonel \
- | mips64orion | mips64orionel \
- | mips64r5900 | mips64r5900el \
- | mips64vr | mips64vrel \
- | mips64vr4100 | mips64vr4100el \
- | mips64vr4300 | mips64vr4300el \
- | mips64vr5000 | mips64vr5000el \
- | mips64vr5900 | mips64vr5900el \
- | mipsisa32 | mipsisa32el \
- | mipsisa32r2 | mipsisa32r2el \
- | mipsisa32r6 | mipsisa32r6el \
- | mipsisa64 | mipsisa64el \
- | mipsisa64r2 | mipsisa64r2el \
- | mipsisa64r6 | mipsisa64r6el \
- | mipsisa64sb1 | mipsisa64sb1el \
- | mipsisa64sr71k | mipsisa64sr71kel \
- | mipsr5900 | mipsr5900el \
- | mipstx39 | mipstx39el \
- | mn10200 | mn10300 \
- | moxie \
- | mt \
- | msp430 \
- | nds32 | nds32le | nds32be \
- | nios | nios2 | nios2eb | nios2el \
- | ns16k | ns32k \
- | open8 | or1k | or1knd | or32 \
- | pdp10 | pdp11 | pj | pjl \
- | powerpc | powerpc64 | powerpc64le | powerpcle \
- | pyramid \
- | riscv32 | riscv64 \
- | rl78 | rx \
- | score \
- | sh | sh[1234] | sh[24]a | sh[24]aeb | sh[23]e | sh[34]eb | sheb | shbe | shle | sh[1234]le | sh3ele \
- | sh64 | sh64le \
- | sparc | sparc64 | sparc64b | sparc64v | sparc86x | sparclet | sparclite \
- | sparcv8 | sparcv9 | sparcv9b | sparcv9v \
- | spu \
- | tahoe | tic4x | tic54x | tic55x | tic6x | tic80 | tron \
- | ubicom32 \
- | v850 | v850e | v850e1 | v850e2 | v850es | v850e2v3 \
- | visium \
- | we32k \
- | x86 | xc16x | xstormy16 | xtensa \
- | z8k | z80)
- basic_machine=$basic_machine-unknown
- ;;
- c54x)
- basic_machine=tic54x-unknown
- ;;
- c55x)
- basic_machine=tic55x-unknown
- ;;
- c6x)
- basic_machine=tic6x-unknown
- ;;
- leon|leon[3-9])
- basic_machine=sparc-$basic_machine
- ;;
- m6811 | m68hc11 | m6812 | m68hc12 | m68hcs12x | nvptx | picochip)
- basic_machine=$basic_machine-unknown
- os=-none
- ;;
- m88110 | m680[12346]0 | m683?2 | m68360 | m5200 | v70 | w65 | z8k)
- ;;
- ms1)
- basic_machine=mt-unknown
- ;;
-
- strongarm | thumb | xscale)
- basic_machine=arm-unknown
- ;;
- xgate)
- basic_machine=$basic_machine-unknown
- os=-none
- ;;
- xscaleeb)
- basic_machine=armeb-unknown
- ;;
-
- xscaleel)
- basic_machine=armel-unknown
- ;;
-
- # We use `pc' rather than `unknown'
- # because (1) that's what they normally are, and
- # (2) the word "unknown" tends to confuse beginning users.
- i*86 | x86_64)
- basic_machine=$basic_machine-pc
- ;;
- # Object if more than one company name word.
- *-*-*)
- echo Invalid configuration \`$1\': machine \`$basic_machine\' not recognized 1>&2
- exit 1
- ;;
- # Recognize the basic CPU types with company name.
- 580-* \
- | a29k-* \
- | aarch64-* | aarch64_be-* \
- | alpha-* | alphaev[4-8]-* | alphaev56-* | alphaev6[78]-* \
- | alpha64-* | alpha64ev[4-8]-* | alpha64ev56-* | alpha64ev6[78]-* \
- | alphapca5[67]-* | alpha64pca5[67]-* | arc-* | arceb-* \
- | arm-* | armbe-* | armle-* | armeb-* | armv*-* \
- | avr-* | avr32-* \
- | be32-* | be64-* \
- | bfin-* | bs2000-* \
- | c[123]* | c30-* | [cjt]90-* | c4x-* \
- | c8051-* | clipper-* | craynv-* | cydra-* \
- | d10v-* | d30v-* | dlx-* \
- | elxsi-* \
- | f30[01]-* | f700-* | fido-* | fr30-* | frv-* | fx80-* \
- | h8300-* | h8500-* \
- | hppa-* | hppa1.[01]-* | hppa2.0-* | hppa2.0[nw]-* | hppa64-* \
- | hexagon-* \
- | i*86-* | i860-* | i960-* | ia64-* \
- | ip2k-* | iq2000-* \
- | k1om-* \
- | le32-* | le64-* \
- | lm32-* \
- | m32c-* | m32r-* | m32rle-* \
- | m68000-* | m680[012346]0-* | m68360-* | m683?2-* | m68k-* \
- | m88110-* | m88k-* | maxq-* | mcore-* | metag-* \
- | microblaze-* | microblazeel-* \
- | mips-* | mipsbe-* | mipseb-* | mipsel-* | mipsle-* \
- | mips16-* \
- | mips64-* | mips64el-* \
- | mips64octeon-* | mips64octeonel-* \
- | mips64orion-* | mips64orionel-* \
- | mips64r5900-* | mips64r5900el-* \
- | mips64vr-* | mips64vrel-* \
- | mips64vr4100-* | mips64vr4100el-* \
- | mips64vr4300-* | mips64vr4300el-* \
- | mips64vr5000-* | mips64vr5000el-* \
- | mips64vr5900-* | mips64vr5900el-* \
- | mipsisa32-* | mipsisa32el-* \
- | mipsisa32r2-* | mipsisa32r2el-* \
- | mipsisa32r6-* | mipsisa32r6el-* \
- | mipsisa64-* | mipsisa64el-* \
- | mipsisa64r2-* | mipsisa64r2el-* \
- | mipsisa64r6-* | mipsisa64r6el-* \
- | mipsisa64sb1-* | mipsisa64sb1el-* \
- | mipsisa64sr71k-* | mipsisa64sr71kel-* \
- | mipsr5900-* | mipsr5900el-* \
- | mipstx39-* | mipstx39el-* \
- | mmix-* \
- | mt-* \
- | msp430-* \
- | nds32-* | nds32le-* | nds32be-* \
- | nios-* | nios2-* | nios2eb-* | nios2el-* \
- | none-* | np1-* | ns16k-* | ns32k-* \
- | open8-* \
- | or1k*-* \
- | orion-* \
- | pdp10-* | pdp11-* | pj-* | pjl-* | pn-* | power-* \
- | powerpc-* | powerpc64-* | powerpc64le-* | powerpcle-* \
- | pyramid-* \
- | rl78-* | romp-* | rs6000-* | rx-* \
- | sh-* | sh[1234]-* | sh[24]a-* | sh[24]aeb-* | sh[23]e-* | sh[34]eb-* | sheb-* | shbe-* \
- | shle-* | sh[1234]le-* | sh3ele-* | sh64-* | sh64le-* \
- | sparc-* | sparc64-* | sparc64b-* | sparc64v-* | sparc86x-* | sparclet-* \
- | sparclite-* \
- | sparcv8-* | sparcv9-* | sparcv9b-* | sparcv9v-* | sv1-* | sx?-* \
- | tahoe-* \
- | tic30-* | tic4x-* | tic54x-* | tic55x-* | tic6x-* | tic80-* \
- | tile*-* \
- | tron-* \
- | ubicom32-* \
- | v850-* | v850e-* | v850e1-* | v850es-* | v850e2-* | v850e2v3-* \
- | vax-* \
- | visium-* \
- | we32k-* \
- | x86-* | x86_64-* | xc16x-* | xps100-* \
- | xstormy16-* | xtensa*-* \
- | ymp-* \
- | z8k-* | z80-*)
- ;;
- # Recognize the basic CPU types without company name, with glob match.
- xtensa*)
- basic_machine=$basic_machine-unknown
- ;;
- # Recognize the various machine names and aliases which stand
- # for a CPU type and a company and sometimes even an OS.
- 386bsd)
- basic_machine=i386-unknown
- os=-bsd
- ;;
- 3b1 | 7300 | 7300-att | att-7300 | pc7300 | safari | unixpc)
- basic_machine=m68000-att
- ;;
- 3b*)
- basic_machine=we32k-att
- ;;
- a29khif)
- basic_machine=a29k-amd
- os=-udi
- ;;
- abacus)
- basic_machine=abacus-unknown
- ;;
- adobe68k)
- basic_machine=m68010-adobe
- os=-scout
- ;;
- alliant | fx80)
- basic_machine=fx80-alliant
- ;;
- altos | altos3068)
- basic_machine=m68k-altos
- ;;
- am29k)
- basic_machine=a29k-none
- os=-bsd
- ;;
- amd64)
- basic_machine=x86_64-pc
- ;;
- amd64-*)
- basic_machine=x86_64-`echo $basic_machine | sed 's/^[^-]*-//'`
- ;;
- amdahl)
- basic_machine=580-amdahl
- os=-sysv
- ;;
- amiga | amiga-*)
- basic_machine=m68k-unknown
- ;;
- amigaos | amigados)
- basic_machine=m68k-unknown
- os=-amigaos
- ;;
- amigaunix | amix)
- basic_machine=m68k-unknown
- os=-sysv4
- ;;
- apollo68)
- basic_machine=m68k-apollo
- os=-sysv
- ;;
- apollo68bsd)
- basic_machine=m68k-apollo
- os=-bsd
- ;;
- aros)
- basic_machine=i386-pc
- os=-aros
- ;;
- aux)
- basic_machine=m68k-apple
- os=-aux
- ;;
- balance)
- basic_machine=ns32k-sequent
- os=-dynix
- ;;
- blackfin)
- basic_machine=bfin-unknown
- os=-linux
- ;;
- blackfin-*)
- basic_machine=bfin-`echo $basic_machine | sed 's/^[^-]*-//'`
- os=-linux
- ;;
- bluegene*)
- basic_machine=powerpc-ibm
- os=-cnk
- ;;
- c54x-*)
- basic_machine=tic54x-`echo $basic_machine | sed 's/^[^-]*-//'`
- ;;
- c55x-*)
- basic_machine=tic55x-`echo $basic_machine | sed 's/^[^-]*-//'`
- ;;
- c6x-*)
- basic_machine=tic6x-`echo $basic_machine | sed 's/^[^-]*-//'`
- ;;
- c90)
- basic_machine=c90-cray
- os=-unicos
- ;;
- cegcc)
- basic_machine=arm-unknown
- os=-cegcc
- ;;
- convex-c1)
- basic_machine=c1-convex
- os=-bsd
- ;;
- convex-c2)
- basic_machine=c2-convex
- os=-bsd
- ;;
- convex-c32)
- basic_machine=c32-convex
- os=-bsd
- ;;
- convex-c34)
- basic_machine=c34-convex
- os=-bsd
- ;;
- convex-c38)
- basic_machine=c38-convex
- os=-bsd
- ;;
- cray | j90)
- basic_machine=j90-cray
- os=-unicos
- ;;
- craynv)
- basic_machine=craynv-cray
- os=-unicosmp
- ;;
- cr16 | cr16-*)
- basic_machine=cr16-unknown
- os=-elf
- ;;
- crds | unos)
- basic_machine=m68k-crds
- ;;
- crisv32 | crisv32-* | etraxfs*)
- basic_machine=crisv32-axis
- ;;
- cris | cris-* | etrax*)
- basic_machine=cris-axis
- ;;
- crx)
- basic_machine=crx-unknown
- os=-elf
- ;;
- da30 | da30-*)
- basic_machine=m68k-da30
- ;;
- decstation | decstation-3100 | pmax | pmax-* | pmin | dec3100 | decstatn)
- basic_machine=mips-dec
- ;;
- decsystem10* | dec10*)
- basic_machine=pdp10-dec
- os=-tops10
- ;;
- decsystem20* | dec20*)
- basic_machine=pdp10-dec
- os=-tops20
- ;;
- delta | 3300 | motorola-3300 | motorola-delta \
- | 3300-motorola | delta-motorola)
- basic_machine=m68k-motorola
- ;;
- delta88)
- basic_machine=m88k-motorola
- os=-sysv3
- ;;
- dicos)
- basic_machine=i686-pc
- os=-dicos
- ;;
- djgpp)
- basic_machine=i586-pc
- os=-msdosdjgpp
- ;;
- dpx20 | dpx20-*)
- basic_machine=rs6000-bull
- os=-bosx
- ;;
- dpx2* | dpx2*-bull)
- basic_machine=m68k-bull
- os=-sysv3
- ;;
- ebmon29k)
- basic_machine=a29k-amd
- os=-ebmon
- ;;
- elxsi)
- basic_machine=elxsi-elxsi
- os=-bsd
- ;;
- encore | umax | mmax)
- basic_machine=ns32k-encore
- ;;
- es1800 | OSE68k | ose68k | ose | OSE)
- basic_machine=m68k-ericsson
- os=-ose
- ;;
- fx2800)
- basic_machine=i860-alliant
- ;;
- genix)
- basic_machine=ns32k-ns
- ;;
- gmicro)
- basic_machine=tron-gmicro
- os=-sysv
- ;;
- go32)
- basic_machine=i386-pc
- os=-go32
- ;;
- h3050r* | hiux*)
- basic_machine=hppa1.1-hitachi
- os=-hiuxwe2
- ;;
- h8300hms)
- basic_machine=h8300-hitachi
- os=-hms
- ;;
- h8300xray)
- basic_machine=h8300-hitachi
- os=-xray
- ;;
- h8500hms)
- basic_machine=h8500-hitachi
- os=-hms
- ;;
- harris)
- basic_machine=m88k-harris
- os=-sysv3
- ;;
- hp300-*)
- basic_machine=m68k-hp
- ;;
- hp300bsd)
- basic_machine=m68k-hp
- os=-bsd
- ;;
- hp300hpux)
- basic_machine=m68k-hp
- os=-hpux
- ;;
- hp3k9[0-9][0-9] | hp9[0-9][0-9])
- basic_machine=hppa1.0-hp
- ;;
- hp9k2[0-9][0-9] | hp9k31[0-9])
- basic_machine=m68000-hp
- ;;
- hp9k3[2-9][0-9])
- basic_machine=m68k-hp
- ;;
- hp9k6[0-9][0-9] | hp6[0-9][0-9])
- basic_machine=hppa1.0-hp
- ;;
- hp9k7[0-79][0-9] | hp7[0-79][0-9])
- basic_machine=hppa1.1-hp
- ;;
- hp9k78[0-9] | hp78[0-9])
- # FIXME: really hppa2.0-hp
- basic_machine=hppa1.1-hp
- ;;
- hp9k8[67]1 | hp8[67]1 | hp9k80[24] | hp80[24] | hp9k8[78]9 | hp8[78]9 | hp9k893 | hp893)
- # FIXME: really hppa2.0-hp
- basic_machine=hppa1.1-hp
- ;;
- hp9k8[0-9][13679] | hp8[0-9][13679])
- basic_machine=hppa1.1-hp
- ;;
- hp9k8[0-9][0-9] | hp8[0-9][0-9])
- basic_machine=hppa1.0-hp
- ;;
- hppa-next)
- os=-nextstep3
- ;;
- hppaosf)
- basic_machine=hppa1.1-hp
- os=-osf
- ;;
- hppro)
- basic_machine=hppa1.1-hp
- os=-proelf
- ;;
- i370-ibm* | ibm*)
- basic_machine=i370-ibm
- ;;
- i*86v32)
- basic_machine=`echo $1 | sed -e 's/86.*/86-pc/'`
- os=-sysv32
- ;;
- i*86v4*)
- basic_machine=`echo $1 | sed -e 's/86.*/86-pc/'`
- os=-sysv4
- ;;
- i*86v)
- basic_machine=`echo $1 | sed -e 's/86.*/86-pc/'`
- os=-sysv
- ;;
- i*86sol2)
- basic_machine=`echo $1 | sed -e 's/86.*/86-pc/'`
- os=-solaris2
- ;;
- i386mach)
- basic_machine=i386-mach
- os=-mach
- ;;
- i386-vsta | vsta)
- basic_machine=i386-unknown
- os=-vsta
- ;;
- iris | iris4d)
- basic_machine=mips-sgi
- case $os in
- -irix*)
- ;;
- *)
- os=-irix4
- ;;
- esac
- ;;
- isi68 | isi)
- basic_machine=m68k-isi
- os=-sysv
- ;;
- leon-*|leon[3-9]-*)
- basic_machine=sparc-`echo $basic_machine | sed 's/-.*//'`
- ;;
- m68knommu)
- basic_machine=m68k-unknown
- os=-linux
- ;;
- m68knommu-*)
- basic_machine=m68k-`echo $basic_machine | sed 's/^[^-]*-//'`
- os=-linux
- ;;
- m88k-omron*)
- basic_machine=m88k-omron
- ;;
- magnum | m3230)
- basic_machine=mips-mips
- os=-sysv
- ;;
- merlin)
- basic_machine=ns32k-utek
- os=-sysv
- ;;
- microblaze*)
- basic_machine=microblaze-xilinx
- ;;
- mingw64)
- basic_machine=x86_64-pc
- os=-mingw64
- ;;
- mingw32)
- basic_machine=i686-pc
- os=-mingw32
- ;;
- mingw32ce)
- basic_machine=arm-unknown
- os=-mingw32ce
- ;;
- miniframe)
- basic_machine=m68000-convergent
- ;;
- *mint | -mint[0-9]* | *MiNT | *MiNT[0-9]*)
- basic_machine=m68k-atari
- os=-mint
- ;;
- mips3*-*)
- basic_machine=`echo $basic_machine | sed -e 's/mips3/mips64/'`
- ;;
- mips3*)
- basic_machine=`echo $basic_machine | sed -e 's/mips3/mips64/'`-unknown
- ;;
- monitor)
- basic_machine=m68k-rom68k
- os=-coff
- ;;
- morphos)
- basic_machine=powerpc-unknown
- os=-morphos
- ;;
- moxiebox)
- basic_machine=moxie-unknown
- os=-moxiebox
- ;;
- msdos)
- basic_machine=i386-pc
- os=-msdos
- ;;
- ms1-*)
- basic_machine=`echo $basic_machine | sed -e 's/ms1-/mt-/'`
- ;;
- msys)
- basic_machine=i686-pc
- os=-msys
- ;;
- mvs)
- basic_machine=i370-ibm
- os=-mvs
- ;;
- nacl)
- basic_machine=le32-unknown
- os=-nacl
- ;;
- ncr3000)
- basic_machine=i486-ncr
- os=-sysv4
- ;;
- netbsd386)
- basic_machine=i386-unknown
- os=-netbsd
- ;;
- netwinder)
- basic_machine=armv4l-rebel
- os=-linux
- ;;
- news | news700 | news800 | news900)
- basic_machine=m68k-sony
- os=-newsos
- ;;
- news1000)
- basic_machine=m68030-sony
- os=-newsos
- ;;
- news-3600 | risc-news)
- basic_machine=mips-sony
- os=-newsos
- ;;
- necv70)
- basic_machine=v70-nec
- os=-sysv
- ;;
- next | m*-next )
- basic_machine=m68k-next
- case $os in
- -nextstep* )
- ;;
- -ns2*)
- os=-nextstep2
- ;;
- *)
- os=-nextstep3
- ;;
- esac
- ;;
- nh3000)
- basic_machine=m68k-harris
- os=-cxux
- ;;
- nh[45]000)
- basic_machine=m88k-harris
- os=-cxux
- ;;
- nindy960)
- basic_machine=i960-intel
- os=-nindy
- ;;
- mon960)
- basic_machine=i960-intel
- os=-mon960
- ;;
- nonstopux)
- basic_machine=mips-compaq
- os=-nonstopux
- ;;
- np1)
- basic_machine=np1-gould
- ;;
- neo-tandem)
- basic_machine=neo-tandem
- ;;
- nse-tandem)
- basic_machine=nse-tandem
- ;;
- nsr-tandem)
- basic_machine=nsr-tandem
- ;;
- op50n-* | op60c-*)
- basic_machine=hppa1.1-oki
- os=-proelf
- ;;
- openrisc | openrisc-*)
- basic_machine=or32-unknown
- ;;
- os400)
- basic_machine=powerpc-ibm
- os=-os400
- ;;
- OSE68000 | ose68000)
- basic_machine=m68000-ericsson
- os=-ose
- ;;
- os68k)
- basic_machine=m68k-none
- os=-os68k
- ;;
- pa-hitachi)
- basic_machine=hppa1.1-hitachi
- os=-hiuxwe2
- ;;
- paragon)
- basic_machine=i860-intel
- os=-osf
- ;;
- parisc)
- basic_machine=hppa-unknown
- os=-linux
- ;;
- parisc-*)
- basic_machine=hppa-`echo $basic_machine | sed 's/^[^-]*-//'`
- os=-linux
- ;;
- pbd)
- basic_machine=sparc-tti
- ;;
- pbb)
- basic_machine=m68k-tti
- ;;
- pc532 | pc532-*)
- basic_machine=ns32k-pc532
- ;;
- pc98)
- basic_machine=i386-pc
- ;;
- pc98-*)
- basic_machine=i386-`echo $basic_machine | sed 's/^[^-]*-//'`
- ;;
- pentium | p5 | k5 | k6 | nexgen | viac3)
- basic_machine=i586-pc
- ;;
- pentiumpro | p6 | 6x86 | athlon | athlon_*)
- basic_machine=i686-pc
- ;;
- pentiumii | pentium2 | pentiumiii | pentium3)
- basic_machine=i686-pc
- ;;
- pentium4)
- basic_machine=i786-pc
- ;;
- pentium-* | p5-* | k5-* | k6-* | nexgen-* | viac3-*)
- basic_machine=i586-`echo $basic_machine | sed 's/^[^-]*-//'`
- ;;
- pentiumpro-* | p6-* | 6x86-* | athlon-*)
- basic_machine=i686-`echo $basic_machine | sed 's/^[^-]*-//'`
- ;;
- pentiumii-* | pentium2-* | pentiumiii-* | pentium3-*)
- basic_machine=i686-`echo $basic_machine | sed 's/^[^-]*-//'`
- ;;
- pentium4-*)
- basic_machine=i786-`echo $basic_machine | sed 's/^[^-]*-//'`
- ;;
- pn)
- basic_machine=pn-gould
- ;;
- power) basic_machine=power-ibm
- ;;
- ppc | ppcbe) basic_machine=powerpc-unknown
- ;;
- ppc-* | ppcbe-*)
- basic_machine=powerpc-`echo $basic_machine | sed 's/^[^-]*-//'`
- ;;
- ppcle | powerpclittle | ppc-le | powerpc-little)
- basic_machine=powerpcle-unknown
- ;;
- ppcle-* | powerpclittle-*)
- basic_machine=powerpcle-`echo $basic_machine | sed 's/^[^-]*-//'`
- ;;
- ppc64) basic_machine=powerpc64-unknown
- ;;
- ppc64-*) basic_machine=powerpc64-`echo $basic_machine | sed 's/^[^-]*-//'`
- ;;
- ppc64le | powerpc64little | ppc64-le | powerpc64-little)
- basic_machine=powerpc64le-unknown
- ;;
- ppc64le-* | powerpc64little-*)
- basic_machine=powerpc64le-`echo $basic_machine | sed 's/^[^-]*-//'`
- ;;
- ps2)
- basic_machine=i386-ibm
- ;;
- pw32)
- basic_machine=i586-unknown
- os=-pw32
- ;;
- rdos | rdos64)
- basic_machine=x86_64-pc
- os=-rdos
- ;;
- rdos32)
- basic_machine=i386-pc
- os=-rdos
- ;;
- rom68k)
- basic_machine=m68k-rom68k
- os=-coff
- ;;
- rm[46]00)
- basic_machine=mips-siemens
- ;;
- rtpc | rtpc-*)
- basic_machine=romp-ibm
- ;;
- s390 | s390-*)
- basic_machine=s390-ibm
- ;;
- s390x | s390x-*)
- basic_machine=s390x-ibm
- ;;
- sa29200)
- basic_machine=a29k-amd
- os=-udi
- ;;
- sb1)
- basic_machine=mipsisa64sb1-unknown
- ;;
- sb1el)
- basic_machine=mipsisa64sb1el-unknown
- ;;
- sde)
- basic_machine=mipsisa32-sde
- os=-elf
- ;;
- sei)
- basic_machine=mips-sei
- os=-seiux
- ;;
- sequent)
- basic_machine=i386-sequent
- ;;
- sh)
- basic_machine=sh-hitachi
- os=-hms
- ;;
- sh5el)
- basic_machine=sh5le-unknown
- ;;
- sh64)
- basic_machine=sh64-unknown
- ;;
- sparclite-wrs | simso-wrs)
- basic_machine=sparclite-wrs
- os=-vxworks
- ;;
- sps7)
- basic_machine=m68k-bull
- os=-sysv2
- ;;
- spur)
- basic_machine=spur-unknown
- ;;
- st2000)
- basic_machine=m68k-tandem
- ;;
- stratus)
- basic_machine=i860-stratus
- os=-sysv4
- ;;
- strongarm-* | thumb-*)
- basic_machine=arm-`echo $basic_machine | sed 's/^[^-]*-//'`
- ;;
- sun2)
- basic_machine=m68000-sun
- ;;
- sun2os3)
- basic_machine=m68000-sun
- os=-sunos3
- ;;
- sun2os4)
- basic_machine=m68000-sun
- os=-sunos4
- ;;
- sun3os3)
- basic_machine=m68k-sun
- os=-sunos3
- ;;
- sun3os4)
- basic_machine=m68k-sun
- os=-sunos4
- ;;
- sun4os3)
- basic_machine=sparc-sun
- os=-sunos3
- ;;
- sun4os4)
- basic_machine=sparc-sun
- os=-sunos4
- ;;
- sun4sol2)
- basic_machine=sparc-sun
- os=-solaris2
- ;;
- sun3 | sun3-*)
- basic_machine=m68k-sun
- ;;
- sun4)
- basic_machine=sparc-sun
- ;;
- sun386 | sun386i | roadrunner)
- basic_machine=i386-sun
- ;;
- sv1)
- basic_machine=sv1-cray
- os=-unicos
- ;;
- symmetry)
- basic_machine=i386-sequent
- os=-dynix
- ;;
- t3e)
- basic_machine=alphaev5-cray
- os=-unicos
- ;;
- t90)
- basic_machine=t90-cray
- os=-unicos
- ;;
- tile*)
- basic_machine=$basic_machine-unknown
- os=-linux-gnu
- ;;
- tx39)
- basic_machine=mipstx39-unknown
- ;;
- tx39el)
- basic_machine=mipstx39el-unknown
- ;;
- toad1)
- basic_machine=pdp10-xkl
- os=-tops20
- ;;
- tower | tower-32)
- basic_machine=m68k-ncr
- ;;
- tpf)
- basic_machine=s390x-ibm
- os=-tpf
- ;;
- udi29k)
- basic_machine=a29k-amd
- os=-udi
- ;;
- ultra3)
- basic_machine=a29k-nyu
- os=-sym1
- ;;
- v810 | necv810)
- basic_machine=v810-nec
- os=-none
- ;;
- vaxv)
- basic_machine=vax-dec
- os=-sysv
- ;;
- vms)
- basic_machine=vax-dec
- os=-vms
- ;;
- vpp*|vx|vx-*)
- basic_machine=f301-fujitsu
- ;;
- vxworks960)
- basic_machine=i960-wrs
- os=-vxworks
- ;;
- vxworks68)
- basic_machine=m68k-wrs
- os=-vxworks
- ;;
- vxworks29k)
- basic_machine=a29k-wrs
- os=-vxworks
- ;;
- w65*)
- basic_machine=w65-wdc
- os=-none
- ;;
- w89k-*)
- basic_machine=hppa1.1-winbond
- os=-proelf
- ;;
- xbox)
- basic_machine=i686-pc
- os=-mingw32
- ;;
- xps | xps100)
- basic_machine=xps100-honeywell
- ;;
- xscale-* | xscalee[bl]-*)
- basic_machine=`echo $basic_machine | sed 's/^xscale/arm/'`
- ;;
- ymp)
- basic_machine=ymp-cray
- os=-unicos
- ;;
- z8k-*-coff)
- basic_machine=z8k-unknown
- os=-sim
- ;;
- z80-*-coff)
- basic_machine=z80-unknown
- os=-sim
- ;;
- none)
- basic_machine=none-none
- os=-none
- ;;
-
-# Here we handle the default manufacturer of certain CPU types. It is in
-# some cases the only manufacturer, in others, it is the most popular.
- w89k)
- basic_machine=hppa1.1-winbond
- ;;
- op50n)
- basic_machine=hppa1.1-oki
- ;;
- op60c)
- basic_machine=hppa1.1-oki
- ;;
- romp)
- basic_machine=romp-ibm
- ;;
- mmix)
- basic_machine=mmix-knuth
- ;;
- rs6000)
- basic_machine=rs6000-ibm
- ;;
- vax)
- basic_machine=vax-dec
- ;;
- pdp10)
- # there are many clones, so DEC is not a safe bet
- basic_machine=pdp10-unknown
- ;;
- pdp11)
- basic_machine=pdp11-dec
- ;;
- we32k)
- basic_machine=we32k-att
- ;;
- sh[1234] | sh[24]a | sh[24]aeb | sh[34]eb | sh[1234]le | sh[23]ele)
- basic_machine=sh-unknown
- ;;
- sparc | sparcv8 | sparcv9 | sparcv9b | sparcv9v)
- basic_machine=sparc-sun
- ;;
- cydra)
- basic_machine=cydra-cydrome
- ;;
- orion)
- basic_machine=orion-highlevel
- ;;
- orion105)
- basic_machine=clipper-highlevel
- ;;
- mac | mpw | mac-mpw)
- basic_machine=m68k-apple
- ;;
- pmac | pmac-mpw)
- basic_machine=powerpc-apple
- ;;
- *-unknown)
- # Make sure to match an already-canonicalized machine name.
- ;;
- *)
- echo Invalid configuration \`$1\': machine \`$basic_machine\' not recognized 1>&2
- exit 1
- ;;
-esac
-
-# Here we canonicalize certain aliases for manufacturers.
-case $basic_machine in
- *-digital*)
- basic_machine=`echo $basic_machine | sed 's/digital.*/dec/'`
- ;;
- *-commodore*)
- basic_machine=`echo $basic_machine | sed 's/commodore.*/cbm/'`
- ;;
- *)
- ;;
-esac
-
-# Decode manufacturer-specific aliases for certain operating systems.
-
-if [ x"$os" != x"" ]
-then
-case $os in
- # First match some system type aliases
- # that might get confused with valid system types.
- # -solaris* is a basic system type, with this one exception.
- -auroraux)
- os=-auroraux
- ;;
- -solaris1 | -solaris1.*)
- os=`echo $os | sed -e 's|solaris1|sunos4|'`
- ;;
- -solaris)
- os=-solaris2
- ;;
- -svr4*)
- os=-sysv4
- ;;
- -unixware*)
- os=-sysv4.2uw
- ;;
- -gnu/linux*)
- os=`echo $os | sed -e 's|gnu/linux|linux-gnu|'`
- ;;
- # First accept the basic system types.
- # The portable systems comes first.
- # Each alternative MUST END IN A *, to match a version number.
- # -sysv* is not here because it comes later, after sysvr4.
- -gnu* | -bsd* | -mach* | -minix* | -genix* | -ultrix* | -irix* \
- | -*vms* | -sco* | -esix* | -isc* | -aix* | -cnk* | -sunos | -sunos[34]*\
- | -hpux* | -unos* | -osf* | -luna* | -dgux* | -auroraux* | -solaris* \
- | -sym* | -kopensolaris* | -plan9* \
- | -amigaos* | -amigados* | -msdos* | -newsos* | -unicos* | -aof* \
- | -aos* | -aros* \
- | -nindy* | -vxsim* | -vxworks* | -ebmon* | -hms* | -mvs* \
- | -clix* | -riscos* | -uniplus* | -iris* | -rtu* | -xenix* \
- | -hiux* | -386bsd* | -knetbsd* | -mirbsd* | -netbsd* \
- | -bitrig* | -openbsd* | -solidbsd* \
- | -ekkobsd* | -kfreebsd* | -freebsd* | -riscix* | -lynxos* \
- | -bosx* | -nextstep* | -cxux* | -aout* | -elf* | -oabi* \
- | -ptx* | -coff* | -ecoff* | -winnt* | -domain* | -vsta* \
- | -udi* | -eabi* | -lites* | -ieee* | -go32* | -aux* \
- | -chorusos* | -chorusrdb* | -cegcc* \
- | -cygwin* | -msys* | -pe* | -psos* | -moss* | -proelf* | -rtems* \
- | -mingw32* | -mingw64* | -linux-gnu* | -linux-android* \
- | -linux-newlib* | -linux-musl* | -linux-uclibc* \
- | -uxpv* | -beos* | -mpeix* | -udk* | -moxiebox* \
- | -interix* | -uwin* | -mks* | -rhapsody* | -darwin* | -opened* \
- | -openstep* | -oskit* | -conix* | -pw32* | -nonstopux* \
- | -storm-chaos* | -tops10* | -tenex* | -tops20* | -its* \
- | -os2* | -vos* | -palmos* | -uclinux* | -nucleus* \
- | -morphos* | -superux* | -rtmk* | -rtmk-nova* | -windiss* \
- | -powermax* | -dnix* | -nx6 | -nx7 | -sei* | -dragonfly* \
- | -skyos* | -haiku* | -rdos* | -toppers* | -drops* | -es* | -tirtos*)
- # Remember, each alternative MUST END IN *, to match a version number.
- ;;
- -qnx*)
- case $basic_machine in
- x86-* | i*86-*)
- ;;
- *)
- os=-nto$os
- ;;
- esac
- ;;
- -nto-qnx*)
- ;;
- -nto*)
- os=`echo $os | sed -e 's|nto|nto-qnx|'`
- ;;
- -sim | -es1800* | -hms* | -xray | -os68k* | -none* | -v88r* \
- | -windows* | -osx | -abug | -netware* | -os9* | -beos* | -haiku* \
- | -macos* | -mpw* | -magic* | -mmixware* | -mon960* | -lnews*)
- ;;
- -mac*)
- os=`echo $os | sed -e 's|mac|macos|'`
- ;;
- -linux-dietlibc)
- os=-linux-dietlibc
- ;;
- -linux*)
- os=`echo $os | sed -e 's|linux|linux-gnu|'`
- ;;
- -sunos5*)
- os=`echo $os | sed -e 's|sunos5|solaris2|'`
- ;;
- -sunos6*)
- os=`echo $os | sed -e 's|sunos6|solaris3|'`
- ;;
- -opened*)
- os=-openedition
- ;;
- -os400*)
- os=-os400
- ;;
- -wince*)
- os=-wince
- ;;
- -osfrose*)
- os=-osfrose
- ;;
- -osf*)
- os=-osf
- ;;
- -utek*)
- os=-bsd
- ;;
- -dynix*)
- os=-bsd
- ;;
- -acis*)
- os=-aos
- ;;
- -atheos*)
- os=-atheos
- ;;
- -syllable*)
- os=-syllable
- ;;
- -386bsd)
- os=-bsd
- ;;
- -ctix* | -uts*)
- os=-sysv
- ;;
- -nova*)
- os=-rtmk-nova
- ;;
- -ns2 )
- os=-nextstep2
- ;;
- -nsk*)
- os=-nsk
- ;;
- # Preserve the version number of sinix5.
- -sinix5.*)
- os=`echo $os | sed -e 's|sinix|sysv|'`
- ;;
- -sinix*)
- os=-sysv4
- ;;
- -tpf*)
- os=-tpf
- ;;
- -triton*)
- os=-sysv3
- ;;
- -oss*)
- os=-sysv3
- ;;
- -svr4)
- os=-sysv4
- ;;
- -svr3)
- os=-sysv3
- ;;
- -sysvr4)
- os=-sysv4
- ;;
- # This must come after -sysvr4.
- -sysv*)
- ;;
- -ose*)
- os=-ose
- ;;
- -es1800*)
- os=-ose
- ;;
- -xenix)
- os=-xenix
- ;;
- -*mint | -mint[0-9]* | -*MiNT | -MiNT[0-9]*)
- os=-mint
- ;;
- -aros*)
- os=-aros
- ;;
- -zvmoe)
- os=-zvmoe
- ;;
- -dicos*)
- os=-dicos
- ;;
- -nacl*)
- ;;
- -none)
- ;;
- *)
- # Get rid of the `-' at the beginning of $os.
- os=`echo $os | sed 's/[^-]*-//'`
- echo Invalid configuration \`$1\': system \`$os\' not recognized 1>&2
- exit 1
- ;;
-esac
-else
-
-# Here we handle the default operating systems that come with various machines.
-# The value should be what the vendor currently ships out the door with their
-# machine or put another way, the most popular os provided with the machine.
-
-# Note that if you're going to try to match "-MANUFACTURER" here (say,
-# "-sun"), then you have to tell the case statement up towards the top
-# that MANUFACTURER isn't an operating system. Otherwise, code above
-# will signal an error saying that MANUFACTURER isn't an operating
-# system, and we'll never get to this point.
-
-case $basic_machine in
- score-*)
- os=-elf
- ;;
- spu-*)
- os=-elf
- ;;
- *-acorn)
- os=-riscix1.2
- ;;
- arm*-rebel)
- os=-linux
- ;;
- arm*-semi)
- os=-aout
- ;;
- c4x-* | tic4x-*)
- os=-coff
- ;;
- c8051-*)
- os=-elf
- ;;
- hexagon-*)
- os=-elf
- ;;
- tic54x-*)
- os=-coff
- ;;
- tic55x-*)
- os=-coff
- ;;
- tic6x-*)
- os=-coff
- ;;
- # This must come before the *-dec entry.
- pdp10-*)
- os=-tops20
- ;;
- pdp11-*)
- os=-none
- ;;
- *-dec | vax-*)
- os=-ultrix4.2
- ;;
- m68*-apollo)
- os=-domain
- ;;
- i386-sun)
- os=-sunos4.0.2
- ;;
- m68000-sun)
- os=-sunos3
- ;;
- m68*-cisco)
- os=-aout
- ;;
- mep-*)
- os=-elf
- ;;
- mips*-cisco)
- os=-elf
- ;;
- mips*-*)
- os=-elf
- ;;
- or32-*)
- os=-coff
- ;;
- *-tti) # must be before sparc entry or we get the wrong os.
- os=-sysv3
- ;;
- sparc-* | *-sun)
- os=-sunos4.1.1
- ;;
- *-be)
- os=-beos
- ;;
- *-haiku)
- os=-haiku
- ;;
- *-ibm)
- os=-aix
- ;;
- *-knuth)
- os=-mmixware
- ;;
- *-wec)
- os=-proelf
- ;;
- *-winbond)
- os=-proelf
- ;;
- *-oki)
- os=-proelf
- ;;
- *-hp)
- os=-hpux
- ;;
- *-hitachi)
- os=-hiux
- ;;
- i860-* | *-att | *-ncr | *-altos | *-motorola | *-convergent)
- os=-sysv
- ;;
- *-cbm)
- os=-amigaos
- ;;
- *-dg)
- os=-dgux
- ;;
- *-dolphin)
- os=-sysv3
- ;;
- m68k-ccur)
- os=-rtu
- ;;
- m88k-omron*)
- os=-luna
- ;;
- *-next )
- os=-nextstep
- ;;
- *-sequent)
- os=-ptx
- ;;
- *-crds)
- os=-unos
- ;;
- *-ns)
- os=-genix
- ;;
- i370-*)
- os=-mvs
- ;;
- *-next)
- os=-nextstep3
- ;;
- *-gould)
- os=-sysv
- ;;
- *-highlevel)
- os=-bsd
- ;;
- *-encore)
- os=-bsd
- ;;
- *-sgi)
- os=-irix
- ;;
- *-siemens)
- os=-sysv4
- ;;
- *-masscomp)
- os=-rtu
- ;;
- f30[01]-fujitsu | f700-fujitsu)
- os=-uxpv
- ;;
- *-rom68k)
- os=-coff
- ;;
- *-*bug)
- os=-coff
- ;;
- *-apple)
- os=-macos
- ;;
- *-atari*)
- os=-mint
- ;;
- *)
- os=-none
- ;;
-esac
-fi
-
-# Here we handle the case where we know the os, and the CPU type, but not the
-# manufacturer. We pick the logical manufacturer.
-vendor=unknown
-case $basic_machine in
- *-unknown)
- case $os in
- -riscix*)
- vendor=acorn
- ;;
- -sunos*)
- vendor=sun
- ;;
- -cnk*|-aix*)
- vendor=ibm
- ;;
- -beos*)
- vendor=be
- ;;
- -hpux*)
- vendor=hp
- ;;
- -mpeix*)
- vendor=hp
- ;;
- -hiux*)
- vendor=hitachi
- ;;
- -unos*)
- vendor=crds
- ;;
- -dgux*)
- vendor=dg
- ;;
- -luna*)
- vendor=omron
- ;;
- -genix*)
- vendor=ns
- ;;
- -mvs* | -opened*)
- vendor=ibm
- ;;
- -os400*)
- vendor=ibm
- ;;
- -ptx*)
- vendor=sequent
- ;;
- -tpf*)
- vendor=ibm
- ;;
- -vxsim* | -vxworks* | -windiss*)
- vendor=wrs
- ;;
- -aux*)
- vendor=apple
- ;;
- -hms*)
- vendor=hitachi
- ;;
- -mpw* | -macos*)
- vendor=apple
- ;;
- -*mint | -mint[0-9]* | -*MiNT | -MiNT[0-9]*)
- vendor=atari
- ;;
- -vos*)
- vendor=stratus
- ;;
- esac
- basic_machine=`echo $basic_machine | sed "s/unknown/$vendor/"`
- ;;
-esac
-
-echo $basic_machine$os
-exit
-
-# Local variables:
-# eval: (add-hook 'write-file-hooks 'time-stamp)
-# time-stamp-start: "timestamp='"
-# time-stamp-format: "%:y-%02m-%02d"
-# time-stamp-end: "'"
-# End:
diff --git a/gcc/mpc/configure b/gcc/mpc/configure
index 3815008e03..51f304d06c 100755
--- a/gcc/mpc/configure
+++ b/gcc/mpc/configure
@@ -1,6 +1,6 @@
#! /bin/sh
# Guess values for system-dependent variables and create Makefiles.
-# Generated by GNU Autoconf 2.69 for mpc 1.1.0.
+# Generated by GNU Autoconf 2.69 for mpc 1.2.0.
#
# Report bugs to .
#
@@ -590,8 +590,8 @@ MAKEFLAGS=
# Identity of this package.
PACKAGE_NAME='mpc'
PACKAGE_TARNAME='mpc'
-PACKAGE_VERSION='1.1.0'
-PACKAGE_STRING='mpc 1.1.0'
+PACKAGE_VERSION='1.2.0'
+PACKAGE_STRING='mpc 1.2.0'
PACKAGE_BUGREPORT='mpc-discuss@lists.gforge.inria.fr'
PACKAGE_URL=''
@@ -669,7 +669,6 @@ am__nodep
AMDEPBACKSLASH
AMDEP_FALSE
AMDEP_TRUE
-am__quote
am__include
DEPDIR
OBJEXT
@@ -759,7 +758,8 @@ PACKAGE_VERSION
PACKAGE_TARNAME
PACKAGE_NAME
PATH_SEPARATOR
-SHELL'
+SHELL
+am__quote'
ac_subst_files=''
ac_user_opts='
enable_option_checking
@@ -1333,7 +1333,7 @@ if test "$ac_init_help" = "long"; then
# Omit some internal or obsolete options to make the list less imposing.
# This message is too long to be a string in the A/UX 3.1 sh.
cat <<_ACEOF
-\`configure' configures mpc 1.1.0 to adapt to many kinds of systems.
+\`configure' configures mpc 1.2.0 to adapt to many kinds of systems.
Usage: $0 [OPTION]... [VAR=VALUE]...
@@ -1403,7 +1403,7 @@ fi
if test -n "$ac_init_help"; then
case $ac_init_help in
- short | recursive ) echo "Configuration of mpc 1.1.0:";;
+ short | recursive ) echo "Configuration of mpc 1.2.0:";;
esac
cat <<\_ACEOF
@@ -1525,7 +1525,7 @@ fi
test -n "$ac_init_help" && exit $ac_status
if $ac_init_version; then
cat <<\_ACEOF
-mpc configure 1.1.0
+mpc configure 1.2.0
generated by GNU Autoconf 2.69
Copyright (C) 2012 Free Software Foundation, Inc.
@@ -1948,7 +1948,7 @@ cat >config.log <<_ACEOF
This file contains any messages produced by compilers while
running configure, to aid debugging if configure makes a mistake.
-It was created by mpc $as_me 1.1.0, which was
+It was created by mpc $as_me 1.2.0, which was
generated by GNU Autoconf 2.69. Invocation command line was
$ $0 $@
@@ -2297,13 +2297,8 @@ ac_compiler_gnu=$ac_cv_c_compiler_gnu
-ac_config_headers="$ac_config_headers config.h"
-
-
-am__api_version='1.15'
-
ac_aux_dir=
-for ac_dir in "$srcdir" "$srcdir/.." "$srcdir/../.."; do
+for ac_dir in build-aux "$srcdir"/build-aux; do
if test -f "$ac_dir/install-sh"; then
ac_aux_dir=$ac_dir
ac_install_sh="$ac_aux_dir/install-sh -c"
@@ -2319,7 +2314,7 @@ for ac_dir in "$srcdir" "$srcdir/.." "$srcdir/../.."; do
fi
done
if test -z "$ac_aux_dir"; then
- as_fn_error $? "cannot find install-sh, install.sh, or shtool in \"$srcdir\" \"$srcdir/..\" \"$srcdir/../..\"" "$LINENO" 5
+ as_fn_error $? "cannot find install-sh, install.sh, or shtool in build-aux \"$srcdir\"/build-aux" "$LINENO" 5
fi
# These three variables are undocumented and unsupported,
@@ -2331,6 +2326,11 @@ ac_config_sub="$SHELL $ac_aux_dir/config.sub" # Please don't use this var.
ac_configure="$SHELL $ac_aux_dir/configure" # Please don't use this var.
+ac_config_headers="$ac_config_headers config.h"
+
+
+am__api_version='1.16'
+
# Find a good install program. We prefer a C program (faster),
# so one script is as good as another. But avoid the broken or
# incompatible versions:
@@ -2815,7 +2815,7 @@ fi
# Define the identity of the package.
PACKAGE='mpc'
- VERSION='1.1.0'
+ VERSION='1.2.0'
cat >>confdefs.h <<_ACEOF
@@ -2845,8 +2845,8 @@ MAKEINFO=${MAKEINFO-"${am_missing_run}makeinfo"}
# For better backward compatibility. To be removed once Automake 1.9.x
# dies out for good. For more background, see:
-#
-#
+#
+#
mkdir_p='$(MKDIR_P)'
# We need awk for the "check" target (and possibly the TAP driver). The
@@ -2897,7 +2897,7 @@ END
Aborting the configuration process, to ensure you take notice of the issue.
You can download and install GNU coreutils to get an 'rm' implementation
-that behaves properly: .
+that behaves properly: .
If you want to complete the configuration process using your problematic
'rm' anyway, export the environment variable ACCEPT_INFERIOR_RM_PROGRAM
@@ -4270,45 +4270,45 @@ DEPDIR="${am__leading_dot}deps"
ac_config_commands="$ac_config_commands depfiles"
-
-am_make=${MAKE-make}
-cat > confinc << 'END'
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking whether ${MAKE-make} supports the include directive" >&5
+$as_echo_n "checking whether ${MAKE-make} supports the include directive... " >&6; }
+cat > confinc.mk << 'END'
am__doit:
- @echo this is the am__doit target
+ @echo this is the am__doit target >confinc.out
.PHONY: am__doit
END
-# If we don't find an include directive, just comment out the code.
-{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for style of include used by $am_make" >&5
-$as_echo_n "checking for style of include used by $am_make... " >&6; }
am__include="#"
am__quote=
-_am_result=none
-# First try GNU make style include.
-echo "include confinc" > confmf
-# Ignore all kinds of additional output from 'make'.
-case `$am_make -s -f confmf 2> /dev/null` in #(
-*the\ am__doit\ target*)
- am__include=include
- am__quote=
- _am_result=GNU
- ;;
-esac
-# Now try BSD make style include.
-if test "$am__include" = "#"; then
- echo '.include "confinc"' > confmf
- case `$am_make -s -f confmf 2> /dev/null` in #(
- *the\ am__doit\ target*)
- am__include=.include
- am__quote="\""
- _am_result=BSD
+# BSD make does it like this.
+echo '.include "confinc.mk" # ignored' > confmf.BSD
+# Other make implementations (GNU, Solaris 10, AIX) do it like this.
+echo 'include confinc.mk # ignored' > confmf.GNU
+_am_result=no
+for s in GNU BSD; do
+ { echo "$as_me:$LINENO: ${MAKE-make} -f confmf.$s && cat confinc.out" >&5
+ (${MAKE-make} -f confmf.$s && cat confinc.out) >&5 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }
+ case $?:`cat confinc.out 2>/dev/null` in #(
+ '0:this is the am__doit target') :
+ case $s in #(
+ BSD) :
+ am__include='.include' am__quote='"' ;; #(
+ *) :
+ am__include='include' am__quote='' ;;
+esac ;; #(
+ *) :
;;
- esac
-fi
-
-
-{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $_am_result" >&5
-$as_echo "$_am_result" >&6; }
-rm -f confinc confmf
+esac
+ if test "$am__include" != "#"; then
+ _am_result="yes ($s style)"
+ break
+ fi
+done
+rm -f confinc.* confmf.*
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: ${_am_result}" >&5
+$as_echo "${_am_result}" >&6; }
# Check whether --enable-dependency-tracking was given.
if test "${enable_dependency_tracking+set}" = set; then :
@@ -12539,85 +12539,6 @@ if test -z "$USER_CFLAGS"; then
if echo $VERSION | grep -c dev >/dev/null 2>&1 ; then
if test "x$GCC" = "xyes" -a "x$compiler" != "xicc"; then
- # enable -Werror for myself (Andreas Enge)
- if test "x$USER" = "xenge"; then
-
-
-
-
-
-
- flag=`echo "-Werror" | $SED 'y% .=/+-(){}<>:*,%_______________%'`
-
- { $as_echo "$as_me:${as_lineno-$LINENO}: checking whether the C compiler accepts the -Werror flag" >&5
-$as_echo_n "checking whether the C compiler accepts the -Werror flag... " >&6; }
-if eval \${ax_cv_c_check_flag_$flag+:} false; then :
- $as_echo_n "(cached) " >&6
-else
-
-
- ac_ext=c
-ac_cpp='$CPP $CPPFLAGS'
-ac_compile='$CC -c $CFLAGS $CPPFLAGS conftest.$ac_ext >&5'
-ac_link='$CC -o conftest$ac_exeext $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5'
-ac_compiler_gnu=$ac_cv_c_compiler_gnu
-
-
- save_CFLAGS="$CFLAGS"
- CFLAGS="$CFLAGS -Werror"
- cat confdefs.h - <<_ACEOF >conftest.$ac_ext
-/* end confdefs.h. */
-
-
-int
-main ()
-{
-
- ;
- return 0;
-}
-
-_ACEOF
-if ac_fn_c_try_compile "$LINENO"; then :
-
- eval "ax_cv_c_check_flag_$flag=yes"
-
-else
-
- eval "ax_cv_c_check_flag_$flag=no"
-
-fi
-rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext
-
- CFLAGS="$save_CFLAGS"
-
- ac_ext=c
-ac_cpp='$CPP $CPPFLAGS'
-ac_compile='$CC -c $CFLAGS $CPPFLAGS conftest.$ac_ext >&5'
-ac_link='$CC -o conftest$ac_exeext $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5'
-ac_compiler_gnu=$ac_cv_c_compiler_gnu
-
-
-
-fi
-eval ac_res=\$ax_cv_c_check_flag_$flag
- { $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_res" >&5
-$as_echo "$ac_res" >&6; }
-
- if eval "test \"`echo '$ax_cv_c_check_flag_'$flag`\" = yes"; then :
-
- :
- CFLAGS="$CFLAGS -Werror"
-
-else
-
- :
-
-
-fi
-
-
- fi
@@ -13985,7 +13906,7 @@ $as_echo "no" >&6; }
fi
rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext
-# Check for a recent MPFR: we require MPFR 3.0.0 for MPC_RNDA
+# Check for a recent MPFR: we require MPFR 4.1.0
# The same remark as above for GMP applies.
{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for recent MPFR" >&5
$as_echo_n "checking for recent MPFR... " >&6; }
@@ -13993,8 +13914,8 @@ cat confdefs.h - <<_ACEOF >conftest.$ac_ext
/* end confdefs.h. */
#include "mpfr.h"
-#if (MPFR_VERSION < MPFR_VERSION_NUM (3,0,0))
-# error "Minimal MPFR version is 3.0.0"
+#if (MPFR_VERSION < MPFR_VERSION_NUM (4,1,0))
+# error "Minimal MPFR version is 4.1.0"
error
#endif
@@ -14006,7 +13927,7 @@ else
{ $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
$as_echo "no" >&6; }
- as_fn_error $? "MPFR version >= 3.0.0 required" "$LINENO" 5
+ as_fn_error $? "MPFR version >= 4.1.0 required" "$LINENO" 5
fi
rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext
@@ -14670,7 +14591,7 @@ fi
{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for current git version" >&5
$as_echo_n "checking for current git version... " >&6; }
- GITVERSION=dd39695
+ GITVERSION=9ab01ab
{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $GITVERSION" >&5
@@ -14680,7 +14601,7 @@ fi
fi
-ac_config_files="$ac_config_files Makefile src/Makefile tests/Makefile doc/Makefile tools/Makefile tools/bench/Makefile"
+ac_config_files="$ac_config_files Makefile src/Makefile tests/Makefile doc/Makefile tools/Makefile tools/bench/Makefile tools/mpcheck/Makefile"
cat >confcache <<\_ACEOF
# This file is a shell script that caches the results of configure
@@ -15216,7 +15137,7 @@ cat >>$CONFIG_STATUS <<\_ACEOF || ac_write_fail=1
# report actual input values of CONFIG_FILES etc. instead of their
# values after options handling.
ac_log="
-This file was extended by mpc $as_me 1.1.0, which was
+This file was extended by mpc $as_me 1.2.0, which was
generated by GNU Autoconf 2.69. Invocation command line was
CONFIG_FILES = $CONFIG_FILES
@@ -15282,7 +15203,7 @@ _ACEOF
cat >>$CONFIG_STATUS <<_ACEOF || ac_write_fail=1
ac_cs_config="`$as_echo "$ac_configure_args" | sed 's/^ //; s/[\\""\`\$]/\\\\&/g'`"
ac_cs_version="\\
-mpc config.status 1.1.0
+mpc config.status 1.2.0
configured by $0, generated by GNU Autoconf 2.69,
with options \\"\$ac_cs_config\\"
@@ -15401,7 +15322,7 @@ cat >>$CONFIG_STATUS <<_ACEOF || ac_write_fail=1
#
# INIT-COMMANDS
#
-AMDEP_TRUE="$AMDEP_TRUE" ac_aux_dir="$ac_aux_dir"
+AMDEP_TRUE="$AMDEP_TRUE" MAKE="${MAKE-make}"
# The HP-UX ksh and POSIX shell print the target directory to stdout
@@ -15705,6 +15626,7 @@ do
"doc/Makefile") CONFIG_FILES="$CONFIG_FILES doc/Makefile" ;;
"tools/Makefile") CONFIG_FILES="$CONFIG_FILES tools/Makefile" ;;
"tools/bench/Makefile") CONFIG_FILES="$CONFIG_FILES tools/bench/Makefile" ;;
+ "tools/mpcheck/Makefile") CONFIG_FILES="$CONFIG_FILES tools/mpcheck/Makefile" ;;
*) as_fn_error $? "invalid argument: \`$ac_config_target'" "$LINENO" 5;;
esac
@@ -16304,29 +16226,35 @@ $as_echo "$as_me: executing $ac_file commands" >&6;}
# Older Autoconf quotes --file arguments for eval, but not when files
# are listed without --file. Let's play safe and only enable the eval
# if we detect the quoting.
- case $CONFIG_FILES in
- *\'*) eval set x "$CONFIG_FILES" ;;
- *) set x $CONFIG_FILES ;;
- esac
+ # TODO: see whether this extra hack can be removed once we start
+ # requiring Autoconf 2.70 or later.
+ case $CONFIG_FILES in #(
+ *\'*) :
+ eval set x "$CONFIG_FILES" ;; #(
+ *) :
+ set x $CONFIG_FILES ;; #(
+ *) :
+ ;;
+esac
shift
- for mf
+ # Used to flag and report bootstrapping failures.
+ am_rc=0
+ for am_mf
do
# Strip MF so we end up with the name of the file.
- mf=`echo "$mf" | sed -e 's/:.*$//'`
- # Check whether this is an Automake generated Makefile or not.
- # We used to match only the files named 'Makefile.in', but
- # some people rename them; so instead we look at the file content.
- # Grep'ing the first line is not enough: some people post-process
- # each Makefile.in and add a new line on top of each file to say so.
- # Grep'ing the whole file is not good either: AIX grep has a line
+ am_mf=`$as_echo "$am_mf" | sed -e 's/:.*$//'`
+ # Check whether this is an Automake generated Makefile which includes
+ # dependency-tracking related rules and includes.
+ # Grep'ing the whole file directly is not great: AIX grep has a line
# limit of 2048, but all sed's we know have understand at least 4000.
- if sed -n 's,^#.*generated by automake.*,X,p' "$mf" | grep X >/dev/null 2>&1; then
- dirpart=`$as_dirname -- "$mf" ||
-$as_expr X"$mf" : 'X\(.*[^/]\)//*[^/][^/]*/*$' \| \
- X"$mf" : 'X\(//\)[^/]' \| \
- X"$mf" : 'X\(//\)$' \| \
- X"$mf" : 'X\(/\)' \| . 2>/dev/null ||
-$as_echo X"$mf" |
+ sed -n 's,^am--depfiles:.*,X,p' "$am_mf" | grep X >/dev/null 2>&1 \
+ || continue
+ am_dirpart=`$as_dirname -- "$am_mf" ||
+$as_expr X"$am_mf" : 'X\(.*[^/]\)//*[^/][^/]*/*$' \| \
+ X"$am_mf" : 'X\(//\)[^/]' \| \
+ X"$am_mf" : 'X\(//\)$' \| \
+ X"$am_mf" : 'X\(/\)' \| . 2>/dev/null ||
+$as_echo X"$am_mf" |
sed '/^X\(.*[^/]\)\/\/*[^/][^/]*\/*$/{
s//\1/
q
@@ -16344,53 +16272,50 @@ $as_echo X"$mf" |
q
}
s/.*/./; q'`
- else
- continue
- fi
- # Extract the definition of DEPDIR, am__include, and am__quote
- # from the Makefile without running 'make'.
- DEPDIR=`sed -n 's/^DEPDIR = //p' < "$mf"`
- test -z "$DEPDIR" && continue
- am__include=`sed -n 's/^am__include = //p' < "$mf"`
- test -z "$am__include" && continue
- am__quote=`sed -n 's/^am__quote = //p' < "$mf"`
- # Find all dependency output files, they are included files with
- # $(DEPDIR) in their names. We invoke sed twice because it is the
- # simplest approach to changing $(DEPDIR) to its actual value in the
- # expansion.
- for file in `sed -n "
- s/^$am__include $am__quote\(.*(DEPDIR).*\)$am__quote"'$/\1/p' <"$mf" | \
- sed -e 's/\$(DEPDIR)/'"$DEPDIR"'/g'`; do
- # Make sure the directory exists.
- test -f "$dirpart/$file" && continue
- fdir=`$as_dirname -- "$file" ||
-$as_expr X"$file" : 'X\(.*[^/]\)//*[^/][^/]*/*$' \| \
- X"$file" : 'X\(//\)[^/]' \| \
- X"$file" : 'X\(//\)$' \| \
- X"$file" : 'X\(/\)' \| . 2>/dev/null ||
-$as_echo X"$file" |
- sed '/^X\(.*[^/]\)\/\/*[^/][^/]*\/*$/{
+ am_filepart=`$as_basename -- "$am_mf" ||
+$as_expr X/"$am_mf" : '.*/\([^/][^/]*\)/*$' \| \
+ X"$am_mf" : 'X\(//\)$' \| \
+ X"$am_mf" : 'X\(/\)' \| . 2>/dev/null ||
+$as_echo X/"$am_mf" |
+ sed '/^.*\/\([^/][^/]*\)\/*$/{
s//\1/
q
}
- /^X\(\/\/\)[^/].*/{
+ /^X\/\(\/\/\)$/{
s//\1/
q
}
- /^X\(\/\/\)$/{
- s//\1/
- q
- }
- /^X\(\/\).*/{
+ /^X\/\(\/\).*/{
s//\1/
q
}
s/.*/./; q'`
- as_dir=$dirpart/$fdir; as_fn_mkdir_p
- # echo "creating $dirpart/$file"
- echo '# dummy' > "$dirpart/$file"
- done
+ { echo "$as_me:$LINENO: cd "$am_dirpart" \
+ && sed -e '/# am--include-marker/d' "$am_filepart" \
+ | $MAKE -f - am--depfiles" >&5
+ (cd "$am_dirpart" \
+ && sed -e '/# am--include-marker/d' "$am_filepart" \
+ | $MAKE -f - am--depfiles) >&5 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); } || am_rc=$?
done
+ if test $am_rc -ne 0; then
+ { { $as_echo "$as_me:${as_lineno-$LINENO}: error: in \`$ac_pwd':" >&5
+$as_echo "$as_me: error: in \`$ac_pwd':" >&2;}
+as_fn_error $? "Something went wrong bootstrapping makefile fragments
+ for automatic dependency tracking. If GNU make was not used, consider
+ re-running the configure script with MAKE=\"gmake\" (or whatever is
+ necessary). You can also try re-running configure with the
+ '--disable-dependency-tracking' option to at least be able to build
+ the package (albeit without support for automatic dependency tracking).
+See \`config.log' for more details" "$LINENO" 5; }
+ fi
+ { am_dirpart=; unset am_dirpart;}
+ { am_filepart=; unset am_filepart;}
+ { am_mf=; unset am_mf;}
+ { am_rc=; unset am_rc;}
+ rm -f conftest-deps.mk
}
;;
"libtool":C)
diff --git a/gcc/mpc/configure.ac b/gcc/mpc/configure.ac
index f0c65a86f7..ab3da6092f 100644
--- a/gcc/mpc/configure.ac
+++ b/gcc/mpc/configure.ac
@@ -1,4 +1,4 @@
-# Copyright (C) 2008, 2009, 2010, 2011, 2012, 2014, 2016, 2017 INRIA
+# Copyright (C) 2008, 2009, 2010, 2011, 2012, 2014, 2016, 2017, 2018, 2020 INRIA
#
# This file is part of GNU MPC.
#
@@ -20,8 +20,9 @@
# Process this file with autoconf to produce a configure script.
AC_PREREQ(2.61)
-AC_INIT(mpc, 1.1.0, mpc-discuss@lists.gforge.inria.fr)
+AC_INIT(mpc, 1.2.0, mpc-discuss@lists.gforge.inria.fr)
AC_CONFIG_SRCDIR([src/mpc-impl.h])
+AC_CONFIG_AUX_DIR([build-aux])
AC_CONFIG_HEADER([config.h])
AM_INIT_AUTOMAKE
@@ -203,22 +204,22 @@ error
AC_MSG_ERROR([GMP version >= 5.0.0 required])
])
-# Check for a recent MPFR: we require MPFR 3.0.0 for MPC_RNDA
+# Check for a recent MPFR: we require MPFR 4.1.0
# The same remark as above for GMP applies.
AC_MSG_CHECKING(for recent MPFR)
AC_COMPILE_IFELSE(
[AC_LANG_SOURCE(
[[
#include "mpfr.h"
-#if (MPFR_VERSION < MPFR_VERSION_NUM (3,0,0))
-# error "Minimal MPFR version is 3.0.0"
+#if (MPFR_VERSION < MPFR_VERSION_NUM (4,1,0))
+# error "Minimal MPFR version is 4.1.0"
error
#endif
]])],
[AC_MSG_RESULT(yes)],
[
AC_MSG_RESULT(no)
- AC_MSG_ERROR([MPFR version >= 3.0.0 required])
+ AC_MSG_ERROR([MPFR version >= 4.1.0 required])
])
# Check for logging feature
@@ -253,5 +254,5 @@ AC_DEFINE_UNQUOTED([MPC_GCC_VERSION], ["$GCC_VERSION"], [Version of gcc])
# Looks for short git hash if the version string contains "dev"
MPC_GITVERSION
-AC_CONFIG_FILES([Makefile src/Makefile tests/Makefile doc/Makefile tools/Makefile tools/bench/Makefile])
+AC_CONFIG_FILES([Makefile src/Makefile tests/Makefile doc/Makefile tools/Makefile tools/bench/Makefile tools/mpcheck/Makefile])
AC_OUTPUT
diff --git a/gcc/mpc/doc/Makefile.in b/gcc/mpc/doc/Makefile.in
index b89746243e..ca17362c39 100644
--- a/gcc/mpc/doc/Makefile.in
+++ b/gcc/mpc/doc/Makefile.in
@@ -1,7 +1,7 @@
-# Makefile.in generated by automake 1.15.1 from Makefile.am.
+# Makefile.in generated by automake 1.16.2 from Makefile.am.
# @configure_input@
-# Copyright (C) 1994-2017 Free Software Foundation, Inc.
+# Copyright (C) 1994-2020 Free Software Foundation, Inc.
# This Makefile.in is free software; the Free Software Foundation
# gives unlimited permission to copy and/or distribute it,
@@ -147,7 +147,8 @@ am__v_texidevnull_ = $(am__v_texidevnull_@AM_DEFAULT_V@)
am__v_texidevnull_0 = > /dev/null
am__v_texidevnull_1 =
INFO_DEPS = $(srcdir)/mpc.info
-am__TEXINFO_TEX_DIR = $(srcdir)
+TEXINFO_TEX = $(top_srcdir)/build-aux/texinfo.tex
+am__TEXINFO_TEX_DIR = $(top_srcdir)/build-aux
DVIS = mpc.dvi
PDFS = mpc.pdf
PSS = mpc.ps
@@ -192,7 +193,9 @@ am__uninstall_files_from_dir = { \
$(am__cd) "$$dir" && rm -f $$files; }; \
}
am__tagged_files = $(HEADERS) $(SOURCES) $(TAGS_FILES) $(LISP)
-am__DIST_COMMON = $(srcdir)/Makefile.in mdate-sh texinfo.tex
+am__DIST_COMMON = $(srcdir)/Makefile.in \
+ $(top_srcdir)/build-aux/mdate-sh \
+ $(top_srcdir)/build-aux/texinfo.tex mdate-sh texinfo.tex
DISTFILES = $(DIST_COMMON) $(DIST_SOURCES) $(TEXINFOS) $(EXTRA_DIST)
ACLOCAL = @ACLOCAL@
AMTAR = @AMTAR@
@@ -340,8 +343,8 @@ Makefile: $(srcdir)/Makefile.in $(top_builddir)/config.status
*config.status*) \
cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh;; \
*) \
- echo ' cd $(top_builddir) && $(SHELL) ./config.status $(subdir)/$@ $(am__depfiles_maybe)'; \
- cd $(top_builddir) && $(SHELL) ./config.status $(subdir)/$@ $(am__depfiles_maybe);; \
+ echo ' cd $(top_builddir) && $(SHELL) ./config.status $(subdir)/$@ $(am__maybe_remake_depfiles)'; \
+ cd $(top_builddir) && $(SHELL) ./config.status $(subdir)/$@ $(am__maybe_remake_depfiles);; \
esac;
$(top_builddir)/config.status: $(top_srcdir)/configure $(CONFIG_STATUS_DEPENDENCIES)
@@ -409,7 +412,7 @@ mpc.html: mpc.texi $(srcdir)/version.texi
$(srcdir)/version.texi: @MAINTAINER_MODE_TRUE@ $(srcdir)/stamp-vti
$(srcdir)/stamp-vti: mpc.texi $(top_srcdir)/configure
@(dir=.; test -f ./mpc.texi || dir=$(srcdir); \
- set `$(SHELL) $(srcdir)/mdate-sh $$dir/mpc.texi`; \
+ set `$(SHELL) $(top_srcdir)/build-aux/mdate-sh $$dir/mpc.texi`; \
echo "@set UPDATED $$1 $$2 $$3"; \
echo "@set UPDATED-MONTH $$2 $$3"; \
echo "@set EDITION $(VERSION)"; \
@@ -526,7 +529,10 @@ ctags CTAGS:
cscope cscopelist:
-distdir: $(DISTFILES)
+distdir: $(BUILT_SOURCES)
+ $(MAKE) $(AM_MAKEFLAGS) distdir-am
+
+distdir-am: $(DISTFILES)
@srcdirstrip=`echo "$(srcdir)" | sed 's/[].[^$$\\*]/\\\\&/g'`; \
topsrcdirstrip=`echo "$(top_srcdir)" | sed 's/[].[^$$\\*]/\\\\&/g'`; \
list='$(DISTFILES)'; \
diff --git a/gcc/mpc/doc/mpc.info b/gcc/mpc/doc/mpc.info
new file mode 100644
index 0000000000..3111787a4b
--- /dev/null
+++ b/gcc/mpc/doc/mpc.info
@@ -0,0 +1,1834 @@
+This is mpc.info, produced by makeinfo version 6.7 from mpc.texi.
+
+This manual is for GNU MPC, a library for multiple precision complex
+arithmetic, version 1.2.0 of August 2020.
+
+ Copyright (C) 2002, 2003, 2004, 2005, 2006, 2007, 2008, 2009, 2010,
+2011, 2012, 2013, 2016, 2018, 2020 INRIA
+
+ Permission is granted to copy, distribute and/or modify this
+ document under the terms of the GNU Free Documentation License,
+ Version 1.3 or any later version published by the Free Software
+ Foundation; with no Invariant Sections. A copy of the license is
+ included in the section entitled "GNU Free Documentation License."
+INFO-DIR-SECTION GNU Packages
+START-INFO-DIR-ENTRY
+* mpc: (mpc)Multiple Precision Complex Library.
+END-INFO-DIR-ENTRY
+
+
+File: mpc.info, Node: Top, Next: Copying, Up: (dir)
+
+GNU MPC
+*******
+
+This manual documents how to install and use the GNU Multiple Precision
+Complex Library, version 1.2.0
+
+* Menu:
+
+* Copying:: GNU MPC Copying Conditions (LGPL).
+* Introduction to GNU MPC:: Brief introduction to GNU MPC.
+* Installing GNU MPC:: How to configure and compile the GNU MPC library.
+* Reporting Bugs:: How to usefully report bugs.
+* GNU MPC Basics:: What every GNU MPC user should know.
+* Complex Functions:: Functions for arithmetic on complex numbers.
+* References::
+* Concept Index::
+* Function Index::
+* GNU Free Documentation License::
+
+
+File: mpc.info, Node: Copying, Next: Introduction to GNU MPC, Prev: Top, Up: Top
+
+GNU MPC Copying Conditions
+**************************
+
+GNU MPC is free software; you can redistribute it and/or modify it under
+the terms of the GNU Lesser General Public License as published by the
+Free Software Foundation; either version 3 of the License, or (at your
+option) any later version.
+
+ GNU MPC is distributed in the hope that it will be useful, but
+WITHOUT ANY WARRANTY; without even the implied warranty of
+MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU Lesser
+General Public License for more details.
+
+ You should have received a copy of the GNU Lesser General Public
+License along with this program. If not, see
+.
+
+
+File: mpc.info, Node: Introduction to GNU MPC, Next: Installing GNU MPC, Prev: Copying, Up: Top
+
+1 Introduction to GNU MPC
+*************************
+
+GNU MPC is a portable library written in C for arbitrary precision
+arithmetic on complex numbers providing correct rounding. It implements
+a multiprecision equivalent of the C99 standard. It builds upon the GNU
+MP and the GNU MPFR libraries.
+
+1.1 How to use this Manual
+==========================
+
+Everyone should read *note GNU MPC Basics::. If you need to install the
+library yourself, you need to read *note Installing GNU MPC::, too.
+
+ The remainder of the manual can be used for later reference, although
+it is probably a good idea to skim through it.
+
+
+File: mpc.info, Node: Installing GNU MPC, Next: Reporting Bugs, Prev: Introduction to GNU MPC, Up: Top
+
+2 Installing GNU MPC
+********************
+
+To build GNU MPC, you first have to install GNU MP (version 5.0.0 or
+higher) and GNU MPFR (version 4.1.0 or higher) on your computer. You
+need a C compiler; GCC version 4.4 or higher is recommended, since GNU
+MPC may trigger a bug in previous versions, see the thread at
+.
+And you need a standard Unix 'make' program, plus some other standard
+Unix utility programs.
+
+ Here are the steps needed to install the library on Unix systems:
+
+ 1. 'tar xzf mpc-1.2.0.tar.gz'
+
+ 2. 'cd mpc-1.2.0'
+
+ 3. './configure'
+
+ if GMP and GNU MPFR are installed into standard directories, that
+ is, directories that are searched by default by the compiler and
+ the linking tools.
+
+ './configure --with-gmp='
+
+ is used to indicate a different location where GMP is installed.
+ Alternatively, you can specify directly GMP include and GMP lib
+ directories with './configure --with-gmp-lib=
+ --with-gmp-include='.
+
+ './configure --with-mpfr='
+
+ is used to indicate a different location where GNU MPFR is
+ installed. Alternatively, you can specify directly GNU MPFR
+ include and GNU MPFR lib directories with './configure
+ --with-mpf-lib=
+ --with-mpfr-include='.
+
+ Another useful parameter is '--prefix', which can be used to
+ specify an alternative installation location instead of
+ '/usr/local'; see 'make install' below.
+
+ To enable checking for memory leaks using 'valgrind' during 'make
+ check', add the parameter '--enable-valgrind-tests'.
+
+ If for debugging purposes you wish to log calls to GNU MPC
+ functions from within your code, add the parameter
+ '--enable-logging'. In your code, replace the inclusion of 'mpc.h'
+ by 'mpc-log.h' and link the executable dynamically. Then all calls
+ to functions with only complex arguments are printed to 'stderr' in
+ the following form: First, the function name is given, followed by
+ its type such as 'c_cc', meaning that the function has one complex
+ result (one 'c' in front of the '_'), computed from two complex
+ arguments (two 'c' after the '_'). Then, the precisions of the
+ real and the imaginary part of the first result is given, followed
+ by the second one and so on. Finally, for each argument, the
+ precisions of its real and imaginary part are specified and the
+ argument itself is printed in hexadecimal via the function
+ 'mpc_out_str' (*note String and Stream Input and Output::). The
+ option requires a dynamic library, so it may not be combined with
+ '--disable-shared'.
+
+ Use './configure --help' for an exhaustive list of parameters.
+
+ 4. 'make'
+
+ This compiles GNU MPC in the working directory.
+
+ 5. 'make check'
+
+ This will make sure GNU MPC was built correctly.
+
+ If you get error messages, please report them to
+ 'mpc-discuss@lists.gforge.inria.fr' (*Note Reporting Bugs::, for
+ information on what to include in useful bug reports).
+
+ 6. 'make install'
+
+ This will copy the file 'mpc.h' to the directory
+ '/usr/local/include', the file 'libmpc.a' to the directory
+ '/usr/local/lib', and the file 'mpc.info' to the directory
+ '/usr/local/share/info' (or if you passed the '--prefix' option to
+ 'configure', using the prefix directory given as argument to
+ '--prefix' instead of '/usr/local'). Note: you need write
+ permissions on these directories.
+
+2.1 Other 'make' Targets
+========================
+
+There are some other useful make targets:
+
+ * 'info'
+
+ Create an info version of the manual, in 'mpc.info'.
+
+ * 'pdf'
+
+ Create a PDF version of the manual, in 'doc/mpc.pdf'.
+
+ * 'dvi'
+
+ Create a DVI version of the manual, in 'doc/mpc.dvi'.
+
+ * 'ps'
+
+ Create a Postscript version of the manual, in 'doc/mpc.ps'.
+
+ * 'html'
+
+ Create an HTML version of the manual, in several pages in the
+ directory 'doc/mpc.html'; if you want only one output HTML file,
+ then type 'makeinfo --html --no-split mpc.texi' instead.
+
+ * 'clean'
+
+ Delete all object files and archive files, but not the
+ configuration files.
+
+ * 'distclean'
+
+ Delete all files not included in the distribution.
+
+ * 'uninstall'
+
+ Delete all files copied by 'make install'.
+
+2.2 Known Build Problems
+========================
+
+On AIX, if GMP was built with the 64-bit ABI, before building and
+testing GNU MPC, it might be necessary to set the 'OBJECT_MODE'
+environment variable to 64 by, e.g.,
+
+ 'export OBJECT_MODE=64'
+
+ This has been tested with the C compiler IBM XL C/C++ Enterprise
+Edition V8.0 for AIX, version: 08.00.0000.0021, GMP 4.2.4 and GNU MPFR
+2.4.1.
+
+ Please report any other problems you encounter to
+'mpc-discuss@lists.gforge.inria.fr'. *Note Reporting Bugs::.
+
+
+File: mpc.info, Node: Reporting Bugs, Next: GNU MPC Basics, Prev: Installing GNU MPC, Up: Top
+
+3 Reporting Bugs
+****************
+
+If you think you have found a bug in the GNU MPC library, please
+investigate and report it. We have made this library available to you,
+and it is not to ask too much from you, to ask you to report the bugs
+that you find.
+
+ There are a few things you should think about when you put your bug
+report together.
+
+ You have to send us a test case that makes it possible for us to
+reproduce the bug. Include instructions on how to run the test case.
+
+ You also have to explain what is wrong; if you get a crash, or if the
+results printed are incorrect and in that case, in what way.
+
+ Please include compiler version information in your bug report. This
+can be extracted using 'gcc -v', or 'cc -V' on some machines. Also,
+include the output from 'uname -a'.
+
+ If your bug report is good, we will do our best to help you to get a
+corrected version of the library; if the bug report is poor, we will not
+do anything about it (aside of chiding you to send better bug reports).
+
+ Send your bug report to: 'mpc-discuss@lists.gforge.inria.fr'.
+
+ If you think something in this manual is unclear, or downright
+incorrect, or if the language needs to be improved, please send a note
+to the same address.
+
+
+File: mpc.info, Node: GNU MPC Basics, Next: Complex Functions, Prev: Reporting Bugs, Up: Top
+
+4 GNU MPC Basics
+****************
+
+All declarations needed to use GNU MPC are collected in the include file
+'mpc.h'. It is designed to work with both C and C++ compilers. You
+should include that file in any program using the GNU MPC library by
+adding the line
+ #include "mpc.h"
+
+4.1 Nomenclature and Types
+==========================
+
+"Complex number" or "Complex" for short, is a pair of two arbitrary
+precision floating-point numbers (for the real and imaginary parts).
+The C data type for such objects is 'mpc_t'.
+
+The "Precision" is the number of bits used to represent the mantissa of
+the real and imaginary parts; the corresponding C data type is
+'mpfr_prec_t'. For more details on the allowed precision range, *note
+(mpfr.info)Nomenclature and Types::.
+
+The "rounding mode" specifies the way to round the result of a complex
+operation, in case the exact result can not be represented exactly in
+the destination mantissa; the corresponding C data type is 'mpc_rnd_t'.
+A complex rounding mode is a pair of two rounding modes: one for the
+real part, one for the imaginary part.
+
+4.2 Function Classes
+====================
+
+There is only one class of functions in the GNU MPC library, namely
+functions for complex arithmetic. The function names begin with 'mpc_'.
+The associated type is 'mpc_t'.
+
+4.3 GNU MPC Variable Conventions
+================================
+
+As a general rule, all GNU MPC functions expect output arguments before
+input arguments. This notation is based on an analogy with the
+assignment operator.
+
+ GNU MPC allows you to use the same variable for both input and output
+in the same expression. For example, the main function for
+floating-point multiplication, 'mpc_mul', can be used like this:
+'mpc_mul (x, x, x, rnd_mode)'. This computes the square of X with
+rounding mode 'rnd_mode' and puts the result back in X.
+
+ Before you can assign to an GNU MPC variable, you need to initialise
+it by calling one of the special initialization functions. When you are
+done with a variable, you need to clear it out, using one of the
+functions for that purpose.
+
+ A variable should only be initialised once, or at least cleared out
+between each initialization. After a variable has been initialised, it
+may be assigned to any number of times.
+
+ For efficiency reasons, avoid to initialise and clear out a variable
+in loops. Instead, initialise it before entering the loop, and clear it
+out after the loop has exited.
+
+ You do not need to be concerned about allocating additional space for
+GNU MPC variables, since each of its real and imaginary part has a
+mantissa of fixed size. Hence unless you change its precision, or clear
+and reinitialise it, a complex variable will have the same allocated
+space during all its life.
+
+4.4 Rounding Modes
+==================
+
+A complex rounding mode is of the form 'MPC_RNDxy' where 'x' and 'y' are
+one of 'N' (to nearest), 'Z' (towards zero), 'U' (towards plus
+infinity), 'D' (towards minus infinity). The first letter refers to the
+rounding mode for the real part, and the second one for the imaginary
+part. For example 'MPC_RNDZU' indicates to round the real part towards
+zero, and the imaginary part towards plus infinity.
+
+ The 'round to nearest' mode works as in the IEEE P754 standard: in
+case the number to be rounded lies exactly in the middle of two
+representable numbers, it is rounded to the one with the least
+significant bit set to zero. For example, the number 5, which is
+represented by (101) in binary, is rounded to (100)=4 with a precision
+of two bits, and not to (110)=6.
+
+4.5 Return Value
+================
+
+Most GNU MPC functions have a return value of type 'int', which is used
+to indicate the position of the rounded real and imaginary parts with
+respect to the exact (infinite precision) values. If this integer is
+'i', the macros 'MPC_INEX_RE(i)' and 'MPC_INEX_IM(i)' give 0 if the
+corresponding rounded value is exact, a negative value if the rounded
+value is less than the exact one, and a positive value if it is greater
+than the exact one. Similarly, functions computing a result of type
+'mpfr_t' return an integer that is 0, positive or negative depending on
+whether the rounded value is the same, larger or smaller then the exact
+result.
+
+ Some functions, such as 'mpc_sin_cos', compute two complex results;
+the macros 'MPC_INEX1(i)' and 'MPC_INEX2(i)', applied to the return
+value 'i' of such a function, yield the exactness value corresponding to
+the first or the second computed value, respectively.
+
+4.6 Branch Cuts And Special Values
+==================================
+
+Some complex functions have branch cuts, across which the function is
+discontinous. In GNU MPC, the branch cuts chosen are the same as those
+specified for the corresponding functions in the ISO C99 standard.
+
+ Likewise, when evaluated at a point whose real or imaginary part is
+either infinite or a NaN or a signed zero, a function returns the same
+value as those specified for the corresponding function in the ISO C99
+standard.
+
+
+File: mpc.info, Node: Complex Functions, Next: References, Prev: GNU MPC Basics, Up: Top
+
+5 Complex Functions
+*******************
+
+The complex functions expect arguments of type 'mpc_t'.
+
+ The GNU MPC floating-point functions have an interface that is
+similar to the GNU MP integer functions. The function prefix for
+operations on complex numbers is 'mpc_'.
+
+ The precision of a computation is defined as follows: Compute the
+requested operation exactly (with "infinite precision"), and round the
+result to the destination variable precision with the given rounding
+mode.
+
+ The GNU MPC complex functions are intended to be a smooth extension
+of the IEEE P754 arithmetic. The results obtained on one computer
+should not differ from the results obtained on a computer with a
+different word size.
+
+* Menu:
+
+* Initializing Complex Numbers::
+* Assigning Complex Numbers::
+* Converting Complex Numbers::
+* String and Stream Input and Output::
+* Complex Comparison::
+* Projection & Decomposing::
+* Basic Arithmetic::
+* Power Functions and Logarithm::
+* Trigonometric Functions::
+* Miscellaneous Complex Functions::
+* Advanced Functions::
+* Internals::
+
+
+File: mpc.info, Node: Initializing Complex Numbers, Next: Assigning Complex Numbers, Up: Complex Functions
+
+5.1 Initialization Functions
+============================
+
+An 'mpc_t' object must be initialised before storing the first value in
+it. The functions 'mpc_init2' and 'mpc_init3' are used for that
+purpose.
+
+ -- Function: void mpc_init2 (mpc_t Z, mpfr_prec_t PREC)
+ Initialise Z to precision PREC bits and set its real and imaginary
+ parts to NaN. Normally, a variable should be initialised once only
+ or at least be cleared, using 'mpc_clear', between initializations.
+
+ -- Function: void mpc_init3 (mpc_t Z, mpfr_prec_t PREC_R, mpfr_prec_t
+ PREC_I)
+ Initialise Z with the precision of its real part being PREC_R bits
+ and the precision of its imaginary part being PREC_I bits, and set
+ the real and imaginary parts to NaN.
+
+ -- Function: void mpc_clear (mpc_t Z)
+ Free the space occupied by Z. Make sure to call this function for
+ all 'mpc_t' variables when you are done with them.
+
+ Here is an example on how to initialise complex variables:
+ {
+ mpc_t x, y;
+ mpc_init2 (x, 256); /* precision _exactly_ 256 bits */
+ mpc_init3 (y, 100, 50); /* 100/50 bits for the real/imaginary part */
+ ...
+ mpc_clear (x);
+ mpc_clear (y);
+ }
+
+ The following function is useful for changing the precision during a
+calculation. A typical use would be for adjusting the precision
+gradually in iterative algorithms like Newton-Raphson, making the
+computation precision closely match the actual accurate part of the
+numbers.
+
+ -- Function: void mpc_set_prec (mpc_t X, mpfr_prec_t PREC)
+ Reset the precision of X to be *exactly* PREC bits, and set its
+ real/imaginary parts to NaN. The previous value stored in X is
+ lost. It is equivalent to a call to 'mpc_clear(x)' followed by a
+ call to 'mpc_init2(x, prec)', but more efficient as no allocation
+ is done in case the current allocated space for the mantissa of X
+ is sufficient.
+
+ -- Function: mpfr_prec_t mpc_get_prec (mpc_t X)
+ If the real and imaginary part of X have the same precision, it is
+ returned, otherwise, 0 is returned.
+
+ -- Function: void mpc_get_prec2 (mpfr_prec_t* PR, mpfr_prec_t* PI,
+ mpc_t X)
+ Returns the precision of the real part of X via PR and of its
+ imaginary part via PI.
+
+
+File: mpc.info, Node: Assigning Complex Numbers, Next: Converting Complex Numbers, Prev: Initializing Complex Numbers, Up: Complex Functions
+
+5.2 Assignment Functions
+========================
+
+These functions assign new values to already initialised complex numbers
+(*note Initializing Complex Numbers::). When using any functions with
+'intmax_t' or 'uintmax_t' parameters, you must include '' or
+'' _before_ 'mpc.h', to allow 'mpc.h' to define prototypes
+for these functions. Similarly, functions with parameters of type
+'complex' or 'long complex' are defined only if '' is
+included _before_ 'mpc.h'. If you need assignment functions that are
+not in the current API, you can define them using the 'MPC_SET_X_Y'
+macro (*note Advanced Functions::).
+
+ -- Function: int mpc_set (mpc_t ROP, mpc_t OP, mpc_rnd_t RND)
+ Set the value of ROP from OP, rounded to the precision of ROP with
+ the given rounding mode RND.
+
+ -- Function: int mpc_set_ui (mpc_t ROP, unsigned long int OP, mpc_rnd_t
+ RND)
+ -- Function: int mpc_set_si (mpc_t ROP, long int OP, mpc_rnd_t RND)
+ -- Function: int mpc_set_uj (mpc_t ROP, uintmax_t OP, mpc_rnd_t RND)
+ -- Function: int mpc_set_sj (mpc_t ROP, intmax_t OP, mpc_rnd_t RND)
+ -- Function: int mpc_set_d (mpc_t ROP, double OP, mpc_rnd_t RND)
+ -- Function: int mpc_set_ld (mpc_t ROP, long double OP, mpc_rnd_t RND)
+ -- Function: int mpc_set_dc (mpc_t ROP, double _Complex OP, mpc_rnd_t
+ RND)
+ -- Function: int mpc_set_ldc (mpc_t ROP, long double _Complex OP,
+ mpc_rnd_t RND)
+ -- Function: int mpc_set_z (mpc_t ROP, mpz_t OP mpc_rnd_t RND)
+ -- Function: int mpc_set_q (mpc_t ROP, mpq_t OP mpc_rnd_t RND)
+ -- Function: int mpc_set_f (mpc_t ROP, mpf_t OP mpc_rnd_t RND)
+ -- Function: int mpc_set_fr (mpc_t ROP, mpfr_t OP, mpc_rnd_t RND)
+ Set the value of ROP from OP, rounded to the precision of ROP with
+ the given rounding mode RND. The argument OP is interpreted as
+ real, so the imaginary part of ROP is set to zero with a positive
+ sign. Please note that even a 'long int' may have to be rounded,
+ if the destination precision is less than the machine word width.
+ For 'mpc_set_d', be careful that the input number OP may not be
+ exactly representable as a double-precision number (this happens
+ for 0.1 for instance), in which case it is first rounded by the C
+ compiler to a double-precision number, and then only to a complex
+ number.
+
+ -- Function: int mpc_set_ui_ui (mpc_t ROP, unsigned long int OP1,
+ unsigned long int OP2, mpc_rnd_t RND)
+ -- Function: int mpc_set_si_si (mpc_t ROP, long int OP1, long int OP2,
+ mpc_rnd_t RND)
+ -- Function: int mpc_set_uj_uj (mpc_t ROP, uintmax_t OP1, uintmax_t
+ OP2, mpc_rnd_t RND)
+ -- Function: int mpc_set_sj_sj (mpc_t ROP, intmax_t OP1, intmax_t OP2,
+ mpc_rnd_t RND)
+ -- Function: int mpc_set_d_d (mpc_t ROP, double OP1, double OP2,
+ mpc_rnd_t RND)
+ -- Function: int mpc_set_ld_ld (mpc_t ROP, long double OP1, long double
+ OP2, mpc_rnd_t RND)
+ -- Function: int mpc_set_z_z (mpc_t ROP, mpz_t OP1, mpz_t OP2,
+ mpc_rnd_t RND)
+ -- Function: int mpc_set_q_q (mpc_t ROP, mpq_t OP1, mpq_t OP2,
+ mpc_rnd_t RND)
+ -- Function: int mpc_set_f_f (mpc_t ROP, mpf_t OP1, mpf_t OP2,
+ mpc_rnd_t RND)
+ -- Function: int mpc_set_fr_fr (mpc_t ROP, mpfr_t OP1, mpfr_t OP2,
+ mpc_rnd_t RND)
+ Set the real part of ROP from OP1, and its imaginary part from OP2,
+ according to the rounding mode RND.
+
+ Beware that the behaviour of 'mpc_set_fr_fr' is undefined if OP1 or
+ OP2 is a pointer to the real or imaginary part of ROP. To exchange
+ the real and the imaginary part of a complex number, either use
+ 'mpfr_swap (mpc_realref (rop), mpc_imagref (rop))', which also
+ exchanges the precisions of the two parts; or use a temporary
+ variable.
+
+ For functions assigning complex variables from strings or input
+streams, *note String and Stream Input and Output::.
+
+ -- Function: void mpc_set_nan (mpc_t ROP)
+ Set ROP to Nan+i*NaN.
+
+ -- Function: void mpc_swap (mpc_t OP1, mpc_t OP2)
+ Swap the values of OP1 and OP2 efficiently. Warning: The
+ precisions are exchanged, too; in case these are different,
+ 'mpc_swap' is thus not equivalent to three 'mpc_set' calls using a
+ third auxiliary variable.
+
+
+File: mpc.info, Node: Converting Complex Numbers, Next: String and Stream Input and Output, Prev: Assigning Complex Numbers, Up: Complex Functions
+
+5.3 Conversion Functions
+========================
+
+The following functions are available only if '' is included
+_before_ 'mpc.h'.
+
+ -- Function: double _Complex mpc_get_dc (mpc_t OP, mpc_rnd_t RND)
+ -- Function: long double _Complex mpc_get_ldc (mpc_t OP, mpc_rnd_t RND)
+ Convert OP to a C complex number, using the rounding mode RND.
+
+ For functions converting complex variables to strings or stream
+output, *note String and Stream Input and Output::.
+
+
+File: mpc.info, Node: String and Stream Input and Output, Next: Complex Comparison, Prev: Converting Complex Numbers, Up: Complex Functions
+
+5.4 String and Stream Input and Output
+======================================
+
+ -- Function: int mpc_strtoc (mpc_t ROP, const char *NPTR, char
+ **ENDPTR, int BASE, mpc_rnd_t RND)
+ Read a complex number from a string NPTR in base BASE, rounded to
+ the precision of ROP with the given rounding mode RND. The BASE
+ must be either 0 or a number from 2 to 36 (otherwise the behaviour
+ is undefined). If NPTR starts with valid data, the result is
+ stored in ROP, the usual inexact value is returned (*note Return
+ Value: return-value.) and, if ENDPTR is not the null pointer,
+ *ENDPTR points to the character just after the valid data.
+ Otherwise, ROP is set to 'NaN + i * NaN', -1 is returned and, if
+ ENDPTR is not the null pointer, the value of NPTR is stored in the
+ location referenced by ENDPTR.
+
+ The expected form of a complex number string is either a real
+ number (an optional leading whitespace, an optional sign followed
+ by a floating-point number), or a pair of real numbers in
+ parentheses separated by whitespace. If a real number is read, the
+ missing imaginary part is set to +0. The form of a floating-point
+ number depends on the base and is described in the documentation of
+ 'mpfr_strtofr' (*note (mpfr.info)Assignment Functions::). For
+ instance, '"3.1415926"', '"(1.25e+7 +.17)"', '"(@nan@ 2)"' and
+ '"(-0 -7)"' are valid strings for BASE = 10. If BASE = 0, then a
+ prefix may be used to indicate the base in which the floating-point
+ number is written. Use prefix '0b' for binary numbers, prefix '0x'
+ for hexadecimal numbers, and no prefix for decimal numbers. The
+ real and imaginary part may then be written in different bases.
+ For instance, '"(1.024e+3 +2.05e+3)"' and '"(0b1p+10 +0x802)"' are
+ valid strings for 'base'=0 and represent the same value.
+
+ -- Function: int mpc_set_str (mpc_t ROP, const char *S, int BASE,
+ mpc_rnd_t rnd)
+ Set ROP to the value of the string S in base BASE, rounded to the
+ precision of ROP with the given rounding mode RND. See the
+ documentation of 'mpc_strtoc' for a detailed description of the
+ valid string formats. Contrarily to 'mpc_strtoc', 'mpc_set_str'
+ requires the _whole_ string to represent a valid complex number
+ (potentially followed by additional white space). This function
+ returns the usual inexact value (*note Return Value: return-value.)
+ if the entire string up to the final null character is a valid
+ number in base BASE; otherwise it returns -1, and ROP is set to
+ NaN+i*NaN.
+
+ -- Function: char * mpc_get_str (int B, size_t N, mpc_t OP, mpc_rnd_t
+ RND)
+ Convert OP to a string containing its real and imaginary parts,
+ separated by a space and enclosed in a pair of parentheses. The
+ numbers are written in base B (which may vary from 2 to 36) and
+ rounded according to RND. The number of significant digits, at
+ least 2, is given by N. It is also possible to let N be zero, in
+ which case the number of digits is chosen large enough so that
+ re-reading the printed value with the same precision, assuming both
+ output and input use rounding to nearest, will recover the original
+ value of OP. Note that 'mpc_get_str' uses the decimal point of the
+ current locale if available, and '.' otherwise.
+
+ The string is generated using the current memory allocation
+ function ('malloc' by default, unless it has been modified using
+ the custom memory allocation interface of 'gmp'); once it is not
+ needed any more, it should be freed by calling 'mpc_free_str'.
+
+ -- Function: void mpc_free_str (char *STR)
+ Free the string STR, which needs to have been allocated by a call
+ to 'mpc_get_str'.
+
+ The following two functions read numbers from input streams and write
+them to output streams. When using any of these functions, you need to
+include 'stdio.h' _before_ 'mpc.h'.
+
+ -- Function: int mpc_inp_str (mpc_t ROP, FILE *STREAM, size_t *READ,
+ int BASE, mpc_rnd_t RND)
+ Input a string in base BASE in the same format as for 'mpc_strtoc'
+ from stdio stream STREAM, rounded according to RND, and put the
+ read complex number into ROP. If STREAM is the null pointer, ROP
+ is read from 'stdin'. Return the usual inexact value; if an error
+ occurs, set ROP to 'NaN + i * NaN' and return -1. If READ is not
+ the null pointer, it is set to the number of read characters.
+
+ Unlike 'mpc_strtoc', the function 'mpc_inp_str' does not possess
+ perfect knowledge of the string to transform and has to read it
+ character by character, so it behaves slightly differently: It
+ tries to read a string describing a complex number and processes
+ this string through a call to 'mpc_set_str'. Precisely, after
+ skipping optional whitespace, a minimal string is read according to
+ the regular expression 'mpfr | '(' \s* mpfr \s+ mpfr \s* ')'',
+ where '\s' denotes a whitespace, and 'mpfr' is either a string
+ containing neither whitespaces nor parentheses, or
+ 'nan(n-char-sequence)' or '@nan@(n-char-sequence)' (regardless of
+ capitalisation) with 'n-char-sequence' a string of ascii letters,
+ digits or ''_''.
+
+ For instance, upon input of '"nan(13 1)"', the function
+ 'mpc_inp_str' starts to recognise a value of NaN followed by an
+ n-char-sequence indicated by the opening parenthesis; as soon as
+ the space is reached, it becomes clear that the expression in
+ parentheses is not an n-char-sequence, and the error flag -1 is
+ returned after 6 characters have been consumed from the stream (the
+ whitespace itself remaining in the stream). The function
+ 'mpc_strtoc', on the other hand, may track back when reaching the
+ whitespace; it treats the string as the two successive complex
+ numbers 'NaN + i * 0' and '13 + i'. It is thus recommended to have
+ a whitespace follow each floating point number to avoid this
+ problem.
+
+ -- Function: size_t mpc_out_str (FILE *STREAM, int BASE, size_t
+ N_DIGITS, mpc_t OP, mpc_rnd_t RND)
+ Output OP on stdio stream STREAM in base BASE, rounded according to
+ RND, in the same format as for 'mpc_strtoc' If STREAM is the null
+ pointer, ROP is written to 'stdout'.
+
+ Return the number of characters written.
+
+
+File: mpc.info, Node: Complex Comparison, Next: Projection & Decomposing, Prev: String and Stream Input and Output, Up: Complex Functions
+
+5.5 Comparison Functions
+========================
+
+ -- Function: int mpc_cmp (mpc_t OP1, mpc_t OP2)
+ -- Function: int mpc_cmp_si_si (mpc_t OP1, long int OP2R, long int
+ OP2I)
+ -- Macro: int mpc_cmp_si (mpc_t OP1, long int OP2)
+
+ Compare OP1 and OP2, where in the case of 'mpc_cmp_si_si', OP2 is
+ taken to be OP2R + i OP2I. The return value C can be decomposed
+ into 'x = MPC_INEX_RE(c)' and 'y = MPC_INEX_IM(c)', such that X is
+ positive if the real part of OP1 is greater than that of OP2, zero
+ if both real parts are equal, and negative if the real part of OP1
+ is less than that of OP2, and likewise for Y. Both OP1 and OP2 are
+ considered to their full own precision, which may differ. It is
+ not allowed that one of the operands has a NaN (Not-a-Number) part.
+
+ The storage of the return value is such that equality can be simply
+ checked with 'mpc_cmp (op1, op2) == 0'.
+
+ -- Function: int mpc_cmp_abs (mpc_t OP1, mpc_t OP2)
+
+ Compare the absolute values of OP1 and OP2. The return value is 0
+ if both are the same (including infinity), positive if the absolute
+ value of OP1 is greater than that of OP2, and negative if it is
+ smaller. If OP1 or OP2 has a real or imaginary part which is NaN,
+ the function behaves like 'mpfr_cmp' on two real numbers of which
+ at least one is NaN.
+
+
+File: mpc.info, Node: Projection & Decomposing, Next: Basic Arithmetic, Prev: Complex Comparison, Up: Complex Functions
+
+5.6 Projection and Decomposing Functions
+========================================
+
+ -- Function: int mpc_real (mpfr_t ROP, mpc_t OP, mpfr_rnd_t RND)
+ Set ROP to the value of the real part of OP rounded in the
+ direction RND.
+
+ -- Function: int mpc_imag (mpfr_t ROP, mpc_t OP, mpfr_rnd_t RND)
+ Set ROP to the value of the imaginary part of OP rounded in the
+ direction RND.
+
+ -- Macro: mpfr_t mpc_realref (mpc_t OP)
+ -- Macro: mpfr_t mpc_imagref (mpc_t OP)
+ Return a reference to the real part and imaginary part of OP,
+ respectively. The 'mpfr' functions can be used on the result of
+ these macros (note that the 'mpfr_t' type is itself a pointer).
+
+ -- Function: int mpc_arg (mpfr_t ROP, mpc_t OP, mpfr_rnd_t RND)
+ Set ROP to the argument of OP, with a branch cut along the negative
+ real axis.
+
+ -- Function: int mpc_proj (mpc_t ROP, mpc_t OP, mpc_rnd_t RND)
+ Compute a projection of OP onto the Riemann sphere. Set ROP to OP
+ rounded in the direction RND, except when at least one part of OP
+ is infinite (even if the other part is a NaN) in which case the
+ real part of ROP is set to plus infinity and its imaginary part to
+ a signed zero with the same sign as the imaginary part of OP.
+
+
+File: mpc.info, Node: Basic Arithmetic, Next: Power Functions and Logarithm, Prev: Projection & Decomposing, Up: Complex Functions
+
+5.7 Basic Arithmetic Functions
+==============================
+
+All the following functions are designed in such a way that, when
+working with real numbers instead of complex numbers, their complexity
+should essentially be the same as with the GNU MPFR library, with only a
+marginal overhead due to the GNU MPC layer.
+
+ -- Function: int mpc_add (mpc_t ROP, mpc_t OP1, mpc_t OP2, mpc_rnd_t
+ RND)
+ -- Function: int mpc_add_ui (mpc_t ROP, mpc_t OP1, unsigned long int
+ OP2, mpc_rnd_t RND)
+ -- Function: int mpc_add_fr (mpc_t ROP, mpc_t OP1, mpfr_t OP2,
+ mpc_rnd_t RND)
+ Set ROP to OP1 + OP2 rounded according to RND.
+
+ -- Function: int mpc_sub (mpc_t ROP, mpc_t OP1, mpc_t OP2, mpc_rnd_t
+ RND)
+ -- Function: int mpc_sub_fr (mpc_t ROP, mpc_t OP1, mpfr_t OP2,
+ mpc_rnd_t RND)
+ -- Function: int mpc_fr_sub (mpc_t ROP, mpfr_t OP1, mpc_t OP2,
+ mpc_rnd_t RND)
+ -- Function: int mpc_sub_ui (mpc_t ROP, mpc_t OP1, unsigned long int
+ OP2, mpc_rnd_t RND)
+ -- Macro: int mpc_ui_sub (mpc_t ROP, unsigned long int OP1, mpc_t OP2,
+ mpc_rnd_t RND)
+ -- Function: int mpc_ui_ui_sub (mpc_t ROP, unsigned long int RE1,
+ unsigned long int IM1, mpc_t OP2, mpc_rnd_t RND)
+ Set ROP to OP1 - OP2 rounded according to RND. For
+ 'mpc_ui_ui_sub', OP1 is RE1 + IM1.
+
+ -- Function: int mpc_neg (mpc_t ROP, mpc_t OP, mpc_rnd_t RND)
+ Set ROP to -OP rounded according to RND. Just changes the sign if
+ ROP and OP are the same variable.
+
+ -- Function: int mpc_sum (mpc_t ROP, mpc_ptr* OP, unsigned long N,
+ mpc_rnd_t RND)
+ Set ROP to the sum of the elements in the array OP of length N,
+ rounded according to RND.
+
+ -- Function: int mpc_mul (mpc_t ROP, mpc_t OP1, mpc_t OP2, mpc_rnd_t
+ RND)
+ -- Function: int mpc_mul_ui (mpc_t ROP, mpc_t OP1, unsigned long int
+ OP2, mpc_rnd_t RND)
+ -- Function: int mpc_mul_si (mpc_t ROP, mpc_t OP1, long int OP2,
+ mpc_rnd_t RND)
+ -- Function: int mpc_mul_fr (mpc_t ROP, mpc_t OP1, mpfr_t OP2,
+ mpc_rnd_t RND)
+ Set ROP to OP1 times OP2 rounded according to RND. Note: for
+ 'mpc_mul', in case OP1 and OP2 have the same value, use 'mpc_sqr'
+ for better efficiency.
+
+ -- Function: int mpc_mul_i (mpc_t ROP, mpc_t OP, int SGN, mpc_rnd_t
+ RND)
+ Set ROP to OP times the imaginary unit i if SGN is non-negative,
+ set ROP to OP times -i otherwise, in both cases rounded according
+ to RND.
+
+ -- Function: int mpc_sqr (mpc_t ROP, mpc_t OP, mpc_rnd_t RND)
+ Set ROP to the square of OP rounded according to RND.
+
+ -- Function: int mpc_fma (mpc_t ROP, mpc_t OP1, mpc_t OP2, mpc_t OP3,
+ mpc_rnd_t RND)
+ Set ROP to OP1*OP2+OP3, rounded according to RND, with only one
+ final rounding.
+
+ -- Function: int mpc_dot (mpc_t ROP, mpc_ptr* OP1, mpc_ptr* OP2,
+ unsigned long N, mpc_rnd_t RND)
+ Set ROP to the dot product of the elements in the arrays OP1 and
+ OP2, both of length N, rounded according to RND.
+
+ -- Function: int mpc_div (mpc_t ROP, mpc_t OP1, mpc_t OP2, mpc_rnd_t
+ RND)
+ -- Function: int mpc_div_ui (mpc_t ROP, mpc_t OP1, unsigned long int
+ OP2, mpc_rnd_t RND)
+ -- Function: int mpc_div_fr (mpc_t ROP, mpc_t OP1, mpfr_t OP2,
+ mpc_rnd_t RND)
+ -- Function: int mpc_ui_div (mpc_t ROP, unsigned long int OP1, mpc_t
+ OP2, mpc_rnd_t RND)
+ -- Function: int mpc_fr_div (mpc_t ROP, mpfr_t OP1, mpc_t OP2,
+ mpc_rnd_t RND)
+ Set ROP to OP1/OP2 rounded according to RND.
+
+ -- Function: int mpc_conj (mpc_t ROP, mpc_t OP, mpc_rnd_t RND)
+ Set ROP to the conjugate of OP rounded according to RND. Just
+ changes the sign of the imaginary part if ROP and OP are the same
+ variable.
+
+ -- Function: int mpc_abs (mpfr_t ROP, mpc_t OP, mpfr_rnd_t RND)
+ Set the floating-point number ROP to the absolute value of OP,
+ rounded in the direction RND.
+
+ -- Function: int mpc_norm (mpfr_t ROP, mpc_t OP, mpfr_rnd_t RND)
+ Set the floating-point number ROP to the norm of OP (i.e., the
+ square of its absolute value), rounded in the direction RND.
+
+ -- Function: int mpc_mul_2ui (mpc_t ROP, mpc_t OP1, unsigned long int
+ OP2, mpc_rnd_t RND)
+ -- Function: int mpc_mul_2si (mpc_t ROP, mpc_t OP1, long int OP2,
+ mpc_rnd_t RND)
+ Set ROP to OP1 times 2 raised to OP2 rounded according to RND.
+ Just modifies the exponents of the real and imaginary parts by OP2
+ when ROP and OP1 are identical.
+
+ -- Function: int mpc_div_2ui (mpc_t ROP, mpc_t OP1, unsigned long int
+ OP2, mpc_rnd_t RND)
+ -- Function: int mpc_div_2si (mpc_t ROP, mpc_t OP1, long int OP2,
+ mpc_rnd_t RND)
+ Set ROP to OP1 divided by 2 raised to OP2 rounded according to RND.
+ Just modifies the exponents of the real and imaginary parts by OP2
+ when ROP and OP1 are identical.
+
+
+File: mpc.info, Node: Power Functions and Logarithm, Next: Trigonometric Functions, Prev: Basic Arithmetic, Up: Complex Functions
+
+5.8 Power Functions and Logarithm
+=================================
+
+ -- Function: int mpc_sqrt (mpc_t ROP, mpc_t OP, mpc_rnd_t RND)
+ Set ROP to the square root of OP rounded according to RND. The
+ returned value ROP has a non-negative real part, and if its real
+ part is zero, a non-negative imaginary part.
+
+ -- Function: int mpc_pow (mpc_t ROP, mpc_t OP1, mpc_t OP2, mpc_rnd_t
+ RND)
+ -- Function: int mpc_pow_d (mpc_t ROP, mpc_t OP1, double OP2, mpc_rnd_t
+ RND)
+ -- Function: int mpc_pow_ld (mpc_t ROP, mpc_t OP1, long double OP2,
+ mpc_rnd_t RND)
+ -- Function: int mpc_pow_si (mpc_t ROP, mpc_t OP1, long OP2, mpc_rnd_t
+ RND)
+ -- Function: int mpc_pow_ui (mpc_t ROP, mpc_t OP1, unsigned long OP2,
+ mpc_rnd_t RND)
+ -- Function: int mpc_pow_z (mpc_t ROP, mpc_t OP1, mpz_t OP2, mpc_rnd_t
+ RND)
+ -- Function: int mpc_pow_fr (mpc_t ROP, mpc_t OP1, mpfr_t OP2,
+ mpc_rnd_t RND)
+ Set ROP to OP1 raised to the power OP2, rounded according to RND.
+ For 'mpc_pow_d', 'mpc_pow_ld', 'mpc_pow_si', 'mpc_pow_ui',
+ 'mpc_pow_z' and 'mpc_pow_fr', the imaginary part of OP2 is
+ considered as +0. When both OP1 and OP2 are zero, the result has
+ real part 1, and imaginary part 0, with sign being the opposite of
+ that of OP2.
+
+ -- Function: int mpc_exp (mpc_t ROP, mpc_t OP, mpc_rnd_t RND)
+ Set ROP to the exponential of OP, rounded according to RND with the
+ precision of ROP.
+
+ -- Function: int mpc_log (mpc_t ROP, mpc_t OP, mpc_rnd_t RND)
+ -- Function: int mpc_log10 (mpc_t ROP, mpc_t OP, mpc_rnd_t RND)
+ Set ROP to the natural and base-10 logarithm of OP respectively,
+ rounded according to RND with the precision of ROP. The principal
+ branch is chosen, with the branch cut on the negative real axis, so
+ that the imaginary part of the result lies in ]-Pi , Pi] and
+ ]-Pi/log(10) , Pi/log(10)] respectively.
+
+ -- Function: int mpc_rootofunity (mpc_t ROP, unsigned long int N,
+ unsigned long int K, mpc_rnd_t RND)
+ Set ROP to the standard primitive N-th root of unity raised to the
+ power K, that is, exp (2 Pi i k / n), rounded according to RND with
+ the precision of ROP.
+
+
+File: mpc.info, Node: Trigonometric Functions, Next: Miscellaneous Complex Functions, Prev: Power Functions and Logarithm, Up: Complex Functions
+
+5.9 Trigonometric Functions
+===========================
+
+ -- Function: int mpc_sin (mpc_t ROP, mpc_t OP, mpc_rnd_t RND)
+ Set ROP to the sine of OP, rounded according to RND with the
+ precision of ROP.
+
+ -- Function: int mpc_cos (mpc_t ROP, mpc_t OP, mpc_rnd_t RND)
+ Set ROP to the cosine of OP, rounded according to RND with the
+ precision of ROP.
+
+ -- Function: int mpc_sin_cos (mpc_t ROP_SIN, mpc_t ROP_COS, mpc_t OP,
+ mpc_rnd_t RND_SIN, mpc_rnd_t RND_COS)
+ Set ROP_SIN to the sine of OP, rounded according to RND_SIN with
+ the precision of ROP_SIN, and ROP_COS to the cosine of OP, rounded
+ according to RND_COS with the precision of ROP_COS.
+
+ -- Function: int mpc_tan (mpc_t ROP, mpc_t OP, mpc_rnd_t RND)
+ Set ROP to the tangent of OP, rounded according to RND with the
+ precision of ROP.
+
+ -- Function: int mpc_sinh (mpc_t ROP, mpc_t OP, mpc_rnd_t RND)
+ Set ROP to the hyperbolic sine of OP, rounded according to RND with
+ the precision of ROP.
+
+ -- Function: int mpc_cosh (mpc_t ROP, mpc_t OP, mpc_rnd_t RND)
+ Set ROP to the hyperbolic cosine of OP, rounded according to RND
+ with the precision of ROP.
+
+ -- Function: int mpc_tanh (mpc_t ROP, mpc_t OP, mpc_rnd_t RND)
+ Set ROP to the hyperbolic tangent of OP, rounded according to RND
+ with the precision of ROP.
+
+ -- Function: int mpc_asin (mpc_t ROP, mpc_t OP, mpc_rnd_t RND)
+ -- Function: int mpc_acos (mpc_t ROP, mpc_t OP, mpc_rnd_t RND)
+ -- Function: int mpc_atan (mpc_t ROP, mpc_t OP, mpc_rnd_t RND)
+ Set ROP to the inverse sine, inverse cosine, inverse tangent of OP,
+ rounded according to RND with the precision of ROP.
+
+ -- Function: int mpc_asinh (mpc_t ROP, mpc_t OP, mpc_rnd_t RND)
+ -- Function: int mpc_acosh (mpc_t ROP, mpc_t OP, mpc_rnd_t RND)
+ -- Function: int mpc_atanh (mpc_t ROP, mpc_t OP, mpc_rnd_t RND)
+ Set ROP to the inverse hyperbolic sine, inverse hyperbolic cosine,
+ inverse hyperbolic tangent of OP, rounded according to RND with the
+ precision of ROP. The branch cut of MPC_ACOSH is (-Inf, 1)
+
+
+File: mpc.info, Node: Miscellaneous Complex Functions, Next: Advanced Functions, Prev: Trigonometric Functions, Up: Complex Functions
+
+5.10 Miscellaneous Functions
+============================
+
+ -- Function: int mpc_urandom (mpc_t ROP, gmp_randstate_t STATE)
+ Generate a uniformly distributed random complex in the unit square
+ [0, 1] x [0, 1]. Return 0, unless an exponent in the real or
+ imaginary part is not in the current exponent range, in which case
+ that part is set to NaN and a zero value is returned. The second
+ argument is a 'gmp_randstate_t' structure which should be created
+ using the GMP 'rand_init' function, see the GMP manual.
+
+ -- Function: const char * mpc_get_version (void)
+ Return the GNU MPC version, as a null-terminated string.
+
+ -- Macro: MPC_VERSION
+ -- Macro: MPC_VERSION_MAJOR
+ -- Macro: MPC_VERSION_MINOR
+ -- Macro: MPC_VERSION_PATCHLEVEL
+ -- Macro: MPC_VERSION_STRING
+ 'MPC_VERSION' is the version of GNU MPC as a preprocessing
+ constant. 'MPC_VERSION_MAJOR', 'MPC_VERSION_MINOR' and
+ 'MPC_VERSION_PATCHLEVEL' are respectively the major, minor and
+ patch level of GNU MPC version, as preprocessing constants.
+ 'MPC_VERSION_STRING' is the version as a string constant, which can
+ be compared to the result of 'mpc_get_version' to check at run time
+ the header file and library used match:
+ if (strcmp (mpc_get_version (), MPC_VERSION_STRING))
+ fprintf (stderr, "Warning: header and library do not match\n");
+ Note: Obtaining different strings is not necessarily an error, as
+ in general, a program compiled with some old GNU MPC version can be
+ dynamically linked with a newer GNU MPC library version (if allowed
+ by the library versioning system).
+
+ -- Macro: long MPC_VERSION_NUM (MAJOR, MINOR, PATCHLEVEL)
+ Create an integer in the same format as used by 'MPC_VERSION' from
+ the given MAJOR, MINOR and PATCHLEVEL. Here is an example of how
+ to check the GNU MPC version at compile time:
+ #if (!defined(MPC_VERSION) || (MPC_VERSION.
+
+ * Guillaume Hanrot, Vincent Lefèvre, Patrick Pélissier, Paul
+ Zimmermann et al. 'mpfr' - A library for multiple-precision
+ floating-point computations with exact rounding. Version 2.4.1,
+ .
+
+ * IEEE standard for binary floating-point arithmetic, Technical
+ Report ANSI-IEEE Standard 754-1985, New York, 1985. Approved March
+ 21, 1985: IEEE Standards Board; approved July 26, 1985: American
+ National Standards Institute, 18 pages.
+
+ * Donald E. Knuth, "The Art of Computer Programming", vol 2,
+ "Seminumerical Algorithms", 2nd edition, Addison-Wesley, 1981.
+
+ * ISO/IEC 9899:1999, Programming languages — C.
+
+
+File: mpc.info, Node: Concept Index, Next: Function Index, Prev: References, Up: Top
+
+Concept Index
+*************
+
+ [index ]
+* Menu:
+
+* Arithmetic functions: Basic Arithmetic. (line 6)
+* Comparison functions: Complex Comparison. (line 6)
+* Complex arithmetic functions: Basic Arithmetic. (line 6)
+* Complex assignment functions: Assigning Complex Numbers.
+ (line 6)
+* Complex comparisons functions: Complex Comparison. (line 6)
+* Complex functions: Complex Functions. (line 6)
+* Complex number: GNU MPC Basics. (line 15)
+* Conditions for copying GNU MPC: Copying. (line 6)
+* Conversion functions: Converting Complex Numbers.
+ (line 6)
+* Copying conditions: Copying. (line 6)
+* Installation: Installing GNU MPC. (line 6)
+* Logarithm: Power Functions and Logarithm.
+ (line 6)
+* Miscellaneous complex functions: Miscellaneous Complex Functions.
+ (line 6)
+* mpc.h: GNU MPC Basics. (line 6)
+* Power functions: Power Functions and Logarithm.
+ (line 6)
+* Precision: GNU MPC Basics. (line 19)
+* Projection and Decomposing Functions: Projection & Decomposing.
+ (line 6)
+* Reporting bugs: Reporting Bugs. (line 6)
+* Rounding Mode: GNU MPC Basics. (line 24)
+* String and stream input and output: String and Stream Input and Output.
+ (line 6)
+* Trigonometric functions: Trigonometric Functions.
+ (line 6)
+* User-defined precision: Complex Functions. (line 12)
+
+
+File: mpc.info, Node: Function Index, Next: GNU Free Documentation License, Prev: Concept Index, Up: Top
+
+Function Index
+**************
+
+ [index ]
+* Menu:
+
+* _Complex: Converting Complex Numbers.
+ (line 9)
+* mpc_abs: Basic Arithmetic. (line 91)
+* mpc_acos: Trigonometric Functions.
+ (line 37)
+* mpc_acosh: Trigonometric Functions.
+ (line 43)
+* mpc_add: Basic Arithmetic. (line 11)
+* mpc_add_fr: Basic Arithmetic. (line 15)
+* mpc_add_ui: Basic Arithmetic. (line 13)
+* mpc_arg: Projection & Decomposing.
+ (line 20)
+* mpc_asin: Trigonometric Functions.
+ (line 36)
+* mpc_asinh: Trigonometric Functions.
+ (line 42)
+* mpc_atan: Trigonometric Functions.
+ (line 38)
+* mpc_atanh: Trigonometric Functions.
+ (line 44)
+* mpc_clear: Initializing Complex Numbers.
+ (line 21)
+* mpc_cmp: Complex Comparison. (line 6)
+* mpc_cmp_abs: Complex Comparison. (line 23)
+* mpc_cmp_si: Complex Comparison. (line 9)
+* mpc_cmp_si_si: Complex Comparison. (line 7)
+* mpc_conj: Basic Arithmetic. (line 86)
+* mpc_cos: Trigonometric Functions.
+ (line 10)
+* mpc_cosh: Trigonometric Functions.
+ (line 28)
+* mpc_div: Basic Arithmetic. (line 74)
+* mpc_div_2si: Basic Arithmetic. (line 109)
+* mpc_div_2ui: Basic Arithmetic. (line 107)
+* mpc_div_fr: Basic Arithmetic. (line 78)
+* mpc_div_ui: Basic Arithmetic. (line 76)
+* mpc_dot: Basic Arithmetic. (line 69)
+* mpc_exp: Power Functions and Logarithm.
+ (line 32)
+* mpc_fma: Basic Arithmetic. (line 64)
+* mpc_free_str: String and Stream Input and Output.
+ (line 66)
+* mpc_fr_div: Basic Arithmetic. (line 82)
+* mpc_fr_sub: Basic Arithmetic. (line 23)
+* mpc_get_ldc: Converting Complex Numbers.
+ (line 10)
+* mpc_get_prec: Initializing Complex Numbers.
+ (line 49)
+* mpc_get_prec2: Initializing Complex Numbers.
+ (line 53)
+* mpc_get_str: String and Stream Input and Output.
+ (line 48)
+* mpc_get_version: Miscellaneous Complex Functions.
+ (line 14)
+* mpc_imag: Projection & Decomposing.
+ (line 10)
+* mpc_imagref: Projection & Decomposing.
+ (line 15)
+* mpc_init2: Initializing Complex Numbers.
+ (line 10)
+* mpc_init3: Initializing Complex Numbers.
+ (line 15)
+* mpc_inp_str: String and Stream Input and Output.
+ (line 74)
+* mpc_log: Power Functions and Logarithm.
+ (line 36)
+* mpc_log10: Power Functions and Logarithm.
+ (line 37)
+* mpc_mul: Basic Arithmetic. (line 43)
+* mpc_mul_2si: Basic Arithmetic. (line 101)
+* mpc_mul_2ui: Basic Arithmetic. (line 99)
+* mpc_mul_fr: Basic Arithmetic. (line 49)
+* mpc_mul_i: Basic Arithmetic. (line 55)
+* mpc_mul_si: Basic Arithmetic. (line 47)
+* mpc_mul_ui: Basic Arithmetic. (line 45)
+* mpc_neg: Basic Arithmetic. (line 34)
+* mpc_norm: Basic Arithmetic. (line 95)
+* mpc_out_str: String and Stream Input and Output.
+ (line 109)
+* mpc_pow: Power Functions and Logarithm.
+ (line 11)
+* mpc_pow_d: Power Functions and Logarithm.
+ (line 13)
+* mpc_pow_fr: Power Functions and Logarithm.
+ (line 23)
+* mpc_pow_ld: Power Functions and Logarithm.
+ (line 15)
+* mpc_pow_si: Power Functions and Logarithm.
+ (line 17)
+* mpc_pow_ui: Power Functions and Logarithm.
+ (line 19)
+* mpc_pow_z: Power Functions and Logarithm.
+ (line 21)
+* mpc_proj: Projection & Decomposing.
+ (line 24)
+* mpc_real: Projection & Decomposing.
+ (line 6)
+* mpc_realref: Projection & Decomposing.
+ (line 14)
+* mpc_rnd_t: GNU MPC Basics. (line 24)
+* mpc_rootofunity: Power Functions and Logarithm.
+ (line 44)
+* mpc_set: Assigning Complex Numbers.
+ (line 16)
+* mpc_set_d: Assigning Complex Numbers.
+ (line 25)
+* mpc_set_dc: Assigning Complex Numbers.
+ (line 27)
+* mpc_set_d_d: Assigning Complex Numbers.
+ (line 54)
+* mpc_set_f: Assigning Complex Numbers.
+ (line 33)
+* mpc_set_fr: Assigning Complex Numbers.
+ (line 34)
+* mpc_set_fr_fr: Assigning Complex Numbers.
+ (line 64)
+* mpc_set_f_f: Assigning Complex Numbers.
+ (line 62)
+* mpc_set_ld: Assigning Complex Numbers.
+ (line 26)
+* mpc_set_ldc: Assigning Complex Numbers.
+ (line 29)
+* mpc_set_ld_ld: Assigning Complex Numbers.
+ (line 56)
+* mpc_set_nan: Assigning Complex Numbers.
+ (line 79)
+* mpc_set_prec: Initializing Complex Numbers.
+ (line 41)
+* mpc_set_q: Assigning Complex Numbers.
+ (line 32)
+* mpc_set_q_q: Assigning Complex Numbers.
+ (line 60)
+* mpc_set_si: Assigning Complex Numbers.
+ (line 22)
+* mpc_set_si_si: Assigning Complex Numbers.
+ (line 48)
+* mpc_set_sj: Assigning Complex Numbers.
+ (line 24)
+* mpc_set_sj_sj: Assigning Complex Numbers.
+ (line 52)
+* mpc_set_str: String and Stream Input and Output.
+ (line 35)
+* mpc_set_ui: Assigning Complex Numbers.
+ (line 20)
+* mpc_set_ui_ui: Assigning Complex Numbers.
+ (line 46)
+* mpc_set_uj: Assigning Complex Numbers.
+ (line 23)
+* mpc_set_uj_uj: Assigning Complex Numbers.
+ (line 50)
+* MPC_SET_X_Y: Advanced Functions. (line 6)
+* mpc_set_z: Assigning Complex Numbers.
+ (line 31)
+* mpc_set_z_z: Assigning Complex Numbers.
+ (line 58)
+* mpc_sin: Trigonometric Functions.
+ (line 6)
+* mpc_sinh: Trigonometric Functions.
+ (line 24)
+* mpc_sin_cos: Trigonometric Functions.
+ (line 14)
+* mpc_sqr: Basic Arithmetic. (line 61)
+* mpc_sqrt: Power Functions and Logarithm.
+ (line 6)
+* mpc_strtoc: String and Stream Input and Output.
+ (line 6)
+* mpc_sub: Basic Arithmetic. (line 19)
+* mpc_sub_fr: Basic Arithmetic. (line 21)
+* mpc_sub_ui: Basic Arithmetic. (line 25)
+* mpc_sum: Basic Arithmetic. (line 38)
+* mpc_swap: Assigning Complex Numbers.
+ (line 82)
+* mpc_t: GNU MPC Basics. (line 15)
+* mpc_tan: Trigonometric Functions.
+ (line 20)
+* mpc_tanh: Trigonometric Functions.
+ (line 32)
+* mpc_ui_div: Basic Arithmetic. (line 80)
+* mpc_ui_sub: Basic Arithmetic. (line 27)
+* mpc_ui_ui_sub: Basic Arithmetic. (line 29)
+* mpc_urandom: Miscellaneous Complex Functions.
+ (line 6)
+* MPC_VERSION: Miscellaneous Complex Functions.
+ (line 17)
+* MPC_VERSION_MAJOR: Miscellaneous Complex Functions.
+ (line 18)
+* MPC_VERSION_MINOR: Miscellaneous Complex Functions.
+ (line 19)
+* MPC_VERSION_NUM: Miscellaneous Complex Functions.
+ (line 36)
+* MPC_VERSION_PATCHLEVEL: Miscellaneous Complex Functions.
+ (line 20)
+* MPC_VERSION_STRING: Miscellaneous Complex Functions.
+ (line 21)
+* mpfr_prec_t: GNU MPC Basics. (line 19)
+
+
+File: mpc.info, Node: GNU Free Documentation License, Prev: Function Index, Up: Top
+
+Appendix A GNU Free Documentation License
+*****************************************
+
+ Version 1.3, 3 November 2008
+
+ Copyright (C) 2000, 2001, 2002, 2007, 2008 Free Software Foundation, Inc.
+
+
+ Everyone is permitted to copy and distribute verbatim copies
+ of this license document, but changing it is not allowed.
+
+ 0. PREAMBLE
+
+ The purpose of this License is to make a manual, textbook, or other
+ functional and useful document "free" in the sense of freedom: to
+ assure everyone the effective freedom to copy and redistribute it,
+ with or without modifying it, either commercially or
+ noncommercially. Secondarily, this License preserves for the
+ author and publisher a way to get credit for their work, while not
+ being considered responsible for modifications made by others.
+
+ This License is a kind of "copyleft", which means that derivative
+ works of the document must themselves be free in the same sense.
+ It complements the GNU General Public License, which is a copyleft
+ license designed for free software.
+
+ We have designed this License in order to use it for manuals for
+ free software, because free software needs free documentation: a
+ free program should come with manuals providing the same freedoms
+ that the software does. But this License is not limited to
+ software manuals; it can be used for any textual work, regardless
+ of subject matter or whether it is published as a printed book. We
+ recommend this License principally for works whose purpose is
+ instruction or reference.
+
+ 1. APPLICABILITY AND DEFINITIONS
+
+ This License applies to any manual or other work, in any medium,
+ that contains a notice placed by the copyright holder saying it can
+ be distributed under the terms of this License. Such a notice
+ grants a world-wide, royalty-free license, unlimited in duration,
+ to use that work under the conditions stated herein. The
+ "Document", below, refers to any such manual or work. Any member
+ of the public is a licensee, and is addressed as "you". You accept
+ the license if you copy, modify or distribute the work in a way
+ requiring permission under copyright law.
+
+ A "Modified Version" of the Document means any work containing the
+ Document or a portion of it, either copied verbatim, or with
+ modifications and/or translated into another language.
+
+ A "Secondary Section" is a named appendix or a front-matter section
+ of the Document that deals exclusively with the relationship of the
+ publishers or authors of the Document to the Document's overall
+ subject (or to related matters) and contains nothing that could
+ fall directly within that overall subject. (Thus, if the Document
+ is in part a textbook of mathematics, a Secondary Section may not
+ explain any mathematics.) The relationship could be a matter of
+ historical connection with the subject or with related matters, or
+ of legal, commercial, philosophical, ethical or political position
+ regarding them.
+
+ The "Invariant Sections" are certain Secondary Sections whose
+ titles are designated, as being those of Invariant Sections, in the
+ notice that says that the Document is released under this License.
+ If a section does not fit the above definition of Secondary then it
+ is not allowed to be designated as Invariant. The Document may
+ contain zero Invariant Sections. If the Document does not identify
+ any Invariant Sections then there are none.
+
+ The "Cover Texts" are certain short passages of text that are
+ listed, as Front-Cover Texts or Back-Cover Texts, in the notice
+ that says that the Document is released under this License. A
+ Front-Cover Text may be at most 5 words, and a Back-Cover Text may
+ be at most 25 words.
+
+ A "Transparent" copy of the Document means a machine-readable copy,
+ represented in a format whose specification is available to the
+ general public, that is suitable for revising the document
+ straightforwardly with generic text editors or (for images composed
+ of pixels) generic paint programs or (for drawings) some widely
+ available drawing editor, and that is suitable for input to text
+ formatters or for automatic translation to a variety of formats
+ suitable for input to text formatters. A copy made in an otherwise
+ Transparent file format whose markup, or absence of markup, has
+ been arranged to thwart or discourage subsequent modification by
+ readers is not Transparent. An image format is not Transparent if
+ used for any substantial amount of text. A copy that is not
+ "Transparent" is called "Opaque".
+
+ Examples of suitable formats for Transparent copies include plain
+ ASCII without markup, Texinfo input format, LaTeX input format,
+ SGML or XML using a publicly available DTD, and standard-conforming
+ simple HTML, PostScript or PDF designed for human modification.
+ Examples of transparent image formats include PNG, XCF and JPG.
+ Opaque formats include proprietary formats that can be read and
+ edited only by proprietary word processors, SGML or XML for which
+ the DTD and/or processing tools are not generally available, and
+ the machine-generated HTML, PostScript or PDF produced by some word
+ processors for output purposes only.
+
+ The "Title Page" means, for a printed book, the title page itself,
+ plus such following pages as are needed to hold, legibly, the
+ material this License requires to appear in the title page. For
+ works in formats which do not have any title page as such, "Title
+ Page" means the text near the most prominent appearance of the
+ work's title, preceding the beginning of the body of the text.
+
+ The "publisher" means any person or entity that distributes copies
+ of the Document to the public.
+
+ A section "Entitled XYZ" means a named subunit of the Document
+ whose title either is precisely XYZ or contains XYZ in parentheses
+ following text that translates XYZ in another language. (Here XYZ
+ stands for a specific section name mentioned below, such as
+ "Acknowledgements", "Dedications", "Endorsements", or "History".)
+ To "Preserve the Title" of such a section when you modify the
+ Document means that it remains a section "Entitled XYZ" according
+ to this definition.
+
+ The Document may include Warranty Disclaimers next to the notice
+ which states that this License applies to the Document. These
+ Warranty Disclaimers are considered to be included by reference in
+ this License, but only as regards disclaiming warranties: any other
+ implication that these Warranty Disclaimers may have is void and
+ has no effect on the meaning of this License.
+
+ 2. VERBATIM COPYING
+
+ You may copy and distribute the Document in any medium, either
+ commercially or noncommercially, provided that this License, the
+ copyright notices, and the license notice saying this License
+ applies to the Document are reproduced in all copies, and that you
+ add no other conditions whatsoever to those of this License. You
+ may not use technical measures to obstruct or control the reading
+ or further copying of the copies you make or distribute. However,
+ you may accept compensation in exchange for copies. If you
+ distribute a large enough number of copies you must also follow the
+ conditions in section 3.
+
+ You may also lend copies, under the same conditions stated above,
+ and you may publicly display copies.
+
+ 3. COPYING IN QUANTITY
+
+ If you publish printed copies (or copies in media that commonly
+ have printed covers) of the Document, numbering more than 100, and
+ the Document's license notice requires Cover Texts, you must
+ enclose the copies in covers that carry, clearly and legibly, all
+ these Cover Texts: Front-Cover Texts on the front cover, and
+ Back-Cover Texts on the back cover. Both covers must also clearly
+ and legibly identify you as the publisher of these copies. The
+ front cover must present the full title with all words of the title
+ equally prominent and visible. You may add other material on the
+ covers in addition. Copying with changes limited to the covers, as
+ long as they preserve the title of the Document and satisfy these
+ conditions, can be treated as verbatim copying in other respects.
+
+ If the required texts for either cover are too voluminous to fit
+ legibly, you should put the first ones listed (as many as fit
+ reasonably) on the actual cover, and continue the rest onto
+ adjacent pages.
+
+ If you publish or distribute Opaque copies of the Document
+ numbering more than 100, you must either include a machine-readable
+ Transparent copy along with each Opaque copy, or state in or with
+ each Opaque copy a computer-network location from which the general
+ network-using public has access to download using public-standard
+ network protocols a complete Transparent copy of the Document, free
+ of added material. If you use the latter option, you must take
+ reasonably prudent steps, when you begin distribution of Opaque
+ copies in quantity, to ensure that this Transparent copy will
+ remain thus accessible at the stated location until at least one
+ year after the last time you distribute an Opaque copy (directly or
+ through your agents or retailers) of that edition to the public.
+
+ It is requested, but not required, that you contact the authors of
+ the Document well before redistributing any large number of copies,
+ to give them a chance to provide you with an updated version of the
+ Document.
+
+ 4. MODIFICATIONS
+
+ You may copy and distribute a Modified Version of the Document
+ under the conditions of sections 2 and 3 above, provided that you
+ release the Modified Version under precisely this License, with the
+ Modified Version filling the role of the Document, thus licensing
+ distribution and modification of the Modified Version to whoever
+ possesses a copy of it. In addition, you must do these things in
+ the Modified Version:
+
+ A. Use in the Title Page (and on the covers, if any) a title
+ distinct from that of the Document, and from those of previous
+ versions (which should, if there were any, be listed in the
+ History section of the Document). You may use the same title
+ as a previous version if the original publisher of that
+ version gives permission.
+
+ B. List on the Title Page, as authors, one or more persons or
+ entities responsible for authorship of the modifications in
+ the Modified Version, together with at least five of the
+ principal authors of the Document (all of its principal
+ authors, if it has fewer than five), unless they release you
+ from this requirement.
+
+ C. State on the Title page the name of the publisher of the
+ Modified Version, as the publisher.
+
+ D. Preserve all the copyright notices of the Document.
+
+ E. Add an appropriate copyright notice for your modifications
+ adjacent to the other copyright notices.
+
+ F. Include, immediately after the copyright notices, a license
+ notice giving the public permission to use the Modified
+ Version under the terms of this License, in the form shown in
+ the Addendum below.
+
+ G. Preserve in that license notice the full lists of Invariant
+ Sections and required Cover Texts given in the Document's
+ license notice.
+
+ H. Include an unaltered copy of this License.
+
+ I. Preserve the section Entitled "History", Preserve its Title,
+ and add to it an item stating at least the title, year, new
+ authors, and publisher of the Modified Version as given on the
+ Title Page. If there is no section Entitled "History" in the
+ Document, create one stating the title, year, authors, and
+ publisher of the Document as given on its Title Page, then add
+ an item describing the Modified Version as stated in the
+ previous sentence.
+
+ J. Preserve the network location, if any, given in the Document
+ for public access to a Transparent copy of the Document, and
+ likewise the network locations given in the Document for
+ previous versions it was based on. These may be placed in the
+ "History" section. You may omit a network location for a work
+ that was published at least four years before the Document
+ itself, or if the original publisher of the version it refers
+ to gives permission.
+
+ K. For any section Entitled "Acknowledgements" or "Dedications",
+ Preserve the Title of the section, and preserve in the section
+ all the substance and tone of each of the contributor
+ acknowledgements and/or dedications given therein.
+
+ L. Preserve all the Invariant Sections of the Document, unaltered
+ in their text and in their titles. Section numbers or the
+ equivalent are not considered part of the section titles.
+
+ M. Delete any section Entitled "Endorsements". Such a section
+ may not be included in the Modified Version.
+
+ N. Do not retitle any existing section to be Entitled
+ "Endorsements" or to conflict in title with any Invariant
+ Section.
+
+ O. Preserve any Warranty Disclaimers.
+
+ If the Modified Version includes new front-matter sections or
+ appendices that qualify as Secondary Sections and contain no
+ material copied from the Document, you may at your option designate
+ some or all of these sections as invariant. To do this, add their
+ titles to the list of Invariant Sections in the Modified Version's
+ license notice. These titles must be distinct from any other
+ section titles.
+
+ You may add a section Entitled "Endorsements", provided it contains
+ nothing but endorsements of your Modified Version by various
+ parties--for example, statements of peer review or that the text
+ has been approved by an organization as the authoritative
+ definition of a standard.
+
+ You may add a passage of up to five words as a Front-Cover Text,
+ and a passage of up to 25 words as a Back-Cover Text, to the end of
+ the list of Cover Texts in the Modified Version. Only one passage
+ of Front-Cover Text and one of Back-Cover Text may be added by (or
+ through arrangements made by) any one entity. If the Document
+ already includes a cover text for the same cover, previously added
+ by you or by arrangement made by the same entity you are acting on
+ behalf of, you may not add another; but you may replace the old
+ one, on explicit permission from the previous publisher that added
+ the old one.
+
+ The author(s) and publisher(s) of the Document do not by this
+ License give permission to use their names for publicity for or to
+ assert or imply endorsement of any Modified Version.
+
+ 5. COMBINING DOCUMENTS
+
+ You may combine the Document with other documents released under
+ this License, under the terms defined in section 4 above for
+ modified versions, provided that you include in the combination all
+ of the Invariant Sections of all of the original documents,
+ unmodified, and list them all as Invariant Sections of your
+ combined work in its license notice, and that you preserve all
+ their Warranty Disclaimers.
+
+ The combined work need only contain one copy of this License, and
+ multiple identical Invariant Sections may be replaced with a single
+ copy. If there are multiple Invariant Sections with the same name
+ but different contents, make the title of each such section unique
+ by adding at the end of it, in parentheses, the name of the
+ original author or publisher of that section if known, or else a
+ unique number. Make the same adjustment to the section titles in
+ the list of Invariant Sections in the license notice of the
+ combined work.
+
+ In the combination, you must combine any sections Entitled
+ "History" in the various original documents, forming one section
+ Entitled "History"; likewise combine any sections Entitled
+ "Acknowledgements", and any sections Entitled "Dedications". You
+ must delete all sections Entitled "Endorsements."
+
+ 6. COLLECTIONS OF DOCUMENTS
+
+ You may make a collection consisting of the Document and other
+ documents released under this License, and replace the individual
+ copies of this License in the various documents with a single copy
+ that is included in the collection, provided that you follow the
+ rules of this License for verbatim copying of each of the documents
+ in all other respects.
+
+ You may extract a single document from such a collection, and
+ distribute it individually under this License, provided you insert
+ a copy of this License into the extracted document, and follow this
+ License in all other respects regarding verbatim copying of that
+ document.
+
+ 7. AGGREGATION WITH INDEPENDENT WORKS
+
+ A compilation of the Document or its derivatives with other
+ separate and independent documents or works, in or on a volume of a
+ storage or distribution medium, is called an "aggregate" if the
+ copyright resulting from the compilation is not used to limit the
+ legal rights of the compilation's users beyond what the individual
+ works permit. When the Document is included in an aggregate, this
+ License does not apply to the other works in the aggregate which
+ are not themselves derivative works of the Document.
+
+ If the Cover Text requirement of section 3 is applicable to these
+ copies of the Document, then if the Document is less than one half
+ of the entire aggregate, the Document's Cover Texts may be placed
+ on covers that bracket the Document within the aggregate, or the
+ electronic equivalent of covers if the Document is in electronic
+ form. Otherwise they must appear on printed covers that bracket
+ the whole aggregate.
+
+ 8. TRANSLATION
+
+ Translation is considered a kind of modification, so you may
+ distribute translations of the Document under the terms of section
+ 4. Replacing Invariant Sections with translations requires special
+ permission from their copyright holders, but you may include
+ translations of some or all Invariant Sections in addition to the
+ original versions of these Invariant Sections. You may include a
+ translation of this License, and all the license notices in the
+ Document, and any Warranty Disclaimers, provided that you also
+ include the original English version of this License and the
+ original versions of those notices and disclaimers. In case of a
+ disagreement between the translation and the original version of
+ this License or a notice or disclaimer, the original version will
+ prevail.
+
+ If a section in the Document is Entitled "Acknowledgements",
+ "Dedications", or "History", the requirement (section 4) to
+ Preserve its Title (section 1) will typically require changing the
+ actual title.
+
+ 9. TERMINATION
+
+ You may not copy, modify, sublicense, or distribute the Document
+ except as expressly provided under this License. Any attempt
+ otherwise to copy, modify, sublicense, or distribute it is void,
+ and will automatically terminate your rights under this License.
+
+ However, if you cease all violation of this License, then your
+ license from a particular copyright holder is reinstated (a)
+ provisionally, unless and until the copyright holder explicitly and
+ finally terminates your license, and (b) permanently, if the
+ copyright holder fails to notify you of the violation by some
+ reasonable means prior to 60 days after the cessation.
+
+ Moreover, your license from a particular copyright holder is
+ reinstated permanently if the copyright holder notifies you of the
+ violation by some reasonable means, this is the first time you have
+ received notice of violation of this License (for any work) from
+ that copyright holder, and you cure the violation prior to 30 days
+ after your receipt of the notice.
+
+ Termination of your rights under this section does not terminate
+ the licenses of parties who have received copies or rights from you
+ under this License. If your rights have been terminated and not
+ permanently reinstated, receipt of a copy of some or all of the
+ same material does not give you any rights to use it.
+
+ 10. FUTURE REVISIONS OF THIS LICENSE
+
+ The Free Software Foundation may publish new, revised versions of
+ the GNU Free Documentation License from time to time. Such new
+ versions will be similar in spirit to the present version, but may
+ differ in detail to address new problems or concerns. See
+ .
+
+ Each version of the License is given a distinguishing version
+ number. If the Document specifies that a particular numbered
+ version of this License "or any later version" applies to it, you
+ have the option of following the terms and conditions either of
+ that specified version or of any later version that has been
+ published (not as a draft) by the Free Software Foundation. If the
+ Document does not specify a version number of this License, you may
+ choose any version ever published (not as a draft) by the Free
+ Software Foundation. If the Document specifies that a proxy can
+ decide which future versions of this License can be used, that
+ proxy's public statement of acceptance of a version permanently
+ authorizes you to choose that version for the Document.
+
+ 11. RELICENSING
+
+ "Massive Multiauthor Collaboration Site" (or "MMC Site") means any
+ World Wide Web server that publishes copyrightable works and also
+ provides prominent facilities for anybody to edit those works. A
+ public wiki that anybody can edit is an example of such a server.
+ A "Massive Multiauthor Collaboration" (or "MMC") contained in the
+ site means any set of copyrightable works thus published on the MMC
+ site.
+
+ "CC-BY-SA" means the Creative Commons Attribution-Share Alike 3.0
+ license published by Creative Commons Corporation, a not-for-profit
+ corporation with a principal place of business in San Francisco,
+ California, as well as future copyleft versions of that license
+ published by that same organization.
+
+ "Incorporate" means to publish or republish a Document, in whole or
+ in part, as part of another Document.
+
+ An MMC is "eligible for relicensing" if it is licensed under this
+ License, and if all works that were first published under this
+ License somewhere other than this MMC, and subsequently
+ incorporated in whole or in part into the MMC, (1) had no cover
+ texts or invariant sections, and (2) were thus incorporated prior
+ to November 1, 2008.
+
+ The operator of an MMC Site may republish an MMC contained in the
+ site under CC-BY-SA on the same site at any time before August 1,
+ 2009, provided the MMC is eligible for relicensing.
+
+ADDENDUM: How to use this License for your documents
+====================================================
+
+To use this License in a document you have written, include a copy of
+the License in the document and put the following copyright and license
+notices just after the title page:
+
+ Copyright (C) YEAR YOUR NAME.
+ Permission is granted to copy, distribute and/or modify this document
+ under the terms of the GNU Free Documentation License, Version 1.3
+ or any later version published by the Free Software Foundation;
+ with no Invariant Sections, no Front-Cover Texts, and no Back-Cover
+ Texts. A copy of the license is included in the section entitled ``GNU
+ Free Documentation License''.
+
+ If you have Invariant Sections, Front-Cover Texts and Back-Cover
+Texts, replace the "with...Texts." line with this:
+
+ with the Invariant Sections being LIST THEIR TITLES, with
+ the Front-Cover Texts being LIST, and with the Back-Cover Texts
+ being LIST.
+
+ If you have Invariant Sections without Cover Texts, or some other
+combination of the three, merge those two alternatives to suit the
+situation.
+
+ If your document contains nontrivial examples of program code, we
+recommend releasing these examples in parallel under your choice of free
+software license, such as the GNU General Public License, to permit
+their use in free software.
+
+
+
+Tag Table:
+Node: Top758
+Node: Copying1465
+Node: Introduction to GNU MPC2237
+Node: Installing GNU MPC2956
+Node: Reporting Bugs8041
+Node: GNU MPC Basics9385
+Ref: return-value13062
+Node: Complex Functions14513
+Node: Initializing Complex Numbers15673
+Node: Assigning Complex Numbers18060
+Node: Converting Complex Numbers22460
+Node: String and Stream Input and Output23085
+Node: Complex Comparison29641
+Node: Projection & Decomposing31154
+Node: Basic Arithmetic32531
+Node: Power Functions and Logarithm37531
+Node: Trigonometric Functions39880
+Node: Miscellaneous Complex Functions42101
+Node: Advanced Functions44277
+Node: Internals45350
+Node: References45801
+Node: Concept Index46704
+Node: Function Index49018
+Node: GNU Free Documentation License63166
+
+End Tag Table
+
+
+Local Variables:
+coding: utf-8
+End:
diff --git a/gcc/mpc/doc/mpc.texi b/gcc/mpc/doc/mpc.texi
index 44252bdfa6..d25b1c4086 100644
--- a/gcc/mpc/doc/mpc.texi
+++ b/gcc/mpc/doc/mpc.texi
@@ -5,7 +5,7 @@
@synindex tp fn
@set MINGMP 5.0.0
-@set MINMPFR 3.0.0
+@set MINMPFR 4.1.0
@set AUTHORS Andreas Enge, Philippe Th@'eveny, Paul Zimmermann
@@ -13,7 +13,7 @@
This manual is for GNU MPC, a library for multiple precision complex arithmetic,
version @value{VERSION} of @value{UPDATED-MONTH}.
-Copyright @copyright{} 2002, 2003, 2004, 2005, 2006, 2007, 2008, 2009, 2010, 2011, 2012, 2013, 2016 INRIA
+Copyright @copyright{} 2002, 2003, 2004, 2005, 2006, 2007, 2008, 2009, 2010, 2011, 2012, 2013, 2016, 2018, 2020 INRIA
@quotation
Permission is granted to copy, distribute and/or modify this document
@@ -79,6 +79,20 @@ x
@end macro
@end ifnottex
+@c @m{T,N} is $T$ in tex or @math{N} otherwise. This is an easy way to give
+@c different forms for math in tex and info. Commas in N or T don't work,
+@c but @C{} can be used instead. \, works in info but not in tex.
+@c (copied from mpfr.texi)
+@iftex
+@macro m {T,N}
+@tex$\T\$@end tex
+@end macro
+@end iftex
+@ifnottex
+@macro m {T,N}
+@math{\N\}
+@end macro
+@end ifnottex
@node Copying
@unnumbered GNU MPC Copying Conditions
@@ -874,6 +888,11 @@ Set @var{rop} to @minus{}@var{op} rounded according to @var{rnd}.
Just changes the sign if @var{rop} and @var{op} are the same variable.
@end deftypefun
+@deftypefun int mpc_sum (mpc_t @var{rop}, mpc_ptr* @var{op}, unsigned long @var{n}, mpc_rnd_t @var{rnd})
+Set @var{rop} to the sum of the elements in the array @var{op} of
+length @var{n}, rounded according to @var{rnd}.
+@end deftypefun
+
@deftypefun int mpc_mul (mpc_t @var{rop}, mpc_t @var{op1}, mpc_t @var{op2}, mpc_rnd_t @var{rnd})
@deftypefunx int mpc_mul_ui (mpc_t @var{rop}, mpc_t @var{op1}, unsigned long int @var{op2}, mpc_rnd_t @var{rnd})
@deftypefunx int mpc_mul_si (mpc_t @var{rop}, mpc_t @var{op1}, long int @var{op2}, mpc_rnd_t @var{rnd})
@@ -898,6 +917,11 @@ Set @var{rop} to @var{op1}*@var{op2}+@var{op3},
rounded according to @var{rnd}, with only one final rounding.
@end deftypefun
+@deftypefun int mpc_dot (mpc_t @var{rop}, mpc_ptr* @var{op1}, mpc_ptr* @var{op2}, unsigned long @var{n}, mpc_rnd_t @var{rnd})
+Set @var{rop} to the dot product of the elements in the arrays @var{op1} and
+@var{op2}, both of length @var{n}, rounded according to @var{rnd}.
+@end deftypefun
+
@deftypefun int mpc_div (mpc_t @var{rop}, mpc_t @var{op1}, mpc_t @var{op2}, mpc_rnd_t @var{rnd})
@deftypefunx int mpc_div_ui (mpc_t @var{rop}, mpc_t @var{op1}, unsigned long int @var{op2}, mpc_rnd_t @var{rnd})
@deftypefunx int mpc_div_fr (mpc_t @var{rop}, mpc_t @var{op1}, mpfr_t @var{op2}, mpc_rnd_t @var{rnd})
@@ -978,12 +1002,25 @@ Set @var{rop} to the natural and base-10 logarithm of @var{op} respectively,
rounded according to @var{rnd} with the precision of @var{rop}.
The principal branch is chosen, with the branch cut on the negative real axis,
so that the imaginary part of the result lies in
-@math{]-\pi , \pi]} and @math{]-\pi/log(10) , \pi/log(10)]} respectively.
+@iftex
+@math{]-\pi , \pi]}
+@end iftex
+@ifnottex
+]-Pi , Pi]
+@end ifnottex
+and
+@iftex
+@math{]-\pi/\log(10) , \pi/\log(10)]}
+@end iftex
+@ifnottex
+]-Pi/log(10) , Pi/log(10)]
+@end ifnottex
+respectively.
@end deftypefun
@deftypefun int mpc_rootofunity (mpc_t @var{rop}, unsigned long int @var{n}, unsigned long int @var{k}, mpc_rnd_t @var{rnd})
Set @var{rop} to the standard primitive @var{n}-th root of unity raised to the power @var{k}, that is,
-@math{\exp (2 \pi i k / n)},
+@m{\exp (2 \pi i k / n),exp (2 Pi i k / n)},
rounded according to @var{rnd} with the precision of @var{rop}.
@end deftypefun
@@ -1042,7 +1079,13 @@ rounded according to @var{rnd} with the precision of @var{rop}.
Set @var{rop} to the inverse hyperbolic sine, inverse hyperbolic cosine,
inverse hyperbolic tangent of @var{op},
rounded according to @var{rnd} with the precision of @var{rop}.
-The branch cut of @var{mpc_acosh} is @math{(-\infty, 1)}.
+The branch cut of @var{mpc_acosh} is
+@iftex
+@math{(-\infty, 1)}.
+@end iftex
+@ifnottex
+(-Inf, 1)
+@end ifnottex
@end deftypefun
@node Miscellaneous Complex Functions
diff --git a/gcc/mpc/doc/stamp-vti b/gcc/mpc/doc/stamp-vti
index 56a933c5a9..ce864b0d8b 100644
--- a/gcc/mpc/doc/stamp-vti
+++ b/gcc/mpc/doc/stamp-vti
@@ -1,4 +1,4 @@
-@set UPDATED 11 January 2018
-@set UPDATED-MONTH January 2018
-@set EDITION 1.1.0
-@set VERSION 1.1.0
+@set UPDATED 17 August 2020
+@set UPDATED-MONTH August 2020
+@set EDITION 1.2.0
+@set VERSION 1.2.0
diff --git a/gcc/mpc/doc/version.texi b/gcc/mpc/doc/version.texi
index 56a933c5a9..ce864b0d8b 100644
--- a/gcc/mpc/doc/version.texi
+++ b/gcc/mpc/doc/version.texi
@@ -1,4 +1,4 @@
-@set UPDATED 11 January 2018
-@set UPDATED-MONTH January 2018
-@set EDITION 1.1.0
-@set VERSION 1.1.0
+@set UPDATED 17 August 2020
+@set UPDATED-MONTH August 2020
+@set EDITION 1.2.0
+@set VERSION 1.2.0
diff --git a/gcc/mpc/m4/mpc.m4 b/gcc/mpc/m4/mpc.m4
index 7ed4bd3c60..f3c75540b8 100644
--- a/gcc/mpc/m4/mpc.m4
+++ b/gcc/mpc/m4/mpc.m4
@@ -1,6 +1,6 @@
# mpc.m4
#
-# Copyright (C) 2008, 2009, 2010, 2011, 2012, 2014 INRIA
+# Copyright (C) 2008, 2009, 2010, 2011, 2012, 2014, 2018 INRIA
#
# This file is part of GNU MPC.
#
@@ -91,10 +91,6 @@ AC_DEFUN([MPC_C_CHECK_WARNINGCFLAGS], [
AC_REQUIRE([AC_PROG_GREP])
if echo $VERSION | grep -c dev >/dev/null 2>&1 ; then
if test "x$GCC" = "xyes" -a "x$compiler" != "xicc"; then
- # enable -Werror for myself (Andreas Enge)
- if test "x$USER" = "xenge"; then
- MPC_C_CHECK_FLAG(-Werror)
- fi
MPC_C_CHECK_FLAG(-g)
MPC_C_CHECK_FLAG(-std=c99)
MPC_C_CHECK_FLAG(-Wno-long-long)
diff --git a/gcc/mpc/src/Makefile.am b/gcc/mpc/src/Makefile.am
index 97c7a0663d..eb2e4ec327 100644
--- a/gcc/mpc/src/Makefile.am
+++ b/gcc/mpc/src/Makefile.am
@@ -1,6 +1,6 @@
## src/Makefile.am -- Process this file with automake to produce Makefile.in
##
-## Copyright (C) 2008, 2009, 2010, 2011, 2012, 2016 INRIA
+## Copyright (C) 2008, 2009, 2010, 2011, 2012, 2016, 2018, 2020 INRIA
##
## This file is part of GNU MPC.
##
@@ -18,19 +18,19 @@
## along with this program. If not, see http://www.gnu.org/licenses/ .
lib_LTLIBRARIES = libmpc.la
-libmpc_la_LDFLAGS = $(MPC_LDFLAGS) -version-info 4:0:1
+libmpc_la_LDFLAGS = $(MPC_LDFLAGS) -version-info 5:0:2
libmpc_la_SOURCES = mpc-impl.h abs.c acos.c acosh.c add.c add_fr.c \
add_si.c add_ui.c arg.c asin.c asinh.c atan.c atanh.c clear.c \
cmp.c cmp_abs.c cmp_si_si.c conj.c cos.c cosh.c \
- div_2si.c div_2ui.c div.c div_fr.c \
- div_ui.c exp.c fma.c fr_div.c fr_sub.c get_prec2.c get_prec.c \
+ div_2si.c div_2ui.c div.c div_fr.c div_ui.c \
+ dot.c exp.c fma.c fr_div.c fr_sub.c get_prec2.c get_prec.c \
get_version.c get_x.c imag.c init2.c init3.c inp_str.c log.c log10.c \
mem.c mul_2si.c mul_2ui.c mul.c mul_fr.c mul_i.c mul_si.c mul_ui.c \
neg.c norm.c out_str.c pow.c pow_fr.c \
pow_ld.c pow_d.c pow_si.c pow_ui.c pow_z.c proj.c real.c rootofunity.c \
- urandom.c set.c \
+ urandom.c set.c \
set_prec.c set_str.c set_x.c set_x_x.c sin.c sin_cos.c sinh.c sqr.c \
- sqrt.c strtoc.c sub.c sub_fr.c sub_ui.c swap.c tan.c tanh.c uceil_log2.c \
- ui_div.c ui_ui_sub.c
+ sqrt.c strtoc.c sub.c sub_fr.c sub_ui.c sum.c swap.c tan.c tanh.c \
+ uceil_log2.c ui_div.c ui_ui_sub.c
libmpc_la_LIBADD = @LTLIBOBJS@
diff --git a/gcc/mpc/src/Makefile.in b/gcc/mpc/src/Makefile.in
index d91999293a..7286ee5db7 100644
--- a/gcc/mpc/src/Makefile.in
+++ b/gcc/mpc/src/Makefile.in
@@ -1,7 +1,7 @@
-# Makefile.in generated by automake 1.15.1 from Makefile.am.
+# Makefile.in generated by automake 1.16.2 from Makefile.am.
# @configure_input@
-# Copyright (C) 1994-2017 Free Software Foundation, Inc.
+# Copyright (C) 1994-2020 Free Software Foundation, Inc.
# This Makefile.in is free software; the Free Software Foundation
# gives unlimited permission to copy and/or distribute it,
@@ -137,16 +137,16 @@ libmpc_la_DEPENDENCIES = @LTLIBOBJS@
am_libmpc_la_OBJECTS = abs.lo acos.lo acosh.lo add.lo add_fr.lo \
add_si.lo add_ui.lo arg.lo asin.lo asinh.lo atan.lo atanh.lo \
clear.lo cmp.lo cmp_abs.lo cmp_si_si.lo conj.lo cos.lo cosh.lo \
- div_2si.lo div_2ui.lo div.lo div_fr.lo div_ui.lo exp.lo fma.lo \
- fr_div.lo fr_sub.lo get_prec2.lo get_prec.lo get_version.lo \
- get_x.lo imag.lo init2.lo init3.lo inp_str.lo log.lo log10.lo \
- mem.lo mul_2si.lo mul_2ui.lo mul.lo mul_fr.lo mul_i.lo \
- mul_si.lo mul_ui.lo neg.lo norm.lo out_str.lo pow.lo pow_fr.lo \
- pow_ld.lo pow_d.lo pow_si.lo pow_ui.lo pow_z.lo proj.lo \
- real.lo rootofunity.lo urandom.lo set.lo set_prec.lo \
+ div_2si.lo div_2ui.lo div.lo div_fr.lo div_ui.lo dot.lo exp.lo \
+ fma.lo fr_div.lo fr_sub.lo get_prec2.lo get_prec.lo \
+ get_version.lo get_x.lo imag.lo init2.lo init3.lo inp_str.lo \
+ log.lo log10.lo mem.lo mul_2si.lo mul_2ui.lo mul.lo mul_fr.lo \
+ mul_i.lo mul_si.lo mul_ui.lo neg.lo norm.lo out_str.lo pow.lo \
+ pow_fr.lo pow_ld.lo pow_d.lo pow_si.lo pow_ui.lo pow_z.lo \
+ proj.lo real.lo rootofunity.lo urandom.lo set.lo set_prec.lo \
set_str.lo set_x.lo set_x_x.lo sin.lo sin_cos.lo sinh.lo \
- sqr.lo sqrt.lo strtoc.lo sub.lo sub_fr.lo sub_ui.lo swap.lo \
- tan.lo tanh.lo uceil_log2.lo ui_div.lo ui_ui_sub.lo
+ sqr.lo sqrt.lo strtoc.lo sub.lo sub_fr.lo sub_ui.lo sum.lo \
+ swap.lo tan.lo tanh.lo uceil_log2.lo ui_div.lo ui_ui_sub.lo
libmpc_la_OBJECTS = $(am_libmpc_la_OBJECTS)
AM_V_lt = $(am__v_lt_@AM_V@)
am__v_lt_ = $(am__v_lt_@AM_DEFAULT_V@)
@@ -168,8 +168,47 @@ am__v_at_ = $(am__v_at_@AM_DEFAULT_V@)
am__v_at_0 = @
am__v_at_1 =
DEFAULT_INCLUDES = -I.@am__isrc@ -I$(top_builddir)
-depcomp = $(SHELL) $(top_srcdir)/depcomp
-am__depfiles_maybe = depfiles
+depcomp = $(SHELL) $(top_srcdir)/build-aux/depcomp
+am__maybe_remake_depfiles = depfiles
+am__depfiles_remade = $(DEPDIR)/logging.Plo ./$(DEPDIR)/abs.Plo \
+ ./$(DEPDIR)/acos.Plo ./$(DEPDIR)/acosh.Plo ./$(DEPDIR)/add.Plo \
+ ./$(DEPDIR)/add_fr.Plo ./$(DEPDIR)/add_si.Plo \
+ ./$(DEPDIR)/add_ui.Plo ./$(DEPDIR)/arg.Plo \
+ ./$(DEPDIR)/asin.Plo ./$(DEPDIR)/asinh.Plo \
+ ./$(DEPDIR)/atan.Plo ./$(DEPDIR)/atanh.Plo \
+ ./$(DEPDIR)/clear.Plo ./$(DEPDIR)/cmp.Plo \
+ ./$(DEPDIR)/cmp_abs.Plo ./$(DEPDIR)/cmp_si_si.Plo \
+ ./$(DEPDIR)/conj.Plo ./$(DEPDIR)/cos.Plo ./$(DEPDIR)/cosh.Plo \
+ ./$(DEPDIR)/div.Plo ./$(DEPDIR)/div_2si.Plo \
+ ./$(DEPDIR)/div_2ui.Plo ./$(DEPDIR)/div_fr.Plo \
+ ./$(DEPDIR)/div_ui.Plo ./$(DEPDIR)/dot.Plo ./$(DEPDIR)/exp.Plo \
+ ./$(DEPDIR)/fma.Plo ./$(DEPDIR)/fr_div.Plo \
+ ./$(DEPDIR)/fr_sub.Plo ./$(DEPDIR)/get_prec.Plo \
+ ./$(DEPDIR)/get_prec2.Plo ./$(DEPDIR)/get_version.Plo \
+ ./$(DEPDIR)/get_x.Plo ./$(DEPDIR)/imag.Plo \
+ ./$(DEPDIR)/init2.Plo ./$(DEPDIR)/init3.Plo \
+ ./$(DEPDIR)/inp_str.Plo ./$(DEPDIR)/log.Plo \
+ ./$(DEPDIR)/log10.Plo ./$(DEPDIR)/mem.Plo ./$(DEPDIR)/mul.Plo \
+ ./$(DEPDIR)/mul_2si.Plo ./$(DEPDIR)/mul_2ui.Plo \
+ ./$(DEPDIR)/mul_fr.Plo ./$(DEPDIR)/mul_i.Plo \
+ ./$(DEPDIR)/mul_si.Plo ./$(DEPDIR)/mul_ui.Plo \
+ ./$(DEPDIR)/neg.Plo ./$(DEPDIR)/norm.Plo \
+ ./$(DEPDIR)/out_str.Plo ./$(DEPDIR)/pow.Plo \
+ ./$(DEPDIR)/pow_d.Plo ./$(DEPDIR)/pow_fr.Plo \
+ ./$(DEPDIR)/pow_ld.Plo ./$(DEPDIR)/pow_si.Plo \
+ ./$(DEPDIR)/pow_ui.Plo ./$(DEPDIR)/pow_z.Plo \
+ ./$(DEPDIR)/proj.Plo ./$(DEPDIR)/real.Plo \
+ ./$(DEPDIR)/rootofunity.Plo ./$(DEPDIR)/set.Plo \
+ ./$(DEPDIR)/set_prec.Plo ./$(DEPDIR)/set_str.Plo \
+ ./$(DEPDIR)/set_x.Plo ./$(DEPDIR)/set_x_x.Plo \
+ ./$(DEPDIR)/sin.Plo ./$(DEPDIR)/sin_cos.Plo \
+ ./$(DEPDIR)/sinh.Plo ./$(DEPDIR)/sqr.Plo ./$(DEPDIR)/sqrt.Plo \
+ ./$(DEPDIR)/strtoc.Plo ./$(DEPDIR)/sub.Plo \
+ ./$(DEPDIR)/sub_fr.Plo ./$(DEPDIR)/sub_ui.Plo \
+ ./$(DEPDIR)/sum.Plo ./$(DEPDIR)/swap.Plo ./$(DEPDIR)/tan.Plo \
+ ./$(DEPDIR)/tanh.Plo ./$(DEPDIR)/uceil_log2.Plo \
+ ./$(DEPDIR)/ui_div.Plo ./$(DEPDIR)/ui_ui_sub.Plo \
+ ./$(DEPDIR)/urandom.Plo
am__mv = mv -f
COMPILE = $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) \
$(CPPFLAGS) $(AM_CFLAGS) $(CFLAGS)
@@ -215,8 +254,8 @@ am__define_uniq_tagged_files = \
done | $(am__uniquify_input)`
ETAGS = etags
CTAGS = ctags
-am__DIST_COMMON = $(srcdir)/Makefile.in $(top_srcdir)/depcomp \
- logging.c
+am__DIST_COMMON = $(srcdir)/Makefile.in \
+ $(top_srcdir)/build-aux/depcomp logging.c
DISTFILES = $(DIST_COMMON) $(DIST_SOURCES) $(TEXINFOS) $(EXTRA_DIST)
ACLOCAL = @ACLOCAL@
AMTAR = @AMTAR@
@@ -343,20 +382,20 @@ top_build_prefix = @top_build_prefix@
top_builddir = @top_builddir@
top_srcdir = @top_srcdir@
lib_LTLIBRARIES = libmpc.la
-libmpc_la_LDFLAGS = $(MPC_LDFLAGS) -version-info 4:0:1
+libmpc_la_LDFLAGS = $(MPC_LDFLAGS) -version-info 5:0:2
libmpc_la_SOURCES = mpc-impl.h abs.c acos.c acosh.c add.c add_fr.c \
add_si.c add_ui.c arg.c asin.c asinh.c atan.c atanh.c clear.c \
cmp.c cmp_abs.c cmp_si_si.c conj.c cos.c cosh.c \
- div_2si.c div_2ui.c div.c div_fr.c \
- div_ui.c exp.c fma.c fr_div.c fr_sub.c get_prec2.c get_prec.c \
+ div_2si.c div_2ui.c div.c div_fr.c div_ui.c \
+ dot.c exp.c fma.c fr_div.c fr_sub.c get_prec2.c get_prec.c \
get_version.c get_x.c imag.c init2.c init3.c inp_str.c log.c log10.c \
mem.c mul_2si.c mul_2ui.c mul.c mul_fr.c mul_i.c mul_si.c mul_ui.c \
neg.c norm.c out_str.c pow.c pow_fr.c \
pow_ld.c pow_d.c pow_si.c pow_ui.c pow_z.c proj.c real.c rootofunity.c \
- urandom.c set.c \
+ urandom.c set.c \
set_prec.c set_str.c set_x.c set_x_x.c sin.c sin_cos.c sinh.c sqr.c \
- sqrt.c strtoc.c sub.c sub_fr.c sub_ui.c swap.c tan.c tanh.c uceil_log2.c \
- ui_div.c ui_ui_sub.c
+ sqrt.c strtoc.c sub.c sub_fr.c sub_ui.c sum.c swap.c tan.c tanh.c \
+ uceil_log2.c ui_div.c ui_ui_sub.c
libmpc_la_LIBADD = @LTLIBOBJS@
all: all-am
@@ -380,8 +419,8 @@ Makefile: $(srcdir)/Makefile.in $(top_builddir)/config.status
*config.status*) \
cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh;; \
*) \
- echo ' cd $(top_builddir) && $(SHELL) ./config.status $(subdir)/$@ $(am__depfiles_maybe)'; \
- cd $(top_builddir) && $(SHELL) ./config.status $(subdir)/$@ $(am__depfiles_maybe);; \
+ echo ' cd $(top_builddir) && $(SHELL) ./config.status $(subdir)/$@ $(am__maybe_remake_depfiles)'; \
+ cd $(top_builddir) && $(SHELL) ./config.status $(subdir)/$@ $(am__maybe_remake_depfiles);; \
esac;
$(top_builddir)/config.status: $(top_srcdir)/configure $(CONFIG_STATUS_DEPENDENCIES)
@@ -437,87 +476,95 @@ mostlyclean-compile:
distclean-compile:
-rm -f *.tab.c
-@AMDEP_TRUE@@am__include@ @am__quote@$(DEPDIR)/logging.Plo@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/abs.Plo@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/acos.Plo@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/acosh.Plo@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/add.Plo@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/add_fr.Plo@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/add_si.Plo@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/add_ui.Plo@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/arg.Plo@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/asin.Plo@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/asinh.Plo@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/atan.Plo@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/atanh.Plo@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/clear.Plo@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/cmp.Plo@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/cmp_abs.Plo@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/cmp_si_si.Plo@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/conj.Plo@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/cos.Plo@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/cosh.Plo@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/div.Plo@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/div_2si.Plo@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/div_2ui.Plo@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/div_fr.Plo@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/div_ui.Plo@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/exp.Plo@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/fma.Plo@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/fr_div.Plo@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/fr_sub.Plo@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/get_prec.Plo@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/get_prec2.Plo@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/get_version.Plo@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/get_x.Plo@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/imag.Plo@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/init2.Plo@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/init3.Plo@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/inp_str.Plo@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/log.Plo@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/log10.Plo@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/mem.Plo@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/mul.Plo@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/mul_2si.Plo@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/mul_2ui.Plo@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/mul_fr.Plo@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/mul_i.Plo@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/mul_si.Plo@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/mul_ui.Plo@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/neg.Plo@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/norm.Plo@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/out_str.Plo@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/pow.Plo@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/pow_d.Plo@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/pow_fr.Plo@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/pow_ld.Plo@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/pow_si.Plo@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/pow_ui.Plo@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/pow_z.Plo@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/proj.Plo@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/real.Plo@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/rootofunity.Plo@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/set.Plo@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/set_prec.Plo@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/set_str.Plo@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/set_x.Plo@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/set_x_x.Plo@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/sin.Plo@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/sin_cos.Plo@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/sinh.Plo@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/sqr.Plo@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/sqrt.Plo@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/strtoc.Plo@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/sub.Plo@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/sub_fr.Plo@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/sub_ui.Plo@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/swap.Plo@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tan.Plo@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tanh.Plo@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/uceil_log2.Plo@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/ui_div.Plo@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/ui_ui_sub.Plo@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/urandom.Plo@am__quote@
+@AMDEP_TRUE@@am__include@ @am__quote@$(DEPDIR)/logging.Plo@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/abs.Plo@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/acos.Plo@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/acosh.Plo@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/add.Plo@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/add_fr.Plo@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/add_si.Plo@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/add_ui.Plo@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/arg.Plo@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/asin.Plo@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/asinh.Plo@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/atan.Plo@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/atanh.Plo@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/clear.Plo@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/cmp.Plo@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/cmp_abs.Plo@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/cmp_si_si.Plo@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/conj.Plo@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/cos.Plo@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/cosh.Plo@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/div.Plo@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/div_2si.Plo@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/div_2ui.Plo@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/div_fr.Plo@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/div_ui.Plo@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/dot.Plo@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/exp.Plo@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/fma.Plo@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/fr_div.Plo@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/fr_sub.Plo@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/get_prec.Plo@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/get_prec2.Plo@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/get_version.Plo@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/get_x.Plo@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/imag.Plo@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/init2.Plo@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/init3.Plo@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/inp_str.Plo@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/log.Plo@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/log10.Plo@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/mem.Plo@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/mul.Plo@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/mul_2si.Plo@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/mul_2ui.Plo@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/mul_fr.Plo@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/mul_i.Plo@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/mul_si.Plo@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/mul_ui.Plo@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/neg.Plo@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/norm.Plo@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/out_str.Plo@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/pow.Plo@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/pow_d.Plo@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/pow_fr.Plo@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/pow_ld.Plo@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/pow_si.Plo@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/pow_ui.Plo@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/pow_z.Plo@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/proj.Plo@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/real.Plo@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/rootofunity.Plo@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/set.Plo@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/set_prec.Plo@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/set_str.Plo@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/set_x.Plo@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/set_x_x.Plo@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/sin.Plo@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/sin_cos.Plo@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/sinh.Plo@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/sqr.Plo@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/sqrt.Plo@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/strtoc.Plo@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/sub.Plo@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/sub_fr.Plo@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/sub_ui.Plo@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/sum.Plo@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/swap.Plo@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tan.Plo@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tanh.Plo@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/uceil_log2.Plo@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/ui_div.Plo@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/ui_ui_sub.Plo@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/urandom.Plo@am__quote@ # am--include-marker
+
+$(am__depfiles_remade):
+ @$(MKDIR_P) $(@D)
+ @echo '# dummy' >$@-t && $(am__mv) $@-t $@
+
+am--depfiles: $(am__depfiles_remade)
.c.o:
@am__fastdepCC_TRUE@ $(AM_V_CC)$(COMPILE) -MT $@ -MD -MP -MF $(DEPDIR)/$*.Tpo -c -o $@ $<
@@ -598,7 +645,10 @@ cscopelist-am: $(am__tagged_files)
distclean-tags:
-rm -f TAGS ID GTAGS GRTAGS GSYMS GPATH tags
-distdir: $(DISTFILES)
+distdir: $(BUILT_SOURCES)
+ $(MAKE) $(AM_MAKEFLAGS) distdir-am
+
+distdir-am: $(DISTFILES)
@srcdirstrip=`echo "$(srcdir)" | sed 's/[].[^$$\\*]/\\\\&/g'`; \
topsrcdirstrip=`echo "$(top_srcdir)" | sed 's/[].[^$$\\*]/\\\\&/g'`; \
list='$(DISTFILES)'; \
@@ -671,7 +721,89 @@ clean-am: clean-generic clean-libLTLIBRARIES clean-libtool \
mostlyclean-am
distclean: distclean-am
- -rm -rf $(DEPDIR) ./$(DEPDIR)
+ -rm -f $(DEPDIR)/logging.Plo
+ -rm -f ./$(DEPDIR)/abs.Plo
+ -rm -f ./$(DEPDIR)/acos.Plo
+ -rm -f ./$(DEPDIR)/acosh.Plo
+ -rm -f ./$(DEPDIR)/add.Plo
+ -rm -f ./$(DEPDIR)/add_fr.Plo
+ -rm -f ./$(DEPDIR)/add_si.Plo
+ -rm -f ./$(DEPDIR)/add_ui.Plo
+ -rm -f ./$(DEPDIR)/arg.Plo
+ -rm -f ./$(DEPDIR)/asin.Plo
+ -rm -f ./$(DEPDIR)/asinh.Plo
+ -rm -f ./$(DEPDIR)/atan.Plo
+ -rm -f ./$(DEPDIR)/atanh.Plo
+ -rm -f ./$(DEPDIR)/clear.Plo
+ -rm -f ./$(DEPDIR)/cmp.Plo
+ -rm -f ./$(DEPDIR)/cmp_abs.Plo
+ -rm -f ./$(DEPDIR)/cmp_si_si.Plo
+ -rm -f ./$(DEPDIR)/conj.Plo
+ -rm -f ./$(DEPDIR)/cos.Plo
+ -rm -f ./$(DEPDIR)/cosh.Plo
+ -rm -f ./$(DEPDIR)/div.Plo
+ -rm -f ./$(DEPDIR)/div_2si.Plo
+ -rm -f ./$(DEPDIR)/div_2ui.Plo
+ -rm -f ./$(DEPDIR)/div_fr.Plo
+ -rm -f ./$(DEPDIR)/div_ui.Plo
+ -rm -f ./$(DEPDIR)/dot.Plo
+ -rm -f ./$(DEPDIR)/exp.Plo
+ -rm -f ./$(DEPDIR)/fma.Plo
+ -rm -f ./$(DEPDIR)/fr_div.Plo
+ -rm -f ./$(DEPDIR)/fr_sub.Plo
+ -rm -f ./$(DEPDIR)/get_prec.Plo
+ -rm -f ./$(DEPDIR)/get_prec2.Plo
+ -rm -f ./$(DEPDIR)/get_version.Plo
+ -rm -f ./$(DEPDIR)/get_x.Plo
+ -rm -f ./$(DEPDIR)/imag.Plo
+ -rm -f ./$(DEPDIR)/init2.Plo
+ -rm -f ./$(DEPDIR)/init3.Plo
+ -rm -f ./$(DEPDIR)/inp_str.Plo
+ -rm -f ./$(DEPDIR)/log.Plo
+ -rm -f ./$(DEPDIR)/log10.Plo
+ -rm -f ./$(DEPDIR)/mem.Plo
+ -rm -f ./$(DEPDIR)/mul.Plo
+ -rm -f ./$(DEPDIR)/mul_2si.Plo
+ -rm -f ./$(DEPDIR)/mul_2ui.Plo
+ -rm -f ./$(DEPDIR)/mul_fr.Plo
+ -rm -f ./$(DEPDIR)/mul_i.Plo
+ -rm -f ./$(DEPDIR)/mul_si.Plo
+ -rm -f ./$(DEPDIR)/mul_ui.Plo
+ -rm -f ./$(DEPDIR)/neg.Plo
+ -rm -f ./$(DEPDIR)/norm.Plo
+ -rm -f ./$(DEPDIR)/out_str.Plo
+ -rm -f ./$(DEPDIR)/pow.Plo
+ -rm -f ./$(DEPDIR)/pow_d.Plo
+ -rm -f ./$(DEPDIR)/pow_fr.Plo
+ -rm -f ./$(DEPDIR)/pow_ld.Plo
+ -rm -f ./$(DEPDIR)/pow_si.Plo
+ -rm -f ./$(DEPDIR)/pow_ui.Plo
+ -rm -f ./$(DEPDIR)/pow_z.Plo
+ -rm -f ./$(DEPDIR)/proj.Plo
+ -rm -f ./$(DEPDIR)/real.Plo
+ -rm -f ./$(DEPDIR)/rootofunity.Plo
+ -rm -f ./$(DEPDIR)/set.Plo
+ -rm -f ./$(DEPDIR)/set_prec.Plo
+ -rm -f ./$(DEPDIR)/set_str.Plo
+ -rm -f ./$(DEPDIR)/set_x.Plo
+ -rm -f ./$(DEPDIR)/set_x_x.Plo
+ -rm -f ./$(DEPDIR)/sin.Plo
+ -rm -f ./$(DEPDIR)/sin_cos.Plo
+ -rm -f ./$(DEPDIR)/sinh.Plo
+ -rm -f ./$(DEPDIR)/sqr.Plo
+ -rm -f ./$(DEPDIR)/sqrt.Plo
+ -rm -f ./$(DEPDIR)/strtoc.Plo
+ -rm -f ./$(DEPDIR)/sub.Plo
+ -rm -f ./$(DEPDIR)/sub_fr.Plo
+ -rm -f ./$(DEPDIR)/sub_ui.Plo
+ -rm -f ./$(DEPDIR)/sum.Plo
+ -rm -f ./$(DEPDIR)/swap.Plo
+ -rm -f ./$(DEPDIR)/tan.Plo
+ -rm -f ./$(DEPDIR)/tanh.Plo
+ -rm -f ./$(DEPDIR)/uceil_log2.Plo
+ -rm -f ./$(DEPDIR)/ui_div.Plo
+ -rm -f ./$(DEPDIR)/ui_ui_sub.Plo
+ -rm -f ./$(DEPDIR)/urandom.Plo
-rm -f Makefile
distclean-am: clean-am distclean-compile distclean-generic \
distclean-tags
@@ -717,7 +849,89 @@ install-ps-am:
installcheck-am:
maintainer-clean: maintainer-clean-am
- -rm -rf $(DEPDIR) ./$(DEPDIR)
+ -rm -f $(DEPDIR)/logging.Plo
+ -rm -f ./$(DEPDIR)/abs.Plo
+ -rm -f ./$(DEPDIR)/acos.Plo
+ -rm -f ./$(DEPDIR)/acosh.Plo
+ -rm -f ./$(DEPDIR)/add.Plo
+ -rm -f ./$(DEPDIR)/add_fr.Plo
+ -rm -f ./$(DEPDIR)/add_si.Plo
+ -rm -f ./$(DEPDIR)/add_ui.Plo
+ -rm -f ./$(DEPDIR)/arg.Plo
+ -rm -f ./$(DEPDIR)/asin.Plo
+ -rm -f ./$(DEPDIR)/asinh.Plo
+ -rm -f ./$(DEPDIR)/atan.Plo
+ -rm -f ./$(DEPDIR)/atanh.Plo
+ -rm -f ./$(DEPDIR)/clear.Plo
+ -rm -f ./$(DEPDIR)/cmp.Plo
+ -rm -f ./$(DEPDIR)/cmp_abs.Plo
+ -rm -f ./$(DEPDIR)/cmp_si_si.Plo
+ -rm -f ./$(DEPDIR)/conj.Plo
+ -rm -f ./$(DEPDIR)/cos.Plo
+ -rm -f ./$(DEPDIR)/cosh.Plo
+ -rm -f ./$(DEPDIR)/div.Plo
+ -rm -f ./$(DEPDIR)/div_2si.Plo
+ -rm -f ./$(DEPDIR)/div_2ui.Plo
+ -rm -f ./$(DEPDIR)/div_fr.Plo
+ -rm -f ./$(DEPDIR)/div_ui.Plo
+ -rm -f ./$(DEPDIR)/dot.Plo
+ -rm -f ./$(DEPDIR)/exp.Plo
+ -rm -f ./$(DEPDIR)/fma.Plo
+ -rm -f ./$(DEPDIR)/fr_div.Plo
+ -rm -f ./$(DEPDIR)/fr_sub.Plo
+ -rm -f ./$(DEPDIR)/get_prec.Plo
+ -rm -f ./$(DEPDIR)/get_prec2.Plo
+ -rm -f ./$(DEPDIR)/get_version.Plo
+ -rm -f ./$(DEPDIR)/get_x.Plo
+ -rm -f ./$(DEPDIR)/imag.Plo
+ -rm -f ./$(DEPDIR)/init2.Plo
+ -rm -f ./$(DEPDIR)/init3.Plo
+ -rm -f ./$(DEPDIR)/inp_str.Plo
+ -rm -f ./$(DEPDIR)/log.Plo
+ -rm -f ./$(DEPDIR)/log10.Plo
+ -rm -f ./$(DEPDIR)/mem.Plo
+ -rm -f ./$(DEPDIR)/mul.Plo
+ -rm -f ./$(DEPDIR)/mul_2si.Plo
+ -rm -f ./$(DEPDIR)/mul_2ui.Plo
+ -rm -f ./$(DEPDIR)/mul_fr.Plo
+ -rm -f ./$(DEPDIR)/mul_i.Plo
+ -rm -f ./$(DEPDIR)/mul_si.Plo
+ -rm -f ./$(DEPDIR)/mul_ui.Plo
+ -rm -f ./$(DEPDIR)/neg.Plo
+ -rm -f ./$(DEPDIR)/norm.Plo
+ -rm -f ./$(DEPDIR)/out_str.Plo
+ -rm -f ./$(DEPDIR)/pow.Plo
+ -rm -f ./$(DEPDIR)/pow_d.Plo
+ -rm -f ./$(DEPDIR)/pow_fr.Plo
+ -rm -f ./$(DEPDIR)/pow_ld.Plo
+ -rm -f ./$(DEPDIR)/pow_si.Plo
+ -rm -f ./$(DEPDIR)/pow_ui.Plo
+ -rm -f ./$(DEPDIR)/pow_z.Plo
+ -rm -f ./$(DEPDIR)/proj.Plo
+ -rm -f ./$(DEPDIR)/real.Plo
+ -rm -f ./$(DEPDIR)/rootofunity.Plo
+ -rm -f ./$(DEPDIR)/set.Plo
+ -rm -f ./$(DEPDIR)/set_prec.Plo
+ -rm -f ./$(DEPDIR)/set_str.Plo
+ -rm -f ./$(DEPDIR)/set_x.Plo
+ -rm -f ./$(DEPDIR)/set_x_x.Plo
+ -rm -f ./$(DEPDIR)/sin.Plo
+ -rm -f ./$(DEPDIR)/sin_cos.Plo
+ -rm -f ./$(DEPDIR)/sinh.Plo
+ -rm -f ./$(DEPDIR)/sqr.Plo
+ -rm -f ./$(DEPDIR)/sqrt.Plo
+ -rm -f ./$(DEPDIR)/strtoc.Plo
+ -rm -f ./$(DEPDIR)/sub.Plo
+ -rm -f ./$(DEPDIR)/sub_fr.Plo
+ -rm -f ./$(DEPDIR)/sub_ui.Plo
+ -rm -f ./$(DEPDIR)/sum.Plo
+ -rm -f ./$(DEPDIR)/swap.Plo
+ -rm -f ./$(DEPDIR)/tan.Plo
+ -rm -f ./$(DEPDIR)/tanh.Plo
+ -rm -f ./$(DEPDIR)/uceil_log2.Plo
+ -rm -f ./$(DEPDIR)/ui_div.Plo
+ -rm -f ./$(DEPDIR)/ui_ui_sub.Plo
+ -rm -f ./$(DEPDIR)/urandom.Plo
-rm -f Makefile
maintainer-clean-am: distclean-am maintainer-clean-generic
@@ -738,9 +952,9 @@ uninstall-am: uninstall-libLTLIBRARIES
.MAKE: install-am install-strip
-.PHONY: CTAGS GTAGS TAGS all all-am check check-am clean clean-generic \
- clean-libLTLIBRARIES clean-libtool cscopelist-am ctags \
- ctags-am distclean distclean-compile distclean-generic \
+.PHONY: CTAGS GTAGS TAGS all all-am am--depfiles check check-am clean \
+ clean-generic clean-libLTLIBRARIES clean-libtool cscopelist-am \
+ ctags ctags-am distclean distclean-compile distclean-generic \
distclean-libtool distclean-tags distdir dvi dvi-am html \
html-am info info-am install install-am install-data \
install-data-am install-dvi install-dvi-am install-exec \
diff --git a/gcc/mpc/src/acos.c b/gcc/mpc/src/acos.c
index b95387dc4c..b29e146c4b 100644
--- a/gcc/mpc/src/acos.c
+++ b/gcc/mpc/src/acos.c
@@ -1,6 +1,6 @@
/* mpc_acos -- arccosine of a complex number.
-Copyright (C) 2009, 2010, 2011, 2012 INRIA
+Copyright (C) 2009, 2010, 2011, 2012, 2020 INRIA
This file is part of GNU MPC.
@@ -31,6 +31,7 @@ mpc_acos (mpc_ptr rop, mpc_srcptr op, mpc_rnd_t rnd)
mpfr_exp_t e1, e2;
mpfr_rnd_t rnd_im;
mpc_rnd_t rnd1;
+ mpfr_exp_t saved_emin, saved_emax;
inex_re = 0;
inex_im = 0;
@@ -170,6 +171,11 @@ mpc_acos (mpc_ptr rop, mpc_srcptr op, mpc_rnd_t rnd)
return MPC_INEX (inex_re, inex_im);
}
+ saved_emin = mpfr_get_emin ();
+ saved_emax = mpfr_get_emax ();
+ mpfr_set_emin (mpfr_get_emin_min ());
+ mpfr_set_emax (mpfr_get_emax_max ());
+
/* regular complex argument: acos(z) = Pi/2 - asin(z) */
p_re = mpfr_get_prec (mpc_realref(rop));
p_im = mpfr_get_prec (mpc_imagref(rop));
@@ -225,5 +231,11 @@ mpc_acos (mpc_ptr rop, mpc_srcptr op, mpc_rnd_t rnd)
mpc_clear (z1);
mpfr_clear (pi_over_2);
+ /* restore the exponent range, and check the range of results */
+ mpfr_set_emin (saved_emin);
+ mpfr_set_emax (saved_emax);
+ inex_re = mpfr_check_range (mpc_realref (rop), inex_re, MPC_RND_RE (rnd));
+ inex_im = mpfr_check_range (mpc_imagref (rop), inex_im, MPC_RND_IM (rnd));
+
return MPC_INEX(inex_re, inex_im);
}
diff --git a/gcc/mpc/src/asin.c b/gcc/mpc/src/asin.c
index 661c18f722..444275fcd2 100644
--- a/gcc/mpc/src/asin.c
+++ b/gcc/mpc/src/asin.c
@@ -1,6 +1,6 @@
/* mpc_asin -- arcsine of a complex number.
-Copyright (C) 2009, 2010, 2011, 2012, 2013, 2014 INRIA
+Copyright (C) 2009, 2010, 2011, 2012, 2013, 2014, 2020 INRIA
This file is part of GNU MPC.
@@ -80,13 +80,192 @@ mpc_asin_special (mpc_ptr rop, mpc_srcptr op, mpc_rnd_t rnd, mpc_ptr z1)
return 1;
}
+/* Put in s an approximation of asin(z) using:
+ asin z = z + 1/2*z^3/3 + (1*3)/(2*4)*z^5/5 + ...
+ Assume |Re(z)|, |Im(z)| < 1/2.
+ Return non-zero if we can get the correct result by rounding s:
+ mpc_set (rop, s, ...) */
+static int
+mpc_asin_series (mpc_srcptr rop, mpc_ptr s, mpc_srcptr z, mpc_rnd_t rnd)
+{
+ mpc_t w, t;
+ unsigned long k, err, kx, ky;
+ mpfr_prec_t p;
+ mpfr_exp_t ex, ey, e;
+
+ /* assume z = (x,y) with |x|,|y| < 2^(-e) with e >= 1, see the error
+ analysis in algorithms.tex */
+ ex = mpfr_get_exp (mpc_realref (z));
+ MPC_ASSERT(ex <= -1);
+ ey = mpfr_get_exp (mpc_imagref (z));
+ MPC_ASSERT(ey <= -1);
+ e = (ex >= ey) ? ex : ey;
+ e = -e;
+ /* now e >= 1 */
+
+ p = mpfr_get_prec (mpc_realref (s)); /* working precision */
+ MPC_ASSERT(mpfr_get_prec (mpc_imagref (s)) == p);
+
+ mpc_init2 (w, p);
+ mpc_init2 (t, p);
+ mpc_set (s, z, MPC_RNDNN);
+ mpc_sqr (w, z, MPC_RNDNN);
+ mpc_set (t, z, MPC_RNDNN);
+ for (k = 1; ;k++)
+ {
+ mpfr_exp_t exp_x, exp_y;
+ mpc_mul (t, t, w, MPC_RNDNN);
+ mpc_mul_ui (t, t, (2 * k - 1) * (2 * k - 1), MPC_RNDNN);
+ mpc_div_ui (t, t, (2 * k) * (2 * k + 1), MPC_RNDNN);
+ exp_x = mpfr_get_exp (mpc_realref (s));
+ exp_y = mpfr_get_exp (mpc_imagref (s));
+ if (mpfr_get_exp (mpc_realref (t)) < exp_x - p &&
+ mpfr_get_exp (mpc_imagref (t)) < exp_y - p)
+ /* Re(t) < 1/2 ulp(Re(s)) and Im(t) < 1/2 ulp(Im(s)),
+ thus adding t to s will not change s */
+ break;
+ mpc_add (s, s, t, MPC_RNDNN);
+ }
+ mpc_clear (w);
+ mpc_clear (t);
+ /* check (2k-1)^2 is exactly representable */
+ MPC_ASSERT(2 * k - 1 <= ULONG_MAX / (2 * k - 1));
+ /* maximal absolute error on Re(s),Im(s) is:
+ (5k-3)k/2*2^(-1-p) for e=1
+ 5k/2*2^(-e-p) for e >= 2 */
+ if (e == 1)
+ {
+ MPC_ASSERT(5 * k - 3 <= ULONG_MAX / k);
+ kx = (5 * k - 3) * k;
+ }
+ else
+ kx = 5 * k;
+ kx = (kx + 1) / 2; /* takes into account the 1/2 factor in both cases */
+ /* now (5k-3)k/2 <= kx for e=1, and 5k/2 <= kx for e >= 2, thus
+ the maximal absolute error on Re(s),Im(s) is bounded by kx*2^(-e-p) */
+
+ e = -e;
+ ky = kx;
+
+ /* for the real part, convert the maximal absolute error kx*2^(e-p) into
+ relative error */
+ ex = mpfr_get_exp (mpc_realref (s));
+ /* ulp(Re(s)) = 2^(ex+1-p) */
+ if (ex+1 > e) /* divide kx by 2^(ex+1-e) */
+ while (ex+1 > e)
+ {
+ kx = (kx + 1) / 2;
+ ex --;
+ }
+ else /* multiply kx by 2^(e-(ex+1)) */
+ kx <<= e - (ex+1);
+ /* now the rounding error is bounded by kx*ulp(Re(s)), add the
+ mathematical error which is bounded by ulp(Re(s)): the first neglected
+ term is less than 1/2*ulp(Re(s)), and each term decreases by at least
+ a factor 2, since |z^2| <= 1/2. */
+ kx ++;
+ for (err = 0; kx > 2; err ++, kx = (kx + 1) / 2);
+ /* can we round Re(s) with error less than 2^(EXP(Re(s))-err) ? */
+ if (!mpfr_can_round (mpc_realref (s), p - err, MPFR_RNDN, MPFR_RNDZ,
+ mpfr_get_prec (mpc_realref (rop)) +
+ (MPC_RND_RE(rnd) == MPFR_RNDN)))
+ return 0;
+
+ /* same for the imaginary part */
+ ey = mpfr_get_exp (mpc_imagref (s));
+ /* we take for e the exponent of Im(z), which amounts to divide the error by
+ 2^delta where delta is the exponent difference between Re(z) and Im(z)
+ (see algorithms.tex) */
+ e = mpfr_get_exp (mpc_imagref (z));
+ /* ulp(Im(s)) = 2^(ey+1-p) */
+ if (ey+1 > e) /* divide ky by 2^(ey+1-e) */
+ while (ey+1 > e)
+ {
+ ky = (ky + 1) / 2;
+ ey --;
+ }
+ else /* multiply ky by 2^(e-(ey+1)) */
+ ky <<= e - (ey+1);
+ /* now the rounding error is bounded by ky*ulp(Im(s)), add the
+ mathematical error which is bounded by ulp(Im(s)): the first neglected
+ term is less than 1/2*ulp(Im(s)), and each term decreases by at least
+ a factor 2, since |z^2| <= 1/2. */
+ ky ++;
+ for (err = 0; ky > 2; err ++, ky = (ky + 1) / 2);
+ /* can we round Im(s) with error less than 2^(EXP(Im(s))-err) ? */
+ return mpfr_can_round (mpc_imagref (s), p - err, MPFR_RNDN, MPFR_RNDZ,
+ mpfr_get_prec (mpc_imagref (rop)) +
+ (MPC_RND_IM(rnd) == MPFR_RNDN));
+}
+
+/* Put in s an approximation of asin(z) for |Re(z)| < 1 and tiny Im(y)
+ (see algorithms.tex). Assume z = x + i*y:
+ |Re(asin(z)) - asin(x)| <= Pi*beta^2/(1-beta)
+ |Im(asin(z)) - y/sqrt(1-x^2)| <= Pi/2*beta^2/(1-beta)
+ where beta = |y|/(1-|x|).
+ We assume |x| >= 1/2 > |y| here, thus beta < 1, and the bounds
+ simplify to 16y^2.
+ Assume Re(s) and Im(s) have the same precision.
+ Return non-zero if we can get the correct result by rounding s:
+ mpc_set (rop, s, ...) */
+static int
+mpc_asin_tiny (mpc_srcptr rop, mpc_ptr s, mpc_srcptr z, mpc_rnd_t rnd)
+{
+ mpfr_exp_t ey, e1, e2, es;
+ mpfr_prec_t p = mpfr_get_prec (mpc_realref (s)), err;
+
+ ey = mpfr_get_exp (mpc_imagref (z));
+
+ MPC_ASSERT(mpfr_get_exp (mpc_realref (z)) >= 0); /* |x| >= 1/2 */
+ MPC_ASSERT(ey < 0); /* |y| < 1/2 */
+
+ e2 = 2 * ey + 4;
+ /* for |x| >= 0.5, |asin x| >= 0.5, thus no need to compute asin(x)
+ if 16y^2 >= 1/2 ulp(1) for the target variable */
+ if (e2 >= - (mpfr_exp_t) mpfr_get_prec (mpc_realref (rop)))
+ return 0;
+
+ /* real part */
+ mpfr_asin (mpc_realref (s), mpc_realref (z), MPFR_RNDN);
+ /* check that we can round with error < 16y^2 */
+ e1 = mpfr_get_exp (mpc_realref (s)) - p;
+ err = (e1 >= e2) ? 0 : e2 - e1;
+ if (!mpfr_can_round (mpc_realref (s), p - err, MPFR_RNDN, MPFR_RNDZ,
+ mpfr_get_prec (mpc_realref (rop)) +
+ (MPC_RND_RE(rnd) == MPFR_RNDN)))
+ return 0;
+
+ /* now compute the approximate imaginary part y/sqrt(1-x^2) */
+ mpfr_sqr (mpc_imagref (s), mpc_realref (z), MPFR_RNDN);
+ /* now Im(s) approximates x^2, with 1/4 <= Im(s) <= 1 and absolute error
+ less than 2^-p */
+ mpfr_ui_sub (mpc_imagref (s), 1, mpc_imagref (s), MPFR_RNDN);
+ /* now Im(s) approximates 1-x^2, with 0 <= Im(s) <= 3/4, assuming p >= 2,
+ and absolute error less than 2^(1-p) */
+ mpfr_sqrt (mpc_imagref (s), mpc_imagref (s), MPFR_RNDN); /* sqrt(1-x^2) */
+ es = mpfr_get_exp (mpc_imagref (s));
+ /* now Im(s) approximates sqrt(1-x^2), with 0 <= Im(s) <= 7/8,
+ assuming p >= 3, and absolute error less than 2^-p + 2^(1-p)/s
+ <= 3*2^-p/s, thus relative error less than 3*2^-p/s^2.
+ Since |s| >= 2^(es-1), the relative error is less than 3*2^(-p+2-2*es) */
+ mpfr_div (mpc_imagref (s), mpc_imagref (z), mpc_imagref (s), MPFR_RNDN);
+ /* now Im(s) approximates y/sqrt(1-x^2), with relative error less than
+ (3*2^(2-2*es)+2)*2^-p. Since es <= 0, 2-2*es >= 2, thus the relative
+ error is less than 2^(4-2*es-p) */
+ err = 4 - 2 * es;
+ return mpfr_can_round (mpc_imagref (s), p - err, MPFR_RNDN, MPFR_RNDZ,
+ mpfr_get_prec (mpc_imagref (rop)) +
+ (MPC_RND_IM(rnd) == MPFR_RNDN));
+}
+
int
mpc_asin (mpc_ptr rop, mpc_srcptr op, mpc_rnd_t rnd)
{
mpfr_prec_t p, p_re, p_im;
mpfr_rnd_t rnd_re, rnd_im;
mpc_t z1;
- int inex, loop = 0;
+ int inex, inex_re, inex_im, loop = 0;
+ mpfr_exp_t saved_emin, saved_emax, err, olderr;
/* special values */
if (mpfr_nan_p (mpc_realref (op)) || mpfr_nan_p (mpc_imagref (op)))
@@ -112,7 +291,6 @@ mpc_asin (mpc_ptr rop, mpc_srcptr op, mpc_rnd_t rnd)
if (mpfr_inf_p (mpc_realref (op)) || mpfr_inf_p (mpc_imagref (op)))
{
- int inex_re;
if (mpfr_inf_p (mpc_realref (op)))
{
int inf_im = mpfr_inf_p (mpc_imagref (op));
@@ -137,8 +315,6 @@ mpc_asin (mpc_ptr rop, mpc_srcptr op, mpc_rnd_t rnd)
/* pure real argument */
if (mpfr_zero_p (mpc_imagref (op)))
{
- int inex_re;
- int inex_im;
int s_im;
s_im = mpfr_signbit (mpc_imagref (op));
@@ -186,7 +362,6 @@ mpc_asin (mpc_ptr rop, mpc_srcptr op, mpc_rnd_t rnd)
/* pure imaginary argument */
if (mpfr_zero_p (mpc_realref (op)))
{
- int inex_im;
int s;
s = mpfr_signbit (mpc_realref (op));
mpfr_set_ui (mpc_realref (rop), 0, MPFR_RNDN);
@@ -197,6 +372,11 @@ mpc_asin (mpc_ptr rop, mpc_srcptr op, mpc_rnd_t rnd)
return MPC_INEX (0, inex_im);
}
+ saved_emin = mpfr_get_emin ();
+ saved_emax = mpfr_get_emax ();
+ mpfr_set_emin (mpfr_get_emin_min ());
+ mpfr_set_emax (mpfr_get_emax_max ());
+
/* regular complex: asin(z) = -i*log(i*z+sqrt(1-z^2)) */
p_re = mpfr_get_prec (mpc_realref(rop));
p_im = mpfr_get_prec (mpc_imagref(rop));
@@ -204,17 +384,33 @@ mpc_asin (mpc_ptr rop, mpc_srcptr op, mpc_rnd_t rnd)
rnd_im = MPC_RND_IM(rnd);
p = p_re >= p_im ? p_re : p_im;
mpc_init2 (z1, p);
+ olderr = err = 0; /* number of lost bits */
while (1)
{
- mpfr_exp_t ex, ey, err;
+ mpfr_exp_t ex, ey;
loop ++;
+ p += err - olderr; /* add extra number of lost bits in previous loop */
+ olderr = err;
p += (loop <= 2) ? mpc_ceil_log2 (p) + 3 : p / 2;
mpfr_set_prec (mpc_realref(z1), p);
mpfr_set_prec (mpc_imagref(z1), p);
/* try special code for 1+i*y with tiny y */
- if (loop == 1 && mpc_asin_special (rop, op, rnd, z1))
+ if (loop == 1 && mpfr_cmp_ui (mpc_realref(op), 1) == 0 &&
+ mpc_asin_special (rop, op, rnd, z1))
+ break;
+
+ /* try special code for small z */
+ if (mpfr_get_exp (mpc_realref (op)) <= -1 &&
+ mpfr_get_exp (mpc_imagref (op)) <= -1 &&
+ mpc_asin_series (rop, z1, op, rnd))
+ break;
+
+ /* try special code for 1/2 <= |x| < 1 and |y| < 1/2 */
+ if (mpfr_get_exp (mpc_realref (op)) == 0 &&
+ mpfr_get_exp (mpc_imagref (op)) <= -1 &&
+ mpc_asin_tiny (rop, z1, op, rnd))
break;
/* z1 <- z^2 */
@@ -224,6 +420,9 @@ mpc_asin (mpc_ptr rop, mpc_srcptr op, mpc_rnd_t rnd)
ex = mpfr_get_exp (mpc_realref(z1));
mpfr_ui_sub (mpc_realref(z1), 1, mpc_realref(z1), MPFR_RNDN);
mpfr_neg (mpc_imagref(z1), mpc_imagref(z1), MPFR_RNDN);
+ /* if Re(z1) = 0, we can't determine the relative error */
+ if (mpfr_zero_p (mpc_realref(z1)))
+ continue;
ex = ex - mpfr_get_exp (mpc_realref(z1));
ex = (ex <= 0) ? 0 : ex;
/* err(x) <= 2^ex * ulp(x) */
@@ -252,7 +451,7 @@ mpc_asin (mpc_ptr rop, mpc_srcptr op, mpc_rnd_t rnd)
ey = mpfr_get_exp (mpc_imagref(z1));
mpfr_sub (mpc_realref(z1), mpc_realref(z1), mpc_imagref(op), MPFR_RNDN);
mpfr_add (mpc_imagref(z1), mpc_imagref(z1), mpc_realref(op), MPFR_RNDN);
- if (mpfr_cmp_ui (mpc_realref(z1), 0) == 0 || mpfr_cmp_ui (mpc_imagref(z1), 0) == 0)
+ if (mpfr_zero_p (mpc_realref(z1)) || mpfr_zero_p (mpc_imagref(z1)))
continue;
ex -= mpfr_get_exp (mpc_realref(z1)); /* cancellation in x */
ey -= mpfr_get_exp (mpc_imagref(z1)); /* cancellation in y */
@@ -286,5 +485,13 @@ mpc_asin (mpc_ptr rop, mpc_srcptr op, mpc_rnd_t rnd)
inex = mpc_set (rop, z1, rnd);
mpc_clear (z1);
- return inex;
+ /* restore the exponent range, and check the range of results */
+ mpfr_set_emin (saved_emin);
+ mpfr_set_emax (saved_emax);
+ inex_re = mpfr_check_range (mpc_realref (rop), MPC_INEX_RE (inex),
+ MPC_RND_RE (rnd));
+ inex_im = mpfr_check_range (mpc_imagref (rop), MPC_INEX_IM (inex),
+ MPC_RND_IM (rnd));
+
+ return MPC_INEX (inex_re, inex_im);
}
diff --git a/gcc/mpc/src/atan.c b/gcc/mpc/src/atan.c
index 1fa5267dfa..cc1922b71b 100644
--- a/gcc/mpc/src/atan.c
+++ b/gcc/mpc/src/atan.c
@@ -1,6 +1,6 @@
/* mpc_atan -- arctangent of a complex number.
-Copyright (C) 2009, 2010, 2011, 2012, 2013, 2017 INRIA
+Copyright (C) 2009, 2010, 2011, 2012, 2013, 2017, 2020 INRIA
This file is part of GNU MPC.
@@ -45,11 +45,9 @@ set_pi_over_2 (mpfr_ptr rop, int s, mpfr_rnd_t rnd)
int
mpc_atan (mpc_ptr rop, mpc_srcptr op, mpc_rnd_t rnd)
{
- int s_re;
- int s_im;
- int inex_re;
- int inex_im;
- int inex;
+ int s_re, s_im;
+ int inex_re, inex_im, inex;
+ mpfr_exp_t saved_emin, saved_emax;
inex_re = 0;
inex_im = 0;
@@ -216,6 +214,11 @@ mpc_atan (mpc_ptr rop, mpc_srcptr op, mpc_rnd_t rnd)
return MPC_INEX (inex_re, inex_im);
}
+ saved_emin = mpfr_get_emin ();
+ saved_emax = mpfr_get_emax ();
+ mpfr_set_emin (mpfr_get_emin_min ());
+ mpfr_set_emax (mpfr_get_emax_max ());
+
/* regular number argument */
{
mpfr_t a, b, x, y;
@@ -391,6 +394,15 @@ mpc_atan (mpc_ptr rop, mpc_srcptr op, mpc_rnd_t rnd)
inex = mpc_set_fr_fr (rop, x, y, rnd);
mpfr_clears (a, b, x, y, (mpfr_ptr) 0);
- return inex;
+
+ /* restore the exponent range, and check the range of results */
+ mpfr_set_emin (saved_emin);
+ mpfr_set_emax (saved_emax);
+ inex_re = mpfr_check_range (mpc_realref (rop), MPC_INEX_RE (inex),
+ MPC_RND_RE (rnd));
+ inex_im = mpfr_check_range (mpc_imagref (rop), MPC_INEX_IM (inex),
+ MPC_RND_IM (rnd));
+
+ return MPC_INEX (inex_re, inex_im);
}
}
diff --git a/gcc/mpc/src/div.c b/gcc/mpc/src/div.c
index 17f8876a73..47df8c14b0 100644
--- a/gcc/mpc/src/div.c
+++ b/gcc/mpc/src/div.c
@@ -1,6 +1,6 @@
/* mpc_div -- Divide two complex numbers.
-Copyright (C) 2002, 2003, 2004, 2005, 2008, 2009, 2010, 2011, 2012 INRIA
+Copyright (C) 2002, 2003, 2004, 2005, 2008, 2009, 2010, 2011, 2012, 2020 INRIA
This file is part of GNU MPC.
@@ -229,6 +229,7 @@ mpc_div_imag (mpc_ptr rop, mpc_srcptr z, mpc_srcptr w, mpc_rnd_t rnd)
return MPC_INEX(inex_re, inex_im);
}
+#define MPFR_EXP(x) ((x)->_mpfr_exp)
int
mpc_div (mpc_ptr a, mpc_srcptr b, mpc_srcptr c, mpc_rnd_t rnd)
@@ -243,6 +244,7 @@ mpc_div (mpc_ptr a, mpc_srcptr b, mpc_srcptr c, mpc_rnd_t rnd)
mpfr_rnd_t rnd_re = MPC_RND_RE (rnd), rnd_im = MPC_RND_IM (rnd);
int saved_underflow, saved_overflow;
int tmpsgn;
+ mpfr_exp_t saved_emin, saved_emax;
/* According to the C standard G.3, there are three types of numbers: */
/* finite (both parts are usual real numbers; contains 0), infinite */
@@ -253,9 +255,10 @@ mpc_div (mpc_ptr a, mpc_srcptr b, mpc_srcptr c, mpc_rnd_t rnd)
/* all other divisions that are not finite/finite return nan+i*nan. */
/* Division by 0 could be handled by the following case of division by */
/* a real; we handle it separately instead. */
- if (mpc_zero_p (c))
+ if (mpc_zero_p (c)) /* both Re(c) and Im(c) are zero */
return mpc_div_zero (a, b, c, rnd);
- else if (mpc_inf_p (b) && mpc_fin_p (c))
+ else if (mpc_inf_p (b) && mpc_fin_p (c)) /* either Re(b) or Im(b) is infinite
+ and both Re(c) and Im(c) are ordinary */
return mpc_div_inf_fin (a, b, c);
else if (mpc_fin_p (b) && mpc_inf_p (c))
return mpc_div_fin_inf (a, b, c);
@@ -273,6 +276,13 @@ mpc_div (mpc_ptr a, mpc_srcptr b, mpc_srcptr c, mpc_rnd_t rnd)
mpc_init2 (res, 2);
mpfr_init (q);
+ /* we perform the division in the largest possible exponent range,
+ to avoid underflow/overflow in intermediate computations */
+ saved_emin = mpfr_get_emin ();
+ saved_emax = mpfr_get_emax ();
+ mpfr_set_emin (mpfr_get_emin_min ());
+ mpfr_set_emax (mpfr_get_emax_max ());
+
/* create the conjugate of c in c_conj without allocating new memory */
mpc_realref (c_conj)[0] = mpc_realref (c)[0];
mpc_imagref (c_conj)[0] = mpc_imagref (c)[0];
@@ -312,7 +322,13 @@ mpc_div (mpc_ptr a, mpc_srcptr b, mpc_srcptr c, mpc_rnd_t rnd)
hopefully, the side-effects of mpc_mul do indeed raise the
mpfr exceptions */
if (overflow_prod) {
+ /* FIXME: in case overflow_norm is also true, the code below is wrong,
+ since the after division by the norm, we might end up with finite
+ real and/or imaginary parts. A workaround would be to scale the
+ inputs (in case the exponents are within the same range). */
int isinf = 0;
+ /* determine if the real part of res is the maximum or the minimum
+ representable number */
tmpsgn = mpfr_sgn (mpc_realref(res));
if (tmpsgn > 0)
{
@@ -331,6 +347,7 @@ mpc_div (mpc_ptr a, mpc_srcptr b, mpc_srcptr c, mpc_rnd_t rnd)
mpfr_set_inf (mpc_realref(res), tmpsgn);
overflow_re = 1;
}
+ /* same for the imaginary part */
tmpsgn = mpfr_sgn (mpc_imagref(res));
isinf = 0;
if (tmpsgn > 0)
@@ -445,5 +462,11 @@ mpc_div (mpc_ptr a, mpc_srcptr b, mpc_srcptr c, mpc_rnd_t rnd)
if (saved_overflow)
mpfr_set_overflow ();
+ /* restore the exponent range, and check the range of results */
+ mpfr_set_emin (saved_emin);
+ mpfr_set_emax (saved_emax);
+ inexact_re = mpfr_check_range (mpc_realref (a), inexact_re, rnd_re);
+ inexact_im = mpfr_check_range (mpc_imagref (a), inexact_im, rnd_im);
+
return MPC_INEX (inexact_re, inexact_im);
}
diff --git a/gcc/mpc/src/dot.c b/gcc/mpc/src/dot.c
new file mode 100644
index 0000000000..68cc117cd4
--- /dev/null
+++ b/gcc/mpc/src/dot.c
@@ -0,0 +1,88 @@
+/* mpc_dot -- Dot product of two arrays of complex numbers.
+
+Copyright (C) 2018, 2020 INRIA
+
+This file is part of GNU MPC.
+
+GNU MPC is free software; you can redistribute it and/or modify it under
+the terms of the GNU Lesser General Public License as published by the
+Free Software Foundation; either version 3 of the License, or (at your
+option) any later version.
+
+GNU MPC is distributed in the hope that it will be useful, but WITHOUT ANY
+WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS
+FOR A PARTICULAR PURPOSE. See the GNU Lesser General Public License for
+more details.
+
+You should have received a copy of the GNU Lesser General Public License
+along with this program. If not, see http://www.gnu.org/licenses/ .
+*/
+
+#include /* for MPC_ASSERT */
+#include "mpc-impl.h"
+
+/* res <- x[0]*y[0] + ... + x[n-1]*y[n-1] */
+int
+mpc_dot (mpc_ptr res, const mpc_ptr *x, const mpc_ptr *y,
+ unsigned long n, mpc_rnd_t rnd)
+{
+ int inex_re, inex_im;
+ mpfr_ptr *t;
+ mpfr_t *z;
+ unsigned long i;
+ mpfr_t re_res;
+
+ z = (mpfr_t *) malloc (2 * n * sizeof (mpfr_t));
+ /* warning: when n=0, malloc() might return NULL (e.g., gcc119) */
+ MPC_ASSERT(n == 0 || z != NULL);
+ t = (mpfr_ptr *) malloc (2 * n * sizeof(mpfr_ptr));
+ MPC_ASSERT(n == 0 || t != NULL);
+ for (i = 0; i < 2 * n; i++)
+ t[i] = z[i];
+ /* we first store in z[i] the value of Re(x[i])*Re(y[i])
+ and in z[n+i] that of -Im(x[i])*Im(y[i]) */
+ for (i = 0; i < n; i++)
+ {
+ mpfr_prec_t prec_x_re = mpfr_get_prec (mpc_realref (x[i]));
+ mpfr_prec_t prec_x_im = mpfr_get_prec (mpc_imagref (x[i]));
+ mpfr_prec_t prec_y_re = mpfr_get_prec (mpc_realref (y[i]));
+ mpfr_prec_t prec_y_im = mpfr_get_prec (mpc_imagref (y[i]));
+ mpfr_prec_t prec_y_max = MPC_MAX (prec_y_re, prec_y_im);
+ /* we allocate z[i] with prec_x_re + prec_y_max bits
+ so that the second loop below does not reallocate */
+ mpfr_init2 (z[i], prec_x_re + prec_y_max);
+ mpfr_set_prec (z[i], prec_x_re + prec_y_re);
+ mpfr_mul (z[i], mpc_realref (x[i]), mpc_realref (y[i]), MPFR_RNDZ);
+ /* idem for z[n+i]: we allocate with prec_x_im + prec_y_max bits */
+ mpfr_init2 (z[n+i], prec_x_im + prec_y_max);
+ mpfr_set_prec (z[n+i], prec_x_im + prec_y_im);
+ mpfr_mul (z[n+i], mpc_imagref (x[i]), mpc_imagref (y[i]), MPFR_RNDZ);
+ mpfr_neg (z[n+i], z[n+i], MPFR_RNDZ);
+ }
+ /* copy the real part in a temporary variable, since it might be in the
+ input array */
+ mpfr_init2 (re_res, mpfr_get_prec (mpc_realref (res)));
+ inex_re = mpfr_sum (re_res, t, 2 * n, MPC_RND_RE (rnd));
+ /* we then store in z[i] the value of Re(x[i])*Im(y[i])
+ and in z[n+i] that of Im(x[i])*Re(y[i]) */
+ for (i = 0; i < n; i++)
+ {
+ mpfr_prec_t prec_x_re = mpfr_get_prec (mpc_realref (x[i]));
+ mpfr_prec_t prec_x_im = mpfr_get_prec (mpc_imagref (x[i]));
+ mpfr_prec_t prec_y_re = mpfr_get_prec (mpc_realref (y[i]));
+ mpfr_prec_t prec_y_im = mpfr_get_prec (mpc_imagref (y[i]));
+ mpfr_set_prec (z[i], prec_x_re + prec_y_im);
+ mpfr_mul (z[i], mpc_realref (x[i]), mpc_imagref (y[i]), MPFR_RNDZ);
+ mpfr_set_prec (z[n+i], prec_x_im + prec_y_re);
+ mpfr_mul (z[n+i], mpc_imagref (x[i]), mpc_realref (y[i]), MPFR_RNDZ);
+ }
+ inex_im = mpfr_sum (mpc_imagref (res), t, 2 * n, MPC_RND_IM (rnd));
+ mpfr_swap (mpc_realref (res), re_res);
+ mpfr_clear (re_res);
+ for (i = 0; i < 2 * n; i++)
+ mpfr_clear (z[i]);
+ free (t);
+ free (z);
+
+ return MPC_INEX(inex_re, inex_im);
+}
diff --git a/gcc/mpc/src/exp.c b/gcc/mpc/src/exp.c
index b28ccea558..5f53db3c5d 100644
--- a/gcc/mpc/src/exp.c
+++ b/gcc/mpc/src/exp.c
@@ -1,6 +1,6 @@
/* mpc_exp -- exponential of a complex number.
-Copyright (C) 2002, 2009, 2010, 2011, 2012 INRIA
+Copyright (C) 2002, 2009, 2010, 2011, 2012, 2020 INRIA
This file is part of GNU MPC.
@@ -28,6 +28,7 @@ mpc_exp (mpc_ptr rop, mpc_srcptr op, mpc_rnd_t rnd)
int ok = 0;
int inex_re, inex_im;
int saved_underflow, saved_overflow;
+ mpfr_exp_t saved_emin, saved_emax;
/* special values */
if (mpfr_nan_p (mpc_realref (op)) || mpfr_nan_p (mpc_imagref (op)))
@@ -58,7 +59,6 @@ mpc_exp (mpc_ptr rop, mpc_srcptr op, mpc_rnd_t rnd)
return MPC_INEX(0, 0); /* NaN is exact */
}
-
if (mpfr_zero_p (mpc_imagref(op)))
/* special case when the input is real
exp(x-i*0) = exp(x) -i*0, even if x is NaN
@@ -77,7 +77,6 @@ mpc_exp (mpc_ptr rop, mpc_srcptr op, mpc_rnd_t rnd)
return MPC_INEX(inex_re, inex_im);
}
-
if (mpfr_inf_p (mpc_realref (op)))
/* real part is an infinity,
exp(-inf +i*y) = 0*(cos y +i*sin y)
@@ -130,6 +129,10 @@ mpc_exp (mpc_ptr rop, mpc_srcptr op, mpc_rnd_t rnd)
return MPC_INEX(0, 0); /* NaN is exact */
}
+ saved_emin = mpfr_get_emin ();
+ saved_emax = mpfr_get_emax ();
+ mpfr_set_emin (mpfr_get_emin_min ());
+ mpfr_set_emax (mpfr_get_emax_max ());
/* from now on, both parts of op are regular numbers */
@@ -150,7 +153,7 @@ mpc_exp (mpc_ptr rop, mpc_srcptr op, mpc_rnd_t rnd)
do
{
- prec += mpc_ceil_log2 (prec) + 5;
+ prec += prec / 2 + mpc_ceil_log2 (prec) + 5;
mpfr_set_prec (x, prec);
mpfr_set_prec (y, prec);
@@ -199,5 +202,11 @@ mpc_exp (mpc_ptr rop, mpc_srcptr op, mpc_rnd_t rnd)
if (saved_overflow)
mpfr_set_overflow ();
+ /* restore the exponent range, and check the range of results */
+ mpfr_set_emin (saved_emin);
+ mpfr_set_emax (saved_emax);
+ inex_re = mpfr_check_range (mpc_realref (rop), inex_re, MPC_RND_RE (rnd));
+ inex_im = mpfr_check_range (mpc_imagref (rop), inex_im, MPC_RND_IM (rnd));
+
return MPC_INEX(inex_re, inex_im);
}
diff --git a/gcc/mpc/src/get_version.c b/gcc/mpc/src/get_version.c
index 34e24c5fcb..9628ab1154 100644
--- a/gcc/mpc/src/get_version.c
+++ b/gcc/mpc/src/get_version.c
@@ -1,6 +1,6 @@
/* mpc_get_version -- MPC version
-Copyright (C) 2008, 2009, 2010, 2011, 2012, 2017 INRIA
+Copyright (C) 2008, 2009, 2010, 2011, 2012, 2017, 2018, 2020 INRIA
This file is part of GNU MPC.
@@ -23,5 +23,5 @@ along with this program. If not, see http://www.gnu.org/licenses/ .
const char *
mpc_get_version (void)
{
- return "1.1.0";
+ return "1.2.0";
}
diff --git a/gcc/mpc/src/get_x.c b/gcc/mpc/src/get_x.c
index 31610ac61d..21b83b05ce 100644
--- a/gcc/mpc/src/get_x.c
+++ b/gcc/mpc/src/get_x.c
@@ -1,7 +1,7 @@
/* mpc_get_dc, mpc_get_ldc -- Transform mpc number into C complex number
mpc_get_str -- Convert a complex number into a string.
-Copyright (C) 2009, 2010, 2011 INRIA
+Copyright (C) 2009, 2010, 2011, 2020 INRIA
This file is part of GNU MPC.
@@ -53,12 +53,12 @@ mpc_get_ldc (mpc_srcptr op, mpc_rnd_t rnd) {
of the locale is used. */
/* mpfr_prec_t can be either int or long int */
-#if (__GMP_MP_SIZE_T_INT == 1)
+#if (_MPFR_EXP_FORMAT == 2)
#define MPC_EXP_FORMAT_SPEC "i"
-#elif (__GMP_MP_SIZE_T_INT == 0)
+#elif (_MPFR_EXP_FORMAT == 3)
#define MPC_EXP_FORMAT_SPEC "li"
#else
-#error "mpfr_exp_t size not supported"
+#error "value of _MPFR_EXP_FORMAT not supported"
#endif
static char *
@@ -76,13 +76,13 @@ pretty_zero (mpfr_srcptr zero)
}
static char *
-prettify (const char *str, const mp_exp_t expo, int base, int special)
+prettify (const char *str, const mpfr_exp_t expo, int base, int special)
{
size_t sz;
char *pretty;
char *p;
const char *s;
- mp_exp_t x;
+ mpfr_exp_t x;
int sign;
sz = strlen (str) + 1; /* + terminal '\0' */
@@ -101,10 +101,10 @@ prettify (const char *str, const mp_exp_t expo, int base, int special)
sign = (str[0] == '-' || str[0] == '+');
x = expo - 1; /* expo is the exponent value with decimal point BEFORE
- the first digit, we wants decimal point AFTER the first
+ the first digit, we want decimal point AFTER the first
digit */
if (base == 16)
- x <<= 2; /* the output exponent is a binary exponent */
+ x *= 4; /* the output exponent is a binary exponent */
++sz; /* + decimal point */
@@ -112,14 +112,14 @@ prettify (const char *str, const mp_exp_t expo, int base, int special)
{
/* augment sz with the size needed for an exponent written in base
ten */
- mp_exp_t xx;
+ mpfr_exp_t xx;
sz += 3; /* + exponent char + sign + 1 digit */
if (x < 0)
{
/* avoid overflow when changing sign (assuming that, for the
- mp_exp_t type, (max value) is greater than (- min value / 10)) */
+ mpfr_exp_t type, (max value) is greater than (- min value / 10)) */
if (x < -10)
{
xx = - (x / 10);
@@ -189,7 +189,7 @@ prettify (const char *str, const mp_exp_t expo, int base, int special)
static char *
get_pretty_str (const int base, const size_t n, mpfr_srcptr x, mpfr_rnd_t rnd)
{
- mp_exp_t expo;
+ mpfr_exp_t expo;
char *ugly;
char *pretty;
diff --git a/gcc/mpc/src/log10.c b/gcc/mpc/src/log10.c
index a9f27e5c5b..5afd4abdad 100644
--- a/gcc/mpc/src/log10.c
+++ b/gcc/mpc/src/log10.c
@@ -1,6 +1,6 @@
/* mpc_log10 -- Take the base-10 logarithm of a complex number.
-Copyright (C) 2012 INRIA
+Copyright (C) 2012, 2020 INRIA
This file is part of GNU MPC.
@@ -37,6 +37,12 @@ mpc_log10 (mpc_ptr rop, mpc_srcptr op, mpc_rnd_t rnd)
mpfr_prec_t prec;
mpfr_t log10;
mpc_t log;
+ mpfr_exp_t saved_emin, saved_emax;
+
+ saved_emin = mpfr_get_emin ();
+ saved_emax = mpfr_get_emax ();
+ mpfr_set_emin (mpfr_get_emin_min ());
+ mpfr_set_emax (mpfr_get_emax_max ());
mpfr_init2 (log10, 2);
mpc_init2 (log, 2);
@@ -143,5 +149,11 @@ mpc_log10 (mpc_ptr rop, mpc_srcptr op, mpc_rnd_t rnd)
mpfr_clear (log10);
mpc_clear (log);
+ /* restore the exponent range, and check the range of results */
+ mpfr_set_emin (saved_emin);
+ mpfr_set_emax (saved_emax);
+ inex_re = mpfr_check_range (mpc_realref (rop), inex_re, MPC_RND_RE (rnd));
+ inex_im = mpfr_check_range (mpc_imagref (rop), inex_im, MPC_RND_IM (rnd));
+
return MPC_INEX(inex_re, inex_im);
}
diff --git a/gcc/mpc/src/mpc-impl.h b/gcc/mpc/src/mpc-impl.h
index 54206917e3..0bbb566b23 100644
--- a/gcc/mpc/src/mpc-impl.h
+++ b/gcc/mpc/src/mpc-impl.h
@@ -1,6 +1,6 @@
/* mpc-impl.h -- Internal include file for mpc.
-Copyright (C) 2002, 2004, 2005, 2008, 2009, 2010, 2011, 2012 INRIA
+Copyright (C) 2002, 2004, 2005, 2008, 2009, 2010, 2011, 2012, 2020 INRIA
This file is part of GNU MPC.
@@ -61,9 +61,9 @@ along with this program. If not, see http://www.gnu.org/licenses/ .
mpfr_copysign (x, y, z, rnd))
/* work around spurious signs in nan */
#define MPFR_ADD_ONE_ULP(x) \
- (mpfr_sgn (x) > 0 ? mpfr_nextabove (x) : mpfr_nextbelow (x))
+ (MPFR_SIGN (x) > 0 ? mpfr_nextabove (x) : mpfr_nextbelow (x))
#define MPFR_SUB_ONE_ULP(x) \
- (mpfr_sgn (x) > 0 ? mpfr_nextbelow (x) : mpfr_nextabove (x))
+ (MPFR_SIGN (x) > 0 ? mpfr_nextbelow (x) : mpfr_nextabove (x))
/* drop unused rounding mode from macros */
#define MPFR_SWAP(a,b) do { mpfr_srcptr tmp; tmp = a; a = b; b = tmp; } while (0)
diff --git a/gcc/mpc/src/mpc.h b/gcc/mpc/src/mpc.h
index 1770439a9d..1e99bfeb18 100644
--- a/gcc/mpc/src/mpc.h
+++ b/gcc/mpc/src/mpc.h
@@ -1,6 +1,6 @@
/* mpc.h -- Include file for mpc.
-Copyright (C) 2002, 2003, 2004, 2005, 2007, 2008, 2009, 2010, 2011, 2012, 2016, 2017 INRIA
+Copyright (C) 2002, 2003, 2004, 2005, 2007, 2008, 2009, 2010, 2011, 2012, 2016, 2017, 2018, 2020 INRIA
This file is part of GNU MPC.
@@ -26,9 +26,9 @@ along with this program. If not, see http://www.gnu.org/licenses/ .
/* Define MPC version number */
#define MPC_VERSION_MAJOR 1
-#define MPC_VERSION_MINOR 1
+#define MPC_VERSION_MINOR 2
#define MPC_VERSION_PATCHLEVEL 0
-#define MPC_VERSION_STRING "1.1.0"
+#define MPC_VERSION_STRING "1.2.0"
/* Macros dealing with MPC VERSION */
#define MPC_VERSION_NUM(a,b,c) (((a) << 16L) | ((b) << 8) | (c))
@@ -42,7 +42,9 @@ along with this program. If not, see http://www.gnu.org/licenses/ .
/* Return values */
-/* Transform negative to 2, positive to 1, leave 0 unchanged */
+/* Transform negative to 2, positive to 1, leave 0 unchanged.
+ Warning: since inex is evaluated two times, we should avoid
+ MPC_INEX(mpc_mul (...), mpc_mul (...)) */
#define MPC_INEX_POS(inex) (((inex) < 0) ? 2 : ((inex) == 0) ? 0 : 1)
/* Transform 2 to negative, 1 to positive, leave 0 unchanged */
#define MPC_INEX_NEG(inex) (((inex) == 2) ? -1 : ((inex) == 0) ? 0 : 1)
@@ -152,6 +154,8 @@ __MPC_DECLSPEC int mpc_div_2si (mpc_ptr, mpc_srcptr, long int, mpc_rnd_t);
__MPC_DECLSPEC int mpc_mul_2si (mpc_ptr, mpc_srcptr, long int, mpc_rnd_t);
__MPC_DECLSPEC int mpc_conj (mpc_ptr, mpc_srcptr, mpc_rnd_t);
__MPC_DECLSPEC int mpc_neg (mpc_ptr, mpc_srcptr, mpc_rnd_t);
+__MPC_DECLSPEC int mpc_sum (mpc_ptr, const mpc_ptr *, unsigned long, mpc_rnd_t);
+__MPC_DECLSPEC int mpc_dot (mpc_ptr, const mpc_ptr *, const mpc_ptr *, unsigned long, mpc_rnd_t);
__MPC_DECLSPEC int mpc_norm (mpfr_ptr, mpc_srcptr, mpfr_rnd_t);
__MPC_DECLSPEC int mpc_abs (mpfr_ptr, mpc_srcptr, mpfr_rnd_t);
__MPC_DECLSPEC int mpc_sqrt (mpc_ptr, mpc_srcptr, mpc_rnd_t);
diff --git a/gcc/mpc/src/mul.c b/gcc/mpc/src/mul.c
index ddcd35408c..61092e57d9 100644
--- a/gcc/mpc/src/mul.c
+++ b/gcc/mpc/src/mul.c
@@ -5,7 +5,7 @@ Copyright (C) 2002, 2004, 2005, 2008, 2009, 2010, 2011, 2012, 2016 INRIA
This file is part of GNU MPC.
GNU MPC is free software; you can redistribute it and/or modify it under
-the terms of the GNU Lesser General Public License as published by the
+ he terms of the GNU Lesser General Public License as published by the
Free Software Foundation; either version 3 of the License, or (at your
option) any later version.
@@ -366,7 +366,7 @@ mpc_mul_naive (mpc_ptr z, mpc_srcptr x, mpc_srcptr y, mpc_rnd_t rnd)
{
/* computes z=x*y by the schoolbook method, where x and y are assumed
to be finite and without zero parts */
- int overlap, inex;
+ int overlap, inex_re, inex_im;
mpc_t rop;
MPC_ASSERT ( mpfr_regular_p (mpc_realref (x)) && mpfr_regular_p (mpc_imagref (x))
@@ -378,22 +378,22 @@ mpc_mul_naive (mpc_ptr z, mpc_srcptr x, mpc_srcptr y, mpc_rnd_t rnd)
rop [0] = z [0];
#if HAVE_MPFR_FMMA
- inex = MPC_INEX (mpfr_fmms (mpc_realref (rop), mpc_realref (x), mpc_realref (y), mpc_imagref (x),
- mpc_imagref (y), MPC_RND_RE (rnd)),
- mpfr_fmma (mpc_imagref (rop), mpc_realref (x), mpc_imagref (y), mpc_imagref (x),
- mpc_realref (y), MPC_RND_IM (rnd)));
+ inex_re = mpfr_fmms (mpc_realref (rop), mpc_realref (x), mpc_realref (y),
+ mpc_imagref (x), mpc_imagref (y), MPC_RND_RE (rnd));
+ inex_im = mpfr_fmma (mpc_imagref (rop), mpc_realref (x), mpc_imagref (y),
+ mpc_imagref (x), mpc_realref (y), MPC_RND_IM (rnd));
#else
- inex = MPC_INEX (mpc_fmma (mpc_realref (rop), mpc_realref (x), mpc_realref (y), mpc_imagref (x),
- mpc_imagref (y), -1, MPC_RND_RE (rnd)),
- mpc_fmma (mpc_imagref (rop), mpc_realref (x), mpc_imagref (y), mpc_imagref (x),
- mpc_realref (y), +1, MPC_RND_IM (rnd)));
+ inex_re = mpc_fmma (mpc_realref (rop), mpc_realref (x), mpc_realref (y),
+ mpc_imagref (x), mpc_imagref (y), -1, MPC_RND_RE (rnd));
+ inex_im = mpc_fmma (mpc_imagref (rop), mpc_realref (x), mpc_imagref (y),
+ mpc_imagref (x), mpc_realref (y), +1, MPC_RND_IM (rnd));
#endif
mpc_set (z, rop, MPC_RNDNN);
if (overlap)
mpc_clear (rop);
- return inex;
+ return MPC_INEX (inex_re, inex_im);
}
@@ -541,22 +541,22 @@ mpc_mul_karatsuba (mpc_ptr rop, mpc_srcptr op1, mpc_srcptr op2, mpc_rnd_t rnd)
inexact |= mpfr_mul (u, u, x, MPFR_RNDA);
/* (a+b)*(c-d) */
- /* if all computations are exact up to here, it may be that
- the real part is exact, thus we need if possible to
- compute v - w exactly */
- if (inexact == 0)
- {
- mpfr_prec_t prec_x;
+ /* if all computations are exact up to here, it may be that
+ the real part is exact, thus we need if possible to
+ compute v - w exactly */
+ if (inexact == 0)
+ {
+ mpfr_prec_t prec_x;
/* v and w are different from 0, so mpfr_get_exp is safe to use */
prec_x = SAFE_ABS (mpfr_exp_t, mpfr_get_exp (v) - mpfr_get_exp (w))
+ MPC_MAX (prec_v, prec_w) + 1;
/* +1 is necessary for a potential carry */
- /* ensure we do not use a too large precision */
- if (prec_x > prec_u)
+ /* ensure we do not use a too large precision */
+ if (prec_x > prec_u)
prec_x = prec_u;
- if (prec_x > prec)
- mpfr_prec_round (x, prec_x, MPFR_RNDN);
- }
+ if (prec_x > prec)
+ mpfr_prec_round (x, prec_x, MPFR_RNDN);
+ }
rnd_u = (sign_u > 0) ? MPFR_RNDU : MPFR_RNDD;
inexact |= mpfr_sub (x, v, w, rnd_u); /* ad - bc */
diff --git a/gcc/mpc/src/pow.c b/gcc/mpc/src/pow.c
index 5494d1338a..4fc90aef49 100644
--- a/gcc/mpc/src/pow.c
+++ b/gcc/mpc/src/pow.c
@@ -1,6 +1,6 @@
/* mpc_pow -- Raise a complex number to the power of another complex number.
-Copyright (C) 2009-2015 INRIA
+Copyright (C) 2009, 2010, 2011, 2012, 2014, 2015, 2016, 2018, 2020 INRIA
This file is part of GNU MPC.
@@ -182,6 +182,7 @@ mpc_pow_exact (mpc_ptr z, mpc_srcptr x, mpfr_srcptr y, mpc_rnd_t rnd,
int x_imag = mpfr_zero_p (mpc_realref(x));
int z_is_y = 0;
mpfr_t copy_of_y;
+ int inex_im;
if (mpc_realref (z) == y || mpc_imagref (z) == y)
{
@@ -403,7 +404,8 @@ mpc_pow_exact (mpc_ptr z, mpc_srcptr x, mpfr_srcptr y, mpc_rnd_t rnd,
}
ret = mpfr_set_z (mpc_realref(z), a, MPC_RND_RE(rnd));
- ret = MPC_INEX(ret, mpfr_set_z (mpc_imagref(z), b, MPC_RND_IM(rnd)));
+ inex_im = mpfr_set_z (mpc_imagref(z), b, MPC_RND_IM(rnd));
+ ret = MPC_INEX(ret, inex_im);
mpfr_mul_2si (mpc_realref(z), mpc_realref(z), ed, MPC_RND_RE(rnd));
mpfr_mul_2si (mpc_imagref(z), mpc_imagref(z), ed, MPC_RND_IM(rnd));
@@ -483,6 +485,8 @@ mpc_pow (mpc_ptr z, mpc_srcptr x, mpc_srcptr y, mpc_rnd_t rnd)
mpc_t t, u;
mpfr_prec_t p, pr, pi, maxprec;
int saved_underflow, saved_overflow;
+ int inex_re, inex_im;
+ mpfr_exp_t saved_emin, saved_emax;
/* save the underflow or overflow flags from MPFR */
saved_underflow = mpfr_underflow_p ();
@@ -590,7 +594,8 @@ mpc_pow (mpc_ptr z, mpc_srcptr x, mpc_srcptr y, mpc_rnd_t rnd)
s2 = mpfr_signbit (mpc_imagref (x));
ret = mpfr_pow (mpc_realref(z), mpc_realref(x), mpc_realref(y), MPC_RND_RE(rnd));
- ret = MPC_INEX(ret, mpfr_set_ui (mpc_imagref(z), 0, MPC_RND_IM(rnd)));
+ inex_im = mpfr_set_ui (mpc_imagref(z), 0, MPC_RND_IM(rnd));
+ ret = MPC_INEX(ret, inex_im);
/* the sign of the zero imaginary part is known in some cases
(see algorithm.tex). In such cases we have (x +s*0i)^(y+/-0i)
@@ -641,6 +646,11 @@ mpc_pow (mpc_ptr z, mpc_srcptr x, mpc_srcptr y, mpc_rnd_t rnd)
z_real = 1;
}
+ saved_emin = mpfr_get_emin ();
+ saved_emax = mpfr_get_emax ();
+ mpfr_set_emin (mpfr_get_emin_min ());
+ mpfr_set_emax (mpfr_get_emax_max ());
+
pr = mpfr_get_prec (mpc_realref(z));
pi = mpfr_get_prec (mpc_imagref(z));
p = (pr > pi) ? pr : pi;
@@ -670,11 +680,13 @@ mpc_pow (mpc_ptr z, mpc_srcptr x, mpc_srcptr y, mpc_rnd_t rnd)
if (mpfr_get_exp (mpc_imagref(t)) > (mpfr_exp_t) q)
q = mpfr_get_exp (mpc_imagref(t));
- /* if q >= p, we get an error of order 1 on the imaginary part of t,
- which is not enough to get the correct sign of exp(t) */
- if (q >= p)
+ /* the signs of the real/imaginary parts of exp(t) are determined by the
+ quadrant of exp(i*imag(t)), which depends on imag(t) mod (2pi).
+ We ensure that p >= q + 64 to get enough precision, but this might
+ be not enough in corner cases (FIXME). */
+ if (p < q + 64)
{
- p = p + 64;
+ p = q + 64;
goto try_again;
}
@@ -682,7 +694,6 @@ mpc_pow (mpc_ptr z, mpc_srcptr x, mpc_srcptr y, mpc_rnd_t rnd)
mpfr_clear_underflow ();
ret_exp = mpc_exp (u, t, MPC_RNDNN);
if (mpfr_underflow_p () || mpfr_overflow_p ()) {
- int inex_re, inex_im;
/* under- and overflow flags are set by mpc_exp */
mpc_set (z, u, MPC_RNDNN);
ret = ret_exp;
@@ -691,7 +702,12 @@ mpc_pow (mpc_ptr z, mpc_srcptr x, mpc_srcptr y, mpc_rnd_t rnd)
if (mpfr_inf_p (mpc_realref (z)))
inex_re = mpc_fix_inf (mpc_realref (z), MPC_RND_RE(rnd));
if (mpfr_inf_p (mpc_imagref (z)))
- inex_im = mpc_fix_inf (mpc_imagref (z), MPC_RND_IM(rnd));
+ {
+ if (z_real)
+ inex_im = mpfr_set_ui (mpc_imagref (z), 0, MPC_RND_IM(rnd));
+ else
+ inex_im = mpc_fix_inf (mpc_imagref (z), MPC_RND_IM(rnd));
+ }
ret = MPC_INEX(inex_re,inex_im);
goto exact;
}
@@ -790,7 +806,8 @@ mpc_pow (mpc_ptr z, mpc_srcptr x, mpc_srcptr y, mpc_rnd_t rnd)
}
else
{
- ret = MPC_INEX (ret, mpfr_set_ui (mpc_imagref (z), 0, MPC_RND_IM (rnd)));
+ inex_im = mpfr_set_ui (mpc_imagref (z), 0, MPC_RND_IM (rnd));
+ ret = MPC_INEX (ret, inex_im);
/* warning: mpfr_set_ui does not set Im(z) to -0 if Im(rnd) = RNDD */
if (MPC_RND_IM (rnd) == MPFR_RNDD || sign_zi)
mpc_conj (z, z, MPC_RNDNN);
@@ -816,7 +833,10 @@ mpc_pow (mpc_ptr z, mpc_srcptr x, mpc_srcptr y, mpc_rnd_t rnd)
ret = MPC_INEX(0, ret);
}
else
- ret = MPC_INEX(mpfr_set_ui (mpc_realref(z), 0, MPC_RND_RE(rnd)), ret);
+ {
+ inex_re = mpfr_set_ui (mpc_realref(z), 0, MPC_RND_RE(rnd));
+ ret = MPC_INEX(inex_re, ret);
+ }
}
else
ret = mpc_set (z, u, rnd);
@@ -830,6 +850,15 @@ mpc_pow (mpc_ptr z, mpc_srcptr x, mpc_srcptr y, mpc_rnd_t rnd)
if (saved_overflow)
mpfr_set_overflow ();
+ /* restore the exponent range, and check the range of results */
+ mpfr_set_emin (saved_emin);
+ mpfr_set_emax (saved_emax);
+ inex_re = mpfr_check_range (mpc_realref (z), MPC_INEX_RE(ret),
+ MPC_RND_RE (rnd));
+ inex_im = mpfr_check_range (mpc_imagref (z), MPC_INEX_IM(ret),
+ MPC_RND_IM (rnd));
+ ret = MPC_INEX(inex_re, inex_im);
+
end:
return ret;
}
diff --git a/gcc/mpc/src/sin_cos.c b/gcc/mpc/src/sin_cos.c
index da0dd17d0e..f50d5bff43 100644
--- a/gcc/mpc/src/sin_cos.c
+++ b/gcc/mpc/src/sin_cos.c
@@ -1,6 +1,6 @@
/* mpc_sin_cos -- combined sine and cosine of a complex number.
-Copyright (C) 2010, 2011, 2012 INRIA
+Copyright (C) 2010, 2011, 2012, 2020 INRIA
This file is part of GNU MPC.
@@ -343,6 +343,12 @@ mpc_sin_cos (mpc_ptr rop_sin, mpc_ptr rop_cos, mpc_srcptr op,
mpfr_prec_t prec;
int ok;
int inex_re, inex_im, inex_sin, inex_cos, loop = 0;
+ mpfr_exp_t saved_emin, saved_emax;
+
+ saved_emin = mpfr_get_emin ();
+ saved_emax = mpfr_get_emax ();
+ mpfr_set_emin (mpfr_get_emin_min ());
+ mpfr_set_emax (mpfr_get_emax_max ());
prec = 2;
if (rop_sin != NULL)
@@ -376,7 +382,6 @@ mpc_sin_cos (mpc_ptr rop_sin, mpc_ptr rop_cos, mpc_srcptr op,
do {
loop ++;
- ok = 1;
prec += (loop <= 2) ? mpc_ceil_log2 (prec) + 5 : prec / 2;
mpfr_set_prec (s, prec);
@@ -389,6 +394,8 @@ mpc_sin_cos (mpc_ptr rop_sin, mpc_ptr rop_cos, mpc_srcptr op,
mpfr_sin_cos (s, c, mpc_realref(op), MPFR_RNDN);
mpfr_sinh_cosh (sh, ch, mpc_imagref(op), MPFR_RNDN);
+ ok = 1;
+
if (rop_sin != NULL) {
/* real part of sine */
mpfr_mul (sch, s, ch, MPFR_RNDN);
@@ -458,6 +465,30 @@ mpc_sin_cos (mpc_ptr rop_sin, mpc_ptr rop_cos, mpc_srcptr op,
mpfr_clear (sch);
mpfr_clear (csh);
+ /* restore the exponent range, and check the range of results */
+ mpfr_set_emin (saved_emin);
+ mpfr_set_emax (saved_emax);
+ if (rop_sin != NULL)
+ {
+ inex_re = mpfr_check_range (mpc_realref (rop_sin),
+ MPC_INEX_RE (inex_sin),
+ MPC_RND_RE (rnd_sin));
+ inex_im = mpfr_check_range (mpc_imagref (rop_sin),
+ MPC_INEX_IM (inex_sin),
+ MPC_RND_IM (rnd_sin));
+ inex_sin = MPC_INEX (inex_re, inex_im);
+ }
+ if (rop_cos != NULL)
+ {
+ inex_re = mpfr_check_range (mpc_realref (rop_cos),
+ MPC_INEX_RE (inex_cos),
+ MPC_RND_RE (rnd_cos));
+ inex_im = mpfr_check_range (mpc_imagref (rop_cos),
+ MPC_INEX_IM (inex_cos),
+ MPC_RND_IM (rnd_cos));
+ inex_cos = MPC_INEX (inex_re, inex_im);
+ }
+
return (MPC_INEX12 (inex_sin, inex_cos));
}
}
diff --git a/gcc/mpc/src/sqrt.c b/gcc/mpc/src/sqrt.c
index 01753ccf96..b2cdc095e5 100644
--- a/gcc/mpc/src/sqrt.c
+++ b/gcc/mpc/src/sqrt.c
@@ -1,6 +1,6 @@
/* mpc_sqrt -- Take the square root of a complex number.
-Copyright (C) 2002, 2008, 2009, 2010, 2011, 2012 INRIA
+Copyright (C) 2002, 2008, 2009, 2010, 2011, 2012, 2020 INRIA
This file is part of GNU MPC.
@@ -48,6 +48,7 @@ mpc_sqrt (mpc_ptr a, mpc_srcptr b, mpc_rnd_t rnd)
/* we need to know the sign of Im(b) when it is +/-0 */
const mpfr_rnd_t r = im_sgn ? MPFR_RNDD : MPFR_RNDU;
/* rounding mode used when computing t */
+ mpfr_exp_t saved_emin, saved_emax;
/* special values */
if (!mpc_fin_p (b)) {
@@ -202,6 +203,11 @@ mpc_sqrt (mpc_ptr a, mpc_srcptr b, mpc_rnd_t rnd)
}
}
+ saved_emin = mpfr_get_emin ();
+ saved_emax = mpfr_get_emax ();
+ mpfr_set_emin (mpfr_get_emin_min ());
+ mpfr_set_emax (mpfr_get_emax_max ());
+
do
{
loops ++;
@@ -210,8 +216,11 @@ mpc_sqrt (mpc_ptr a, mpc_srcptr b, mpc_rnd_t rnd)
mpfr_set_prec (t, prec);
/* let b = x + iy */
/* w = sqrt ((|x| + sqrt (x^2 + y^2)) / 2), rounded down */
- /* total error bounded by 3 ulps */
- inex_w = mpc_abs (w, b, MPFR_RNDD);
+ /* final error on w bounded by 10 ulps, see algorithms.tex */
+ inex_w = mpfr_sqr (w, mpc_realref (b), MPFR_RNDD);
+ inex_w |= mpfr_sqr (t, mpc_imagref (b), MPFR_RNDD);
+ inex_w |= mpfr_add (w, w, t, MPFR_RNDD);
+ inex_w |= mpfr_sqrt (w, w, MPFR_RNDD);
if (re_cmp < 0)
inex_w |= mpfr_sub (w, w, mpc_realref (b), MPFR_RNDD);
else
@@ -222,7 +231,7 @@ mpc_sqrt (mpc_ptr a, mpc_srcptr b, mpc_rnd_t rnd)
repr_w = mpfr_min_prec (w) <= prec_w;
if (!repr_w)
/* use the usual trick for obtaining the ternary value */
- ok_w = mpfr_can_round (w, prec - 2, MPFR_RNDD, MPFR_RNDU,
+ ok_w = mpfr_can_round (w, prec - 4, MPFR_RNDD, MPFR_RNDU,
prec_w + (rnd_w == MPFR_RNDN));
else {
/* w is representable in the target precision and thus cannot be
@@ -230,16 +239,16 @@ mpc_sqrt (mpc_ptr a, mpc_srcptr b, mpc_rnd_t rnd)
if (rnd_w == MPFR_RNDN)
/* If w can be rounded to nearest, then actually no rounding
occurs, and the ternary value is known from inex_w. */
- ok_w = mpfr_can_round (w, prec - 2, MPFR_RNDD, MPFR_RNDN, prec_w);
+ ok_w = mpfr_can_round (w, prec - 4, MPFR_RNDD, MPFR_RNDN, prec_w);
else
/* If w can be rounded down, then any direct rounding and the
ternary flag can be determined from inex_w. */
- ok_w = mpfr_can_round (w, prec - 2, MPFR_RNDD, MPFR_RNDD, prec_w);
+ ok_w = mpfr_can_round (w, prec - 4, MPFR_RNDD, MPFR_RNDD, prec_w);
}
if (!inex_w || ok_w) {
/* t = y / 2w, rounded away */
- /* total error bounded by 7 ulps */
+ /* total error bounded by 16 ulps, see algorithms.tex */
inex_t = mpfr_div (t, mpc_imagref (b), w, r);
if (!inex_t && inex_w)
/* The division was exact, but w was not. */
@@ -249,13 +258,13 @@ mpc_sqrt (mpc_ptr a, mpc_srcptr b, mpc_rnd_t rnd)
if (!repr_t)
/* As for w; since t was rounded away, we check whether rounding to 0
is possible. */
- ok_t = mpfr_can_round (t, prec - 3, r, MPFR_RNDZ,
+ ok_t = mpfr_can_round (t, prec - 4, r, MPFR_RNDZ,
prec_t + (rnd_t == MPFR_RNDN));
else {
if (rnd_t == MPFR_RNDN)
- ok_t = mpfr_can_round (t, prec - 3, r, MPFR_RNDN, prec_t);
+ ok_t = mpfr_can_round (t, prec - 4, r, MPFR_RNDN, prec_t);
else
- ok_t = mpfr_can_round (t, prec - 3, r, r, prec_t);
+ ok_t = mpfr_can_round (t, prec - 4, r, r, prec_t);
}
}
}
@@ -360,5 +369,11 @@ mpc_sqrt (mpc_ptr a, mpc_srcptr b, mpc_rnd_t rnd)
mpfr_clear (w);
mpfr_clear (t);
+ /* restore the exponent range, and check the range of results */
+ mpfr_set_emin (saved_emin);
+ mpfr_set_emax (saved_emax);
+ inex_re = mpfr_check_range (mpc_realref (a), inex_re, MPC_RND_RE (rnd));
+ inex_im = mpfr_check_range (mpc_imagref (a), inex_im, MPC_RND_IM (rnd));
+
return MPC_INEX (inex_re, inex_im);
}
diff --git a/gcc/mpc/src/sum.c b/gcc/mpc/src/sum.c
new file mode 100644
index 0000000000..09dd82f987
--- /dev/null
+++ b/gcc/mpc/src/sum.c
@@ -0,0 +1,43 @@
+/* mpc_sum -- Add an array of complex numbers.
+
+Copyright (C) 2018 INRIA
+
+This file is part of GNU MPC.
+
+GNU MPC is free software; you can redistribute it and/or modify it under
+the terms of the GNU Lesser General Public License as published by the
+Free Software Foundation; either version 3 of the License, or (at your
+option) any later version.
+
+GNU MPC is distributed in the hope that it will be useful, but WITHOUT ANY
+WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS
+FOR A PARTICULAR PURPOSE. See the GNU Lesser General Public License for
+more details.
+
+You should have received a copy of the GNU Lesser General Public License
+along with this program. If not, see http://www.gnu.org/licenses/ .
+*/
+
+#include /* for MPC_ASSERT */
+#include "mpc-impl.h"
+
+int
+mpc_sum (mpc_ptr sum, const mpc_ptr *z, unsigned long n, mpc_rnd_t rnd)
+{
+ int inex_re, inex_im;
+ mpfr_ptr *t;
+ unsigned long i;
+
+ t = (mpfr_ptr *) malloc (n * sizeof(mpfr_t));
+ /* warning: when n=0, malloc() might return NULL (e.g., gcc119) */
+ MPC_ASSERT(n == 0 || t != NULL);
+ for (i = 0; i < n; i++)
+ t[i] = mpc_realref (z[i]);
+ inex_re = mpfr_sum (mpc_realref (sum), t, n, MPC_RND_RE (rnd));
+ for (i = 0; i < n; i++)
+ t[i] = mpc_imagref (z[i]);
+ inex_im = mpfr_sum (mpc_imagref (sum), t, n, MPC_RND_IM (rnd));
+ free (t);
+
+ return MPC_INEX(inex_re, inex_im);
+}
diff --git a/gcc/mpc/src/tan.c b/gcc/mpc/src/tan.c
index 0ddc994ea6..ec26bea97a 100644
--- a/gcc/mpc/src/tan.c
+++ b/gcc/mpc/src/tan.c
@@ -1,6 +1,6 @@
/* mpc_tan -- tangent of a complex number.
-Copyright (C) 2008-2015 INRIA
+Copyright (C) 2008, 2009, 2010, 2011, 2012, 2013, 2015, 2020 INRIA
This file is part of GNU MPC.
@@ -22,14 +22,78 @@ along with this program. If not, see http://www.gnu.org/licenses/ .
#include
#include "mpc-impl.h"
+/* special case where the imaginary part of tan(op) rounds to -1 or 1:
+ return 1 if |Im(tan(op))| > 1, and -1 if |Im(tan(op))| < 1, return 0
+ if we can't decide.
+ The imaginary part is sinh(2*y)/(cos(2*x) + cosh(2*y)) where op = (x,y).
+*/
+static int
+tan_im_cmp_one (mpc_srcptr op)
+{
+ mpfr_t x, c;
+ int ret = 0;
+ mpfr_exp_t expc;
+
+ mpfr_init2 (x, mpfr_get_prec (mpc_realref (op)));
+ mpfr_mul_2exp (x, mpc_realref (op), 1, MPFR_RNDN);
+ mpfr_init2 (c, 32);
+ mpfr_cos (c, x, MPFR_RNDN);
+ /* if cos(2x) >= 0, then |sinh(2y)/(cos(2x)+cosh(2y))| < 1 */
+ if (mpfr_sgn (c) >= 0)
+ ret = -1; /* |Im(tan(op))| < 1 */
+ else
+ {
+ /* now cos(2x) < 0: |cosh(2y) - sinh(2y)| = exp(-2|y|) */
+ expc = mpfr_get_exp (c);
+ mpfr_abs (c, mpc_imagref (op), MPFR_RNDN);
+ mpfr_mul_si (c, c, -2, MPFR_RNDN);
+ mpfr_exp (c, c, MPFR_RNDN);
+ if (mpfr_zero_p (c) || mpfr_get_exp (c) < expc)
+ ret = 1; /* |Im(tan(op))| > 1 */
+ }
+ mpfr_clear (c);
+ mpfr_clear (x);
+ return ret;
+}
+
+/* special case where the real part of tan(op) underflows to 0:
+ return 1 if 0 < Re(tan(op)) < 2^(emin-2),
+ -1 if -2^(emin-2) < Re(tan(op))| < 0, and 0 if we can't decide.
+ The real part is sin(2*x)/(cos(2*x) + cosh(2*y)) where op = (x,y),
+ thus has the sign of sin(2*x).
+*/
+static int
+tan_re_cmp_zero (mpc_srcptr op, mpfr_exp_t emin)
+{
+ mpfr_t x, s, c;
+ int ret = 0;
+
+ mpfr_init2 (x, mpfr_get_prec (mpc_realref (op)));
+ mpfr_mul_2exp (x, mpc_realref (op), 1, MPFR_RNDN);
+ mpfr_init2 (s, 32);
+ mpfr_init2 (c, 32);
+ mpfr_sin (s, x, MPFR_RNDA);
+ mpfr_mul_2exp (x, mpc_imagref (op), 1, MPFR_RNDN);
+ mpfr_cosh (c, x, MPFR_RNDZ);
+ mpfr_sub_ui (c, c, 1, MPFR_RNDZ);
+ mpfr_div (s, s, c, MPFR_RNDA);
+ if (mpfr_zero_p (s) || mpfr_get_exp (s) <= emin - 2)
+ ret = mpfr_sgn (s);
+ mpfr_clear (s);
+ mpfr_clear (c);
+ mpfr_clear (x);
+ return ret;
+}
+
int
mpc_tan (mpc_ptr rop, mpc_srcptr op, mpc_rnd_t rnd)
{
mpc_t x, y;
mpfr_prec_t prec;
mpfr_exp_t err;
- int ok = 0;
- int inex;
+ int ok;
+ int inex, inex_re, inex_im;
+ mpfr_exp_t saved_emin, saved_emax;
/* special values */
if (!mpc_fin_p (op))
@@ -80,7 +144,6 @@ mpc_tan (mpc_ptr rop, mpc_srcptr op, mpc_rnd_t rnd)
/* tan(+Inf +i*Inf) = +/-0 +i */
{
const int sign_re = mpfr_signbit (mpc_realref (op));
- int inex_im;
mpfr_set_ui (mpc_realref (rop), 0, MPC_RND_RE (rnd));
mpfr_setsign (mpc_realref (rop), mpc_realref (rop), sign_re, MPFR_RNDN);
@@ -106,7 +169,6 @@ mpc_tan (mpc_ptr rop, mpc_srcptr op, mpc_rnd_t rnd)
{
mpfr_t c;
mpfr_t s;
- int inex_im;
mpfr_init (c);
mpfr_init (s);
@@ -132,8 +194,6 @@ mpc_tan (mpc_ptr rop, mpc_srcptr op, mpc_rnd_t rnd)
/* tan(-0 -i*y) = -0 +i*tanh(y), when y is finite. */
/* tan(+0 +i*y) = +0 +i*tanh(y), when y is finite. */
{
- int inex_im;
-
mpfr_set (mpc_realref (rop), mpc_realref (op), MPC_RND_RE (rnd));
inex_im = mpfr_tanh (mpc_imagref (rop), mpc_imagref (op), MPC_RND_IM (rnd));
@@ -144,14 +204,17 @@ mpc_tan (mpc_ptr rop, mpc_srcptr op, mpc_rnd_t rnd)
/* tan(x -i*0) = tan(x) -i*0, when x is finite. */
/* tan(x +i*0) = tan(x) +i*0, when x is finite. */
{
- int inex_re;
-
inex_re = mpfr_tan (mpc_realref (rop), mpc_realref (op), MPC_RND_RE (rnd));
mpfr_set (mpc_imagref (rop), mpc_imagref (op), MPC_RND_IM (rnd));
return MPC_INEX (inex_re, 0);
}
+ saved_emin = mpfr_get_emin ();
+ saved_emax = mpfr_get_emax ();
+ mpfr_set_emin (mpfr_get_emin_min ());
+ mpfr_set_emax (mpfr_get_emax_max ());
+
/* ordinary (non-zero) numbers */
/* tan(op) = sin(op) / cos(op).
@@ -198,7 +261,7 @@ mpc_tan (mpc_ptr rop, mpc_srcptr op, mpc_rnd_t rnd)
MPFR_ADD_ONE_ULP (mpc_imagref (x));
MPFR_ADD_ONE_ULP (mpc_realref (y));
MPFR_ADD_ONE_ULP (mpc_imagref (y));
- MPC_ASSERT (mpfr_zero_p (mpc_realref (x)) == 0);
+
if ( mpfr_inf_p (mpc_realref (x)) || mpfr_inf_p (mpc_imagref (x))
|| mpfr_inf_p (mpc_realref (y)) || mpfr_inf_p (mpc_imagref (y))) {
@@ -206,7 +269,6 @@ mpc_tan (mpc_ptr rop, mpc_srcptr op, mpc_rnd_t rnd)
Im(op) was large, in which case the result is
sign(tan(Re(op)))*0 + sign(Im(op))*I,
where sign(tan(Re(op))) = sign(Re(x))*sign(Re(y)). */
- int inex_re, inex_im;
mpfr_set_ui (mpc_realref (rop), 0, MPFR_RNDN);
if (mpfr_sgn (mpc_realref (x)) * mpfr_sgn (mpc_realref (y)) < 0)
{
@@ -251,36 +313,74 @@ mpc_tan (mpc_ptr rop, mpc_srcptr op, mpc_rnd_t rnd)
tan(1+14*I) = 1.26e-10 + 1.00*I. For small precision sin(op) and
cos(op) differ only by a factor I, thus after mpc_div x = I and
its real part is zero. */
- if (mpfr_zero_p (mpc_realref (x)) || mpfr_zero_p (mpc_imagref (x)))
+ if (mpfr_zero_p (mpc_realref (x)))
{
- err = prec; /* double precision */
- continue;
+ /* since we use an extended exponent range, if real(x) is zero,
+ this means the real part underflows, and we assume we can round */
+ ok = tan_re_cmp_zero (op, saved_emin);
+ if (ok > 0)
+ MPFR_ADD_ONE_ULP (mpc_realref (x));
+ else
+ MPFR_SUB_ONE_ULP (mpc_realref (x));
}
- if (MPC_INEX_RE (inex))
- MPFR_ADD_ONE_ULP (mpc_realref (x));
- if (MPC_INEX_IM (inex))
- MPFR_ADD_ONE_ULP (mpc_imagref (x));
- MPC_ASSERT (mpfr_zero_p (mpc_realref (x)) == 0);
- ezr = mpfr_get_exp (mpc_realref (x));
+ else
+ {
+ if (MPC_INEX_RE (inex))
+ MPFR_ADD_ONE_ULP (mpc_realref (x));
+ MPC_ASSERT (mpfr_zero_p (mpc_realref (x)) == 0);
+ ezr = mpfr_get_exp (mpc_realref (x));
- /* FIXME: compute
- k = Exp(Re(x))+Exp(Re(y))-2min{Exp(Re(y)), Exp(Im(y))}-Exp(Re(x/y))
- avoiding overflow */
- k = exr - ezr + MPC_MAX(-eyr, eyr - 2 * eyi);
- err = k < 2 ? 7 : (k == 2 ? 8 : (5 + k));
+ /* FIXME: compute
+ k = Exp(Re(x))+Exp(Re(y))-2min{Exp(Re(y)), Exp(Im(y))}-Exp(Re(x/y))
+ avoiding overflow */
+ k = exr - ezr + MPC_MAX(-eyr, eyr - 2 * eyi);
+ err = k < 2 ? 7 : (k == 2 ? 8 : (5 + k));
- /* Can the real part be rounded? */
- ok = (!mpfr_number_p (mpc_realref (x)))
- || mpfr_can_round (mpc_realref(x), prec - err, MPFR_RNDN, MPFR_RNDZ,
- MPC_PREC_RE(rop) + (MPC_RND_RE(rnd) == MPFR_RNDN));
+ /* Can the real part be rounded? */
+ ok = (!mpfr_number_p (mpc_realref (x)))
+ || mpfr_can_round (mpc_realref(x), prec - err, MPFR_RNDN, MPFR_RNDZ,
+ MPC_PREC_RE(rop) + (MPC_RND_RE(rnd) == MPFR_RNDN));
+ }
if (ok)
{
+ if (MPC_INEX_IM (inex))
+ MPFR_ADD_ONE_ULP (mpc_imagref (x));
+
/* Can the imaginary part be rounded? */
ok = (!mpfr_number_p (mpc_imagref (x)))
- || mpfr_can_round (mpc_imagref(x), prec - 6, MPFR_RNDN, MPFR_RNDZ,
- MPC_PREC_IM(rop) + (MPC_RND_IM(rnd) == MPFR_RNDN));
+ || mpfr_can_round (mpc_imagref(x), prec - 6, MPFR_RNDN, MPFR_RNDZ,
+ MPC_PREC_IM(rop) + (MPC_RND_IM(rnd) == MPFR_RNDN));
+
+ /* Special case when Im(x) = +/- 1:
+ tan z = [sin(2x)+i*sinh(2y)] / [cos(2x) + cosh(2y)]
+ (formula 4.3.57 of Abramowitz and Stegun) thus for y large
+ in absolute value the imaginary part is near -1 or +1.
+ More precisely cos(2x) + cosh(2y) = cosh(2y) + t with |t| <= 1,
+ thus since cosh(2y) >= exp|2y|/2, then the imaginary part is:
+ tanh(2y) * 1/(1+u) where u = |cos(2x)/cosh(2y)| <= 2/exp|2y|
+ thus |im(z) - tanh(2y)| <= 2/exp|2y| * tanh(2y).
+ Since |tanh(2y)| = (1-exp(-4|y|))/(1+exp(-4|y|)),
+ we have 1-|tanh(2y)| < 2*exp(-4|y|).
+ Thus |im(z)-1| < 2/exp|2y| + 2/exp|4y| < 4/exp|2y| < 4/2^|2y|.
+ If 2^EXP(y) >= p+2, then im(z) rounds to -1 or 1. */
+ if (ok == 0 && (mpfr_cmp_ui (mpc_imagref(x), 1) == 0 ||
+ mpfr_cmp_si (mpc_imagref(x), -1) == 0) &&
+ mpfr_get_exp (mpc_imagref(op)) >= 0 &&
+ ((size_t) mpfr_get_exp (mpc_imagref(op)) >= 8 * sizeof (mpfr_prec_t) ||
+ ((mpfr_prec_t) 1) << mpfr_get_exp (mpc_imagref(op)) >= mpfr_get_prec (mpc_imagref (rop)) + 2))
+ {
+ /* subtract one ulp, so that we get the correct inexact flag */
+ ok = tan_im_cmp_one (op);
+ if (ok < 0)
+ MPFR_SUB_ONE_ULP (mpc_imagref(x));
+ else if (ok > 0)
+ MPFR_ADD_ONE_ULP (mpc_imagref(x));
+ }
}
+
+ if (ok == 0)
+ prec += prec / 2;
}
while (ok == 0);
@@ -290,5 +390,13 @@ mpc_tan (mpc_ptr rop, mpc_srcptr op, mpc_rnd_t rnd)
mpc_clear (x);
mpc_clear (y);
- return inex;
+ /* restore the exponent range, and check the range of results */
+ mpfr_set_emin (saved_emin);
+ mpfr_set_emax (saved_emax);
+ inex_re = mpfr_check_range (mpc_realref (rop), MPC_INEX_RE(inex),
+ MPC_RND_RE (rnd));
+ inex_im = mpfr_check_range (mpc_imagref (rop), MPC_INEX_IM(inex),
+ MPC_RND_IM (rnd));
+
+ return MPC_INEX(inex_re, inex_im);
}
diff --git a/gcc/mpc/tests/Makefile.am b/gcc/mpc/tests/Makefile.am
index baa3e6329b..10116ad77d 100644
--- a/gcc/mpc/tests/Makefile.am
+++ b/gcc/mpc/tests/Makefile.am
@@ -1,6 +1,6 @@
## tests/Makefile.am -- Process this file with automake to produce Makefile.in
##
-## Copyright (C) 2008, 2009, 2010, 2011, 2012, 2013, 2016 INRIA
+## Copyright (C) 2008, 2009, 2010, 2011, 2012, 2013, 2016, 2020 INRIA
##
## This file is part of GNU MPC.
##
@@ -17,11 +17,17 @@
## You should have received a copy of the GNU Lesser General Public License
## along with this program. If not, see http://www.gnu.org/licenses/ .
-AM_CPPFLAGS = -I$(top_srcdir)/src
+AM_CPPFLAGS = -I$(top_srcdir)/src -I$(top_srcdir)
LDADD = libmpc-tests.la $(top_builddir)/src/libmpc.la
# let libtool create an executable instead of a shell script
# useful for tests with valgrind
-AM_LDFLAGS = -no-install
+# The -L$(top_builddir)/src/.libs option is necessary for some platforms,
+# such as HP-UX, when --with-gmp or --with-mpfr is used and an old MPC
+# library is already installed in the corresponding lib directories: its
+# purpose is to make sure that the local .libs comes first in the library
+# search path (otherwise the tests are linked against the old MPC library
+# by the LINK command -- see the generated Makefile).
+AM_LDFLAGS = -no-install -L$(top_builddir)/src/.libs
# LOADLIBES (documented in the "GNU make" manual and equivalent to LDLIBS)
# enables to compile a program foo.c in the test directory by simply doing
# "make foo".
@@ -31,13 +37,13 @@ LOADLIBES=$(DEFS) $(AM_CPPFLAGS) $(CPPFLAGS) $(CFLAGS) \
check_PROGRAMS = tabs tacos tacosh tadd tadd_fr tadd_si tadd_ui targ \
tasin tasinh tatan tatanh tcmp_abs tconj tcos tcosh \
- tdiv tdiv_2si tdiv_2ui \
- tdiv_fr tdiv_ui texp tfma tfr_div tfr_sub timag tio_str tlog tlog10 \
+ tdiv tdiv_2si tdiv_2ui tdiv_fr tdiv_ui tdot texp tfma tfr_div tfr_sub \
+ timag tio_str tlog tlog10 \
tmul tmul_2si tmul_2ui tmul_fr tmul_i tmul_si tmul_ui tneg tnorm tpow \
tpow_d tpow_fr tpow_ld tpow_si tpow_ui tpow_z tprec tproj treal \
treimref trootofunity \
tset tsin tsin_cos tsinh tsqr tsqrt tstrtoc tsub tsub_fr \
- tsub_ui tswap ttan ttanh tui_div tui_ui_sub tget_version exceptions
+ tsub_ui tsum tswap ttan ttanh tui_div tui_ui_sub tget_version exceptions
check_LTLIBRARIES=libmpc-tests.la
libmpc_tests_la_SOURCES = mpc-tests.h check_data.c clear_parameters.c \
diff --git a/gcc/mpc/tests/Makefile.in b/gcc/mpc/tests/Makefile.in
index 031638307a..c071888f26 100644
--- a/gcc/mpc/tests/Makefile.in
+++ b/gcc/mpc/tests/Makefile.in
@@ -1,7 +1,7 @@
-# Makefile.in generated by automake 1.15.1 from Makefile.am.
+# Makefile.in generated by automake 1.16.2 from Makefile.am.
# @configure_input@
-# Copyright (C) 1994-2017 Free Software Foundation, Inc.
+# Copyright (C) 1994-2020 Free Software Foundation, Inc.
# This Makefile.in is free software; the Free Software Foundation
# gives unlimited permission to copy and/or distribute it,
@@ -93,20 +93,20 @@ check_PROGRAMS = tabs$(EXEEXT) tacos$(EXEEXT) tacosh$(EXEEXT) \
tatan$(EXEEXT) tatanh$(EXEEXT) tcmp_abs$(EXEEXT) \
tconj$(EXEEXT) tcos$(EXEEXT) tcosh$(EXEEXT) tdiv$(EXEEXT) \
tdiv_2si$(EXEEXT) tdiv_2ui$(EXEEXT) tdiv_fr$(EXEEXT) \
- tdiv_ui$(EXEEXT) texp$(EXEEXT) tfma$(EXEEXT) tfr_div$(EXEEXT) \
- tfr_sub$(EXEEXT) timag$(EXEEXT) tio_str$(EXEEXT) tlog$(EXEEXT) \
- tlog10$(EXEEXT) tmul$(EXEEXT) tmul_2si$(EXEEXT) \
- tmul_2ui$(EXEEXT) tmul_fr$(EXEEXT) tmul_i$(EXEEXT) \
- tmul_si$(EXEEXT) tmul_ui$(EXEEXT) tneg$(EXEEXT) tnorm$(EXEEXT) \
- tpow$(EXEEXT) tpow_d$(EXEEXT) tpow_fr$(EXEEXT) \
- tpow_ld$(EXEEXT) tpow_si$(EXEEXT) tpow_ui$(EXEEXT) \
- tpow_z$(EXEEXT) tprec$(EXEEXT) tproj$(EXEEXT) treal$(EXEEXT) \
- treimref$(EXEEXT) trootofunity$(EXEEXT) tset$(EXEEXT) \
- tsin$(EXEEXT) tsin_cos$(EXEEXT) tsinh$(EXEEXT) tsqr$(EXEEXT) \
- tsqrt$(EXEEXT) tstrtoc$(EXEEXT) tsub$(EXEEXT) tsub_fr$(EXEEXT) \
- tsub_ui$(EXEEXT) tswap$(EXEEXT) ttan$(EXEEXT) ttanh$(EXEEXT) \
- tui_div$(EXEEXT) tui_ui_sub$(EXEEXT) tget_version$(EXEEXT) \
- exceptions$(EXEEXT)
+ tdiv_ui$(EXEEXT) tdot$(EXEEXT) texp$(EXEEXT) tfma$(EXEEXT) \
+ tfr_div$(EXEEXT) tfr_sub$(EXEEXT) timag$(EXEEXT) \
+ tio_str$(EXEEXT) tlog$(EXEEXT) tlog10$(EXEEXT) tmul$(EXEEXT) \
+ tmul_2si$(EXEEXT) tmul_2ui$(EXEEXT) tmul_fr$(EXEEXT) \
+ tmul_i$(EXEEXT) tmul_si$(EXEEXT) tmul_ui$(EXEEXT) \
+ tneg$(EXEEXT) tnorm$(EXEEXT) tpow$(EXEEXT) tpow_d$(EXEEXT) \
+ tpow_fr$(EXEEXT) tpow_ld$(EXEEXT) tpow_si$(EXEEXT) \
+ tpow_ui$(EXEEXT) tpow_z$(EXEEXT) tprec$(EXEEXT) tproj$(EXEEXT) \
+ treal$(EXEEXT) treimref$(EXEEXT) trootofunity$(EXEEXT) \
+ tset$(EXEEXT) tsin$(EXEEXT) tsin_cos$(EXEEXT) tsinh$(EXEEXT) \
+ tsqr$(EXEEXT) tsqrt$(EXEEXT) tstrtoc$(EXEEXT) tsub$(EXEEXT) \
+ tsub_fr$(EXEEXT) tsub_ui$(EXEEXT) tsum$(EXEEXT) tswap$(EXEEXT) \
+ ttan$(EXEEXT) ttanh$(EXEEXT) tui_div$(EXEEXT) \
+ tui_ui_sub$(EXEEXT) tget_version$(EXEEXT) exceptions$(EXEEXT)
subdir = tests
ACLOCAL_M4 = $(top_srcdir)/aclocal.m4
am__aclocal_m4_deps = $(top_srcdir)/m4/ax_c_check_flag.m4 \
@@ -225,6 +225,10 @@ tdiv_ui_SOURCES = tdiv_ui.c
tdiv_ui_OBJECTS = tdiv_ui.$(OBJEXT)
tdiv_ui_LDADD = $(LDADD)
tdiv_ui_DEPENDENCIES = libmpc-tests.la $(top_builddir)/src/libmpc.la
+tdot_SOURCES = tdot.c
+tdot_OBJECTS = tdot.$(OBJEXT)
+tdot_LDADD = $(LDADD)
+tdot_DEPENDENCIES = libmpc-tests.la $(top_builddir)/src/libmpc.la
texp_SOURCES = texp.c
texp_OBJECTS = texp.$(OBJEXT)
texp_LDADD = $(LDADD)
@@ -387,6 +391,10 @@ tsub_ui_SOURCES = tsub_ui.c
tsub_ui_OBJECTS = tsub_ui.$(OBJEXT)
tsub_ui_LDADD = $(LDADD)
tsub_ui_DEPENDENCIES = libmpc-tests.la $(top_builddir)/src/libmpc.la
+tsum_SOURCES = tsum.c
+tsum_OBJECTS = tsum.$(OBJEXT)
+tsum_LDADD = $(LDADD)
+tsum_DEPENDENCIES = libmpc-tests.la $(top_builddir)/src/libmpc.la
tswap_SOURCES = tswap.c
tswap_OBJECTS = tswap.$(OBJEXT)
tswap_LDADD = $(LDADD)
@@ -421,8 +429,52 @@ am__v_at_ = $(am__v_at_@AM_DEFAULT_V@)
am__v_at_0 = @
am__v_at_1 =
DEFAULT_INCLUDES = -I.@am__isrc@ -I$(top_builddir)
-depcomp = $(SHELL) $(top_srcdir)/depcomp
-am__depfiles_maybe = depfiles
+depcomp = $(SHELL) $(top_srcdir)/build-aux/depcomp
+am__maybe_remake_depfiles = depfiles
+am__depfiles_remade = ./$(DEPDIR)/check_data.Plo \
+ ./$(DEPDIR)/clear_parameters.Plo \
+ ./$(DEPDIR)/close_datafile.Plo ./$(DEPDIR)/comparisons.Plo \
+ ./$(DEPDIR)/copy_parameter.Plo ./$(DEPDIR)/double_rounding.Plo \
+ ./$(DEPDIR)/exceptions.Po ./$(DEPDIR)/init_parameters.Plo \
+ ./$(DEPDIR)/mpfr_flags.Plo ./$(DEPDIR)/open_datafile.Plo \
+ ./$(DEPDIR)/print_parameter.Plo ./$(DEPDIR)/random.Plo \
+ ./$(DEPDIR)/read_data.Plo ./$(DEPDIR)/read_description.Plo \
+ ./$(DEPDIR)/read_line.Plo ./$(DEPDIR)/rounding.Plo \
+ ./$(DEPDIR)/setprec_parameters.Plo ./$(DEPDIR)/tabs.Po \
+ ./$(DEPDIR)/tacos.Po ./$(DEPDIR)/tacosh.Po ./$(DEPDIR)/tadd.Po \
+ ./$(DEPDIR)/tadd_fr.Po ./$(DEPDIR)/tadd_si.Po \
+ ./$(DEPDIR)/tadd_ui.Po ./$(DEPDIR)/targ.Po \
+ ./$(DEPDIR)/tasin.Po ./$(DEPDIR)/tasinh.Po \
+ ./$(DEPDIR)/tatan.Po ./$(DEPDIR)/tatanh.Po \
+ ./$(DEPDIR)/tcmp_abs.Po ./$(DEPDIR)/tconj.Po \
+ ./$(DEPDIR)/tcos.Po ./$(DEPDIR)/tcosh.Po ./$(DEPDIR)/tdiv.Po \
+ ./$(DEPDIR)/tdiv_2si.Po ./$(DEPDIR)/tdiv_2ui.Po \
+ ./$(DEPDIR)/tdiv_fr.Po ./$(DEPDIR)/tdiv_ui.Po \
+ ./$(DEPDIR)/tdot.Po ./$(DEPDIR)/texp.Po ./$(DEPDIR)/tfma.Po \
+ ./$(DEPDIR)/tfr_div.Po ./$(DEPDIR)/tfr_sub.Po \
+ ./$(DEPDIR)/tget_version.Po ./$(DEPDIR)/timag.Po \
+ ./$(DEPDIR)/tio_str.Po ./$(DEPDIR)/tlog.Po \
+ ./$(DEPDIR)/tlog10.Po ./$(DEPDIR)/tmul.Po \
+ ./$(DEPDIR)/tmul_2si.Po ./$(DEPDIR)/tmul_2ui.Po \
+ ./$(DEPDIR)/tmul_fr.Po ./$(DEPDIR)/tmul_i.Po \
+ ./$(DEPDIR)/tmul_si.Po ./$(DEPDIR)/tmul_ui.Po \
+ ./$(DEPDIR)/tneg.Po ./$(DEPDIR)/tnorm.Po \
+ ./$(DEPDIR)/tpl_gmp.Plo ./$(DEPDIR)/tpl_mpc.Plo \
+ ./$(DEPDIR)/tpl_mpfr.Plo ./$(DEPDIR)/tpl_native.Plo \
+ ./$(DEPDIR)/tpow.Po ./$(DEPDIR)/tpow_d.Po \
+ ./$(DEPDIR)/tpow_fr.Po ./$(DEPDIR)/tpow_ld.Po \
+ ./$(DEPDIR)/tpow_si.Po ./$(DEPDIR)/tpow_ui.Po \
+ ./$(DEPDIR)/tpow_z.Po ./$(DEPDIR)/tprec.Po \
+ ./$(DEPDIR)/tproj.Po ./$(DEPDIR)/treal.Po \
+ ./$(DEPDIR)/treimref.Po ./$(DEPDIR)/trootofunity.Po \
+ ./$(DEPDIR)/tset.Po ./$(DEPDIR)/tsin.Po \
+ ./$(DEPDIR)/tsin_cos.Po ./$(DEPDIR)/tsinh.Po \
+ ./$(DEPDIR)/tsqr.Po ./$(DEPDIR)/tsqrt.Po \
+ ./$(DEPDIR)/tstrtoc.Po ./$(DEPDIR)/tsub.Po \
+ ./$(DEPDIR)/tsub_fr.Po ./$(DEPDIR)/tsub_ui.Po \
+ ./$(DEPDIR)/tsum.Po ./$(DEPDIR)/tswap.Po ./$(DEPDIR)/ttan.Po \
+ ./$(DEPDIR)/ttanh.Po ./$(DEPDIR)/tui_div.Po \
+ ./$(DEPDIR)/tui_ui_sub.Po
am__mv = mv -f
COMPILE = $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) \
$(CPPFLAGS) $(AM_CFLAGS) $(CFLAGS)
@@ -445,25 +497,25 @@ am__v_CCLD_1 =
SOURCES = $(libmpc_tests_la_SOURCES) exceptions.c tabs.c tacos.c \
tacosh.c tadd.c tadd_fr.c tadd_si.c tadd_ui.c targ.c tasin.c \
tasinh.c tatan.c tatanh.c tcmp_abs.c tconj.c tcos.c tcosh.c \
- tdiv.c tdiv_2si.c tdiv_2ui.c tdiv_fr.c tdiv_ui.c texp.c tfma.c \
- tfr_div.c tfr_sub.c tget_version.c timag.c tio_str.c tlog.c \
- tlog10.c tmul.c tmul_2si.c tmul_2ui.c tmul_fr.c tmul_i.c \
- tmul_si.c tmul_ui.c tneg.c tnorm.c tpow.c tpow_d.c tpow_fr.c \
- tpow_ld.c tpow_si.c tpow_ui.c tpow_z.c tprec.c tproj.c treal.c \
- treimref.c trootofunity.c tset.c tsin.c tsin_cos.c tsinh.c \
- tsqr.c tsqrt.c tstrtoc.c tsub.c tsub_fr.c tsub_ui.c tswap.c \
- ttan.c ttanh.c tui_div.c tui_ui_sub.c
+ tdiv.c tdiv_2si.c tdiv_2ui.c tdiv_fr.c tdiv_ui.c tdot.c texp.c \
+ tfma.c tfr_div.c tfr_sub.c tget_version.c timag.c tio_str.c \
+ tlog.c tlog10.c tmul.c tmul_2si.c tmul_2ui.c tmul_fr.c \
+ tmul_i.c tmul_si.c tmul_ui.c tneg.c tnorm.c tpow.c tpow_d.c \
+ tpow_fr.c tpow_ld.c tpow_si.c tpow_ui.c tpow_z.c tprec.c \
+ tproj.c treal.c treimref.c trootofunity.c tset.c tsin.c \
+ tsin_cos.c tsinh.c tsqr.c tsqrt.c tstrtoc.c tsub.c tsub_fr.c \
+ tsub_ui.c tsum.c tswap.c ttan.c ttanh.c tui_div.c tui_ui_sub.c
DIST_SOURCES = $(libmpc_tests_la_SOURCES) exceptions.c tabs.c tacos.c \
tacosh.c tadd.c tadd_fr.c tadd_si.c tadd_ui.c targ.c tasin.c \
tasinh.c tatan.c tatanh.c tcmp_abs.c tconj.c tcos.c tcosh.c \
- tdiv.c tdiv_2si.c tdiv_2ui.c tdiv_fr.c tdiv_ui.c texp.c tfma.c \
- tfr_div.c tfr_sub.c tget_version.c timag.c tio_str.c tlog.c \
- tlog10.c tmul.c tmul_2si.c tmul_2ui.c tmul_fr.c tmul_i.c \
- tmul_si.c tmul_ui.c tneg.c tnorm.c tpow.c tpow_d.c tpow_fr.c \
- tpow_ld.c tpow_si.c tpow_ui.c tpow_z.c tprec.c tproj.c treal.c \
- treimref.c trootofunity.c tset.c tsin.c tsin_cos.c tsinh.c \
- tsqr.c tsqrt.c tstrtoc.c tsub.c tsub_fr.c tsub_ui.c tswap.c \
- ttan.c ttanh.c tui_div.c tui_ui_sub.c
+ tdiv.c tdiv_2si.c tdiv_2ui.c tdiv_fr.c tdiv_ui.c tdot.c texp.c \
+ tfma.c tfr_div.c tfr_sub.c tget_version.c timag.c tio_str.c \
+ tlog.c tlog10.c tmul.c tmul_2si.c tmul_2ui.c tmul_fr.c \
+ tmul_i.c tmul_si.c tmul_ui.c tneg.c tnorm.c tpow.c tpow_d.c \
+ tpow_fr.c tpow_ld.c tpow_si.c tpow_ui.c tpow_z.c tprec.c \
+ tproj.c treal.c treimref.c trootofunity.c tset.c tsin.c \
+ tsin_cos.c tsinh.c tsqr.c tsqrt.c tstrtoc.c tsub.c tsub_fr.c \
+ tsub_ui.c tsum.c tswap.c ttan.c ttanh.c tui_div.c tui_ui_sub.c
am__can_run_installinfo = \
case $$AM_UPDATE_INFO_DIR in \
n|no|NO) false;; \
@@ -674,7 +726,7 @@ RECHECK_LOGS = $(TEST_LOGS)
AM_RECURSIVE_TARGETS = check recheck
TEST_SUITE_LOG = test-suite.log
TEST_EXTENSIONS = @EXEEXT@ .test
-LOG_DRIVER = $(SHELL) $(top_srcdir)/test-driver
+LOG_DRIVER = $(SHELL) $(top_srcdir)/build-aux/test-driver
LOG_COMPILE = $(LOG_COMPILER) $(AM_LOG_FLAGS) $(LOG_FLAGS)
am__set_b = \
case '$@' in \
@@ -689,11 +741,12 @@ am__set_b = \
am__test_logs1 = $(TESTS:=.log)
am__test_logs2 = $(am__test_logs1:@EXEEXT@.log=.log)
TEST_LOGS = $(am__test_logs2:.test.log=.log)
-TEST_LOG_DRIVER = $(SHELL) $(top_srcdir)/test-driver
+TEST_LOG_DRIVER = $(SHELL) $(top_srcdir)/build-aux/test-driver
TEST_LOG_COMPILE = $(TEST_LOG_COMPILER) $(AM_TEST_LOG_FLAGS) \
$(TEST_LOG_FLAGS)
-am__DIST_COMMON = $(srcdir)/Makefile.in $(top_srcdir)/depcomp \
- $(top_srcdir)/test-driver
+am__DIST_COMMON = $(srcdir)/Makefile.in \
+ $(top_srcdir)/build-aux/depcomp \
+ $(top_srcdir)/build-aux/test-driver
DISTFILES = $(DIST_COMMON) $(DIST_SOURCES) $(TEXINFOS) $(EXTRA_DIST)
ACLOCAL = @ACLOCAL@
AMTAR = @AMTAR@
@@ -819,11 +872,17 @@ target_alias = @target_alias@
top_build_prefix = @top_build_prefix@
top_builddir = @top_builddir@
top_srcdir = @top_srcdir@
-AM_CPPFLAGS = -I$(top_srcdir)/src
+AM_CPPFLAGS = -I$(top_srcdir)/src -I$(top_srcdir)
LDADD = libmpc-tests.la $(top_builddir)/src/libmpc.la
# let libtool create an executable instead of a shell script
# useful for tests with valgrind
-AM_LDFLAGS = -no-install
+# The -L$(top_builddir)/src/.libs option is necessary for some platforms,
+# such as HP-UX, when --with-gmp or --with-mpfr is used and an old MPC
+# library is already installed in the corresponding lib directories: its
+# purpose is to make sure that the local .libs comes first in the library
+# search path (otherwise the tests are linked against the old MPC library
+# by the LINK command -- see the generated Makefile).
+AM_LDFLAGS = -no-install -L$(top_builddir)/src/.libs
# LOADLIBES (documented in the "GNU make" manual and equivalent to LDLIBS)
# enables to compile a program foo.c in the test directory by simply doing
# "make foo".
@@ -885,8 +944,8 @@ Makefile: $(srcdir)/Makefile.in $(top_builddir)/config.status
*config.status*) \
cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh;; \
*) \
- echo ' cd $(top_builddir) && $(SHELL) ./config.status $(subdir)/$@ $(am__depfiles_maybe)'; \
- cd $(top_builddir) && $(SHELL) ./config.status $(subdir)/$@ $(am__depfiles_maybe);; \
+ echo ' cd $(top_builddir) && $(SHELL) ./config.status $(subdir)/$@ $(am__maybe_remake_depfiles)'; \
+ cd $(top_builddir) && $(SHELL) ./config.status $(subdir)/$@ $(am__maybe_remake_depfiles);; \
esac;
$(top_builddir)/config.status: $(top_srcdir)/configure $(CONFIG_STATUS_DEPENDENCIES)
@@ -898,6 +957,15 @@ $(ACLOCAL_M4): @MAINTAINER_MODE_TRUE@ $(am__aclocal_m4_deps)
cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh
$(am__aclocal_m4_deps):
+clean-checkPROGRAMS:
+ @list='$(check_PROGRAMS)'; test -n "$$list" || exit 0; \
+ echo " rm -f" $$list; \
+ rm -f $$list || exit $$?; \
+ test -n "$(EXEEXT)" || exit 0; \
+ list=`for p in $$list; do echo "$$p"; done | sed 's/$(EXEEXT)$$//'`; \
+ echo " rm -f" $$list; \
+ rm -f $$list
+
clean-checkLTLIBRARIES:
-test -z "$(check_LTLIBRARIES)" || rm -f $(check_LTLIBRARIES)
@list='$(check_LTLIBRARIES)'; \
@@ -912,15 +980,6 @@ clean-checkLTLIBRARIES:
libmpc-tests.la: $(libmpc_tests_la_OBJECTS) $(libmpc_tests_la_DEPENDENCIES) $(EXTRA_libmpc_tests_la_DEPENDENCIES)
$(AM_V_CCLD)$(LINK) $(libmpc_tests_la_OBJECTS) $(libmpc_tests_la_LIBADD) $(LIBS)
-clean-checkPROGRAMS:
- @list='$(check_PROGRAMS)'; test -n "$$list" || exit 0; \
- echo " rm -f" $$list; \
- rm -f $$list || exit $$?; \
- test -n "$(EXEEXT)" || exit 0; \
- list=`for p in $$list; do echo "$$p"; done | sed 's/$(EXEEXT)$$//'`; \
- echo " rm -f" $$list; \
- rm -f $$list
-
exceptions$(EXEEXT): $(exceptions_OBJECTS) $(exceptions_DEPENDENCIES) $(EXTRA_exceptions_DEPENDENCIES)
@rm -f exceptions$(EXEEXT)
$(AM_V_CCLD)$(LINK) $(exceptions_OBJECTS) $(exceptions_LDADD) $(LIBS)
@@ -1009,6 +1068,10 @@ tdiv_ui$(EXEEXT): $(tdiv_ui_OBJECTS) $(tdiv_ui_DEPENDENCIES) $(EXTRA_tdiv_ui_DEP
@rm -f tdiv_ui$(EXEEXT)
$(AM_V_CCLD)$(LINK) $(tdiv_ui_OBJECTS) $(tdiv_ui_LDADD) $(LIBS)
+tdot$(EXEEXT): $(tdot_OBJECTS) $(tdot_DEPENDENCIES) $(EXTRA_tdot_DEPENDENCIES)
+ @rm -f tdot$(EXEEXT)
+ $(AM_V_CCLD)$(LINK) $(tdot_OBJECTS) $(tdot_LDADD) $(LIBS)
+
texp$(EXEEXT): $(texp_OBJECTS) $(texp_DEPENDENCIES) $(EXTRA_texp_DEPENDENCIES)
@rm -f texp$(EXEEXT)
$(AM_V_CCLD)$(LINK) $(texp_OBJECTS) $(texp_LDADD) $(LIBS)
@@ -1169,6 +1232,10 @@ tsub_ui$(EXEEXT): $(tsub_ui_OBJECTS) $(tsub_ui_DEPENDENCIES) $(EXTRA_tsub_ui_DEP
@rm -f tsub_ui$(EXEEXT)
$(AM_V_CCLD)$(LINK) $(tsub_ui_OBJECTS) $(tsub_ui_LDADD) $(LIBS)
+tsum$(EXEEXT): $(tsum_OBJECTS) $(tsum_DEPENDENCIES) $(EXTRA_tsum_DEPENDENCIES)
+ @rm -f tsum$(EXEEXT)
+ $(AM_V_CCLD)$(LINK) $(tsum_OBJECTS) $(tsum_LDADD) $(LIBS)
+
tswap$(EXEEXT): $(tswap_OBJECTS) $(tswap_DEPENDENCIES) $(EXTRA_tswap_DEPENDENCIES)
@rm -f tswap$(EXEEXT)
$(AM_V_CCLD)$(LINK) $(tswap_OBJECTS) $(tswap_LDADD) $(LIBS)
@@ -1195,93 +1262,101 @@ mostlyclean-compile:
distclean-compile:
-rm -f *.tab.c
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/check_data.Plo@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/clear_parameters.Plo@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/close_datafile.Plo@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/comparisons.Plo@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/copy_parameter.Plo@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/double_rounding.Plo@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/exceptions.Po@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/init_parameters.Plo@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/mpfr_flags.Plo@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/open_datafile.Plo@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/print_parameter.Plo@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/random.Plo@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/read_data.Plo@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/read_description.Plo@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/read_line.Plo@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/rounding.Plo@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/setprec_parameters.Plo@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tabs.Po@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tacos.Po@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tacosh.Po@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tadd.Po@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tadd_fr.Po@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tadd_si.Po@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tadd_ui.Po@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/targ.Po@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tasin.Po@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tasinh.Po@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tatan.Po@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tatanh.Po@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tcmp_abs.Po@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tconj.Po@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tcos.Po@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tcosh.Po@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tdiv.Po@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tdiv_2si.Po@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tdiv_2ui.Po@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tdiv_fr.Po@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tdiv_ui.Po@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/texp.Po@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tfma.Po@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tfr_div.Po@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tfr_sub.Po@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tget_version.Po@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/timag.Po@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tio_str.Po@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tlog.Po@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tlog10.Po@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tmul.Po@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tmul_2si.Po@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tmul_2ui.Po@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tmul_fr.Po@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tmul_i.Po@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tmul_si.Po@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tmul_ui.Po@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tneg.Po@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tnorm.Po@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tpl_gmp.Plo@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tpl_mpc.Plo@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tpl_mpfr.Plo@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tpl_native.Plo@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tpow.Po@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tpow_d.Po@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tpow_fr.Po@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tpow_ld.Po@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tpow_si.Po@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tpow_ui.Po@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tpow_z.Po@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tprec.Po@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tproj.Po@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/treal.Po@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/treimref.Po@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/trootofunity.Po@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tset.Po@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tsin.Po@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tsin_cos.Po@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tsinh.Po@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tsqr.Po@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tsqrt.Po@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tstrtoc.Po@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tsub.Po@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tsub_fr.Po@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tsub_ui.Po@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tswap.Po@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/ttan.Po@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/ttanh.Po@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tui_div.Po@am__quote@
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tui_ui_sub.Po@am__quote@
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/check_data.Plo@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/clear_parameters.Plo@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/close_datafile.Plo@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/comparisons.Plo@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/copy_parameter.Plo@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/double_rounding.Plo@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/exceptions.Po@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/init_parameters.Plo@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/mpfr_flags.Plo@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/open_datafile.Plo@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/print_parameter.Plo@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/random.Plo@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/read_data.Plo@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/read_description.Plo@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/read_line.Plo@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/rounding.Plo@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/setprec_parameters.Plo@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tabs.Po@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tacos.Po@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tacosh.Po@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tadd.Po@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tadd_fr.Po@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tadd_si.Po@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tadd_ui.Po@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/targ.Po@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tasin.Po@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tasinh.Po@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tatan.Po@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tatanh.Po@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tcmp_abs.Po@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tconj.Po@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tcos.Po@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tcosh.Po@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tdiv.Po@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tdiv_2si.Po@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tdiv_2ui.Po@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tdiv_fr.Po@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tdiv_ui.Po@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tdot.Po@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/texp.Po@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tfma.Po@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tfr_div.Po@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tfr_sub.Po@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tget_version.Po@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/timag.Po@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tio_str.Po@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tlog.Po@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tlog10.Po@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tmul.Po@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tmul_2si.Po@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tmul_2ui.Po@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tmul_fr.Po@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tmul_i.Po@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tmul_si.Po@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tmul_ui.Po@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tneg.Po@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tnorm.Po@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tpl_gmp.Plo@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tpl_mpc.Plo@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tpl_mpfr.Plo@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tpl_native.Plo@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tpow.Po@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tpow_d.Po@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tpow_fr.Po@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tpow_ld.Po@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tpow_si.Po@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tpow_ui.Po@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tpow_z.Po@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tprec.Po@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tproj.Po@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/treal.Po@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/treimref.Po@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/trootofunity.Po@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tset.Po@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tsin.Po@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tsin_cos.Po@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tsinh.Po@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tsqr.Po@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tsqrt.Po@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tstrtoc.Po@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tsub.Po@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tsub_fr.Po@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tsub_ui.Po@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tsum.Po@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tswap.Po@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/ttan.Po@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/ttanh.Po@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tui_div.Po@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tui_ui_sub.Po@am__quote@ # am--include-marker
+
+$(am__depfiles_remade):
+ @$(MKDIR_P) $(@D)
+ @echo '# dummy' >$@-t && $(am__mv) $@-t $@
+
+am--depfiles: $(am__depfiles_remade)
.c.o:
@am__fastdepCC_TRUE@ $(AM_V_CC)$(COMPILE) -MT $@ -MD -MP -MF $(DEPDIR)/$*.Tpo -c -o $@ $<
@@ -1482,7 +1557,7 @@ $(TEST_SUITE_LOG): $(TEST_LOGS)
fi; \
$$success || exit 1
-check-TESTS:
+check-TESTS: $(check_PROGRAMS) $(check_LTLIBRARIES)
@list='$(RECHECK_LOGS)'; test -z "$$list" || rm -f $$list
@list='$(RECHECK_LOGS:.log=.trs)'; test -z "$$list" || rm -f $$list
@test -z "$(TEST_SUITE_LOG)" || rm -f $(TEST_SUITE_LOG)
@@ -1492,7 +1567,7 @@ check-TESTS:
log_list=`echo $$log_list`; trs_list=`echo $$trs_list`; \
$(MAKE) $(AM_MAKEFLAGS) $(TEST_SUITE_LOG) TEST_LOGS="$$log_list"; \
exit $$?;
-recheck: all $(check_LTLIBRARIES) $(check_PROGRAMS)
+recheck: all $(check_PROGRAMS) $(check_LTLIBRARIES)
@test -z "$(TEST_SUITE_LOG)" || rm -f $(TEST_SUITE_LOG)
@set +e; $(am__set_TESTS_bases); \
bases=`for i in $$bases; do echo $$i; done \
@@ -1650,6 +1725,13 @@ tdiv_ui.log: tdiv_ui$(EXEEXT)
--log-file $$b.log --trs-file $$b.trs \
$(am__common_driver_flags) $(AM_LOG_DRIVER_FLAGS) $(LOG_DRIVER_FLAGS) -- $(LOG_COMPILE) \
"$$tst" $(AM_TESTS_FD_REDIRECT)
+tdot.log: tdot$(EXEEXT)
+ @p='tdot$(EXEEXT)'; \
+ b='tdot'; \
+ $(am__check_pre) $(LOG_DRIVER) --test-name "$$f" \
+ --log-file $$b.log --trs-file $$b.trs \
+ $(am__common_driver_flags) $(AM_LOG_DRIVER_FLAGS) $(LOG_DRIVER_FLAGS) -- $(LOG_COMPILE) \
+ "$$tst" $(AM_TESTS_FD_REDIRECT)
texp.log: texp$(EXEEXT)
@p='texp$(EXEEXT)'; \
b='texp'; \
@@ -1923,6 +2005,13 @@ tsub_ui.log: tsub_ui$(EXEEXT)
--log-file $$b.log --trs-file $$b.trs \
$(am__common_driver_flags) $(AM_LOG_DRIVER_FLAGS) $(LOG_DRIVER_FLAGS) -- $(LOG_COMPILE) \
"$$tst" $(AM_TESTS_FD_REDIRECT)
+tsum.log: tsum$(EXEEXT)
+ @p='tsum$(EXEEXT)'; \
+ b='tsum'; \
+ $(am__check_pre) $(LOG_DRIVER) --test-name "$$f" \
+ --log-file $$b.log --trs-file $$b.trs \
+ $(am__common_driver_flags) $(AM_LOG_DRIVER_FLAGS) $(LOG_DRIVER_FLAGS) -- $(LOG_COMPILE) \
+ "$$tst" $(AM_TESTS_FD_REDIRECT)
tswap.log: tswap$(EXEEXT)
@p='tswap$(EXEEXT)'; \
b='tswap'; \
@@ -1987,7 +2076,10 @@ exceptions.log: exceptions$(EXEEXT)
@am__EXEEXT_TRUE@ $(am__common_driver_flags) $(AM_TEST_LOG_DRIVER_FLAGS) $(TEST_LOG_DRIVER_FLAGS) -- $(TEST_LOG_COMPILE) \
@am__EXEEXT_TRUE@ "$$tst" $(AM_TESTS_FD_REDIRECT)
-distdir: $(DISTFILES)
+distdir: $(BUILT_SOURCES)
+ $(MAKE) $(AM_MAKEFLAGS) distdir-am
+
+distdir-am: $(DISTFILES)
@srcdirstrip=`echo "$(srcdir)" | sed 's/[].[^$$\\*]/\\\\&/g'`; \
topsrcdirstrip=`echo "$(top_srcdir)" | sed 's/[].[^$$\\*]/\\\\&/g'`; \
list='$(DISTFILES)'; \
@@ -2018,7 +2110,7 @@ distdir: $(DISTFILES)
fi; \
done
check-am: all-am
- $(MAKE) $(AM_MAKEFLAGS) $(check_LTLIBRARIES) $(check_PROGRAMS)
+ $(MAKE) $(AM_MAKEFLAGS) $(check_PROGRAMS) $(check_LTLIBRARIES)
$(MAKE) $(AM_MAKEFLAGS) check-TESTS
check: check-am
all-am: Makefile
@@ -2063,7 +2155,95 @@ clean-am: clean-checkLTLIBRARIES clean-checkPROGRAMS clean-generic \
clean-libtool mostlyclean-am
distclean: distclean-am
- -rm -rf ./$(DEPDIR)
+ -rm -f ./$(DEPDIR)/check_data.Plo
+ -rm -f ./$(DEPDIR)/clear_parameters.Plo
+ -rm -f ./$(DEPDIR)/close_datafile.Plo
+ -rm -f ./$(DEPDIR)/comparisons.Plo
+ -rm -f ./$(DEPDIR)/copy_parameter.Plo
+ -rm -f ./$(DEPDIR)/double_rounding.Plo
+ -rm -f ./$(DEPDIR)/exceptions.Po
+ -rm -f ./$(DEPDIR)/init_parameters.Plo
+ -rm -f ./$(DEPDIR)/mpfr_flags.Plo
+ -rm -f ./$(DEPDIR)/open_datafile.Plo
+ -rm -f ./$(DEPDIR)/print_parameter.Plo
+ -rm -f ./$(DEPDIR)/random.Plo
+ -rm -f ./$(DEPDIR)/read_data.Plo
+ -rm -f ./$(DEPDIR)/read_description.Plo
+ -rm -f ./$(DEPDIR)/read_line.Plo
+ -rm -f ./$(DEPDIR)/rounding.Plo
+ -rm -f ./$(DEPDIR)/setprec_parameters.Plo
+ -rm -f ./$(DEPDIR)/tabs.Po
+ -rm -f ./$(DEPDIR)/tacos.Po
+ -rm -f ./$(DEPDIR)/tacosh.Po
+ -rm -f ./$(DEPDIR)/tadd.Po
+ -rm -f ./$(DEPDIR)/tadd_fr.Po
+ -rm -f ./$(DEPDIR)/tadd_si.Po
+ -rm -f ./$(DEPDIR)/tadd_ui.Po
+ -rm -f ./$(DEPDIR)/targ.Po
+ -rm -f ./$(DEPDIR)/tasin.Po
+ -rm -f ./$(DEPDIR)/tasinh.Po
+ -rm -f ./$(DEPDIR)/tatan.Po
+ -rm -f ./$(DEPDIR)/tatanh.Po
+ -rm -f ./$(DEPDIR)/tcmp_abs.Po
+ -rm -f ./$(DEPDIR)/tconj.Po
+ -rm -f ./$(DEPDIR)/tcos.Po
+ -rm -f ./$(DEPDIR)/tcosh.Po
+ -rm -f ./$(DEPDIR)/tdiv.Po
+ -rm -f ./$(DEPDIR)/tdiv_2si.Po
+ -rm -f ./$(DEPDIR)/tdiv_2ui.Po
+ -rm -f ./$(DEPDIR)/tdiv_fr.Po
+ -rm -f ./$(DEPDIR)/tdiv_ui.Po
+ -rm -f ./$(DEPDIR)/tdot.Po
+ -rm -f ./$(DEPDIR)/texp.Po
+ -rm -f ./$(DEPDIR)/tfma.Po
+ -rm -f ./$(DEPDIR)/tfr_div.Po
+ -rm -f ./$(DEPDIR)/tfr_sub.Po
+ -rm -f ./$(DEPDIR)/tget_version.Po
+ -rm -f ./$(DEPDIR)/timag.Po
+ -rm -f ./$(DEPDIR)/tio_str.Po
+ -rm -f ./$(DEPDIR)/tlog.Po
+ -rm -f ./$(DEPDIR)/tlog10.Po
+ -rm -f ./$(DEPDIR)/tmul.Po
+ -rm -f ./$(DEPDIR)/tmul_2si.Po
+ -rm -f ./$(DEPDIR)/tmul_2ui.Po
+ -rm -f ./$(DEPDIR)/tmul_fr.Po
+ -rm -f ./$(DEPDIR)/tmul_i.Po
+ -rm -f ./$(DEPDIR)/tmul_si.Po
+ -rm -f ./$(DEPDIR)/tmul_ui.Po
+ -rm -f ./$(DEPDIR)/tneg.Po
+ -rm -f ./$(DEPDIR)/tnorm.Po
+ -rm -f ./$(DEPDIR)/tpl_gmp.Plo
+ -rm -f ./$(DEPDIR)/tpl_mpc.Plo
+ -rm -f ./$(DEPDIR)/tpl_mpfr.Plo
+ -rm -f ./$(DEPDIR)/tpl_native.Plo
+ -rm -f ./$(DEPDIR)/tpow.Po
+ -rm -f ./$(DEPDIR)/tpow_d.Po
+ -rm -f ./$(DEPDIR)/tpow_fr.Po
+ -rm -f ./$(DEPDIR)/tpow_ld.Po
+ -rm -f ./$(DEPDIR)/tpow_si.Po
+ -rm -f ./$(DEPDIR)/tpow_ui.Po
+ -rm -f ./$(DEPDIR)/tpow_z.Po
+ -rm -f ./$(DEPDIR)/tprec.Po
+ -rm -f ./$(DEPDIR)/tproj.Po
+ -rm -f ./$(DEPDIR)/treal.Po
+ -rm -f ./$(DEPDIR)/treimref.Po
+ -rm -f ./$(DEPDIR)/trootofunity.Po
+ -rm -f ./$(DEPDIR)/tset.Po
+ -rm -f ./$(DEPDIR)/tsin.Po
+ -rm -f ./$(DEPDIR)/tsin_cos.Po
+ -rm -f ./$(DEPDIR)/tsinh.Po
+ -rm -f ./$(DEPDIR)/tsqr.Po
+ -rm -f ./$(DEPDIR)/tsqrt.Po
+ -rm -f ./$(DEPDIR)/tstrtoc.Po
+ -rm -f ./$(DEPDIR)/tsub.Po
+ -rm -f ./$(DEPDIR)/tsub_fr.Po
+ -rm -f ./$(DEPDIR)/tsub_ui.Po
+ -rm -f ./$(DEPDIR)/tsum.Po
+ -rm -f ./$(DEPDIR)/tswap.Po
+ -rm -f ./$(DEPDIR)/ttan.Po
+ -rm -f ./$(DEPDIR)/ttanh.Po
+ -rm -f ./$(DEPDIR)/tui_div.Po
+ -rm -f ./$(DEPDIR)/tui_ui_sub.Po
-rm -f Makefile
distclean-am: clean-am distclean-compile distclean-generic \
distclean-tags
@@ -2109,7 +2289,95 @@ install-ps-am:
installcheck-am:
maintainer-clean: maintainer-clean-am
- -rm -rf ./$(DEPDIR)
+ -rm -f ./$(DEPDIR)/check_data.Plo
+ -rm -f ./$(DEPDIR)/clear_parameters.Plo
+ -rm -f ./$(DEPDIR)/close_datafile.Plo
+ -rm -f ./$(DEPDIR)/comparisons.Plo
+ -rm -f ./$(DEPDIR)/copy_parameter.Plo
+ -rm -f ./$(DEPDIR)/double_rounding.Plo
+ -rm -f ./$(DEPDIR)/exceptions.Po
+ -rm -f ./$(DEPDIR)/init_parameters.Plo
+ -rm -f ./$(DEPDIR)/mpfr_flags.Plo
+ -rm -f ./$(DEPDIR)/open_datafile.Plo
+ -rm -f ./$(DEPDIR)/print_parameter.Plo
+ -rm -f ./$(DEPDIR)/random.Plo
+ -rm -f ./$(DEPDIR)/read_data.Plo
+ -rm -f ./$(DEPDIR)/read_description.Plo
+ -rm -f ./$(DEPDIR)/read_line.Plo
+ -rm -f ./$(DEPDIR)/rounding.Plo
+ -rm -f ./$(DEPDIR)/setprec_parameters.Plo
+ -rm -f ./$(DEPDIR)/tabs.Po
+ -rm -f ./$(DEPDIR)/tacos.Po
+ -rm -f ./$(DEPDIR)/tacosh.Po
+ -rm -f ./$(DEPDIR)/tadd.Po
+ -rm -f ./$(DEPDIR)/tadd_fr.Po
+ -rm -f ./$(DEPDIR)/tadd_si.Po
+ -rm -f ./$(DEPDIR)/tadd_ui.Po
+ -rm -f ./$(DEPDIR)/targ.Po
+ -rm -f ./$(DEPDIR)/tasin.Po
+ -rm -f ./$(DEPDIR)/tasinh.Po
+ -rm -f ./$(DEPDIR)/tatan.Po
+ -rm -f ./$(DEPDIR)/tatanh.Po
+ -rm -f ./$(DEPDIR)/tcmp_abs.Po
+ -rm -f ./$(DEPDIR)/tconj.Po
+ -rm -f ./$(DEPDIR)/tcos.Po
+ -rm -f ./$(DEPDIR)/tcosh.Po
+ -rm -f ./$(DEPDIR)/tdiv.Po
+ -rm -f ./$(DEPDIR)/tdiv_2si.Po
+ -rm -f ./$(DEPDIR)/tdiv_2ui.Po
+ -rm -f ./$(DEPDIR)/tdiv_fr.Po
+ -rm -f ./$(DEPDIR)/tdiv_ui.Po
+ -rm -f ./$(DEPDIR)/tdot.Po
+ -rm -f ./$(DEPDIR)/texp.Po
+ -rm -f ./$(DEPDIR)/tfma.Po
+ -rm -f ./$(DEPDIR)/tfr_div.Po
+ -rm -f ./$(DEPDIR)/tfr_sub.Po
+ -rm -f ./$(DEPDIR)/tget_version.Po
+ -rm -f ./$(DEPDIR)/timag.Po
+ -rm -f ./$(DEPDIR)/tio_str.Po
+ -rm -f ./$(DEPDIR)/tlog.Po
+ -rm -f ./$(DEPDIR)/tlog10.Po
+ -rm -f ./$(DEPDIR)/tmul.Po
+ -rm -f ./$(DEPDIR)/tmul_2si.Po
+ -rm -f ./$(DEPDIR)/tmul_2ui.Po
+ -rm -f ./$(DEPDIR)/tmul_fr.Po
+ -rm -f ./$(DEPDIR)/tmul_i.Po
+ -rm -f ./$(DEPDIR)/tmul_si.Po
+ -rm -f ./$(DEPDIR)/tmul_ui.Po
+ -rm -f ./$(DEPDIR)/tneg.Po
+ -rm -f ./$(DEPDIR)/tnorm.Po
+ -rm -f ./$(DEPDIR)/tpl_gmp.Plo
+ -rm -f ./$(DEPDIR)/tpl_mpc.Plo
+ -rm -f ./$(DEPDIR)/tpl_mpfr.Plo
+ -rm -f ./$(DEPDIR)/tpl_native.Plo
+ -rm -f ./$(DEPDIR)/tpow.Po
+ -rm -f ./$(DEPDIR)/tpow_d.Po
+ -rm -f ./$(DEPDIR)/tpow_fr.Po
+ -rm -f ./$(DEPDIR)/tpow_ld.Po
+ -rm -f ./$(DEPDIR)/tpow_si.Po
+ -rm -f ./$(DEPDIR)/tpow_ui.Po
+ -rm -f ./$(DEPDIR)/tpow_z.Po
+ -rm -f ./$(DEPDIR)/tprec.Po
+ -rm -f ./$(DEPDIR)/tproj.Po
+ -rm -f ./$(DEPDIR)/treal.Po
+ -rm -f ./$(DEPDIR)/treimref.Po
+ -rm -f ./$(DEPDIR)/trootofunity.Po
+ -rm -f ./$(DEPDIR)/tset.Po
+ -rm -f ./$(DEPDIR)/tsin.Po
+ -rm -f ./$(DEPDIR)/tsin_cos.Po
+ -rm -f ./$(DEPDIR)/tsinh.Po
+ -rm -f ./$(DEPDIR)/tsqr.Po
+ -rm -f ./$(DEPDIR)/tsqrt.Po
+ -rm -f ./$(DEPDIR)/tstrtoc.Po
+ -rm -f ./$(DEPDIR)/tsub.Po
+ -rm -f ./$(DEPDIR)/tsub_fr.Po
+ -rm -f ./$(DEPDIR)/tsub_ui.Po
+ -rm -f ./$(DEPDIR)/tsum.Po
+ -rm -f ./$(DEPDIR)/tswap.Po
+ -rm -f ./$(DEPDIR)/ttan.Po
+ -rm -f ./$(DEPDIR)/ttanh.Po
+ -rm -f ./$(DEPDIR)/tui_div.Po
+ -rm -f ./$(DEPDIR)/tui_ui_sub.Po
-rm -f Makefile
maintainer-clean-am: distclean-am maintainer-clean-generic
@@ -2130,20 +2398,20 @@ uninstall-am:
.MAKE: check-am install-am install-strip
-.PHONY: CTAGS GTAGS TAGS all all-am check check-TESTS check-am clean \
- clean-checkLTLIBRARIES clean-checkPROGRAMS clean-generic \
- clean-libtool cscopelist-am ctags ctags-am distclean \
- distclean-compile distclean-generic distclean-libtool \
- distclean-tags distdir dvi dvi-am html html-am info info-am \
- install install-am install-data install-data-am install-dvi \
- install-dvi-am install-exec install-exec-am install-html \
- install-html-am install-info install-info-am install-man \
- install-pdf install-pdf-am install-ps install-ps-am \
- install-strip installcheck installcheck-am installdirs \
- maintainer-clean maintainer-clean-generic mostlyclean \
- mostlyclean-compile mostlyclean-generic mostlyclean-libtool \
- pdf pdf-am ps ps-am recheck tags tags-am uninstall \
- uninstall-am
+.PHONY: CTAGS GTAGS TAGS all all-am am--depfiles check check-TESTS \
+ check-am clean clean-checkLTLIBRARIES clean-checkPROGRAMS \
+ clean-generic clean-libtool cscopelist-am ctags ctags-am \
+ distclean distclean-compile distclean-generic \
+ distclean-libtool distclean-tags distdir dvi dvi-am html \
+ html-am info info-am install install-am install-data \
+ install-data-am install-dvi install-dvi-am install-exec \
+ install-exec-am install-html install-html-am install-info \
+ install-info-am install-man install-pdf install-pdf-am \
+ install-ps install-ps-am install-strip installcheck \
+ installcheck-am installdirs maintainer-clean \
+ maintainer-clean-generic mostlyclean mostlyclean-compile \
+ mostlyclean-generic mostlyclean-libtool pdf pdf-am ps ps-am \
+ recheck tags tags-am uninstall uninstall-am
.PRECIOUS: Makefile
diff --git a/gcc/mpc/tests/div.dat b/gcc/mpc/tests/div.dat
index b030382432..00f372d009 100644
--- a/gcc/mpc/tests/div.dat
+++ b/gcc/mpc/tests/div.dat
@@ -2437,9 +2437,6 @@
0 0 10 1 10 0 10 0 10 0b1@536870912 10 0 10 0b1@536870912 N N
0 0 10 1 10 0 10 0b1@536870912 10 0 10 0b1@536870912 10 0 N N
-# overflow (reported by Emmanuel Thome)
-- + 250 -inf 250 +inf 250 1 250 0 250 -1e-164895850 250 -1e-164895850 N N
-
# bug found by tgeneric of ui_div
+ + 2 0b1.1@256 2 0b1.1@-2758 34 52349199244 2 0 2 0b1.1@-221 2 -0b1@-3234 U N
@@ -2484,3 +2481,8 @@
- - 2 0 2 0x1p-1073741823 2 0x3p-1073741824 2 0x1p-1073741823 2 1 2 -1 Z Z
# (1.5+i)*2^emin/(1+i) gives (1.25 - 0.25*i)*2^emin
- + 2 0x1p-1073741823 2 -0 2 0x3p-1073741824 2 0x1p-1073741823 2 1 2 1 Z Z
+
+# example with exact division (0 -1) which works:
+0 0 2 0 2 -1 2 -0x1p50450368 2 0x1p50450368 2 -0x1p50450368 2 -0x1p50450368 N N
+# same with larger exponents, which gives (0 -Inf) in revision 389c43d:
+0 0 2 0 2 -1 2 -0x1p536870910 2 0x1p536870910 2 -0x1p536870910 2 -0x1p536870910 N N
diff --git a/gcc/mpc/tests/mpc-tests.h b/gcc/mpc/tests/mpc-tests.h
index 8a33da8ffc..673e4e3432 100644
--- a/gcc/mpc/tests/mpc-tests.h
+++ b/gcc/mpc/tests/mpc-tests.h
@@ -1,6 +1,6 @@
/* mpc-tests.h -- Tests helper functions.
-Copyright (C) 2008, 2009, 2010, 2011, 2012, 2013, 2014 INRIA
+Copyright (C) 2008, 2009, 2010, 2011, 2012, 2013, 2014, 2020 INRIA
This file is part of GNU MPC.
@@ -104,7 +104,7 @@ extern gmp_randstate_t rands;
extern void test_start (void);
extern void test_end (void);
-extern void test_default_random (mpc_ptr, mp_exp_t, mp_exp_t,
+extern void test_default_random (mpc_ptr, mpfr_exp_t, mpfr_exp_t,
unsigned int, unsigned int);
void test_random_si (long int *n, unsigned long emax,
diff --git a/gcc/mpc/tests/pow_ui.dat b/gcc/mpc/tests/pow_ui.dat
index d448a68874..b41df7ed6a 100644
--- a/gcc/mpc/tests/pow_ui.dat
+++ b/gcc/mpc/tests/pow_ui.dat
@@ -85,8 +85,8 @@
0 0 53 1 53 0 53 +1 53 +0 +2 N N
0 0 53 1 53 0 53 +1 53 -0 +2 N N
-# overflow
-? ? 53 +inf 53 +inf 53 1e100000000 53 1e100000000 1000000000 N N
+# overflow: (a+a*I)^n is real for n divisible by 4
+? 0 53 +inf 53 0 53 1e100000000 53 1e100000000 1000000000 N N
# underflow
? ? 53 0 53 0 53 1e-100000000 53 1e-100000000 1000000000 N N
# cannot round after one loop
diff --git a/gcc/mpc/tests/sqrt.dat b/gcc/mpc/tests/sqrt.dat
index 076f2afadc..432b5d9dd2 100644
--- a/gcc/mpc/tests/sqrt.dat
+++ b/gcc/mpc/tests/sqrt.dat
@@ -113,6 +113,11 @@
- - 53 0x5a827999fcef30p-54 53 -0x16a09e667f3bcdp-52 25 +0 67 -4 Z D
+ - 53 0x16a09e667f3bcdp-52 53 -0x16a09e667f3bcdp-52 23 -0 68 -4 U D
+# z=(-1.95050937e+25,-2.65087379e-39)
++ - 24 0x7.2fb038p-164 24 -0x1.011258p32 24 -0x1.0225d4p64 24 -0xe.6ec760p-132 N N
+# z=(-1.89432151e+24,-1.06397210e+09)
+? ? 24 0x0.001954c04p0 24 -0x1.407478p40 24 -0x1.912360p80 24 -0x3.f6aed0p28 N N
+
# bugs fixed in r160 2008-07-15
- + 19 0b11101001001001001100p+39 19 -0b1010110101100111011p-236 19 0b1.101010001010100000p+117 19 -0b1.001110111101100001p-158 N Z
- + 2 0b11p+100 2 -0b11p+100 2 -0 2 -0b11p+203 N Z
diff --git a/gcc/mpc/tests/tacos.c b/gcc/mpc/tests/tacos.c
index 6ad1cc69e9..8463bbb87a 100644
--- a/gcc/mpc/tests/tacos.c
+++ b/gcc/mpc/tests/tacos.c
@@ -28,11 +28,78 @@ along with this program. If not, see http://www.gnu.org/licenses/ .
#include "data_check.tpl"
#include "tgeneric.tpl"
+/* test with reduced exponent range */
+static void
+test_reduced (void)
+{
+ mpfr_exp_t emin = mpfr_get_emin ();
+ mpfr_exp_t emax = mpfr_get_emax ();
+ mpc_t x, z, zr;
+
+ mpfr_set_emin (-148);
+ mpfr_set_emax (128);
+ mpc_init2 (x, 24);
+ mpc_init2 (z, 24);
+ mpc_init2 (zr, 24);
+ mpfr_set_flt (mpc_realref (x), -0x0.01f28c10p0f, MPFR_RNDN);
+ mpfr_set_flt (mpc_imagref (x), -0x6.79cdd0p-68f, MPFR_RNDN);
+ mpc_acos (z, x, MPC_RNDNN);
+ mpfr_set_flt (mpc_realref (zr), 0x1.941242p0f, MPFR_RNDN);
+ mpfr_set_flt (mpc_imagref (zr), 0x6.79da18p-68f, MPFR_RNDN);
+ if (mpc_cmp (z, zr))
+ {
+ printf ("Incorrect acos with reduced exponent range:\n");
+ mpfr_printf ("Expected (%Re,%Re)\n", mpc_realref (zr), mpc_imagref (zr));
+ mpfr_printf ("Got (%Re,%Re)\n", mpc_realref (z), mpc_imagref (z));
+ exit (1);
+ }
+ mpc_clear (x);
+ mpc_clear (z);
+ mpc_clear (zr);
+ mpfr_set_emin (emin);
+ mpfr_set_emax (emax);
+}
+
+/* another test with reduced exponent range */
+static void
+test_reduced2 (void)
+{
+ mpfr_exp_t emin = mpfr_get_emin ();
+ mpfr_exp_t emax = mpfr_get_emax ();
+ mpc_t x, z, zr;
+
+ mpfr_set_emin (-1073);
+ mpfr_set_emax (1024);
+ mpc_init2 (x, 53);
+ mpc_init2 (z, 53);
+ mpc_init2 (zr, 53);
+ mpfr_set_d (mpc_realref (x), -2.2694475687286223e-15, MPFR_RNDN);
+ mpfr_set_d (mpc_imagref (x), 2.7236935900137536e-309, MPFR_RNDN);
+ mpc_acos (z, x, MPC_RNDNN);
+ mpfr_set_d (mpc_realref (zr), 1.5707963267948988, MPFR_RNDN);
+ mpfr_set_d (mpc_imagref (zr), -2.7236935900137536e-309, MPFR_RNDN);
+ if (mpc_cmp (z, zr))
+ {
+ printf ("Incorrect acos with reduced exponent range:\n");
+ mpfr_printf ("Expected (%Re,%Re)\n", mpc_realref (zr), mpc_imagref (zr));
+ mpfr_printf ("Got (%Re,%Re)\n", mpc_realref (z), mpc_imagref (z));
+ exit (1);
+ }
+ mpc_clear (x);
+ mpc_clear (z);
+ mpc_clear (zr);
+ mpfr_set_emin (emin);
+ mpfr_set_emax (emax);
+}
+
int
main (void)
{
test_start ();
+ test_reduced ();
+ test_reduced2 ();
+
data_check_template ("acos.dsc", "acos.dat");
tgeneric_template ("acos.dsc", 2, 512, 7, 7);
diff --git a/gcc/mpc/tests/tdiv.c b/gcc/mpc/tests/tdiv.c
index 51ffb39899..56b0996101 100644
--- a/gcc/mpc/tests/tdiv.c
+++ b/gcc/mpc/tests/tdiv.c
@@ -1,6 +1,6 @@
/* tdiv -- test file for mpc_div.
-Copyright (C) 2002, 2008, 2009, 2011, 2013 INRIA
+Copyright (C) 2002, 2008, 2009, 2011, 2013, 2020 INRIA
This file is part of GNU MPC.
@@ -31,11 +31,49 @@ along with this program. If not, see http://www.gnu.org/licenses/ .
#include "data_check.tpl"
#include "tgeneric.tpl"
+static void
+bug20200206 (void)
+{
+ mpfr_exp_t emin = mpfr_get_emin ();
+ mpfr_exp_t emax = mpfr_get_emax ();
+ mpc_t x, y, z, zr;
+
+ mpfr_set_emin (-1073);
+ mpfr_set_emax (0);
+ mpc_init2 (x, 53);
+ mpc_init2 (y, 53);
+ mpc_init2 (z, 53);
+ mpc_init2 (zr, 53);
+ mpfr_set_d (mpc_realref (x), -5.3310997889069899e-216, MPFR_RNDN);
+ mpfr_set_d (mpc_imagref (x), -4.9188093228194944e-89, MPFR_RNDN);
+ mpfr_set_d (mpc_realref (y), -3.6801500191882962e-14, MPFR_RNDN);
+ mpfr_set_d (mpc_imagref (y), 4.5420247980297260e-145, MPFR_RNDN);
+ mpc_div (z, x, y, MPC_RNDNN);
+ /* quotient is 1.44844440684571e-202 + 1.33657848108714e-75*I,
+ where both the real and imaginary parts fit in the exponent range */
+ mpfr_set_d (mpc_realref (zr), 0x2.d69b18295a8cep-672, MPFR_RNDN);
+ mpfr_set_d (mpc_imagref (zr), 0x9.ac3e51d39eea8p-252, MPFR_RNDN);
+ if (mpc_cmp (z, zr))
+ {
+ printf ("Incorrect division with reduced exponent range:\n");
+ mpfr_printf ("Expected (%Re,%Re)\n", mpc_realref (zr), mpc_imagref (zr));
+ mpfr_printf ("Got (%Re,%Re)\n", mpc_realref (z), mpc_imagref (z));
+ exit (1);
+ }
+ mpc_clear (x);
+ mpc_clear (y);
+ mpc_clear (z);
+ mpc_clear (zr);
+ mpfr_set_emin (emin);
+ mpfr_set_emax (emax);
+}
+
int
main (void)
{
test_start ();
+ bug20200206 ();
data_check_template ("div.dsc", "div.dat");
tgeneric_template ("div.dsc", 2, 1024, 7, 4096);
diff --git a/gcc/mpc/tests/tdot.c b/gcc/mpc/tests/tdot.c
new file mode 100644
index 0000000000..3d289fcfe2
--- /dev/null
+++ b/gcc/mpc/tests/tdot.c
@@ -0,0 +1,98 @@
+/* tdot -- test file for mpc_dot.
+
+Copyright (C) 2018, 2020 INRIA
+
+This file is part of GNU MPC.
+
+GNU MPC is free software; you can redistribute it and/or modify it under
+the terms of the GNU Lesser General Public License as published by the
+Free Software Foundation; either version 3 of the License, or (at your
+option) any later version.
+
+GNU MPC is distributed in the hope that it will be useful, but WITHOUT ANY
+WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS
+FOR A PARTICULAR PURPOSE. See the GNU Lesser General Public License for
+more details.
+
+You should have received a copy of the GNU Lesser General Public License
+along with this program. If not, see http://www.gnu.org/licenses/ .
+*/
+
+#include "mpc-tests.h"
+
+static void
+check_special (void)
+{
+ mpc_t z[3], res;
+ mpc_ptr t[3];
+ int i, inex;
+
+ /* z[0] = (1,2), z[1] = (2,3), z[2] = (3,4) */
+ for (i = 0; i < 3; i++)
+ {
+ mpc_init2 (z[i], 17);
+ mpc_set_ui_ui (z[i], i+1, i+2, MPC_RNDNN);
+ t[i] = z[i];
+ }
+ mpc_init2 (res, 17);
+ /* dot product of empty vectors is 0 */
+ inex = mpc_dot (res, t, t, 0, MPC_RNDNN);
+ MPC_ASSERT (inex == 0);
+ MPC_ASSERT (mpfr_zero_p (mpc_realref (res)));
+ MPC_ASSERT (mpfr_zero_p (mpc_imagref (res)));
+ MPC_ASSERT (mpfr_signbit (mpc_realref (res)) == 0);
+ MPC_ASSERT (mpfr_signbit (mpc_imagref (res)) == 0);
+ /* (1,2)*(1,2) = (-3,4) */
+ inex = mpc_dot (res, t, t, 1, MPC_RNDNN);
+ MPC_ASSERT (inex == 0);
+ MPC_ASSERT (mpfr_regular_p (mpc_realref (res)));
+ MPC_ASSERT (mpfr_regular_p (mpc_imagref (res)));
+ MPC_ASSERT (mpfr_cmp_si (mpc_realref (res), -3) == 0);
+ MPC_ASSERT (mpfr_cmp_ui (mpc_imagref (res), 4) == 0);
+ /* (1,2)*(1,2) + (2,3)*(2,3) = (-8,16) */
+ inex = mpc_dot (res, t, t, 2, MPC_RNDNN);
+ MPC_ASSERT (inex == 0);
+ MPC_ASSERT (mpfr_regular_p (mpc_realref (res)));
+ MPC_ASSERT (mpfr_regular_p (mpc_imagref (res)));
+ MPC_ASSERT (mpfr_cmp_si (mpc_realref (res), -8) == 0);
+ MPC_ASSERT (mpfr_cmp_ui (mpc_imagref (res), 16) == 0);
+ /* (1,2)*(1,2) + (2,3)*(2,3) + (3,4)*(3,4) = (-15,40) */
+ inex = mpc_dot (res, t, t, 3, MPC_RNDNN);
+ MPC_ASSERT (inex == 0);
+ MPC_ASSERT (mpfr_regular_p (mpc_realref (res)));
+ MPC_ASSERT (mpfr_regular_p (mpc_imagref (res)));
+ MPC_ASSERT (mpfr_cmp_si (mpc_realref (res), -15) == 0);
+ MPC_ASSERT (mpfr_cmp_ui (mpc_imagref (res), 40) == 0);
+ for (i = 0; i < 3; i++)
+ mpc_clear (z[i]);
+ mpc_clear (res);
+}
+
+/* bug reported by Trevor Spiteri */
+static void
+bug20200717 (void)
+{
+ mpc_t a;
+ mpc_ptr p[1];
+ mpc_init2 (a, 53);
+ mpc_set_ui_ui (a, 1, 2, MPC_RNDNN);
+ p[0] = a;
+ mpc_dot (a, p, p, 1, MPC_RNDNN);
+ MPC_ASSERT (mpfr_cmp_si (mpc_realref (a), -3) == 0);
+ MPC_ASSERT (mpfr_cmp_ui (mpc_imagref (a), 4) == 0);
+ mpc_clear (a);
+}
+
+int
+main (void)
+{
+ test_start ();
+
+ bug20200717 ();
+ check_special ();
+
+ test_end ();
+
+ return 0;
+}
+
diff --git a/gcc/mpc/tests/tmul.c b/gcc/mpc/tests/tmul.c
index 4331ba9ee8..fae9233e90 100644
--- a/gcc/mpc/tests/tmul.c
+++ b/gcc/mpc/tests/tmul.c
@@ -1,6 +1,6 @@
/* tmul -- test file for mpc_mul.
-Copyright (C) 2002, 2005, 2008, 2009, 2010, 2011, 2012, 2013 INRIA
+Copyright (C) 2002, 2005, 2008, 2009, 2010, 2011, 2012, 2013, 2014, 2020 INRIA
This file is part of GNU MPC.
@@ -130,6 +130,34 @@ check_regular (void)
mpc_clear (y);
}
+static void
+bug20200206 (void)
+{
+ mpfr_exp_t emin = mpfr_get_emin ();
+ mpc_t x, y, z;
+
+ mpfr_set_emin (-1073);
+ mpc_init2 (x, 53);
+ mpc_init2 (y, 53);
+ mpc_init2 (z, 53);
+ mpfr_set_d (mpc_realref (x), -6.0344722345057644e-272, MPFR_RNDN);
+ mpfr_set_d (mpc_imagref (x), -4.8536770224196353e-204, MPFR_RNDN);
+ mpfr_set_d (mpc_realref (y), 1.3834775731431992e-246, MPFR_RNDN);
+ mpfr_set_d (mpc_imagref (y), 2.9246270396940562e-124, MPFR_RNDN);
+ mpc_mul (z, x, y, MPC_RNDNN);
+ if (mpfr_regular_p (mpc_realref (z)) &&
+ mpfr_get_exp (mpc_realref (z)) < -1073)
+ {
+ printf ("Error, mpc_mul returns an out-of-range exponent:\n");
+ mpfr_dump (mpc_realref (z));
+ printf ("Bug most probably in MPFR, please upgrade to MPFR 4.1.0 or later\n");
+ exit (1);
+ }
+ mpc_clear (x);
+ mpc_clear (y);
+ mpc_clear (z);
+ mpfr_set_emin (emin);
+}
#ifdef TIMING
static void
@@ -199,6 +227,7 @@ main (void)
timemul ();
#endif
+ bug20200206 ();
check_regular ();
data_check_template ("mul.dsc", "mul.dat");
diff --git a/gcc/mpc/tests/tpow.c b/gcc/mpc/tests/tpow.c
index 7cfcd3cf82..09dd09cd14 100644
--- a/gcc/mpc/tests/tpow.c
+++ b/gcc/mpc/tests/tpow.c
@@ -52,6 +52,39 @@ reuse_bug (void)
}
}
+/* at precision 53, mpc_pow gave (inf,-inf), and
+ at precision 73, it gave (inf,inf) */
+static void
+bug20200208 (void)
+{
+ mpc_t x, y, z, zr;
+ mpfr_prec_t prec1 = 53, prec2 = 73;
+
+ mpc_init2 (x, prec1);
+ mpc_init2 (y, prec1);
+ mpc_init2 (z, prec1);
+ mpc_init2 (zr, prec2);
+ mpfr_set_d (mpc_realref (x), 2.0851332234623992e-197, MPFR_RNDN);
+ mpfr_set_d (mpc_imagref (x), -5.6221457829327427e-17, MPFR_RNDN);
+ mpfr_set_d (mpc_realref (y), -2.1866902464899554e+138, MPFR_RNDN);
+ mpfr_set_d (mpc_imagref (y), 2.5932544562430328e-234, MPFR_RNDN);
+ mpc_pow (z, x, y, MPC_RNDNN);
+ mpc_pow (zr, x, y, MPC_RNDNN);
+ if (mpc_cmp (z, zr))
+ {
+ printf ("Inconsistent power with different precisions:\n");
+ mpfr_printf ("prec %lu: (%Re,%Re)\n",
+ prec1, mpc_realref (z), mpc_imagref (z));
+ mpfr_printf ("prec %lu: (%Re,%Re)\n",
+ prec2, mpc_realref (zr), mpc_imagref (zr));
+ exit (1);
+ }
+ mpc_clear (x);
+ mpc_clear (y);
+ mpc_clear (z);
+ mpc_clear (zr);
+}
+
#define MPC_FUNCTION_CALL \
P[0].mpc_inex = mpc_pow (P[1].mpc, P[2].mpc, P[3].mpc, P[4].mpc_rnd)
#define MPC_FUNCTION_CALL_REUSE_OP1 \
@@ -67,6 +100,8 @@ main (void)
{
test_start ();
+ bug20200208 ();
+
reuse_bug ();
data_check_template ("pow.dsc", "pow.dat");
diff --git a/gcc/mpc/tests/tsqrt.c b/gcc/mpc/tests/tsqrt.c
index 17d05c3daf..3bcde336bf 100644
--- a/gcc/mpc/tests/tsqrt.c
+++ b/gcc/mpc/tests/tsqrt.c
@@ -1,6 +1,6 @@
/* tsqrt -- test file for mpc_sqrt.
-Copyright (C) 2008, 2013 INRIA
+Copyright (C) 2008, 2013, 2020 INRIA
This file is part of GNU MPC.
@@ -28,11 +28,45 @@ along with this program. If not, see http://www.gnu.org/licenses/ .
#include "data_check.tpl"
#include "tgeneric.tpl"
+/* check with reduced exponent range */
+static void
+bug20200207 (void)
+{
+ mpfr_exp_t emin = mpfr_get_emin ();
+ mpfr_exp_t emax = mpfr_get_emax ();
+ mpc_t x, z, zr;
+
+ mpfr_set_emin (-148);
+ mpfr_set_emax (128);
+ mpc_init2 (x, 24);
+ mpc_init2 (z, 24);
+ mpc_init2 (zr, 24);
+ mpfr_set_d (mpc_realref (x), -1.89432151320234e24, MPFR_RNDN);
+ mpfr_set_d (mpc_imagref (x), -1.06397209600000e9, MPFR_RNDN);
+ mpc_sqrt (z, x, MPC_RNDNN);
+ /* square root is 0.00038652126908433 - 1.37634353022868e12*I */
+ mpfr_set_d (mpc_realref (zr), 0.00038652126908433, MPFR_RNDN);
+ mpfr_set_d (mpc_imagref (zr), -1.37634353022868e12, MPFR_RNDN);
+ if (mpc_cmp (z, zr))
+ {
+ printf ("Incorrect square root with reduced exponent range:\n");
+ mpfr_printf ("Expected (%Re,%Re)\n", mpc_realref (zr), mpc_imagref (zr));
+ mpfr_printf ("Got (%Re,%Re)\n", mpc_realref (z), mpc_imagref (z));
+ exit (1);
+ }
+ mpc_clear (x);
+ mpc_clear (z);
+ mpc_clear (zr);
+ mpfr_set_emin (emin);
+ mpfr_set_emax (emax);
+}
+
int
main (void)
{
test_start ();
+ bug20200207 ();
data_check_template ("sqrt.dsc", "sqrt.dat");
tgeneric_template ("sqrt.dsc", 2, 1024, 7, 256);
diff --git a/gcc/mpc/tests/tsum.c b/gcc/mpc/tests/tsum.c
new file mode 100644
index 0000000000..74733d7e41
--- /dev/null
+++ b/gcc/mpc/tests/tsum.c
@@ -0,0 +1,69 @@
+/* tsum -- test file for mpc_sum.
+
+Copyright (C) 2018 INRIA
+
+This file is part of GNU MPC.
+
+GNU MPC is free software; you can redistribute it and/or modify it under
+the terms of the GNU Lesser General Public License as published by the
+Free Software Foundation; either version 3 of the License, or (at your
+option) any later version.
+
+GNU MPC is distributed in the hope that it will be useful, but WITHOUT ANY
+WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS
+FOR A PARTICULAR PURPOSE. See the GNU Lesser General Public License for
+more details.
+
+You should have received a copy of the GNU Lesser General Public License
+along with this program. If not, see http://www.gnu.org/licenses/ .
+*/
+
+#include "mpc-tests.h"
+
+static void
+check_special (void)
+{
+ mpc_t z[3], res;
+ mpc_ptr t[3];
+ int i, inex;
+
+ for (i = 0; i < 3; i++)
+ {
+ mpc_init2 (z[i], 17);
+ mpc_set_ui_ui (z[i], i+1, i+2, MPC_RNDNN);
+ t[i] = z[i];
+ }
+ mpc_init2 (res, 17);
+ inex = mpc_sum (res, t, 0, MPC_RNDNN);
+ MPC_ASSERT (inex == 0);
+ MPC_ASSERT (mpfr_cmp_ui (mpc_realref (res), 0) == 0);
+ MPC_ASSERT (mpfr_cmp_ui (mpc_imagref (res), 0) == 0);
+ inex = mpc_sum (res, t, 1, MPC_RNDNN);
+ MPC_ASSERT (inex == 0);
+ MPC_ASSERT (mpfr_cmp_ui (mpc_realref (res), 1) == 0);
+ MPC_ASSERT (mpfr_cmp_ui (mpc_imagref (res), 2) == 0);
+ inex = mpc_sum (res, t, 2, MPC_RNDNN);
+ MPC_ASSERT (inex == 0);
+ MPC_ASSERT (mpfr_cmp_ui (mpc_realref (res), 3) == 0);
+ MPC_ASSERT (mpfr_cmp_ui (mpc_imagref (res), 5) == 0);
+ inex = mpc_sum (res, t, 3, MPC_RNDNN);
+ MPC_ASSERT (inex == 0);
+ MPC_ASSERT (mpfr_cmp_ui (mpc_realref (res), 6) == 0);
+ MPC_ASSERT (mpfr_cmp_ui (mpc_imagref (res), 9) == 0);
+ for (i = 0; i < 3; i++)
+ mpc_clear (z[i]);
+ mpc_clear (res);
+}
+
+int
+main (void)
+{
+ test_start ();
+
+ check_special ();
+
+ test_end ();
+
+ return 0;
+}
+
diff --git a/gcc/mpc/tests/ttan.c b/gcc/mpc/tests/ttan.c
index db2d3f98f9..2f42ca330c 100644
--- a/gcc/mpc/tests/ttan.c
+++ b/gcc/mpc/tests/ttan.c
@@ -1,6 +1,6 @@
/* ttan -- test file for mpc_tan.
-Copyright (C) 2008, 2011, 2012, 2013 INRIA
+Copyright (C) 2008, 2011, 2012, 2013, 2020 INRIA
This file is part of GNU MPC.
@@ -197,6 +197,68 @@ pure_imaginary_argument (void)
mpfr_clear (y);
}
+/* test with reduced exponent range */
+static void
+bug20200211 (void)
+{
+ mpfr_exp_t emin = mpfr_get_emin ();
+ mpc_t x, z, zr;
+
+ mpfr_set_emin (-148);
+ mpc_init2 (x, 24);
+ mpc_init2 (z, 24);
+ mpc_init2 (zr, 24);
+ mpfr_set_flt (mpc_realref (x), 0x3.b32d48p24, MPFR_RNDN);
+ mpfr_set_flt (mpc_imagref (x), -0x48.08bd0p0, MPFR_RNDN);
+ mpc_tan (z, x, MPC_RNDNN);
+ /* the real part should be 1.8638349976774607754968796608e-63,
+ but since that underflows, we should get +0 */
+ mpfr_set_flt (mpc_realref (zr), +0.0f, MPFR_RNDN);
+ mpfr_set_flt (mpc_imagref (zr), -1.0f, MPFR_RNDN);
+ if (mpc_cmp (z, zr))
+ {
+ printf ("Incorrect tangent with reduced exponent range:\n");
+ mpfr_printf ("Expected (%Re,%Re)\n", mpc_realref (zr), mpc_imagref (zr));
+ mpfr_printf ("Got (%Re,%Re)\n", mpc_realref (z), mpc_imagref (z));
+ exit (1);
+ }
+ mpc_clear (x);
+ mpc_clear (z);
+ mpc_clear (zr);
+ mpfr_set_emin (emin);
+}
+
+/* test failing with gcc 5.4.0, line 127 of tan.dat */
+static void
+bug20200301 (void)
+{
+ mpc_t x, z, zr;
+ int inex;
+
+ mpc_init2 (x, 53);
+ mpc_init2 (z, 53);
+ mpc_init2 (zr, 53);
+ mpfr_set_d (mpc_realref (x), 0x4580CBF242683p-3, MPFR_RNDN);
+ mpfr_set_d (mpc_imagref (x), -0x1B3E8A3660D279p-3, MPFR_RNDN);
+ inex = mpc_tan (z, x, MPC_RNDNN);
+ mpfr_set_d (mpc_realref (zr), -0.0, MPFR_RNDN);
+ mpfr_set_d (mpc_imagref (zr), -1.0, MPFR_RNDN);
+ if (mpc_cmp (z, zr) != 0 || mpfr_signbit (mpc_realref (z)) == 0 ||
+ MPC_INEX_RE(inex) <= 0 || MPC_INEX_IM(inex) >= 0)
+ {
+ printf ("Incorrect tangent (bug20200301):\n");
+ mpfr_printf ("Expected (%Re,%Re)\n", mpc_realref (zr), mpc_imagref (zr));
+ mpfr_printf ("Got (%Re,%Re)\n", mpc_realref (z), mpc_imagref (z));
+ mpfr_printf ("expected ternary value (+1, -1)\n");
+ mpfr_printf ("got ternary value (%d, %d)\n", MPC_INEX_RE(inex),
+ MPC_INEX_IM(inex));
+ exit (1);
+ }
+ mpc_clear (x);
+ mpc_clear (z);
+ mpc_clear (zr);
+}
+
#define MPC_FUNCTION_CALL \
P[0].mpc_inex = mpc_tan (P[1].mpc, P[2].mpc, P[3].mpc_rnd)
#define MPC_FUNCTION_CALL_REUSE_OP1 \
@@ -210,6 +272,9 @@ main (void)
{
test_start ();
+ bug20200301 ();
+ bug20200211 ();
+
data_check_template ("tan.dsc", "tan.dat");
tgeneric_template ("tan.dsc", 2, 512, 7, 4);
diff --git a/gcc/mpc/tools/Makefile.am b/gcc/mpc/tools/Makefile.am
index 5730d54a5d..86257e1387 100644
--- a/gcc/mpc/tools/Makefile.am
+++ b/gcc/mpc/tools/Makefile.am
@@ -1,6 +1,7 @@
## tools/Makefile.am -- Process this file with automake to produce Makefile.in
##
## Copyright (C) 2014 CNRS
+## Copyright (C) 2020 INRIA
##
## This file is part of GNU MPC.
##
@@ -17,5 +18,5 @@
## You should have received a copy of the GNU Lesser General Public License
## along with this program. If not, see http://www.gnu.org/licenses/ .
-SUBDIRS = bench
+SUBDIRS = bench mpcheck
diff --git a/gcc/mpc/tools/Makefile.in b/gcc/mpc/tools/Makefile.in
index b6dcbf7a59..ebce3edff9 100644
--- a/gcc/mpc/tools/Makefile.in
+++ b/gcc/mpc/tools/Makefile.in
@@ -1,7 +1,7 @@
-# Makefile.in generated by automake 1.15.1 from Makefile.am.
+# Makefile.in generated by automake 1.16.2 from Makefile.am.
# @configure_input@
-# Copyright (C) 1994-2017 Free Software Foundation, Inc.
+# Copyright (C) 1994-2020 Free Software Foundation, Inc.
# This Makefile.in is free software; the Free Software Foundation
# gives unlimited permission to copy and/or distribute it,
@@ -137,7 +137,7 @@ am__recursive_targets = \
$(RECURSIVE_CLEAN_TARGETS) \
$(am__extra_recursive_targets)
AM_RECURSIVE_TARGETS = $(am__recursive_targets:-recursive=) TAGS CTAGS \
- distdir
+ distdir distdir-am
am__tagged_files = $(HEADERS) $(SOURCES) $(TAGS_FILES) $(LISP)
# Read a list of newline-separated strings from the standard input,
# and print each of them once, without duplicates. Input order is
@@ -309,7 +309,7 @@ target_alias = @target_alias@
top_build_prefix = @top_build_prefix@
top_builddir = @top_builddir@
top_srcdir = @top_srcdir@
-SUBDIRS = bench
+SUBDIRS = bench mpcheck
all: all-recursive
.SUFFIXES:
@@ -330,8 +330,8 @@ Makefile: $(srcdir)/Makefile.in $(top_builddir)/config.status
*config.status*) \
cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh;; \
*) \
- echo ' cd $(top_builddir) && $(SHELL) ./config.status $(subdir)/$@ $(am__depfiles_maybe)'; \
- cd $(top_builddir) && $(SHELL) ./config.status $(subdir)/$@ $(am__depfiles_maybe);; \
+ echo ' cd $(top_builddir) && $(SHELL) ./config.status $(subdir)/$@ $(am__maybe_remake_depfiles)'; \
+ cd $(top_builddir) && $(SHELL) ./config.status $(subdir)/$@ $(am__maybe_remake_depfiles);; \
esac;
$(top_builddir)/config.status: $(top_srcdir)/configure $(CONFIG_STATUS_DEPENDENCIES)
@@ -448,7 +448,10 @@ cscopelist-am: $(am__tagged_files)
distclean-tags:
-rm -f TAGS ID GTAGS GRTAGS GSYMS GPATH tags
-distdir: $(DISTFILES)
+distdir: $(BUILT_SOURCES)
+ $(MAKE) $(AM_MAKEFLAGS) distdir-am
+
+distdir-am: $(DISTFILES)
@srcdirstrip=`echo "$(srcdir)" | sed 's/[].[^$$\\*]/\\\\&/g'`; \
topsrcdirstrip=`echo "$(top_srcdir)" | sed 's/[].[^$$\\*]/\\\\&/g'`; \
list='$(DISTFILES)'; \
diff --git a/gcc/mpc/tools/bench/Makefile.in b/gcc/mpc/tools/bench/Makefile.in
index bfcb1f0ebf..b113bd0050 100644
--- a/gcc/mpc/tools/bench/Makefile.in
+++ b/gcc/mpc/tools/bench/Makefile.in
@@ -1,7 +1,7 @@
-# Makefile.in generated by automake 1.15.1 from Makefile.am.
+# Makefile.in generated by automake 1.16.2 from Makefile.am.
# @configure_input@
-# Copyright (C) 1994-2017 Free Software Foundation, Inc.
+# Copyright (C) 1994-2020 Free Software Foundation, Inc.
# This Makefile.in is free software; the Free Software Foundation
# gives unlimited permission to copy and/or distribute it,
@@ -127,8 +127,9 @@ am__v_at_ = $(am__v_at_@AM_DEFAULT_V@)
am__v_at_0 = @
am__v_at_1 =
DEFAULT_INCLUDES = -I.@am__isrc@ -I$(top_builddir)
-depcomp = $(SHELL) $(top_srcdir)/depcomp
-am__depfiles_maybe = depfiles
+depcomp = $(SHELL) $(top_srcdir)/build-aux/depcomp
+am__maybe_remake_depfiles = depfiles
+am__depfiles_remade = ./$(DEPDIR)/mpcbench.Po
am__mv = mv -f
COMPILE = $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) \
$(CPPFLAGS) $(AM_CFLAGS) $(CFLAGS)
@@ -175,7 +176,8 @@ am__define_uniq_tagged_files = \
done | $(am__uniquify_input)`
ETAGS = etags
CTAGS = ctags
-am__DIST_COMMON = $(srcdir)/Makefile.in $(top_srcdir)/depcomp
+am__DIST_COMMON = $(srcdir)/Makefile.in \
+ $(top_srcdir)/build-aux/depcomp
DISTFILES = $(DIST_COMMON) $(DIST_SOURCES) $(TEXINFOS) $(EXTRA_DIST)
ACLOCAL = @ACLOCAL@
AMTAR = @AMTAR@
@@ -326,8 +328,8 @@ Makefile: $(srcdir)/Makefile.in $(top_builddir)/config.status
*config.status*) \
cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh;; \
*) \
- echo ' cd $(top_builddir) && $(SHELL) ./config.status $(subdir)/$@ $(am__depfiles_maybe)'; \
- cd $(top_builddir) && $(SHELL) ./config.status $(subdir)/$@ $(am__depfiles_maybe);; \
+ echo ' cd $(top_builddir) && $(SHELL) ./config.status $(subdir)/$@ $(am__maybe_remake_depfiles)'; \
+ cd $(top_builddir) && $(SHELL) ./config.status $(subdir)/$@ $(am__maybe_remake_depfiles);; \
esac;
$(top_builddir)/config.status: $(top_srcdir)/configure $(CONFIG_STATUS_DEPENDENCIES)
@@ -349,7 +351,13 @@ mostlyclean-compile:
distclean-compile:
-rm -f *.tab.c
-@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/mpcbench.Po@am__quote@
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/mpcbench.Po@am__quote@ # am--include-marker
+
+$(am__depfiles_remade):
+ @$(MKDIR_P) $(@D)
+ @echo '# dummy' >$@-t && $(am__mv) $@-t $@
+
+am--depfiles: $(am__depfiles_remade)
.c.o:
@am__fastdepCC_TRUE@ $(AM_V_CC)$(COMPILE) -MT $@ -MD -MP -MF $(DEPDIR)/$*.Tpo -c -o $@ $<
@@ -430,7 +438,10 @@ cscopelist-am: $(am__tagged_files)
distclean-tags:
-rm -f TAGS ID GTAGS GRTAGS GSYMS GPATH tags
-distdir: $(DISTFILES)
+distdir: $(BUILT_SOURCES)
+ $(MAKE) $(AM_MAKEFLAGS) distdir-am
+
+distdir-am: $(DISTFILES)
@srcdirstrip=`echo "$(srcdir)" | sed 's/[].[^$$\\*]/\\\\&/g'`; \
topsrcdirstrip=`echo "$(top_srcdir)" | sed 's/[].[^$$\\*]/\\\\&/g'`; \
list='$(DISTFILES)'; \
@@ -499,7 +510,7 @@ clean: clean-am
clean-am: clean-generic clean-libtool mostlyclean-am
distclean: distclean-am
- -rm -rf ./$(DEPDIR)
+ -rm -f ./$(DEPDIR)/mpcbench.Po
-rm -f Makefile
distclean-am: clean-am distclean-compile distclean-generic \
distclean-tags
@@ -545,7 +556,7 @@ install-ps-am:
installcheck-am:
maintainer-clean: maintainer-clean-am
- -rm -rf ./$(DEPDIR)
+ -rm -f ./$(DEPDIR)/mpcbench.Po
-rm -f Makefile
maintainer-clean-am: distclean-am maintainer-clean-generic
@@ -566,18 +577,19 @@ uninstall-am:
.MAKE: install-am install-strip
-.PHONY: CTAGS GTAGS TAGS all all-am check check-am clean clean-generic \
- clean-libtool cscopelist-am ctags ctags-am distclean \
- distclean-compile distclean-generic distclean-libtool \
- distclean-tags distdir dvi dvi-am html html-am info info-am \
- install install-am install-data install-data-am install-dvi \
- install-dvi-am install-exec install-exec-am install-html \
- install-html-am install-info install-info-am install-man \
- install-pdf install-pdf-am install-ps install-ps-am \
- install-strip installcheck installcheck-am installdirs \
- maintainer-clean maintainer-clean-generic mostlyclean \
- mostlyclean-compile mostlyclean-generic mostlyclean-libtool \
- pdf pdf-am ps ps-am tags tags-am uninstall uninstall-am
+.PHONY: CTAGS GTAGS TAGS all all-am am--depfiles check check-am clean \
+ clean-generic clean-libtool cscopelist-am ctags ctags-am \
+ distclean distclean-compile distclean-generic \
+ distclean-libtool distclean-tags distdir dvi dvi-am html \
+ html-am info info-am install install-am install-data \
+ install-data-am install-dvi install-dvi-am install-exec \
+ install-exec-am install-html install-html-am install-info \
+ install-info-am install-man install-pdf install-pdf-am \
+ install-ps install-ps-am install-strip installcheck \
+ installcheck-am installdirs maintainer-clean \
+ maintainer-clean-generic mostlyclean mostlyclean-compile \
+ mostlyclean-generic mostlyclean-libtool pdf pdf-am ps ps-am \
+ tags tags-am uninstall uninstall-am
.PRECIOUS: Makefile
diff --git a/gcc/mpc/tools/mpcheck/Makefile.am b/gcc/mpc/tools/mpcheck/Makefile.am
new file mode 100644
index 0000000000..77ed6b0fd3
--- /dev/null
+++ b/gcc/mpc/tools/mpcheck/Makefile.am
@@ -0,0 +1,31 @@
+## tools/mpcheck/Makefile.am -- Process this file with automake to produce Makefile.in
+##
+## Copyright (C) 2014 CNRS
+## Copyright (C) 2020 INRIA
+##
+## This file is part of GNU MPC.
+##
+## GNU MPC is free software; you can redistribute it and/or modify it under
+## the terms of the GNU Lesser General Public License as published by the
+## Free Software Foundation; either version 3 of the License, or (at your
+## option) any later version.
+##
+## GNU MPC is distributed in the hope that it will be useful, but WITHOUT ANY
+## WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS
+## FOR A PARTICULAR PURPOSE. See the GNU Lesser General Public License for
+## more details.
+##
+## You should have received a copy of the GNU Lesser General Public License
+## along with this program. If not, see http://www.gnu.org/licenses/ .
+
+AM_CPPFLAGS = -I$(top_srcdir)/src
+AM_DEFAULT_SOURCE_EXT = .c
+
+LDADD = $(top_builddir)/src/libmpc.la -lm
+
+BINARIES = mpcheck-float mpcheck-double mpcheck-longdouble mpcheck-float128
+EXTRA_PROGRAMS = $(BINARIES)
+CLEANFILES = $(BINARIES)
+
+mpcheck : $(BINARIES)
+
diff --git a/gcc/mpc/tools/mpcheck/Makefile.in b/gcc/mpc/tools/mpcheck/Makefile.in
new file mode 100644
index 0000000000..6c6e8b48a9
--- /dev/null
+++ b/gcc/mpc/tools/mpcheck/Makefile.in
@@ -0,0 +1,639 @@
+# Makefile.in generated by automake 1.16.2 from Makefile.am.
+# @configure_input@
+
+# Copyright (C) 1994-2020 Free Software Foundation, Inc.
+
+# This Makefile.in is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY, to the extent permitted by law; without
+# even the implied warranty of MERCHANTABILITY or FITNESS FOR A
+# PARTICULAR PURPOSE.
+
+@SET_MAKE@
+VPATH = @srcdir@
+am__is_gnu_make = { \
+ if test -z '$(MAKELEVEL)'; then \
+ false; \
+ elif test -n '$(MAKE_HOST)'; then \
+ true; \
+ elif test -n '$(MAKE_VERSION)' && test -n '$(CURDIR)'; then \
+ true; \
+ else \
+ false; \
+ fi; \
+}
+am__make_running_with_option = \
+ case $${target_option-} in \
+ ?) ;; \
+ *) echo "am__make_running_with_option: internal error: invalid" \
+ "target option '$${target_option-}' specified" >&2; \
+ exit 1;; \
+ esac; \
+ has_opt=no; \
+ sane_makeflags=$$MAKEFLAGS; \
+ if $(am__is_gnu_make); then \
+ sane_makeflags=$$MFLAGS; \
+ else \
+ case $$MAKEFLAGS in \
+ *\\[\ \ ]*) \
+ bs=\\; \
+ sane_makeflags=`printf '%s\n' "$$MAKEFLAGS" \
+ | sed "s/$$bs$$bs[$$bs $$bs ]*//g"`;; \
+ esac; \
+ fi; \
+ skip_next=no; \
+ strip_trailopt () \
+ { \
+ flg=`printf '%s\n' "$$flg" | sed "s/$$1.*$$//"`; \
+ }; \
+ for flg in $$sane_makeflags; do \
+ test $$skip_next = yes && { skip_next=no; continue; }; \
+ case $$flg in \
+ *=*|--*) continue;; \
+ -*I) strip_trailopt 'I'; skip_next=yes;; \
+ -*I?*) strip_trailopt 'I';; \
+ -*O) strip_trailopt 'O'; skip_next=yes;; \
+ -*O?*) strip_trailopt 'O';; \
+ -*l) strip_trailopt 'l'; skip_next=yes;; \
+ -*l?*) strip_trailopt 'l';; \
+ -[dEDm]) skip_next=yes;; \
+ -[JT]) skip_next=yes;; \
+ esac; \
+ case $$flg in \
+ *$$target_option*) has_opt=yes; break;; \
+ esac; \
+ done; \
+ test $$has_opt = yes
+am__make_dryrun = (target_option=n; $(am__make_running_with_option))
+am__make_keepgoing = (target_option=k; $(am__make_running_with_option))
+pkgdatadir = $(datadir)/@PACKAGE@
+pkgincludedir = $(includedir)/@PACKAGE@
+pkglibdir = $(libdir)/@PACKAGE@
+pkglibexecdir = $(libexecdir)/@PACKAGE@
+am__cd = CDPATH="$${ZSH_VERSION+.}$(PATH_SEPARATOR)" && cd
+install_sh_DATA = $(install_sh) -c -m 644
+install_sh_PROGRAM = $(install_sh) -c
+install_sh_SCRIPT = $(install_sh) -c
+INSTALL_HEADER = $(INSTALL_DATA)
+transform = $(program_transform_name)
+NORMAL_INSTALL = :
+PRE_INSTALL = :
+POST_INSTALL = :
+NORMAL_UNINSTALL = :
+PRE_UNINSTALL = :
+POST_UNINSTALL = :
+build_triplet = @build@
+host_triplet = @host@
+EXTRA_PROGRAMS = $(am__EXEEXT_1)
+subdir = tools/mpcheck
+ACLOCAL_M4 = $(top_srcdir)/aclocal.m4
+am__aclocal_m4_deps = $(top_srcdir)/m4/ax_c_check_flag.m4 \
+ $(top_srcdir)/m4/ax_gcc_option.m4 \
+ $(top_srcdir)/m4/ax_gcc_version.m4 $(top_srcdir)/m4/libtool.m4 \
+ $(top_srcdir)/m4/ltoptions.m4 $(top_srcdir)/m4/ltsugar.m4 \
+ $(top_srcdir)/m4/ltversion.m4 $(top_srcdir)/m4/lt~obsolete.m4 \
+ $(top_srcdir)/m4/mpc.m4 $(top_srcdir)/m4/valgrind-tests.m4 \
+ $(top_srcdir)/configure.ac
+am__configure_deps = $(am__aclocal_m4_deps) $(CONFIGURE_DEPENDENCIES) \
+ $(ACLOCAL_M4)
+DIST_COMMON = $(srcdir)/Makefile.am $(am__DIST_COMMON)
+mkinstalldirs = $(install_sh) -d
+CONFIG_HEADER = $(top_builddir)/config.h
+CONFIG_CLEAN_FILES =
+CONFIG_CLEAN_VPATH_FILES =
+am__EXEEXT_1 = mpcheck-float$(EXEEXT) mpcheck-double$(EXEEXT) \
+ mpcheck-longdouble$(EXEEXT) mpcheck-float128$(EXEEXT)
+mpcheck_double_SOURCES = mpcheck-double.c
+mpcheck_double_OBJECTS = mpcheck-double.$(OBJEXT)
+mpcheck_double_LDADD = $(LDADD)
+mpcheck_double_DEPENDENCIES = $(top_builddir)/src/libmpc.la
+AM_V_lt = $(am__v_lt_@AM_V@)
+am__v_lt_ = $(am__v_lt_@AM_DEFAULT_V@)
+am__v_lt_0 = --silent
+am__v_lt_1 =
+mpcheck_float_SOURCES = mpcheck-float.c
+mpcheck_float_OBJECTS = mpcheck-float.$(OBJEXT)
+mpcheck_float_LDADD = $(LDADD)
+mpcheck_float_DEPENDENCIES = $(top_builddir)/src/libmpc.la
+mpcheck_float128_SOURCES = mpcheck-float128.c
+mpcheck_float128_OBJECTS = mpcheck-float128.$(OBJEXT)
+mpcheck_float128_LDADD = $(LDADD)
+mpcheck_float128_DEPENDENCIES = $(top_builddir)/src/libmpc.la
+mpcheck_longdouble_SOURCES = mpcheck-longdouble.c
+mpcheck_longdouble_OBJECTS = mpcheck-longdouble.$(OBJEXT)
+mpcheck_longdouble_LDADD = $(LDADD)
+mpcheck_longdouble_DEPENDENCIES = $(top_builddir)/src/libmpc.la
+AM_V_P = $(am__v_P_@AM_V@)
+am__v_P_ = $(am__v_P_@AM_DEFAULT_V@)
+am__v_P_0 = false
+am__v_P_1 = :
+AM_V_GEN = $(am__v_GEN_@AM_V@)
+am__v_GEN_ = $(am__v_GEN_@AM_DEFAULT_V@)
+am__v_GEN_0 = @echo " GEN " $@;
+am__v_GEN_1 =
+AM_V_at = $(am__v_at_@AM_V@)
+am__v_at_ = $(am__v_at_@AM_DEFAULT_V@)
+am__v_at_0 = @
+am__v_at_1 =
+DEFAULT_INCLUDES = -I.@am__isrc@ -I$(top_builddir)
+depcomp = $(SHELL) $(top_srcdir)/build-aux/depcomp
+am__maybe_remake_depfiles = depfiles
+am__depfiles_remade = ./$(DEPDIR)/mpcheck-double.Po \
+ ./$(DEPDIR)/mpcheck-float.Po ./$(DEPDIR)/mpcheck-float128.Po \
+ ./$(DEPDIR)/mpcheck-longdouble.Po
+am__mv = mv -f
+COMPILE = $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) \
+ $(CPPFLAGS) $(AM_CFLAGS) $(CFLAGS)
+LTCOMPILE = $(LIBTOOL) $(AM_V_lt) --tag=CC $(AM_LIBTOOLFLAGS) \
+ $(LIBTOOLFLAGS) --mode=compile $(CC) $(DEFS) \
+ $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) \
+ $(AM_CFLAGS) $(CFLAGS)
+AM_V_CC = $(am__v_CC_@AM_V@)
+am__v_CC_ = $(am__v_CC_@AM_DEFAULT_V@)
+am__v_CC_0 = @echo " CC " $@;
+am__v_CC_1 =
+CCLD = $(CC)
+LINK = $(LIBTOOL) $(AM_V_lt) --tag=CC $(AM_LIBTOOLFLAGS) \
+ $(LIBTOOLFLAGS) --mode=link $(CCLD) $(AM_CFLAGS) $(CFLAGS) \
+ $(AM_LDFLAGS) $(LDFLAGS) -o $@
+AM_V_CCLD = $(am__v_CCLD_@AM_V@)
+am__v_CCLD_ = $(am__v_CCLD_@AM_DEFAULT_V@)
+am__v_CCLD_0 = @echo " CCLD " $@;
+am__v_CCLD_1 =
+SOURCES = mpcheck-double.c mpcheck-float.c mpcheck-float128.c \
+ mpcheck-longdouble.c
+DIST_SOURCES = mpcheck-double.c mpcheck-float.c mpcheck-float128.c \
+ mpcheck-longdouble.c
+am__can_run_installinfo = \
+ case $$AM_UPDATE_INFO_DIR in \
+ n|no|NO) false;; \
+ *) (install-info --version) >/dev/null 2>&1;; \
+ esac
+am__tagged_files = $(HEADERS) $(SOURCES) $(TAGS_FILES) $(LISP)
+# Read a list of newline-separated strings from the standard input,
+# and print each of them once, without duplicates. Input order is
+# *not* preserved.
+am__uniquify_input = $(AWK) '\
+ BEGIN { nonempty = 0; } \
+ { items[$$0] = 1; nonempty = 1; } \
+ END { if (nonempty) { for (i in items) print i; }; } \
+'
+# Make sure the list of sources is unique. This is necessary because,
+# e.g., the same source file might be shared among _SOURCES variables
+# for different programs/libraries.
+am__define_uniq_tagged_files = \
+ list='$(am__tagged_files)'; \
+ unique=`for i in $$list; do \
+ if test -f "$$i"; then echo $$i; else echo $(srcdir)/$$i; fi; \
+ done | $(am__uniquify_input)`
+ETAGS = etags
+CTAGS = ctags
+am__DIST_COMMON = $(srcdir)/Makefile.in \
+ $(top_srcdir)/build-aux/depcomp README
+DISTFILES = $(DIST_COMMON) $(DIST_SOURCES) $(TEXINFOS) $(EXTRA_DIST)
+ACLOCAL = @ACLOCAL@
+AMTAR = @AMTAR@
+AM_DEFAULT_VERBOSITY = @AM_DEFAULT_VERBOSITY@
+AR = @AR@
+AS = @AS@
+AUTOCONF = @AUTOCONF@
+AUTOHEADER = @AUTOHEADER@
+AUTOMAKE = @AUTOMAKE@
+AWK = @AWK@
+CC = @CC@
+CCDEPMODE = @CCDEPMODE@
+CFLAGS = @CFLAGS@
+CPP = @CPP@
+CPPFLAGS = @CPPFLAGS@
+CYGPATH_W = @CYGPATH_W@
+DEFS = @DEFS@
+DEPDIR = @DEPDIR@
+DLLTOOL = @DLLTOOL@
+DSYMUTIL = @DSYMUTIL@
+DUMPBIN = @DUMPBIN@
+ECHO_C = @ECHO_C@
+ECHO_N = @ECHO_N@
+ECHO_T = @ECHO_T@
+EGREP = @EGREP@
+EXEEXT = @EXEEXT@
+FGREP = @FGREP@
+GCC_VERSION = @GCC_VERSION@
+GITVERSION = @GITVERSION@
+GREP = @GREP@
+HASGIT = @HASGIT@
+INSTALL = @INSTALL@
+INSTALL_DATA = @INSTALL_DATA@
+INSTALL_PROGRAM = @INSTALL_PROGRAM@
+INSTALL_SCRIPT = @INSTALL_SCRIPT@
+INSTALL_STRIP_PROGRAM = @INSTALL_STRIP_PROGRAM@
+LD = @LD@
+LDFLAGS = @LDFLAGS@
+LIBOBJS = @LIBOBJS@
+LIBS = @LIBS@
+LIBTOOL = @LIBTOOL@
+LIPO = @LIPO@
+LN_S = @LN_S@
+LTLIBOBJS = @LTLIBOBJS@
+LT_SYS_LIBRARY_PATH = @LT_SYS_LIBRARY_PATH@
+MAINT = @MAINT@
+MAKEINFO = @MAKEINFO@
+MANIFEST_TOOL = @MANIFEST_TOOL@
+MKDIR_P = @MKDIR_P@
+MPC_LDFLAGS = @MPC_LDFLAGS@
+MPC_LOG_H = @MPC_LOG_H@
+NM = @NM@
+NMEDIT = @NMEDIT@
+OBJDUMP = @OBJDUMP@
+OBJEXT = @OBJEXT@
+OTOOL = @OTOOL@
+OTOOL64 = @OTOOL64@
+PACKAGE = @PACKAGE@
+PACKAGE_BUGREPORT = @PACKAGE_BUGREPORT@
+PACKAGE_NAME = @PACKAGE_NAME@
+PACKAGE_STRING = @PACKAGE_STRING@
+PACKAGE_TARNAME = @PACKAGE_TARNAME@
+PACKAGE_URL = @PACKAGE_URL@
+PACKAGE_VERSION = @PACKAGE_VERSION@
+PATH_SEPARATOR = @PATH_SEPARATOR@
+RANLIB = @RANLIB@
+SED = @SED@
+SET_MAKE = @SET_MAKE@
+SHELL = @SHELL@
+STRIP = @STRIP@
+VALGRIND = @VALGRIND@
+VALGRIND_OPTS = @VALGRIND_OPTS@
+VERSION = @VERSION@
+abs_builddir = @abs_builddir@
+abs_srcdir = @abs_srcdir@
+abs_top_builddir = @abs_top_builddir@
+abs_top_srcdir = @abs_top_srcdir@
+ac_ct_AR = @ac_ct_AR@
+ac_ct_CC = @ac_ct_CC@
+ac_ct_DUMPBIN = @ac_ct_DUMPBIN@
+am__include = @am__include@
+am__leading_dot = @am__leading_dot@
+am__quote = @am__quote@
+am__tar = @am__tar@
+am__untar = @am__untar@
+bindir = @bindir@
+build = @build@
+build_alias = @build_alias@
+build_cpu = @build_cpu@
+build_os = @build_os@
+build_vendor = @build_vendor@
+builddir = @builddir@
+datadir = @datadir@
+datarootdir = @datarootdir@
+docdir = @docdir@
+dvidir = @dvidir@
+exec_prefix = @exec_prefix@
+host = @host@
+host_alias = @host_alias@
+host_cpu = @host_cpu@
+host_os = @host_os@
+host_vendor = @host_vendor@
+htmldir = @htmldir@
+includedir = @includedir@
+infodir = @infodir@
+install_sh = @install_sh@
+libdir = @libdir@
+libexecdir = @libexecdir@
+localedir = @localedir@
+localstatedir = @localstatedir@
+mandir = @mandir@
+mkdir_p = @mkdir_p@
+oldincludedir = @oldincludedir@
+pdfdir = @pdfdir@
+prefix = @prefix@
+program_transform_name = @program_transform_name@
+psdir = @psdir@
+sbindir = @sbindir@
+sharedstatedir = @sharedstatedir@
+srcdir = @srcdir@
+sysconfdir = @sysconfdir@
+target_alias = @target_alias@
+top_build_prefix = @top_build_prefix@
+top_builddir = @top_builddir@
+top_srcdir = @top_srcdir@
+AM_CPPFLAGS = -I$(top_srcdir)/src
+AM_DEFAULT_SOURCE_EXT = .c
+LDADD = $(top_builddir)/src/libmpc.la -lm
+BINARIES = mpcheck-float mpcheck-double mpcheck-longdouble mpcheck-float128
+CLEANFILES = $(BINARIES)
+all: all-am
+
+.SUFFIXES:
+.SUFFIXES: .c .lo .o .obj
+$(srcdir)/Makefile.in: @MAINTAINER_MODE_TRUE@ $(srcdir)/Makefile.am $(am__configure_deps)
+ @for dep in $?; do \
+ case '$(am__configure_deps)' in \
+ *$$dep*) \
+ ( cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh ) \
+ && { if test -f $@; then exit 0; else break; fi; }; \
+ exit 1;; \
+ esac; \
+ done; \
+ echo ' cd $(top_srcdir) && $(AUTOMAKE) --gnu tools/mpcheck/Makefile'; \
+ $(am__cd) $(top_srcdir) && \
+ $(AUTOMAKE) --gnu tools/mpcheck/Makefile
+Makefile: $(srcdir)/Makefile.in $(top_builddir)/config.status
+ @case '$?' in \
+ *config.status*) \
+ cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh;; \
+ *) \
+ echo ' cd $(top_builddir) && $(SHELL) ./config.status $(subdir)/$@ $(am__maybe_remake_depfiles)'; \
+ cd $(top_builddir) && $(SHELL) ./config.status $(subdir)/$@ $(am__maybe_remake_depfiles);; \
+ esac;
+
+$(top_builddir)/config.status: $(top_srcdir)/configure $(CONFIG_STATUS_DEPENDENCIES)
+ cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh
+
+$(top_srcdir)/configure: @MAINTAINER_MODE_TRUE@ $(am__configure_deps)
+ cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh
+$(ACLOCAL_M4): @MAINTAINER_MODE_TRUE@ $(am__aclocal_m4_deps)
+ cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh
+$(am__aclocal_m4_deps):
+
+mpcheck-double$(EXEEXT): $(mpcheck_double_OBJECTS) $(mpcheck_double_DEPENDENCIES) $(EXTRA_mpcheck_double_DEPENDENCIES)
+ @rm -f mpcheck-double$(EXEEXT)
+ $(AM_V_CCLD)$(LINK) $(mpcheck_double_OBJECTS) $(mpcheck_double_LDADD) $(LIBS)
+
+mpcheck-float$(EXEEXT): $(mpcheck_float_OBJECTS) $(mpcheck_float_DEPENDENCIES) $(EXTRA_mpcheck_float_DEPENDENCIES)
+ @rm -f mpcheck-float$(EXEEXT)
+ $(AM_V_CCLD)$(LINK) $(mpcheck_float_OBJECTS) $(mpcheck_float_LDADD) $(LIBS)
+
+mpcheck-float128$(EXEEXT): $(mpcheck_float128_OBJECTS) $(mpcheck_float128_DEPENDENCIES) $(EXTRA_mpcheck_float128_DEPENDENCIES)
+ @rm -f mpcheck-float128$(EXEEXT)
+ $(AM_V_CCLD)$(LINK) $(mpcheck_float128_OBJECTS) $(mpcheck_float128_LDADD) $(LIBS)
+
+mpcheck-longdouble$(EXEEXT): $(mpcheck_longdouble_OBJECTS) $(mpcheck_longdouble_DEPENDENCIES) $(EXTRA_mpcheck_longdouble_DEPENDENCIES)
+ @rm -f mpcheck-longdouble$(EXEEXT)
+ $(AM_V_CCLD)$(LINK) $(mpcheck_longdouble_OBJECTS) $(mpcheck_longdouble_LDADD) $(LIBS)
+
+mostlyclean-compile:
+ -rm -f *.$(OBJEXT)
+
+distclean-compile:
+ -rm -f *.tab.c
+
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/mpcheck-double.Po@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/mpcheck-float.Po@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/mpcheck-float128.Po@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/mpcheck-longdouble.Po@am__quote@ # am--include-marker
+
+$(am__depfiles_remade):
+ @$(MKDIR_P) $(@D)
+ @echo '# dummy' >$@-t && $(am__mv) $@-t $@
+
+am--depfiles: $(am__depfiles_remade)
+
+.c.o:
+@am__fastdepCC_TRUE@ $(AM_V_CC)$(COMPILE) -MT $@ -MD -MP -MF $(DEPDIR)/$*.Tpo -c -o $@ $<
+@am__fastdepCC_TRUE@ $(AM_V_at)$(am__mv) $(DEPDIR)/$*.Tpo $(DEPDIR)/$*.Po
+@AMDEP_TRUE@@am__fastdepCC_FALSE@ $(AM_V_CC)source='$<' object='$@' libtool=no @AMDEPBACKSLASH@
+@AMDEP_TRUE@@am__fastdepCC_FALSE@ DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@
+@am__fastdepCC_FALSE@ $(AM_V_CC@am__nodep@)$(COMPILE) -c -o $@ $<
+
+.c.obj:
+@am__fastdepCC_TRUE@ $(AM_V_CC)$(COMPILE) -MT $@ -MD -MP -MF $(DEPDIR)/$*.Tpo -c -o $@ `$(CYGPATH_W) '$<'`
+@am__fastdepCC_TRUE@ $(AM_V_at)$(am__mv) $(DEPDIR)/$*.Tpo $(DEPDIR)/$*.Po
+@AMDEP_TRUE@@am__fastdepCC_FALSE@ $(AM_V_CC)source='$<' object='$@' libtool=no @AMDEPBACKSLASH@
+@AMDEP_TRUE@@am__fastdepCC_FALSE@ DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@
+@am__fastdepCC_FALSE@ $(AM_V_CC@am__nodep@)$(COMPILE) -c -o $@ `$(CYGPATH_W) '$<'`
+
+.c.lo:
+@am__fastdepCC_TRUE@ $(AM_V_CC)$(LTCOMPILE) -MT $@ -MD -MP -MF $(DEPDIR)/$*.Tpo -c -o $@ $<
+@am__fastdepCC_TRUE@ $(AM_V_at)$(am__mv) $(DEPDIR)/$*.Tpo $(DEPDIR)/$*.Plo
+@AMDEP_TRUE@@am__fastdepCC_FALSE@ $(AM_V_CC)source='$<' object='$@' libtool=yes @AMDEPBACKSLASH@
+@AMDEP_TRUE@@am__fastdepCC_FALSE@ DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@
+@am__fastdepCC_FALSE@ $(AM_V_CC@am__nodep@)$(LTCOMPILE) -c -o $@ $<
+
+mostlyclean-libtool:
+ -rm -f *.lo
+
+clean-libtool:
+ -rm -rf .libs _libs
+
+ID: $(am__tagged_files)
+ $(am__define_uniq_tagged_files); mkid -fID $$unique
+tags: tags-am
+TAGS: tags
+
+tags-am: $(TAGS_DEPENDENCIES) $(am__tagged_files)
+ set x; \
+ here=`pwd`; \
+ $(am__define_uniq_tagged_files); \
+ shift; \
+ if test -z "$(ETAGS_ARGS)$$*$$unique"; then :; else \
+ test -n "$$unique" || unique=$$empty_fix; \
+ if test $$# -gt 0; then \
+ $(ETAGS) $(ETAGSFLAGS) $(AM_ETAGSFLAGS) $(ETAGS_ARGS) \
+ "$$@" $$unique; \
+ else \
+ $(ETAGS) $(ETAGSFLAGS) $(AM_ETAGSFLAGS) $(ETAGS_ARGS) \
+ $$unique; \
+ fi; \
+ fi
+ctags: ctags-am
+
+CTAGS: ctags
+ctags-am: $(TAGS_DEPENDENCIES) $(am__tagged_files)
+ $(am__define_uniq_tagged_files); \
+ test -z "$(CTAGS_ARGS)$$unique" \
+ || $(CTAGS) $(CTAGSFLAGS) $(AM_CTAGSFLAGS) $(CTAGS_ARGS) \
+ $$unique
+
+GTAGS:
+ here=`$(am__cd) $(top_builddir) && pwd` \
+ && $(am__cd) $(top_srcdir) \
+ && gtags -i $(GTAGS_ARGS) "$$here"
+cscopelist: cscopelist-am
+
+cscopelist-am: $(am__tagged_files)
+ list='$(am__tagged_files)'; \
+ case "$(srcdir)" in \
+ [\\/]* | ?:[\\/]*) sdir="$(srcdir)" ;; \
+ *) sdir=$(subdir)/$(srcdir) ;; \
+ esac; \
+ for i in $$list; do \
+ if test -f "$$i"; then \
+ echo "$(subdir)/$$i"; \
+ else \
+ echo "$$sdir/$$i"; \
+ fi; \
+ done >> $(top_builddir)/cscope.files
+
+distclean-tags:
+ -rm -f TAGS ID GTAGS GRTAGS GSYMS GPATH tags
+
+distdir: $(BUILT_SOURCES)
+ $(MAKE) $(AM_MAKEFLAGS) distdir-am
+
+distdir-am: $(DISTFILES)
+ @srcdirstrip=`echo "$(srcdir)" | sed 's/[].[^$$\\*]/\\\\&/g'`; \
+ topsrcdirstrip=`echo "$(top_srcdir)" | sed 's/[].[^$$\\*]/\\\\&/g'`; \
+ list='$(DISTFILES)'; \
+ dist_files=`for file in $$list; do echo $$file; done | \
+ sed -e "s|^$$srcdirstrip/||;t" \
+ -e "s|^$$topsrcdirstrip/|$(top_builddir)/|;t"`; \
+ case $$dist_files in \
+ */*) $(MKDIR_P) `echo "$$dist_files" | \
+ sed '/\//!d;s|^|$(distdir)/|;s,/[^/]*$$,,' | \
+ sort -u` ;; \
+ esac; \
+ for file in $$dist_files; do \
+ if test -f $$file || test -d $$file; then d=.; else d=$(srcdir); fi; \
+ if test -d $$d/$$file; then \
+ dir=`echo "/$$file" | sed -e 's,/[^/]*$$,,'`; \
+ if test -d "$(distdir)/$$file"; then \
+ find "$(distdir)/$$file" -type d ! -perm -700 -exec chmod u+rwx {} \;; \
+ fi; \
+ if test -d $(srcdir)/$$file && test $$d != $(srcdir); then \
+ cp -fpR $(srcdir)/$$file "$(distdir)$$dir" || exit 1; \
+ find "$(distdir)/$$file" -type d ! -perm -700 -exec chmod u+rwx {} \;; \
+ fi; \
+ cp -fpR $$d/$$file "$(distdir)$$dir" || exit 1; \
+ else \
+ test -f "$(distdir)/$$file" \
+ || cp -p $$d/$$file "$(distdir)/$$file" \
+ || exit 1; \
+ fi; \
+ done
+check-am: all-am
+check: check-am
+all-am: Makefile
+installdirs:
+install: install-am
+install-exec: install-exec-am
+install-data: install-data-am
+uninstall: uninstall-am
+
+install-am: all-am
+ @$(MAKE) $(AM_MAKEFLAGS) install-exec-am install-data-am
+
+installcheck: installcheck-am
+install-strip:
+ if test -z '$(STRIP)'; then \
+ $(MAKE) $(AM_MAKEFLAGS) INSTALL_PROGRAM="$(INSTALL_STRIP_PROGRAM)" \
+ install_sh_PROGRAM="$(INSTALL_STRIP_PROGRAM)" INSTALL_STRIP_FLAG=-s \
+ install; \
+ else \
+ $(MAKE) $(AM_MAKEFLAGS) INSTALL_PROGRAM="$(INSTALL_STRIP_PROGRAM)" \
+ install_sh_PROGRAM="$(INSTALL_STRIP_PROGRAM)" INSTALL_STRIP_FLAG=-s \
+ "INSTALL_PROGRAM_ENV=STRIPPROG='$(STRIP)'" install; \
+ fi
+mostlyclean-generic:
+
+clean-generic:
+ -test -z "$(CLEANFILES)" || rm -f $(CLEANFILES)
+
+distclean-generic:
+ -test -z "$(CONFIG_CLEAN_FILES)" || rm -f $(CONFIG_CLEAN_FILES)
+ -test . = "$(srcdir)" || test -z "$(CONFIG_CLEAN_VPATH_FILES)" || rm -f $(CONFIG_CLEAN_VPATH_FILES)
+
+maintainer-clean-generic:
+ @echo "This command is intended for maintainers to use"
+ @echo "it deletes files that may require special tools to rebuild."
+clean: clean-am
+
+clean-am: clean-generic clean-libtool mostlyclean-am
+
+distclean: distclean-am
+ -rm -f ./$(DEPDIR)/mpcheck-double.Po
+ -rm -f ./$(DEPDIR)/mpcheck-float.Po
+ -rm -f ./$(DEPDIR)/mpcheck-float128.Po
+ -rm -f ./$(DEPDIR)/mpcheck-longdouble.Po
+ -rm -f Makefile
+distclean-am: clean-am distclean-compile distclean-generic \
+ distclean-tags
+
+dvi: dvi-am
+
+dvi-am:
+
+html: html-am
+
+html-am:
+
+info: info-am
+
+info-am:
+
+install-data-am:
+
+install-dvi: install-dvi-am
+
+install-dvi-am:
+
+install-exec-am:
+
+install-html: install-html-am
+
+install-html-am:
+
+install-info: install-info-am
+
+install-info-am:
+
+install-man:
+
+install-pdf: install-pdf-am
+
+install-pdf-am:
+
+install-ps: install-ps-am
+
+install-ps-am:
+
+installcheck-am:
+
+maintainer-clean: maintainer-clean-am
+ -rm -f ./$(DEPDIR)/mpcheck-double.Po
+ -rm -f ./$(DEPDIR)/mpcheck-float.Po
+ -rm -f ./$(DEPDIR)/mpcheck-float128.Po
+ -rm -f ./$(DEPDIR)/mpcheck-longdouble.Po
+ -rm -f Makefile
+maintainer-clean-am: distclean-am maintainer-clean-generic
+
+mostlyclean: mostlyclean-am
+
+mostlyclean-am: mostlyclean-compile mostlyclean-generic \
+ mostlyclean-libtool
+
+pdf: pdf-am
+
+pdf-am:
+
+ps: ps-am
+
+ps-am:
+
+uninstall-am:
+
+.MAKE: install-am install-strip
+
+.PHONY: CTAGS GTAGS TAGS all all-am am--depfiles check check-am clean \
+ clean-generic clean-libtool cscopelist-am ctags ctags-am \
+ distclean distclean-compile distclean-generic \
+ distclean-libtool distclean-tags distdir dvi dvi-am html \
+ html-am info info-am install install-am install-data \
+ install-data-am install-dvi install-dvi-am install-exec \
+ install-exec-am install-html install-html-am install-info \
+ install-info-am install-man install-pdf install-pdf-am \
+ install-ps install-ps-am install-strip installcheck \
+ installcheck-am installdirs maintainer-clean \
+ maintainer-clean-generic mostlyclean mostlyclean-compile \
+ mostlyclean-generic mostlyclean-libtool pdf pdf-am ps ps-am \
+ tags tags-am uninstall uninstall-am
+
+.PRECIOUS: Makefile
+
+
+mpcheck : $(BINARIES)
+
+# Tell versions [3.59,3.63) of GNU make to not export all variables.
+# Otherwise a system limit (for SysV at least) may be exceeded.
+.NOEXPORT:
diff --git a/gcc/mpc/tools/mpcheck/README b/gcc/mpc/tools/mpcheck/README
new file mode 100644
index 0000000000..c65ca0b83d
--- /dev/null
+++ b/gcc/mpc/tools/mpcheck/README
@@ -0,0 +1,4 @@
+The mpcheck tool provides tests to check the MPC library against the
+C library. It is meant as a tool for MPC developers, or for people who
+want to assert the accuracy of the C library.
+
diff --git a/gcc/mpc/tools/mpcheck/mpcheck-double.c b/gcc/mpc/tools/mpcheck/mpcheck-double.c
new file mode 100644
index 0000000000..53d779f5d3
--- /dev/null
+++ b/gcc/mpc/tools/mpcheck/mpcheck-double.c
@@ -0,0 +1,244 @@
+/* mpcheck-double -- compare mpc functions against "double complex"
+ from the GNU libc implementation
+
+Copyright (C) 2020 INRIA
+
+This file is part of GNU MPC.
+
+GNU MPC is free software; you can redistribute it and/or modify it under
+the terms of the GNU Lesser General Public License as published by the
+Free Software Foundation; either version 3 of the License, or (at your
+option) any later version.
+
+GNU MPC is distributed in the hope that it will be useful, but WITHOUT ANY
+WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS
+FOR A PARTICULAR PURPOSE. See the GNU Lesser General Public License for
+more details.
+
+You should have received a copy of the GNU Lesser General Public License
+along with this program. If not, see http://www.gnu.org/licenses/ .
+*/
+
+/* the GNU libc provides the following functions (as of 2.31),
+ with 'f' suffix for the float/binary32 version, with no suffix
+ for the double/binary64 version, with 'l' suffix for the long double
+ version, and with 'f128' suffix for the __float128 version:
+
+ cabs casinh cexp csinh
+ cacos catan clog csqrt
+ cacosh catanh clog10 ctan
+ carg ccos cpow ctanh
+ casin ccosh csin
+*/
+
+#define _GNU_SOURCE /* for clog10 */
+#include
+#include
+#include
+#include
+#include
+#include
+#include
+#ifdef __GNUC__
+#include
+#endif
+#include "mpc.h"
+
+#define PRECISION 53
+#define EMAX 1024
+#define TYPE double
+#define SUFFIX
+
+#define mpc_get_type mpc_get_dc
+#define mpc_set_type mpc_set_dc
+#define mpfr_set_type mpfr_set_d
+
+gmp_randstate_t state;
+mpz_t expz; /* global variable used in mpcheck_random */
+unsigned long seed = 0;
+int verbose = 0;
+mpfr_exp_t emin, emax;
+
+#include "mpcheck-common.c"
+
+#define FOO add
+#define CFOO(x,y) (x+y)
+#include "mpcheck-template3.c"
+
+#define FOO sub
+#define CFOO(x,y) (x-y)
+#include "mpcheck-template3.c"
+
+#define FOO mul
+#define CFOO(x,y) (x*y)
+#include "mpcheck-template3.c"
+
+#define FOO div
+#define CFOO(x,y) (x/y)
+#include "mpcheck-template3.c"
+
+#define FOO pow
+#include "mpcheck-template3.c"
+
+#define FOO abs
+#include "mpcheck-template2.c"
+
+#define FOO arg
+#include "mpcheck-template2.c"
+
+#define FOO sqrt
+#include "mpcheck-template1.c"
+
+#define FOO acos
+#include "mpcheck-template1.c"
+
+#define FOO acosh
+#include "mpcheck-template1.c"
+
+#define FOO asin
+#include "mpcheck-template1.c"
+
+#define FOO asinh
+#include "mpcheck-template1.c"
+
+#define FOO atan
+#include "mpcheck-template1.c"
+
+#define FOO atanh
+#include "mpcheck-template1.c"
+
+#define FOO cos
+#include "mpcheck-template1.c"
+
+#define FOO cosh
+#include "mpcheck-template1.c"
+
+#define FOO exp
+#include "mpcheck-template1.c"
+
+#define FOO log
+#include "mpcheck-template1.c"
+
+#define FOO log10
+#include "mpcheck-template1.c"
+
+#define FOO sin
+#include "mpcheck-template1.c"
+
+#define FOO sinh
+#include "mpcheck-template1.c"
+
+/* use reduced exponent range for tan and tanh */
+#define FOO_EMIN -8
+#define FOO_EMAX 8
+
+#define FOO tan
+#include "mpcheck-template1.c"
+
+#define FOO tanh
+#include "mpcheck-template1.c"
+
+#undef FOO_EMIN
+#undef FOO_EMAX
+
+int
+main (int argc, char *argv[])
+{
+ mpfr_prec_t p = PRECISION; /* precision of 'double' */
+ unsigned long n = 1000000; /* default number of random tests per function */
+
+ while (argc >= 2 && argv[1][0] == '-')
+ {
+ if (argc >= 3 && strcmp (argv[1], "-p") == 0)
+ {
+ p = atoi (argv[2]);
+ argc -= 2;
+ argv += 2;
+ }
+ else if (argc >= 3 && strcmp (argv[1], "-seed") == 0)
+ {
+ seed = atoi (argv[2]);
+ argc -= 2;
+ argv += 2;
+ }
+ else if (argc >= 3 && strcmp (argv[1], "-num") == 0)
+ {
+ n = atoi (argv[2]);
+ argc -= 2;
+ argv += 2;
+ }
+ else if (strcmp (argv[1], "-v") == 0)
+ {
+ verbose ++;
+ argc --;
+ argv ++;
+ }
+ else if (strcmp (argv[1], "-check") == 0)
+ {
+ recheck = 1;
+ argc --;
+ argv ++;
+ }
+ else
+ {
+ fprintf (stderr, "Unknown option %s\n", argv[1]);
+ exit (1);
+ }
+ }
+
+ /* set exponent range */
+ emin = -EMAX - PRECISION + 4; /* should be -1073 */
+ emax = EMAX;
+ mpfr_set_emin (emin);
+ mpfr_set_emax (emax);
+
+ gmp_randinit_default (state);
+ mpz_init (expz);
+
+ printf ("Using GMP %s, MPFR %s\n", gmp_version, mpfr_get_version ());
+
+#ifdef __GNUC__
+ printf ("GNU libc version: %s\n", gnu_get_libc_version ());
+ printf ("GNU libc release: %s\n", gnu_get_libc_release ());
+#endif
+
+ if (seed == 0)
+ seed = getpid ();
+ printf ("Using random seed %lu\n", seed);
+
+ /* (complex,complex) -> complex */
+ test_add (p, n);
+ test_sub (p, n);
+ test_mul (p, n);
+ test_div (p, n);
+ test_pow (p, n);
+
+ /* complex -> real */
+ test_abs (p, n);
+ test_arg (p, n);
+
+ /* complex -> complex */
+ test_sqrt (p, n);
+ test_acos (p, n);
+ test_acosh (p, n);
+ test_asin (p, n);
+ test_asinh (p, n);
+ test_atan (p, n);
+ test_atanh (p, n);
+ test_cos (p, n);
+ test_cosh (p, n);
+ test_exp (p, n);
+ test_log (p, n);
+ test_log10 (p, n);
+ test_sin (p, n);
+ test_sinh (p, n);
+ test_tan (p, n);
+ test_tanh (p, n);
+
+ gmp_randclear (state);
+ mpz_clear (expz);
+
+ report_maximal_errors ();
+
+ return 0;
+}
diff --git a/gcc/mpc/tools/mpcheck/mpcheck-float.c b/gcc/mpc/tools/mpcheck/mpcheck-float.c
new file mode 100644
index 0000000000..d1d35595fb
--- /dev/null
+++ b/gcc/mpc/tools/mpcheck/mpcheck-float.c
@@ -0,0 +1,249 @@
+/* mpcheck-float -- compare mpc functions against "float complex"
+ from the GNU libc implementation
+
+Copyright (C) 2020 INRIA
+
+This file is part of GNU MPC.
+
+GNU MPC is free software; you can redistribute it and/or modify it under
+the terms of the GNU Lesser General Public License as published by the
+Free Software Foundation; either version 3 of the License, or (at your
+option) any later version.
+
+GNU MPC is distributed in the hope that it will be useful, but WITHOUT ANY
+WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS
+FOR A PARTICULAR PURPOSE. See the GNU Lesser General Public License for
+more details.
+
+You should have received a copy of the GNU Lesser General Public License
+along with this program. If not, see http://www.gnu.org/licenses/ .
+*/
+
+/* the GNU libc provides the following functions (as of 2.31),
+ with 'f' suffix for the float/binary32 version, with no suffix
+ for the double/binary64 version, with 'l' suffix for the long double
+ version, and with 'f128' suffix for the __float128 version:
+
+ cabs casinh cexp csinh
+ cacos catan clog csqrt
+ cacosh catanh clog10 ctan
+ carg ccos cpow ctanh
+ casin ccosh csin
+*/
+
+#define _GNU_SOURCE /* for clog10 */
+#include
+#include
+#include
+#include
+#include
+#include
+#include
+#include "mpc.h"
+#ifdef __GNUC__
+#include
+#endif
+
+#define PRECISION 24
+#define EMAX 128
+#define TYPE float
+#define SUFFIX f
+
+#define mpfr_set_type mpfr_set_flt
+
+static TYPE complex
+mpc_get_type (mpc_t x, mpc_rnd_t rnd)
+{
+ /* there is no mpc_get_fltc function */
+ return (TYPE complex) mpc_get_dc (x, rnd);
+}
+
+static int
+mpc_set_type (mpc_t x, TYPE complex y, mpc_rnd_t rnd)
+{
+ /* there is no mpc_set_fltc function */
+ return mpc_set_dc (x, (double complex) y, rnd);
+}
+
+gmp_randstate_t state;
+mpz_t expz; /* global variable used in mpcheck_random */
+unsigned long seed = 0;
+int verbose = 0;
+mpfr_exp_t emin, emax;
+
+#include "mpcheck-common.c"
+
+#define FOO add
+#define CFOO(x,y) (x+y)
+#include "mpcheck-template3.c"
+
+#define FOO sub
+#define CFOO(x,y) (x-y)
+#include "mpcheck-template3.c"
+
+#define FOO mul
+#define CFOO(x,y) (x*y)
+#include "mpcheck-template3.c"
+
+#define FOO div
+#define CFOO(x,y) (x/y)
+#include "mpcheck-template3.c"
+
+#define FOO pow
+#include "mpcheck-template3.c"
+
+#define FOO abs
+#include "mpcheck-template2.c"
+
+#define FOO arg
+#include "mpcheck-template2.c"
+
+#define FOO sqrt
+#include "mpcheck-template1.c"
+
+#define FOO acos
+#include "mpcheck-template1.c"
+
+#define FOO acosh
+#include "mpcheck-template1.c"
+
+#define FOO asin
+#include "mpcheck-template1.c"
+
+#define FOO asinh
+#include "mpcheck-template1.c"
+
+#define FOO atan
+#include "mpcheck-template1.c"
+
+#define FOO atanh
+#include "mpcheck-template1.c"
+
+#define FOO cos
+#include "mpcheck-template1.c"
+
+#define FOO cosh
+#include "mpcheck-template1.c"
+
+#define FOO exp
+#include "mpcheck-template1.c"
+
+#define FOO log
+#include "mpcheck-template1.c"
+
+#define FOO log10
+#include "mpcheck-template1.c"
+
+#define FOO sin
+#include "mpcheck-template1.c"
+
+#define FOO sinh
+#include "mpcheck-template1.c"
+
+#define FOO tan
+#include "mpcheck-template1.c"
+
+#define FOO tanh
+#include "mpcheck-template1.c"
+
+int
+main (int argc, char *argv[])
+{
+ mpfr_prec_t p = PRECISION; /* precision of 'float' */
+ unsigned long n = 1000000; /* default number of random tests per function */
+
+ while (argc >= 2 && argv[1][0] == '-')
+ {
+ if (argc >= 3 && strcmp (argv[1], "-p") == 0)
+ {
+ p = atoi (argv[2]);
+ argc -= 2;
+ argv += 2;
+ }
+ else if (argc >= 3 && strcmp (argv[1], "-seed") == 0)
+ {
+ seed = atoi (argv[2]);
+ argc -= 2;
+ argv += 2;
+ }
+ else if (argc >= 3 && strcmp (argv[1], "-num") == 0)
+ {
+ n = atoi (argv[2]);
+ argc -= 2;
+ argv += 2;
+ }
+ else if (strcmp (argv[1], "-v") == 0)
+ {
+ verbose ++;
+ argc --;
+ argv ++;
+ }
+ else if (strcmp (argv[1], "-check") == 0)
+ {
+ recheck = 1;
+ argc --;
+ argv ++;
+ }
+ else
+ {
+ fprintf (stderr, "Unknown option %s\n", argv[1]);
+ exit (1);
+ }
+ }
+
+ /* set exponent range */
+ emin = -EMAX - PRECISION + 4; /* should be -148 */
+ emax = EMAX;
+ mpfr_set_emin (emin);
+ mpfr_set_emax (emax);
+
+ gmp_randinit_default (state);
+ mpz_init (expz);
+
+ printf ("Using GMP %s, MPFR %s\n", gmp_version, mpfr_get_version ());
+
+#ifdef __GNUC__
+ printf ("GNU libc version: %s\n", gnu_get_libc_version ());
+ printf ("GNU libc release: %s\n", gnu_get_libc_release ());
+#endif
+
+ if (seed == 0)
+ seed = getpid ();
+ printf ("Using random seed %lu\n", seed);
+
+ /* (complex,complex) -> complex */
+ test_add (p, n);
+ test_sub (p, n);
+ test_mul (p, n);
+ test_div (p, n);
+ test_pow (p, n);
+
+ /* complex -> real */
+ test_abs (p, n);
+ test_arg (p, n);
+
+ /* complex -> complex */
+ test_sqrt (p, n);
+ test_acos (p, n);
+ test_acosh (p, n);
+ test_asin (p, n);
+ test_asinh (p, n);
+ test_atan (p, n);
+ test_atanh (p, n);
+ test_cos (p, n);
+ test_cosh (p, n);
+ test_exp (p, n);
+ test_log (p, n);
+ test_log10 (p, n);
+ test_sin (p, n);
+ test_sinh (p, n);
+ test_tan (p, n);
+ test_tanh (p, n);
+
+ gmp_randclear (state);
+ mpz_clear (expz);
+
+ report_maximal_errors ();
+
+ return 0;
+}
diff --git a/gcc/mpc/tools/mpcheck/mpcheck-float128.c b/gcc/mpc/tools/mpcheck/mpcheck-float128.c
new file mode 100644
index 0000000000..1d02ae2a1c
--- /dev/null
+++ b/gcc/mpc/tools/mpcheck/mpcheck-float128.c
@@ -0,0 +1,254 @@
+/* mpcheck-float128 -- compare mpc functions against "__float128 complex"
+ from the GNU libc implementation
+
+Copyright (C) 2020 INRIA
+
+This file is part of GNU MPC.
+
+GNU MPC is free software; you can redistribute it and/or modify it under
+the terms of the GNU Lesser General Public License as published by the
+Free Software Foundation; either version 3 of the License, or (at your
+option) any later version.
+
+GNU MPC is distributed in the hope that it will be useful, but WITHOUT ANY
+WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS
+FOR A PARTICULAR PURPOSE. See the GNU Lesser General Public License for
+more details.
+
+You should have received a copy of the GNU Lesser General Public License
+along with this program. If not, see http://www.gnu.org/licenses/ .
+*/
+
+/* the GNU libc provides the following functions (as of 2.31),
+ with 'f' suffix for the float/binary32 version, with no suffix
+ for the double/binary64 version, with 'l' suffix for the long double
+ version, and with 'f128' suffix for the __float128 version:
+
+ cabs casinh cexp csinh
+ cacos catan clog csqrt
+ cacosh catanh clog10 ctan
+ carg ccos cpow ctanh
+ casin ccosh csin
+*/
+
+#define _GNU_SOURCE /* for clog10 */
+#include
+#include
+#include
+#include
+#include
+#include
+#include
+#define MPFR_WANT_FLOAT128
+#include "mpc.h"
+#ifdef __GNUC__
+#include
+#endif
+
+#define PRECISION 113
+#define EMAX 16384
+#define TYPE _Float128
+#define SUFFIX f128
+
+#define mpfr_set_type mpfr_set_float128
+
+static TYPE complex
+mpc_get_type (mpc_t z, mpc_rnd_t rnd)
+{
+ TYPE x, y;
+ /* there is no mpc_get_float128c function */
+ x = mpfr_get_float128 (mpc_realref (z), MPC_RND_RE(rnd));
+ y = mpfr_get_float128 (mpc_imagref (z), MPC_RND_IM(rnd));
+ return x + I * y;
+}
+
+static int
+mpc_set_type (mpc_t x, TYPE complex y, mpc_rnd_t rnd)
+{
+ /* there is no mpc_set_float128c function */
+ mpfr_set_float128 (mpc_realref (x), crealf128 (y), MPC_RND_RE(rnd));
+ mpfr_set_float128 (mpc_imagref (x), cimagf128 (y), MPC_RND_IM(rnd));
+}
+
+gmp_randstate_t state;
+mpz_t expz; /* global variable used in mpcheck_random */
+unsigned long seed = 0;
+int verbose = 0;
+mpfr_exp_t emin, emax;
+
+#include "mpcheck-common.c"
+
+#define FOO add
+#define CFOO(x,y) (x+y)
+#include "mpcheck-template3.c"
+
+#define FOO sub
+#define CFOO(x,y) (x-y)
+#include "mpcheck-template3.c"
+
+#define FOO mul
+#define CFOO(x,y) (x*y)
+#include "mpcheck-template3.c"
+
+#define FOO div
+#define CFOO(x,y) (x/y)
+#include "mpcheck-template3.c"
+
+#define FOO pow
+#include "mpcheck-template3.c"
+
+#define FOO abs
+#include "mpcheck-template2.c"
+
+#define FOO arg
+#include "mpcheck-template2.c"
+
+#define FOO sqrt
+#include "mpcheck-template1.c"
+
+#define FOO acos
+#include "mpcheck-template1.c"
+
+#define FOO acosh
+#include "mpcheck-template1.c"
+
+#define FOO asin
+#include "mpcheck-template1.c"
+
+#define FOO asinh
+#include "mpcheck-template1.c"
+
+#define FOO atan
+#include "mpcheck-template1.c"
+
+#define FOO atanh
+#include "mpcheck-template1.c"
+
+#define FOO cos
+#include "mpcheck-template1.c"
+
+#define FOO cosh
+#include "mpcheck-template1.c"
+
+#define FOO exp
+#include "mpcheck-template1.c"
+
+#define FOO log
+#include "mpcheck-template1.c"
+
+#define FOO log10
+#include "mpcheck-template1.c"
+
+#define FOO sin
+#include "mpcheck-template1.c"
+
+#define FOO sinh
+#include "mpcheck-template1.c"
+
+#define FOO tan
+#include "mpcheck-template1.c"
+
+#define FOO tanh
+#include "mpcheck-template1.c"
+
+int
+main (int argc, char *argv[])
+{
+ mpfr_prec_t p = PRECISION; /* precision of 'double' */
+ unsigned long n = 1000000; /* default number of random tests per function */
+
+ while (argc >= 2 && argv[1][0] == '-')
+ {
+ if (argc >= 3 && strcmp (argv[1], "-p") == 0)
+ {
+ p = atoi (argv[2]);
+ argc -= 2;
+ argv += 2;
+ }
+ else if (argc >= 3 && strcmp (argv[1], "-seed") == 0)
+ {
+ seed = atoi (argv[2]);
+ argc -= 2;
+ argv += 2;
+ }
+ else if (argc >= 3 && strcmp (argv[1], "-num") == 0)
+ {
+ n = atoi (argv[2]);
+ argc -= 2;
+ argv += 2;
+ }
+ else if (strcmp (argv[1], "-v") == 0)
+ {
+ verbose ++;
+ argc --;
+ argv ++;
+ }
+ else if (strcmp (argv[1], "-check") == 0)
+ {
+ recheck = 1;
+ argc --;
+ argv ++;
+ }
+ else
+ {
+ fprintf (stderr, "Unknown option %s\n", argv[1]);
+ exit (1);
+ }
+ }
+
+ /* set exponent range */
+ emin = -EMAX - 64 + 4; /* should be -16444 like for long double */
+ emax = EMAX;
+ mpfr_set_emin (emin);
+ mpfr_set_emax (emax);
+
+ gmp_randinit_default (state);
+ mpz_init (expz);
+
+ printf ("Using GMP %s, MPFR %s\n", gmp_version, mpfr_get_version ());
+
+#ifdef __GNUC__
+ printf ("GNU libc version: %s\n", gnu_get_libc_version ());
+ printf ("GNU libc release: %s\n", gnu_get_libc_release ());
+#endif
+
+ if (seed == 0)
+ seed = getpid ();
+ printf ("Using random seed %lu\n", seed);
+
+ /* (complex,complex) -> complex */
+ test_add (p, n);
+ test_sub (p, n);
+ test_mul (p, n);
+ test_div (p, n);
+ test_pow (p, n);
+
+ /* complex -> real */
+ test_abs (p, n);
+ test_arg (p, n);
+
+ /* complex -> complex */
+ test_sqrt (p, n);
+ test_acos (p, n);
+ test_acosh (p, n);
+ test_asin (p, n);
+ test_asinh (p, n);
+ test_atan (p, n);
+ test_atanh (p, n);
+ test_cos (p, n);
+ test_cosh (p, n);
+ test_exp (p, n);
+ test_log (p, n);
+ test_log10 (p, n);
+ test_sin (p, n);
+ test_sinh (p, n);
+ test_tan (p, n);
+ test_tanh (p, n);
+
+ gmp_randclear (state);
+ mpz_clear (expz);
+
+ report_maximal_errors ();
+
+ return 0;
+}
diff --git a/gcc/mpc/tools/mpcheck/mpcheck-longdouble.c b/gcc/mpc/tools/mpcheck/mpcheck-longdouble.c
new file mode 100644
index 0000000000..e5e3ee4db9
--- /dev/null
+++ b/gcc/mpc/tools/mpcheck/mpcheck-longdouble.c
@@ -0,0 +1,237 @@
+/* mpcheck-longdouble -- compare mpc functions against "long double complex"
+ from the GNU libc implementation
+
+Copyright (C) 2020 INRIA
+
+This file is part of GNU MPC.
+
+GNU MPC is free software; you can redistribute it and/or modify it under
+the terms of the GNU Lesser General Public License as published by the
+Free Software Foundation; either version 3 of the License, or (at your
+option) any later version.
+
+GNU MPC is distributed in the hope that it will be useful, but WITHOUT ANY
+WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS
+FOR A PARTICULAR PURPOSE. See the GNU Lesser General Public License for
+more details.
+
+You should have received a copy of the GNU Lesser General Public License
+along with this program. If not, see http://www.gnu.org/licenses/ .
+*/
+
+/* the GNU libc provides the following functions (as of 2.31),
+ with 'f' suffix for the float/binary32 version, with no suffix
+ for the double/binary64 version, with 'l' suffix for the long double
+ version, and with 'f128' suffix for the __float128 version:
+
+ cabs casinh cexp csinh
+ cacos catan clog csqrt
+ cacosh catanh clog10 ctan
+ carg ccos cpow ctanh
+ casin ccosh csin
+*/
+
+#define _GNU_SOURCE /* for clog10 */
+#include
+#include
+#include
+#include
+#include
+#include
+#include
+#include "mpc.h"
+#ifdef __GNUC__
+#include
+#endif
+
+#define PRECISION 64
+#define EMAX 16384
+#define TYPE long double
+#define SUFFIX l
+
+#define mpc_get_type mpc_get_ldc
+#define mpc_set_type mpc_set_ldc
+#define mpfr_set_type mpfr_set_ld
+
+gmp_randstate_t state;
+mpz_t expz; /* global variable used in mpcheck_random */
+unsigned long seed = 0;
+int verbose = 0;
+mpfr_exp_t emin, emax;
+
+#include "mpcheck-common.c"
+
+#define FOO add
+#define CFOO(x,y) (x+y)
+#include "mpcheck-template3.c"
+
+#define FOO sub
+#define CFOO(x,y) (x-y)
+#include "mpcheck-template3.c"
+
+#define FOO mul
+#define CFOO(x,y) (x*y)
+#include "mpcheck-template3.c"
+
+#define FOO div
+#define CFOO(x,y) (x/y)
+#include "mpcheck-template3.c"
+
+#define FOO pow
+#include "mpcheck-template3.c"
+
+#define FOO abs
+#include "mpcheck-template2.c"
+
+#define FOO arg
+#include "mpcheck-template2.c"
+
+#define FOO sqrt
+#include "mpcheck-template1.c"
+
+#define FOO acos
+#include "mpcheck-template1.c"
+
+#define FOO acosh
+#include "mpcheck-template1.c"
+
+#define FOO asin
+#include "mpcheck-template1.c"
+
+#define FOO asinh
+#include "mpcheck-template1.c"
+
+#define FOO atan
+#include "mpcheck-template1.c"
+
+#define FOO atanh
+#include "mpcheck-template1.c"
+
+#define FOO cos
+#include "mpcheck-template1.c"
+
+#define FOO cosh
+#include "mpcheck-template1.c"
+
+#define FOO exp
+#include "mpcheck-template1.c"
+
+#define FOO log
+#include "mpcheck-template1.c"
+
+#define FOO log10
+#include "mpcheck-template1.c"
+
+#define FOO sin
+#include "mpcheck-template1.c"
+
+#define FOO sinh
+#include "mpcheck-template1.c"
+
+#define FOO tan
+#include "mpcheck-template1.c"
+
+#define FOO tanh
+#include "mpcheck-template1.c"
+
+int
+main (int argc, char *argv[])
+{
+ mpfr_prec_t p = PRECISION; /* precision of 'double' */
+ unsigned long n = 1000000; /* default number of random tests per function */
+
+ while (argc >= 2 && argv[1][0] == '-')
+ {
+ if (argc >= 3 && strcmp (argv[1], "-p") == 0)
+ {
+ p = atoi (argv[2]);
+ argc -= 2;
+ argv += 2;
+ }
+ else if (argc >= 3 && strcmp (argv[1], "-seed") == 0)
+ {
+ seed = atoi (argv[2]);
+ argc -= 2;
+ argv += 2;
+ }
+ else if (argc >= 3 && strcmp (argv[1], "-num") == 0)
+ {
+ n = atoi (argv[2]);
+ argc -= 2;
+ argv += 2;
+ }
+ else if (strcmp (argv[1], "-v") == 0)
+ {
+ verbose ++;
+ argc --;
+ argv ++;
+ }
+ else if (strcmp (argv[1], "-check") == 0)
+ {
+ recheck = 1;
+ argc --;
+ argv ++;
+ }
+ else
+ {
+ fprintf (stderr, "Unknown option %s\n", argv[1]);
+ exit (1);
+ }
+ }
+
+ /* set exponent range */
+ emin = -EMAX - PRECISION + 4; /* should be -16444 */
+ emax = EMAX;
+ mpfr_set_emin (emin);
+ mpfr_set_emax (emax);
+
+ gmp_randinit_default (state);
+ mpz_init (expz);
+
+ printf ("Using GMP %s, MPFR %s\n", gmp_version, mpfr_get_version ());
+
+#ifdef __GNUC__
+ printf ("GNU libc version: %s\n", gnu_get_libc_version ());
+ printf ("GNU libc release: %s\n", gnu_get_libc_release ());
+#endif
+
+ if (seed == 0)
+ seed = getpid ();
+ printf ("Using random seed %lu\n", seed);
+
+ /* (complex,complex) -> complex */
+ test_add (p, n);
+ test_sub (p, n);
+ test_mul (p, n);
+ test_div (p, n);
+ test_pow (p, n);
+
+ /* complex -> real */
+ test_abs (p, n);
+ test_arg (p, n);
+
+ /* complex -> complex */
+ test_sqrt (p, n);
+ test_acos (p, n);
+ test_acosh (p, n);
+ test_asin (p, n);
+ test_asinh (p, n);
+ test_atan (p, n);
+ test_atanh (p, n);
+ test_cos (p, n);
+ test_cosh (p, n);
+ test_exp (p, n);
+ test_log (p, n);
+ test_log10 (p, n);
+ test_sin (p, n);
+ test_sinh (p, n);
+ test_tan (p, n);
+ test_tanh (p, n);
+
+ gmp_randclear (state);
+ mpz_clear (expz);
+
+ report_maximal_errors ();
+
+ return 0;
+}